instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_9516>.
The molecule contains the following groups: Ester, Alcohol, Ether, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_9516>.
**Token:** <BB_9516> **SMILES:** COC(=O)C(O)CCSC **Molecular Formula:** C6H12O3S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Alcohol, Ether, Sulfide
Provide the SMILES representation for the building block token <BB_9517>.
C=C(C)C(=O)NCCOCCOCCN.Cl
What is the building block token for the following molecule?
C=C(C)C(=O)NCCOCCOCCN.Cl
<BB_9517>
What is the molecular formula for <BB_9517>?
The molecular formula for <BB_9517> (C=C(C)C(=O)NCCOCCOCCN.Cl) is C10H21ClN2O3.
Describe the ring structures in building block <BB_9517>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9517>.
The molecule contains the following groups: Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9517>.
**Token:** <BB_9517> **SMILES:** C=C(C)C(=O)NCCOCCOCCN.Cl **Molecular Formula:** C10H21ClN2O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9518>.
CN1C(=O)CCCc2ccccc21
What is the building block token for the following molecule?
CN1C(=O)CCCc2ccccc21
<BB_9518>
What is the molecular formula for <BB_9518>?
The molecular formula for <BB_9518> (CN1C(=O)CCCc2ccccc21) is C11H13NO.
Describe the ring structures in building block <BB_9518>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6.
List the primary functional groups present in <BB_9518>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_9518>.
**Token:** <BB_9518> **SMILES:** CN1C(=O)CCCc2ccccc21 **Molecular Formula:** C11H13NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_9519>.
N#Cc1ccc(-c2nc(CCl)co2)cc1
What is the building block token for the following molecule?
N#Cc1ccc(-c2nc(CCl)co2)cc1
<BB_9519>
What is the molecular formula for <BB_9519>?
The molecular formula for <BB_9519> (N#Cc1ccc(-c2nc(CCl)co2)cc1) is C11H7ClN2O.
Describe the ring structures in building block <BB_9519>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9519>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9519>.
**Token:** <BB_9519> **SMILES:** N#Cc1ccc(-c2nc(CCl)co2)cc1 **Molecular Formula:** C11H7ClN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9520>.
Cl.NCc1ccc(-c2ccsc2)cc1
What is the building block token for the following molecule?
Cl.NCc1ccc(-c2ccsc2)cc1
<BB_9520>
What is the molecular formula for <BB_9520>?
The molecular formula for <BB_9520> (Cl.NCc1ccc(-c2ccsc2)cc1) is C11H12ClNS.
Describe the ring structures in building block <BB_9520>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9520>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9520>.
**Token:** <BB_9520> **SMILES:** Cl.NCc1ccc(-c2ccsc2)cc1 **Molecular Formula:** C11H12ClNS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9521>.
Cl.Cl.NCCNC(=O)c1ccncc1
What is the building block token for the following molecule?
Cl.Cl.NCCNC(=O)c1ccncc1
<BB_9521>
What is the molecular formula for <BB_9521>?
The molecular formula for <BB_9521> (Cl.Cl.NCCNC(=O)c1ccncc1) is C8H13Cl2N3O.
Describe the ring structures in building block <BB_9521>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9521>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9521>.
**Token:** <BB_9521> **SMILES:** Cl.Cl.NCCNC(=O)c1ccncc1 **Molecular Formula:** C8H13Cl2N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9522>.
CC1Cn2ncc(Br)c2CN1.Cl
What is the building block token for the following molecule?
CC1Cn2ncc(Br)c2CN1.Cl
<BB_9522>
What is the molecular formula for <BB_9522>?
The molecular formula for <BB_9522> (CC1Cn2ncc(Br)c2CN1.Cl) is C7H11BrClN3.
Describe the ring structures in building block <BB_9522>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9522>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9522>.
**Token:** <BB_9522> **SMILES:** CC1Cn2ncc(Br)c2CN1.Cl **Molecular Formula:** C7H11BrClN3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9523>.
Cl.Cl.NCCCCNCc1ccccn1
What is the building block token for the following molecule?
Cl.Cl.NCCCCNCc1ccccn1
<BB_9523>
What is the molecular formula for <BB_9523>?
The molecular formula for <BB_9523> (Cl.Cl.NCCCCNCc1ccccn1) is C10H19Cl2N3.
Describe the ring structures in building block <BB_9523>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9523>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9523>.
**Token:** <BB_9523> **SMILES:** Cl.Cl.NCCCCNCc1ccccn1 **Molecular Formula:** C10H19Cl2N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9524>.
Cc1ncc(N)c(N)n1.Cl
What is the building block token for the following molecule?
Cc1ncc(N)c(N)n1.Cl
<BB_9524>
What is the molecular formula for <BB_9524>?
The molecular formula for <BB_9524> (Cc1ncc(N)c(N)n1.Cl) is C5H9ClN4.
Describe the ring structures in building block <BB_9524>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9524>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9524>.
**Token:** <BB_9524> **SMILES:** Cc1ncc(N)c(N)n1.Cl **Molecular Formula:** C5H9ClN4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9525>.
Cl.NC1COc2cc(F)ccc21
What is the building block token for the following molecule?
Cl.NC1COc2cc(F)ccc21
<BB_9525>
What is the molecular formula for <BB_9525>?
The molecular formula for <BB_9525> (Cl.NC1COc2cc(F)ccc21) is C8H9ClFNO.
Describe the ring structures in building block <BB_9525>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9525>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9525>.
**Token:** <BB_9525> **SMILES:** Cl.NC1COc2cc(F)ccc21 **Molecular Formula:** C8H9ClFNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9526>.
Cl.c1ccc(C2CCCCN2)cc1
What is the building block token for the following molecule?
Cl.c1ccc(C2CCCCN2)cc1
<BB_9526>
What is the molecular formula for <BB_9526>?
The molecular formula for <BB_9526> (Cl.c1ccc(C2CCCCN2)cc1) is C11H16ClN.
Describe the ring structures in building block <BB_9526>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9526>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9526>.
**Token:** <BB_9526> **SMILES:** Cl.c1ccc(C2CCCCN2)cc1 **Molecular Formula:** C11H16ClN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9527>.
CC(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)Cl
What is the building block token for the following molecule?
CC(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)Cl
<BB_9527>
What is the molecular formula for <BB_9527>?
The molecular formula for <BB_9527> (CC(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)Cl) is C8H8ClNO4S.
Describe the ring structures in building block <BB_9527>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9527>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_9527>.
**Token:** <BB_9527> **SMILES:** CC(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)Cl **Molecular Formula:** C8H8ClNO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_9528>.
O=P(O)(O)c1ccncc1
What is the building block token for the following molecule?
O=P(O)(O)c1ccncc1
<BB_9528>
What is the molecular formula for <BB_9528>?
The molecular formula for <BB_9528> (O=P(O)(O)c1ccncc1) is C5H6NO3P.
Describe the ring structures in building block <BB_9528>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9528>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9528>.
**Token:** <BB_9528> **SMILES:** O=P(O)(O)c1ccncc1 **Molecular Formula:** C5H6NO3P **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9529>.
CCO[C@@H]1CCCCC[C@H]1N
What is the building block token for the following molecule?
CCO[C@@H]1CCCCC[C@H]1N
<BB_9529>
What is the molecular formula for <BB_9529>?
The molecular formula for <BB_9529> (CCO[C@@H]1CCCCC[C@H]1N) is C9H19NO.
Describe the ring structures in building block <BB_9529>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.
List the primary functional groups present in <BB_9529>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9529>.
**Token:** <BB_9529> **SMILES:** CCO[C@@H]1CCCCC[C@H]1N **Molecular Formula:** C9H19NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_9530>.
OCc1ccc(-n2ccnc2)c(F)c1
What is the building block token for the following molecule?
OCc1ccc(-n2ccnc2)c(F)c1
<BB_9530>
What is the molecular formula for <BB_9530>?
The molecular formula for <BB_9530> (OCc1ccc(-n2ccnc2)c(F)c1) is C10H9FN2O.
Describe the ring structures in building block <BB_9530>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9530>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9530>.
**Token:** <BB_9530> **SMILES:** OCc1ccc(-n2ccnc2)c(F)c1 **Molecular Formula:** C10H9FN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9531>.
CCCCC(=O)NCCc1ccc(OC)cc1
What is the building block token for the following molecule?
CCCCC(=O)NCCc1ccc(OC)cc1
<BB_9531>
What is the molecular formula for <BB_9531>?
The molecular formula for <BB_9531> (CCCCC(=O)NCCc1ccc(OC)cc1) is C14H21NO2.
Describe the ring structures in building block <BB_9531>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9531>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9531>.
**Token:** <BB_9531> **SMILES:** CCCCC(=O)NCCc1ccc(OC)cc1 **Molecular Formula:** C14H21NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_9532>.
C[C@@H](N)c1cc(Cl)ccc1Br.Cl
What is the building block token for the following molecule?
C[C@@H](N)c1cc(Cl)ccc1Br.Cl
<BB_9532>
What is the molecular formula for <BB_9532>?
The molecular formula for <BB_9532> (C[C@@H](N)c1cc(Cl)ccc1Br.Cl) is C8H10BrCl2N.
Describe the ring structures in building block <BB_9532>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9532>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9532>.
**Token:** <BB_9532> **SMILES:** C[C@@H](N)c1cc(Cl)ccc1Br.Cl **Molecular Formula:** C8H10BrCl2N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9533>.
CC(C)(C)OC(=O)N1CCN2C(=O)CCC2C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCN2C(=O)CCC2C1
<BB_9533>