instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_9783>?
The molecular formula for <BB_9783> (C1Cc2nc(C3CCNCC3)sc2C1.Cl) is C11H17ClN2S.
Describe the ring structures in building block <BB_9783>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9783>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9783>.
**Token:** <BB_9783> **SMILES:** C1Cc2nc(C3CCNCC3)sc2C1.Cl **Molecular Formula:** C11H17ClN2S **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9784>.
COC[C@@H]1CO1
What is the building block token for the following molecule?
COC[C@@H]1CO1
<BB_9784>
What is the molecular formula for <BB_9784>?
The molecular formula for <BB_9784> (COC[C@@H]1CO1) is C4H8O2.
Describe the ring structures in building block <BB_9784>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9784>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_9784>.
**Token:** <BB_9784> **SMILES:** COC[C@@H]1CO1 **Molecular Formula:** C4H8O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_9785>.
CC1(C)C[C@@H](N)[C@H]1OCc1ccccc1.Cl
What is the building block token for the following molecule?
CC1(C)C[C@@H](N)[C@H]1OCc1ccccc1.Cl
<BB_9785>
What is the molecular formula for <BB_9785>?
The molecular formula for <BB_9785> (CC1(C)C[C@@H](N)[C@H]1OCc1ccccc1.Cl) is C13H20ClNO.
Describe the ring structures in building block <BB_9785>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6.
List the primary functional groups present in <BB_9785>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9785>.
**Token:** <BB_9785> **SMILES:** CC1(C)C[C@@H](N)[C@H]1OCc1ccccc1.Cl **Molecular Formula:** C13H20ClNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9786>.
Cc1ccc(C2(C(=O)O)CC2)c(F)c1
What is the building block token for the following molecule?
Cc1ccc(C2(C(=O)O)CC2)c(F)c1
<BB_9786>
What is the molecular formula for <BB_9786>?
The molecular formula for <BB_9786> (Cc1ccc(C2(C(=O)O)CC2)c(F)c1) is C11H11FO2.
Describe the ring structures in building block <BB_9786>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9786>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9786>.
**Token:** <BB_9786> **SMILES:** Cc1ccc(C2(C(=O)O)CC2)c(F)c1 **Molecular Formula:** C11H11FO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9787>.
O=C1CCCC(N2C(=O)c3ccccc3C2=O)C1
What is the building block token for the following molecule?
O=C1CCCC(N2C(=O)c3ccccc3C2=O)C1
<BB_9787>
What is the molecular formula for <BB_9787>?
The molecular formula for <BB_9787> (O=C1CCCC(N2C(=O)c3ccccc3C2=O)C1) is C14H13NO3.
Describe the ring structures in building block <BB_9787>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9787>.
The molecule contains the following groups: Amide, Ketone.
Provide a comprehensive chemical profile for the building block <BB_9787>.
**Token:** <BB_9787> **SMILES:** O=C1CCCC(N2C(=O)c3ccccc3C2=O)C1 **Molecular Formula:** C14H13NO3 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amide, Ketone
Provide the SMILES representation for the building block token <BB_9788>.
N=C(N)c1ccc2ccccc2c1
What is the building block token for the following molecule?
N=C(N)c1ccc2ccccc2c1
<BB_9788>
What is the molecular formula for <BB_9788>?
The molecular formula for <BB_9788> (N=C(N)c1ccc2ccccc2c1) is C11H10N2.
Describe the ring structures in building block <BB_9788>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9788>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9788>.
**Token:** <BB_9788> **SMILES:** N=C(N)c1ccc2ccccc2c1 **Molecular Formula:** C11H10N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9789>.
NNC(=O)CC1CCCCC1
What is the building block token for the following molecule?
NNC(=O)CC1CCCCC1
<BB_9789>
What is the molecular formula for <BB_9789>?
The molecular formula for <BB_9789> (NNC(=O)CC1CCCCC1) is C8H16N2O.
Describe the ring structures in building block <BB_9789>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9789>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_9789>.
**Token:** <BB_9789> **SMILES:** NNC(=O)CC1CCCCC1 **Molecular Formula:** C8H16N2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_9790>.
Cc1cccc(-n2nnc(C(=O)O)c2N)c1
What is the building block token for the following molecule?
Cc1cccc(-n2nnc(C(=O)O)c2N)c1
<BB_9790>
What is the molecular formula for <BB_9790>?
The molecular formula for <BB_9790> (Cc1cccc(-n2nnc(C(=O)O)c2N)c1) is C10H10N4O2.
Describe the ring structures in building block <BB_9790>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9790>.
The molecule contains the following groups: Carboxylic Acid, Amine.
Provide a comprehensive chemical profile for the building block <BB_9790>.
**Token:** <BB_9790> **SMILES:** Cc1cccc(-n2nnc(C(=O)O)c2N)c1 **Molecular Formula:** C10H10N4O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amine
Provide the SMILES representation for the building block token <BB_9791>.
C#Cc1ccc(Cl)nc1Cl
What is the building block token for the following molecule?
C#Cc1ccc(Cl)nc1Cl
<BB_9791>
What is the molecular formula for <BB_9791>?
The molecular formula for <BB_9791> (C#Cc1ccc(Cl)nc1Cl) is C7H3Cl2N.
Describe the ring structures in building block <BB_9791>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9791>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9791>.
**Token:** <BB_9791> **SMILES:** C#Cc1ccc(Cl)nc1Cl **Molecular Formula:** C7H3Cl2N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9792>.
Cl.N#C[C@@]1(CN)C[C@H]1C(F)(F)F
What is the building block token for the following molecule?
Cl.N#C[C@@]1(CN)C[C@H]1C(F)(F)F
<BB_9792>
What is the molecular formula for <BB_9792>?
The molecular formula for <BB_9792> (Cl.N#C[C@@]1(CN)C[C@H]1C(F)(F)F) is C6H8ClF3N2.
Describe the ring structures in building block <BB_9792>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9792>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9792>.
**Token:** <BB_9792> **SMILES:** Cl.N#C[C@@]1(CN)C[C@H]1C(F)(F)F **Molecular Formula:** C6H8ClF3N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9793>.
CC(C)(C)OC(=O)N1CCCC2CCNCC21.Cl
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCCC2CCNCC21.Cl
<BB_9793>
What is the molecular formula for <BB_9793>?
The molecular formula for <BB_9793> (CC(C)(C)OC(=O)N1CCCC2CCNCC21.Cl) is C13H25ClN2O2.
Describe the ring structures in building block <BB_9793>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9793>.
The molecule contains the following groups: Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9793>.
**Token:** <BB_9793> **SMILES:** CC(C)(C)OC(=O)N1CCCC2CCNCC21.Cl **Molecular Formula:** C13H25ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9794>.
Brc1ccc2ncc(I)n2c1
What is the building block token for the following molecule?
Brc1ccc2ncc(I)n2c1
<BB_9794>
What is the molecular formula for <BB_9794>?
The molecular formula for <BB_9794> (Brc1ccc2ncc(I)n2c1) is C7H4BrIN2.
Describe the ring structures in building block <BB_9794>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9794>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9794>.
**Token:** <BB_9794> **SMILES:** Brc1ccc2ncc(I)n2c1 **Molecular Formula:** C7H4BrIN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9795>.
Cc1cc(F)ccc1C#N
What is the building block token for the following molecule?
Cc1cc(F)ccc1C#N
<BB_9795>
What is the molecular formula for <BB_9795>?
The molecular formula for <BB_9795> (Cc1cc(F)ccc1C#N) is C8H6FN.
Describe the ring structures in building block <BB_9795>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9795>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9795>.
**Token:** <BB_9795> **SMILES:** Cc1cc(F)ccc1C#N **Molecular Formula:** C8H6FN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9796>.
C1COCC2(N1)C1CC3CC(C1)CC2C3.Cl
What is the building block token for the following molecule?
C1COCC2(N1)C1CC3CC(C1)CC2C3.Cl
<BB_9796>
What is the molecular formula for <BB_9796>?
The molecular formula for <BB_9796> (C1COCC2(N1)C1CC3CC(C1)CC2C3.Cl) is C13H22ClNO.
Describe the ring structures in building block <BB_9796>.
The molecule contains 5 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9796>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9796>.
**Token:** <BB_9796> **SMILES:** C1COCC2(N1)C1CC3CC(C1)CC2C3.Cl **Molecular Formula:** C13H22ClNO **Ring System:** The molecule contains 5 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9797>.
Nc1cn[nH]c1C1CCNC1
What is the building block token for the following molecule?
Nc1cn[nH]c1C1CCNC1
<BB_9797>
What is the molecular formula for <BB_9797>?
The molecular formula for <BB_9797> (Nc1cn[nH]c1C1CCNC1) is C7H12N4.
Describe the ring structures in building block <BB_9797>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9797>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_9797>.
**Token:** <BB_9797> **SMILES:** Nc1cn[nH]c1C1CCNC1 **Molecular Formula:** C7H12N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_9798>.
CC(C)(C)OC(=O)NCc1cccc(CBr)c1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NCc1cccc(CBr)c1
<BB_9798>
What is the molecular formula for <BB_9798>?
The molecular formula for <BB_9798> (CC(C)(C)OC(=O)NCc1cccc(CBr)c1) is C13H18BrNO2.
Describe the ring structures in building block <BB_9798>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9798>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9798>.
**Token:** <BB_9798> **SMILES:** CC(C)(C)OC(=O)NCc1cccc(CBr)c1 **Molecular Formula:** C13H18BrNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9799>.
NC(c1cc(F)ccc1F)C1CC1
What is the building block token for the following molecule?
NC(c1cc(F)ccc1F)C1CC1
<BB_9799>
What is the molecular formula for <BB_9799>?
The molecular formula for <BB_9799> (NC(c1cc(F)ccc1F)C1CC1) is C10H11F2N.
Describe the ring structures in building block <BB_9799>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9799>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9799>.
**Token:** <BB_9799> **SMILES:** NC(c1cc(F)ccc1F)C1CC1 **Molecular Formula:** C10H11F2N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)