instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_9550>.
CC(C)(C)c1cc(Br)cnc1N
What is the building block token for the following molecule?
CC(C)(C)c1cc(Br)cnc1N
<BB_9550>
What is the molecular formula for <BB_9550>?
The molecular formula for <BB_9550> (CC(C)(C)c1cc(Br)cnc1N) is C9H13BrN2.
Describe the ring structures in building block <BB_9550>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9550>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9550>.
**Token:** <BB_9550> **SMILES:** CC(C)(C)c1cc(Br)cnc1N **Molecular Formula:** C9H13BrN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9551>.
CC(C)(C)OC(=O)N1CC(CO)(CO)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC(CO)(CO)C1
<BB_9551>
What is the molecular formula for <BB_9551>?
The molecular formula for <BB_9551> (CC(C)(C)OC(=O)N1CC(CO)(CO)C1) is C10H19NO4.
Describe the ring structures in building block <BB_9551>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_9551>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_9551>.
**Token:** <BB_9551> **SMILES:** CC(C)(C)OC(=O)N1CC(CO)(CO)C1 **Molecular Formula:** C10H19NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_9552>.
COc1cc(C(N)=O)cc(OC)c1F
What is the building block token for the following molecule?
COc1cc(C(N)=O)cc(OC)c1F
<BB_9552>
What is the molecular formula for <BB_9552>?
The molecular formula for <BB_9552> (COc1cc(C(N)=O)cc(OC)c1F) is C9H10FNO3.
Describe the ring structures in building block <BB_9552>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9552>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9552>.
**Token:** <BB_9552> **SMILES:** COc1cc(C(N)=O)cc(OC)c1F **Molecular Formula:** C9H10FNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9553>.
NC(c1cccc(Cl)c1)C1CCCC1
What is the building block token for the following molecule?
NC(c1cccc(Cl)c1)C1CCCC1
<BB_9553>
What is the molecular formula for <BB_9553>?
The molecular formula for <BB_9553> (NC(c1cccc(Cl)c1)C1CCCC1) is C12H16ClN.
Describe the ring structures in building block <BB_9553>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9553>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9553>.
**Token:** <BB_9553> **SMILES:** NC(c1cccc(Cl)c1)C1CCCC1 **Molecular Formula:** C12H16ClN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9554>.
COc1ccc(C2(C(=O)O)CCCC2)cc1OC
What is the building block token for the following molecule?
COc1ccc(C2(C(=O)O)CCCC2)cc1OC
<BB_9554>
What is the molecular formula for <BB_9554>?
The molecular formula for <BB_9554> (COc1ccc(C2(C(=O)O)CCCC2)cc1OC) is C14H18O4.
Describe the ring structures in building block <BB_9554>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9554>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_9554>.
**Token:** <BB_9554> **SMILES:** COc1ccc(C2(C(=O)O)CCCC2)cc1OC **Molecular Formula:** C14H18O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_9555>.
FCC1(CS)CCOCC1
What is the building block token for the following molecule?
FCC1(CS)CCOCC1
<BB_9555>
What is the molecular formula for <BB_9555>?
The molecular formula for <BB_9555> (FCC1(CS)CCOCC1) is C7H13FOS.
Describe the ring structures in building block <BB_9555>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9555>.
The molecule contains the following groups: Ether, Thiol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9555>.
**Token:** <BB_9555> **SMILES:** FCC1(CS)CCOCC1 **Molecular Formula:** C7H13FOS **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Ether, Thiol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9556>.
NCC1CC2(CCCCC2)CC2(CC2)C1
What is the building block token for the following molecule?
NCC1CC2(CCCCC2)CC2(CC2)C1
<BB_9556>
What is the molecular formula for <BB_9556>?
The molecular formula for <BB_9556> (NCC1CC2(CCCCC2)CC2(CC2)C1) is C14H25N.
Describe the ring structures in building block <BB_9556>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9556>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9556>.
**Token:** <BB_9556> **SMILES:** NCC1CC2(CCCCC2)CC2(CC2)C1 **Molecular Formula:** C14H25N **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9557>.
Clc1cc2ccncc2cc1Cl
What is the building block token for the following molecule?
Clc1cc2ccncc2cc1Cl
<BB_9557>
What is the molecular formula for <BB_9557>?
The molecular formula for <BB_9557> (Clc1cc2ccncc2cc1Cl) is C9H5Cl2N.
Describe the ring structures in building block <BB_9557>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9557>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9557>.
**Token:** <BB_9557> **SMILES:** Clc1cc2ccncc2cc1Cl **Molecular Formula:** C9H5Cl2N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9558>.
Cc1ccc(CCC(C)N)o1
What is the building block token for the following molecule?
Cc1ccc(CCC(C)N)o1
<BB_9558>
What is the molecular formula for <BB_9558>?
The molecular formula for <BB_9558> (Cc1ccc(CCC(C)N)o1) is C9H15NO.
Describe the ring structures in building block <BB_9558>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9558>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9558>.
**Token:** <BB_9558> **SMILES:** Cc1ccc(CCC(C)N)o1 **Molecular Formula:** C9H15NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9559>.
CSc1cc(C(=O)O)ccc1NC(C)=O
What is the building block token for the following molecule?
CSc1cc(C(=O)O)ccc1NC(C)=O
<BB_9559>
What is the molecular formula for <BB_9559>?
The molecular formula for <BB_9559> (CSc1cc(C(=O)O)ccc1NC(C)=O) is C10H11NO3S.
Describe the ring structures in building block <BB_9559>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9559>.
The molecule contains the following groups: Carboxylic Acid, Amide, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_9559>.
**Token:** <BB_9559> **SMILES:** CSc1cc(C(=O)O)ccc1NC(C)=O **Molecular Formula:** C10H11NO3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Sulfide
Provide the SMILES representation for the building block token <BB_9560>.
CN(C)[C@H]1CCCCNC1
What is the building block token for the following molecule?
CN(C)[C@H]1CCCCNC1
<BB_9560>
What is the molecular formula for <BB_9560>?
The molecular formula for <BB_9560> (CN(C)[C@H]1CCCCNC1) is C8H18N2.
Describe the ring structures in building block <BB_9560>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.
List the primary functional groups present in <BB_9560>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9560>.
**Token:** <BB_9560> **SMILES:** CN(C)[C@H]1CCCCNC1 **Molecular Formula:** C8H18N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_9561>.
CC(C)(C)OC(=O)NCCS(=O)(=O)F
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NCCS(=O)(=O)F
<BB_9561>
What is the molecular formula for <BB_9561>?
The molecular formula for <BB_9561> (CC(C)(C)OC(=O)NCCS(=O)(=O)F) is C7H14FNO4S.
Describe the ring structures in building block <BB_9561>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9561>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9561>.
**Token:** <BB_9561> **SMILES:** CC(C)(C)OC(=O)NCCS(=O)(=O)F **Molecular Formula:** C7H14FNO4S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9562>.
O=C(O)c1ccc(-c2cn[nH]c2)cn1
What is the building block token for the following molecule?
O=C(O)c1ccc(-c2cn[nH]c2)cn1
<BB_9562>
What is the molecular formula for <BB_9562>?
The molecular formula for <BB_9562> (O=C(O)c1ccc(-c2cn[nH]c2)cn1) is C9H7N3O2.
Describe the ring structures in building block <BB_9562>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9562>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_9562>.
**Token:** <BB_9562> **SMILES:** O=C(O)c1ccc(-c2cn[nH]c2)cn1 **Molecular Formula:** C9H7N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_9563>.
CNCc1ccc2c(c1)CCO2.Cl
What is the building block token for the following molecule?
CNCc1ccc2c(c1)CCO2.Cl
<BB_9563>
What is the molecular formula for <BB_9563>?
The molecular formula for <BB_9563> (CNCc1ccc2c(c1)CCO2.Cl) is C10H14ClNO.
Describe the ring structures in building block <BB_9563>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9563>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9563>.
**Token:** <BB_9563> **SMILES:** CNCc1ccc2c(c1)CCO2.Cl **Molecular Formula:** C10H14ClNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9564>.
CS(=O)(=O)c1cc(Cl)ncn1
What is the building block token for the following molecule?
CS(=O)(=O)c1cc(Cl)ncn1
<BB_9564>
What is the molecular formula for <BB_9564>?
The molecular formula for <BB_9564> (CS(=O)(=O)c1cc(Cl)ncn1) is C5H5ClN2O2S.
Describe the ring structures in building block <BB_9564>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9564>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9564>.
**Token:** <BB_9564> **SMILES:** CS(=O)(=O)c1cc(Cl)ncn1 **Molecular Formula:** C5H5ClN2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9565>.
N#CC(OCCCCl)C1CC1
What is the building block token for the following molecule?
N#CC(OCCCCl)C1CC1
<BB_9565>
What is the molecular formula for <BB_9565>?
The molecular formula for <BB_9565> (N#CC(OCCCCl)C1CC1) is C8H12ClNO.
Describe the ring structures in building block <BB_9565>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9565>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9565>.
**Token:** <BB_9565> **SMILES:** N#CC(OCCCCl)C1CC1 **Molecular Formula:** C8H12ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Ether, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9566>.
O=C(O)c1ccc2c(c1)C(=O)NS(=O)(=O)O2
What is the building block token for the following molecule?
O=C(O)c1ccc2c(c1)C(=O)NS(=O)(=O)O2
<BB_9566>
What is the molecular formula for <BB_9566>?
The molecular formula for <BB_9566> (O=C(O)c1ccc2c(c1)C(=O)NS(=O)(=O)O2) is C8H5NO6S.
Describe the ring structures in building block <BB_9566>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.