instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_9566>.
The molecule contains the following groups: Carboxylic Acid, Amide, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9566>.
**Token:** <BB_9566> **SMILES:** O=C(O)c1ccc2c(c1)C(=O)NS(=O)(=O)O2 **Molecular Formula:** C8H5NO6S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Sulfonamide
Provide the SMILES representation for the building block token <BB_9567>.
Cl.NC1CCCCC1
What is the building block token for the following molecule?
Cl.NC1CCCCC1
<BB_9567>
What is the molecular formula for <BB_9567>?
The molecular formula for <BB_9567> (Cl.NC1CCCCC1) is C6H14ClN.
Describe the ring structures in building block <BB_9567>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9567>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9567>.
**Token:** <BB_9567> **SMILES:** Cl.NC1CCCCC1 **Molecular Formula:** C6H14ClN **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9568>.
Fc1cc(F)c2sc(Br)nc2c1
What is the building block token for the following molecule?
Fc1cc(F)c2sc(Br)nc2c1
<BB_9568>
What is the molecular formula for <BB_9568>?
The molecular formula for <BB_9568> (Fc1cc(F)c2sc(Br)nc2c1) is C7H2BrF2NS.
Describe the ring structures in building block <BB_9568>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9568>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9568>.
**Token:** <BB_9568> **SMILES:** Fc1cc(F)c2sc(Br)nc2c1 **Molecular Formula:** C7H2BrF2NS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9569>.
Cc1cc(C(C)C)nc(N2CCNCC2)n1
What is the building block token for the following molecule?
Cc1cc(C(C)C)nc(N2CCNCC2)n1
<BB_9569>
What is the molecular formula for <BB_9569>?
The molecular formula for <BB_9569> (Cc1cc(C(C)C)nc(N2CCNCC2)n1) is C12H20N4.
Describe the ring structures in building block <BB_9569>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9569>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9569>.
**Token:** <BB_9569> **SMILES:** Cc1cc(C(C)C)nc(N2CCNCC2)n1 **Molecular Formula:** C12H20N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_9570>.
CC1(C)CCC(O)(CN)C1.Cl
What is the building block token for the following molecule?
CC1(C)CCC(O)(CN)C1.Cl
<BB_9570>
What is the molecular formula for <BB_9570>?
The molecular formula for <BB_9570> (CC1(C)CCC(O)(CN)C1.Cl) is C8H18ClNO.
Describe the ring structures in building block <BB_9570>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9570>.
The molecule contains the following groups: Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9570>.
**Token:** <BB_9570> **SMILES:** CC1(C)CCC(O)(CN)C1.Cl **Molecular Formula:** C8H18ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9571>.
CC(C)(C)OC(=O)N1CCCc2cc(CN)ccc21
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCCc2cc(CN)ccc21
<BB_9571>
What is the molecular formula for <BB_9571>?
The molecular formula for <BB_9571> (CC(C)(C)OC(=O)N1CCCc2cc(CN)ccc21) is C15H22N2O2.
Describe the ring structures in building block <BB_9571>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9571>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9571>.
**Token:** <BB_9571> **SMILES:** CC(C)(C)OC(=O)N1CCCc2cc(CN)ccc21 **Molecular Formula:** C15H22N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_9572>.
CC(C)(C)NS(=O)(=O)c1ccc(N)cc1
What is the building block token for the following molecule?
CC(C)(C)NS(=O)(=O)c1ccc(N)cc1
<BB_9572>
What is the molecular formula for <BB_9572>?
The molecular formula for <BB_9572> (CC(C)(C)NS(=O)(=O)c1ccc(N)cc1) is C10H16N2O2S.
Describe the ring structures in building block <BB_9572>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9572>.
The molecule contains the following groups: Amine, Secondary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9572>.
**Token:** <BB_9572> **SMILES:** CC(C)(C)NS(=O)(=O)c1ccc(N)cc1 **Molecular Formula:** C10H16N2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_9573>.
Br.Clc1ccnc(CCBr)c1
What is the building block token for the following molecule?
Br.Clc1ccnc(CCBr)c1
<BB_9573>
What is the molecular formula for <BB_9573>?
The molecular formula for <BB_9573> (Br.Clc1ccnc(CCBr)c1) is C7H8Br2ClN.
Describe the ring structures in building block <BB_9573>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9573>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9573>.
**Token:** <BB_9573> **SMILES:** Br.Clc1ccnc(CCBr)c1 **Molecular Formula:** C7H8Br2ClN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9574>.
COC(=O)c1oc(Br)cc1C
What is the building block token for the following molecule?
COC(=O)c1oc(Br)cc1C
<BB_9574>
What is the molecular formula for <BB_9574>?
The molecular formula for <BB_9574> (COC(=O)c1oc(Br)cc1C) is C7H7BrO3.
Describe the ring structures in building block <BB_9574>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9574>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9574>.
**Token:** <BB_9574> **SMILES:** COC(=O)c1oc(Br)cc1C **Molecular Formula:** C7H7BrO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9575>.
COC(=O)c1cccc(S(N)(=O)=O)c1
What is the building block token for the following molecule?
COC(=O)c1cccc(S(N)(=O)=O)c1
<BB_9575>
What is the molecular formula for <BB_9575>?
The molecular formula for <BB_9575> (COC(=O)c1cccc(S(N)(=O)=O)c1) is C8H9NO4S.
Describe the ring structures in building block <BB_9575>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9575>.
The molecule contains the following groups: Amine, Ester, Ether, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9575>.
**Token:** <BB_9575> **SMILES:** COC(=O)c1cccc(S(N)(=O)=O)c1 **Molecular Formula:** C8H9NO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Sulfonamide
Provide the SMILES representation for the building block token <BB_9576>.
CC1(C)C2CCC1(CBr)CC2
What is the building block token for the following molecule?
CC1(C)C2CCC1(CBr)CC2
<BB_9576>
What is the molecular formula for <BB_9576>?
The molecular formula for <BB_9576> (CC1(C)C2CCC1(CBr)CC2) is C10H17Br.
Describe the ring structures in building block <BB_9576>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9576>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9576>.
**Token:** <BB_9576> **SMILES:** CC1(C)C2CCC1(CBr)CC2 **Molecular Formula:** C10H17Br **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9577>.
O=S(=O)(Cl)c1ccc(Cl)c(-c2nnn[nH]2)c1
What is the building block token for the following molecule?
O=S(=O)(Cl)c1ccc(Cl)c(-c2nnn[nH]2)c1
<BB_9577>
What is the molecular formula for <BB_9577>?
The molecular formula for <BB_9577> (O=S(=O)(Cl)c1ccc(Cl)c(-c2nnn[nH]2)c1) is C7H4Cl2N4O2S.
Describe the ring structures in building block <BB_9577>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9577>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9577>.
**Token:** <BB_9577> **SMILES:** O=S(=O)(Cl)c1ccc(Cl)c(-c2nnn[nH]2)c1 **Molecular Formula:** C7H4Cl2N4O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9578>.
CCOC(=O)c1cnc2ccnn2c1N
What is the building block token for the following molecule?
CCOC(=O)c1cnc2ccnn2c1N
<BB_9578>
What is the molecular formula for <BB_9578>?
The molecular formula for <BB_9578> (CCOC(=O)c1cnc2ccnn2c1N) is C9H10N4O2.
Describe the ring structures in building block <BB_9578>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9578>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9578>.
**Token:** <BB_9578> **SMILES:** CCOC(=O)c1cnc2ccnn2c1N **Molecular Formula:** C9H10N4O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_9579>.
CC(=O)C(=O)CCl
What is the building block token for the following molecule?
CC(=O)C(=O)CCl
<BB_9579>
What is the molecular formula for <BB_9579>?
The molecular formula for <BB_9579> (CC(=O)C(=O)CCl) is C4H5ClO2.
Describe the ring structures in building block <BB_9579>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9579>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9579>.
**Token:** <BB_9579> **SMILES:** CC(=O)C(=O)CCl **Molecular Formula:** C4H5ClO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9580>.
C[Si](C)(C)C#Cc1cocc1Br
What is the building block token for the following molecule?
C[Si](C)(C)C#Cc1cocc1Br
<BB_9580>
What is the molecular formula for <BB_9580>?
The molecular formula for <BB_9580> (C[Si](C)(C)C#Cc1cocc1Br) is C9H11BrOSi.
Describe the ring structures in building block <BB_9580>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9580>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9580>.
**Token:** <BB_9580> **SMILES:** C[Si](C)(C)C#Cc1cocc1Br **Molecular Formula:** C9H11BrOSi **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9581>.
CCC(OC1CCCC(C)C1)C(=O)O
What is the building block token for the following molecule?
CCC(OC1CCCC(C)C1)C(=O)O
<BB_9581>
What is the molecular formula for <BB_9581>?
The molecular formula for <BB_9581> (CCC(OC1CCCC(C)C1)C(=O)O) is C11H20O3.
Describe the ring structures in building block <BB_9581>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9581>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_9581>.
**Token:** <BB_9581> **SMILES:** CCC(OC1CCCC(C)C1)C(=O)O **Molecular Formula:** C11H20O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_9582>.
CCOC(=O)CC(=O)c1ccccc1OC
What is the building block token for the following molecule?
CCOC(=O)CC(=O)c1ccccc1OC
<BB_9582>
What is the molecular formula for <BB_9582>?
The molecular formula for <BB_9582> (CCOC(=O)CC(=O)c1ccccc1OC) is C12H14O4.
Describe the ring structures in building block <BB_9582>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9582>.
The molecule contains the following groups: Ester, Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_9582>.
**Token:** <BB_9582> **SMILES:** CCOC(=O)CC(=O)c1ccccc1OC **Molecular Formula:** C12H14O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ketone, Ether
Provide the SMILES representation for the building block token <BB_9583>.
Clc1ncc2ccsc2n1
What is the building block token for the following molecule?
Clc1ncc2ccsc2n1
<BB_9583>