instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_9583>?
The molecular formula for <BB_9583> (Clc1ncc2ccsc2n1) is C6H3ClN2S.
Describe the ring structures in building block <BB_9583>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9583>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9583>.
**Token:** <BB_9583> **SMILES:** Clc1ncc2ccsc2n1 **Molecular Formula:** C6H3ClN2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9584>.
O=[N+]([O-])c1cc(F)c[n+]([O-])c1
What is the building block token for the following molecule?
O=[N+]([O-])c1cc(F)c[n+]([O-])c1
<BB_9584>
What is the molecular formula for <BB_9584>?
The molecular formula for <BB_9584> (O=[N+]([O-])c1cc(F)c[n+]([O-])c1) is C5H3FN2O3.
Describe the ring structures in building block <BB_9584>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9584>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_9584>.
**Token:** <BB_9584> **SMILES:** O=[N+]([O-])c1cc(F)c[n+]([O-])c1 **Molecular Formula:** C5H3FN2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_9585>.
Cl.O=C(O)CSCC1CCCN2CCCCC12
What is the building block token for the following molecule?
Cl.O=C(O)CSCC1CCCN2CCCCC12
<BB_9585>
What is the molecular formula for <BB_9585>?
The molecular formula for <BB_9585> (Cl.O=C(O)CSCC1CCCN2CCCCC12) is C12H22ClNO2S.
Describe the ring structures in building block <BB_9585>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9585>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9585>.
**Token:** <BB_9585> **SMILES:** Cl.O=C(O)CSCC1CCCN2CCCCC12 **Molecular Formula:** C12H22ClNO2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9586>.
c1ccc2c(c1)NCC21CCNC1
What is the building block token for the following molecule?
c1ccc2c(c1)NCC21CCNC1
<BB_9586>
What is the molecular formula for <BB_9586>?
The molecular formula for <BB_9586> (c1ccc2c(c1)NCC21CCNC1) is C11H14N2.
Describe the ring structures in building block <BB_9586>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9586>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_9586>.
**Token:** <BB_9586> **SMILES:** c1ccc2c(c1)NCC21CCNC1 **Molecular Formula:** C11H14N2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_9587>.
COc1ccc(OC)c(C2CCCN2)c1.Cl
What is the building block token for the following molecule?
COc1ccc(OC)c(C2CCCN2)c1.Cl
<BB_9587>
What is the molecular formula for <BB_9587>?
The molecular formula for <BB_9587> (COc1ccc(OC)c(C2CCCN2)c1.Cl) is C12H18ClNO2.
Describe the ring structures in building block <BB_9587>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9587>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9587>.
**Token:** <BB_9587> **SMILES:** COc1ccc(OC)c(C2CCCN2)c1.Cl **Molecular Formula:** C12H18ClNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9588>.
NC[C@@H]1CCCNC1
What is the building block token for the following molecule?
NC[C@@H]1CCCNC1
<BB_9588>
What is the molecular formula for <BB_9588>?
The molecular formula for <BB_9588> (NC[C@@H]1CCCNC1) is C6H14N2.
Describe the ring structures in building block <BB_9588>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9588>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_9588>.
**Token:** <BB_9588> **SMILES:** NC[C@@H]1CCCNC1 **Molecular Formula:** C6H14N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_9589>.
Cl.NCC1CC1(Br)Br
What is the building block token for the following molecule?
Cl.NCC1CC1(Br)Br
<BB_9589>
What is the molecular formula for <BB_9589>?
The molecular formula for <BB_9589> (Cl.NCC1CC1(Br)Br) is C4H8Br2ClN.
Describe the ring structures in building block <BB_9589>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9589>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9589>.
**Token:** <BB_9589> **SMILES:** Cl.NCC1CC1(Br)Br **Molecular Formula:** C4H8Br2ClN **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9590>.
CC(C(N)=NO)n1ccnc1
What is the building block token for the following molecule?
CC(C(N)=NO)n1ccnc1
<BB_9590>
What is the molecular formula for <BB_9590>?
The molecular formula for <BB_9590> (CC(C(N)=NO)n1ccnc1) is C6H10N4O.
Describe the ring structures in building block <BB_9590>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9590>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9590>.
**Token:** <BB_9590> **SMILES:** CC(C(N)=NO)n1ccnc1 **Molecular Formula:** C6H10N4O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9591>.
O=C(Cl)C(=O)c1ccc(F)cc1
What is the building block token for the following molecule?
O=C(Cl)C(=O)c1ccc(F)cc1
<BB_9591>
What is the molecular formula for <BB_9591>?
The molecular formula for <BB_9591> (O=C(Cl)C(=O)c1ccc(F)cc1) is C8H4ClFO2.
Describe the ring structures in building block <BB_9591>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9591>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9591>.
**Token:** <BB_9591> **SMILES:** O=C(Cl)C(=O)c1ccc(F)cc1 **Molecular Formula:** C8H4ClFO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9592>.
Cc1cc(CCC(=O)O)ccc1Br
What is the building block token for the following molecule?
Cc1cc(CCC(=O)O)ccc1Br
<BB_9592>
What is the molecular formula for <BB_9592>?
The molecular formula for <BB_9592> (Cc1cc(CCC(=O)O)ccc1Br) is C10H11BrO2.
Describe the ring structures in building block <BB_9592>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9592>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9592>.
**Token:** <BB_9592> **SMILES:** Cc1cc(CCC(=O)O)ccc1Br **Molecular Formula:** C10H11BrO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9593>.
CCN(CC)c1nc(=NN)nc(N(CC)CC)[nH]1
What is the building block token for the following molecule?
CCN(CC)c1nc(=NN)nc(N(CC)CC)[nH]1
<BB_9593>
What is the molecular formula for <BB_9593>?
The molecular formula for <BB_9593> (CCN(CC)c1nc(=NN)nc(N(CC)CC)[nH]1) is C11H23N7.
Describe the ring structures in building block <BB_9593>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9593>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9593>.
**Token:** <BB_9593> **SMILES:** CCN(CC)c1nc(=NN)nc(N(CC)CC)[nH]1 **Molecular Formula:** C11H23N7 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_9594>.
CC12CCCCN1C(=O)NC2
What is the building block token for the following molecule?
CC12CCCCN1C(=O)NC2
<BB_9594>
What is the molecular formula for <BB_9594>?
The molecular formula for <BB_9594> (CC12CCCCN1C(=O)NC2) is C8H14N2O.
Describe the ring structures in building block <BB_9594>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9594>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_9594>.
**Token:** <BB_9594> **SMILES:** CC12CCCCN1C(=O)NC2 **Molecular Formula:** C8H14N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_9595>.
Fc1ccc(NCc2ccco2)c(F)c1
What is the building block token for the following molecule?
Fc1ccc(NCc2ccco2)c(F)c1
<BB_9595>
What is the molecular formula for <BB_9595>?
The molecular formula for <BB_9595> (Fc1ccc(NCc2ccco2)c(F)c1) is C11H9F2NO.
Describe the ring structures in building block <BB_9595>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9595>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9595>.
**Token:** <BB_9595> **SMILES:** Fc1ccc(NCc2ccco2)c(F)c1 **Molecular Formula:** C11H9F2NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9596>.
CCc1ccc(C)cc1CBr
What is the building block token for the following molecule?
CCc1ccc(C)cc1CBr
<BB_9596>
What is the molecular formula for <BB_9596>?
The molecular formula for <BB_9596> (CCc1ccc(C)cc1CBr) is C10H13Br.
Describe the ring structures in building block <BB_9596>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9596>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9596>.
**Token:** <BB_9596> **SMILES:** CCc1ccc(C)cc1CBr **Molecular Formula:** C10H13Br **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9597>.
CN1C(=O)CCc2cc(C(=O)CBr)ccc21
What is the building block token for the following molecule?
CN1C(=O)CCc2cc(C(=O)CBr)ccc21
<BB_9597>
What is the molecular formula for <BB_9597>?
The molecular formula for <BB_9597> (CN1C(=O)CCc2cc(C(=O)CBr)ccc21) is C12H12BrNO2.
Describe the ring structures in building block <BB_9597>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9597>.
The molecule contains the following groups: Amide, Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9597>.
**Token:** <BB_9597> **SMILES:** CN1C(=O)CCc2cc(C(=O)CBr)ccc21 **Molecular Formula:** C12H12BrNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide, Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9598>.
CN(CC1CC1)C(=O)CCl
What is the building block token for the following molecule?
CN(CC1CC1)C(=O)CCl
<BB_9598>
What is the molecular formula for <BB_9598>?
The molecular formula for <BB_9598> (CN(CC1CC1)C(=O)CCl) is C7H12ClNO.
Describe the ring structures in building block <BB_9598>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9598>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9598>.
**Token:** <BB_9598> **SMILES:** CN(CC1CC1)C(=O)CCl **Molecular Formula:** C7H12ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9599>.
CC1(C)OCC(CCN)CO1
What is the building block token for the following molecule?
CC1(C)OCC(CCN)CO1
<BB_9599>
What is the molecular formula for <BB_9599>?
The molecular formula for <BB_9599> (CC1(C)OCC(CCN)CO1) is C8H17NO2.
Describe the ring structures in building block <BB_9599>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9599>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9599>.
**Token:** <BB_9599> **SMILES:** CC1(C)OCC(CCN)CO1 **Molecular Formula:** C8H17NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Ether