instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_9600>.
Cc1n[nH]c(C)c1C(C)N.Cl.Cl
What is the building block token for the following molecule?
Cc1n[nH]c(C)c1C(C)N.Cl.Cl
<BB_9600>
What is the molecular formula for <BB_9600>?
The molecular formula for <BB_9600> (Cc1n[nH]c(C)c1C(C)N.Cl.Cl) is C7H15Cl2N3.
Describe the ring structures in building block <BB_9600>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9600>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9600>.
**Token:** <BB_9600> **SMILES:** Cc1n[nH]c(C)c1C(C)N.Cl.Cl **Molecular Formula:** C7H15Cl2N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9601>.
CC(C)C[C@H](NS(=O)(=O)c1ccc(Cl)cc1)C(=O)O
What is the building block token for the following molecule?
CC(C)C[C@H](NS(=O)(=O)c1ccc(Cl)cc1)C(=O)O
<BB_9601>
What is the molecular formula for <BB_9601>?
The molecular formula for <BB_9601> (CC(C)C[C@H](NS(=O)(=O)c1ccc(Cl)cc1)C(=O)O) is C12H16ClNO4S.
Describe the ring structures in building block <BB_9601>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9601>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9601>.
**Token:** <BB_9601> **SMILES:** CC(C)C[C@H](NS(=O)(=O)c1ccc(Cl)cc1)C(=O)O **Molecular Formula:** C12H16ClNO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_9602>.
N[C@@H]1CCCC[C@H]1O
What is the building block token for the following molecule?
N[C@@H]1CCCC[C@H]1O
<BB_9602>
What is the molecular formula for <BB_9602>?
The molecular formula for <BB_9602> (N[C@@H]1CCCC[C@H]1O) is C6H13NO.
Describe the ring structures in building block <BB_9602>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9602>.
The molecule contains the following groups: Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9602>.
**Token:** <BB_9602> **SMILES:** N[C@@H]1CCCC[C@H]1O **Molecular Formula:** C6H13NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Alcohol
Provide the SMILES representation for the building block token <BB_9603>.
CCC1(N)CC1(C)C.Cl
What is the building block token for the following molecule?
CCC1(N)CC1(C)C.Cl
<BB_9603>
What is the molecular formula for <BB_9603>?
The molecular formula for <BB_9603> (CCC1(N)CC1(C)C.Cl) is C7H16ClN.
Describe the ring structures in building block <BB_9603>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9603>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9603>.
**Token:** <BB_9603> **SMILES:** CCC1(N)CC1(C)C.Cl **Molecular Formula:** C7H16ClN **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9604>.
CC12CCCC(CO)(C1)C2
What is the building block token for the following molecule?
CC12CCCC(CO)(C1)C2
<BB_9604>
What is the molecular formula for <BB_9604>?
The molecular formula for <BB_9604> (CC12CCCC(CO)(C1)C2) is C9H16O.
Describe the ring structures in building block <BB_9604>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9604>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9604>.
**Token:** <BB_9604> **SMILES:** CC12CCCC(CO)(C1)C2 **Molecular Formula:** C9H16O **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_9605>.
O=S1(=O)CCc2cc(Br)ccc21
What is the building block token for the following molecule?
O=S1(=O)CCc2cc(Br)ccc21
<BB_9605>
What is the molecular formula for <BB_9605>?
The molecular formula for <BB_9605> (O=S1(=O)CCc2cc(Br)ccc21) is C8H7BrO2S.
Describe the ring structures in building block <BB_9605>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9605>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9605>.
**Token:** <BB_9605> **SMILES:** O=S1(=O)CCc2cc(Br)ccc21 **Molecular Formula:** C8H7BrO2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9606>.
CNCCN1CCC2(CCCCC2)CC1
What is the building block token for the following molecule?
CNCCN1CCC2(CCCCC2)CC1
<BB_9606>
What is the molecular formula for <BB_9606>?
The molecular formula for <BB_9606> (CNCCN1CCC2(CCCCC2)CC1) is C13H26N2.
Describe the ring structures in building block <BB_9606>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9606>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9606>.
**Token:** <BB_9606> **SMILES:** CNCCN1CCC2(CCCCC2)CC1 **Molecular Formula:** C13H26N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_9607>.
O=C1CC(=O)C(c2ccccc2)N1
What is the building block token for the following molecule?
O=C1CC(=O)C(c2ccccc2)N1
<BB_9607>
What is the molecular formula for <BB_9607>?
The molecular formula for <BB_9607> (O=C1CC(=O)C(c2ccccc2)N1) is C10H9NO2.
Describe the ring structures in building block <BB_9607>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9607>.
The molecule contains the following groups: Amide, Ketone.
Provide a comprehensive chemical profile for the building block <BB_9607>.
**Token:** <BB_9607> **SMILES:** O=C1CC(=O)C(c2ccccc2)N1 **Molecular Formula:** C10H9NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amide, Ketone
Provide the SMILES representation for the building block token <BB_9608>.
Cc1cccnc1N=[N+]=[N-]
What is the building block token for the following molecule?
Cc1cccnc1N=[N+]=[N-]
<BB_9608>
What is the molecular formula for <BB_9608>?
The molecular formula for <BB_9608> (Cc1cccnc1N=[N+]=[N-]) is C6H6N4.
Describe the ring structures in building block <BB_9608>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9608>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9608>.
**Token:** <BB_9608> **SMILES:** Cc1cccnc1N=[N+]=[N-] **Molecular Formula:** C6H6N4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9609>.
CO[C@@H]1CNC[C@H]1F.Cl
What is the building block token for the following molecule?
CO[C@@H]1CNC[C@H]1F.Cl
<BB_9609>
What is the molecular formula for <BB_9609>?
The molecular formula for <BB_9609> (CO[C@@H]1CNC[C@H]1F.Cl) is C5H11ClFNO.
Describe the ring structures in building block <BB_9609>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9609>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9609>.
**Token:** <BB_9609> **SMILES:** CO[C@@H]1CNC[C@H]1F.Cl **Molecular Formula:** C5H11ClFNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9610>.
CCn1c(C(=O)O)c(C=O)c2cc(Br)ccc21
What is the building block token for the following molecule?
CCn1c(C(=O)O)c(C=O)c2cc(Br)ccc21
<BB_9610>
What is the molecular formula for <BB_9610>?
The molecular formula for <BB_9610> (CCn1c(C(=O)O)c(C=O)c2cc(Br)ccc21) is C12H10BrNO3.
Describe the ring structures in building block <BB_9610>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9610>.
The molecule contains the following groups: Carboxylic Acid, Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9610>.
**Token:** <BB_9610> **SMILES:** CCn1c(C(=O)O)c(C=O)c2cc(Br)ccc21 **Molecular Formula:** C12H10BrNO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9611>.
N[C@H](CO)CC(F)(F)F
What is the building block token for the following molecule?
N[C@H](CO)CC(F)(F)F
<BB_9611>
What is the molecular formula for <BB_9611>?
The molecular formula for <BB_9611> (N[C@H](CO)CC(F)(F)F) is C4H8F3NO.
Describe the ring structures in building block <BB_9611>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9611>.
The molecule contains the following groups: Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9611>.
**Token:** <BB_9611> **SMILES:** N[C@H](CO)CC(F)(F)F **Molecular Formula:** C4H8F3NO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9612>.
Cl.Nc1ccc2c(c1)CS(=O)(=O)N2
What is the building block token for the following molecule?
Cl.Nc1ccc2c(c1)CS(=O)(=O)N2
<BB_9612>
What is the molecular formula for <BB_9612>?
The molecular formula for <BB_9612> (Cl.Nc1ccc2c(c1)CS(=O)(=O)N2) is C7H9ClN2O2S.
Describe the ring structures in building block <BB_9612>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9612>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9612>.
**Token:** <BB_9612> **SMILES:** Cl.Nc1ccc2c(c1)CS(=O)(=O)N2 **Molecular Formula:** C7H9ClN2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_9613>.
Cc1ccc(S(N)(=O)=O)cc1N(C)C
What is the building block token for the following molecule?
Cc1ccc(S(N)(=O)=O)cc1N(C)C
<BB_9613>
What is the molecular formula for <BB_9613>?
The molecular formula for <BB_9613> (Cc1ccc(S(N)(=O)=O)cc1N(C)C) is C9H14N2O2S.
Describe the ring structures in building block <BB_9613>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9613>.
The molecule contains the following groups: Amine, Tertiary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9613>.
**Token:** <BB_9613> **SMILES:** Cc1ccc(S(N)(=O)=O)cc1N(C)C **Molecular Formula:** C9H14N2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_9614>.
C1CNc2nonc2N1
What is the building block token for the following molecule?
C1CNc2nonc2N1
<BB_9614>
What is the molecular formula for <BB_9614>?
The molecular formula for <BB_9614> (C1CNc2nonc2N1) is C4H6N4O.
Describe the ring structures in building block <BB_9614>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9614>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_9614>.
**Token:** <BB_9614> **SMILES:** C1CNc2nonc2N1 **Molecular Formula:** C4H6N4O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_9615>.
CC(=O)Nc1ccc(C(=O)NCC(=O)O)cc1
What is the building block token for the following molecule?
CC(=O)Nc1ccc(C(=O)NCC(=O)O)cc1
<BB_9615>
What is the molecular formula for <BB_9615>?
The molecular formula for <BB_9615> (CC(=O)Nc1ccc(C(=O)NCC(=O)O)cc1) is C11H12N2O4.
Describe the ring structures in building block <BB_9615>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9615>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_9615>.
**Token:** <BB_9615> **SMILES:** CC(=O)Nc1ccc(C(=O)NCC(=O)O)cc1 **Molecular Formula:** C11H12N2O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_9616>.
O=C1CCCC(CBr)C1
What is the building block token for the following molecule?
O=C1CCCC(CBr)C1
<BB_9616>
What is the molecular formula for <BB_9616>?
The molecular formula for <BB_9616> (O=C1CCCC(CBr)C1) is C7H11BrO.
Describe the ring structures in building block <BB_9616>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.