instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_9766>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_9766>.
**Token:** <BB_9766> **SMILES:** CC1OC2(C)CC1(CO)C2 **Molecular Formula:** C8H14O2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_9767>.
O=C(O)Cc1ccc(C(F)(F)F)c(Cl)c1
What is the building block token for the following molecule?
O=C(O)Cc1ccc(C(F)(F)F)c(Cl)c1
<BB_9767>
What is the molecular formula for <BB_9767>?
The molecular formula for <BB_9767> (O=C(O)Cc1ccc(C(F)(F)F)c(Cl)c1) is C9H6ClF3O2.
Describe the ring structures in building block <BB_9767>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9767>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9767>.
**Token:** <BB_9767> **SMILES:** O=C(O)Cc1ccc(C(F)(F)F)c(Cl)c1 **Molecular Formula:** C9H6ClF3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9768>.
Cc1nnc(NCc2ccco2)c(C(=O)O)c1C
What is the building block token for the following molecule?
Cc1nnc(NCc2ccco2)c(C(=O)O)c1C
<BB_9768>
What is the molecular formula for <BB_9768>?
The molecular formula for <BB_9768> (Cc1nnc(NCc2ccco2)c(C(=O)O)c1C) is C12H13N3O3.
Describe the ring structures in building block <BB_9768>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9768>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_9768>.
**Token:** <BB_9768> **SMILES:** Cc1nnc(NCc2ccco2)c(C(=O)O)c1C **Molecular Formula:** C12H13N3O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Secondary Amine
Provide the SMILES representation for the building block token <BB_9769>.
C=Cc1ncccc1C(=O)[O-].[Li+]
What is the building block token for the following molecule?
C=Cc1ncccc1C(=O)[O-].[Li+]
<BB_9769>
What is the molecular formula for <BB_9769>?
The molecular formula for <BB_9769> (C=Cc1ncccc1C(=O)[O-].[Li+]) is C8H6LiNO2.
Describe the ring structures in building block <BB_9769>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9769>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9769>.
**Token:** <BB_9769> **SMILES:** C=Cc1ncccc1C(=O)[O-].[Li+] **Molecular Formula:** C8H6LiNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9770>.
CC(N[C@@H](Cc1ccccc1)C(=O)O)C(=O)O.Cl
What is the building block token for the following molecule?
CC(N[C@@H](Cc1ccccc1)C(=O)O)C(=O)O.Cl
<BB_9770>
What is the molecular formula for <BB_9770>?
The molecular formula for <BB_9770> (CC(N[C@@H](Cc1ccccc1)C(=O)O)C(=O)O.Cl) is C12H16ClNO4.
Describe the ring structures in building block <BB_9770>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9770>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9770>.
**Token:** <BB_9770> **SMILES:** CC(N[C@@H](Cc1ccccc1)C(=O)O)C(=O)O.Cl **Molecular Formula:** C12H16ClNO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9771>.
COC(=O)c1cc2c(F)c(F)cc(F)c2[nH]1
What is the building block token for the following molecule?
COC(=O)c1cc2c(F)c(F)cc(F)c2[nH]1
<BB_9771>
What is the molecular formula for <BB_9771>?
The molecular formula for <BB_9771> (COC(=O)c1cc2c(F)c(F)cc(F)c2[nH]1) is C10H6F3NO2.
Describe the ring structures in building block <BB_9771>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9771>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9771>.
**Token:** <BB_9771> **SMILES:** COC(=O)c1cc2c(F)c(F)cc(F)c2[nH]1 **Molecular Formula:** C10H6F3NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9772>.
CC1CCCC(=N)N1.Cl
What is the building block token for the following molecule?
CC1CCCC(=N)N1.Cl
<BB_9772>
What is the molecular formula for <BB_9772>?
The molecular formula for <BB_9772> (CC1CCCC(=N)N1.Cl) is C6H13ClN2.
Describe the ring structures in building block <BB_9772>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9772>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9772>.
**Token:** <BB_9772> **SMILES:** CC1CCCC(=N)N1.Cl **Molecular Formula:** C6H13ClN2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9773>.
CCC(C)(N)C(N)=O
What is the building block token for the following molecule?
CCC(C)(N)C(N)=O
<BB_9773>
What is the molecular formula for <BB_9773>?
The molecular formula for <BB_9773> (CCC(C)(N)C(N)=O) is C5H12N2O.
Describe the ring structures in building block <BB_9773>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9773>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_9773>.
**Token:** <BB_9773> **SMILES:** CCC(C)(N)C(N)=O **Molecular Formula:** C5H12N2O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_9774>.
CC(C)c1ccc2c(c1)[C@H](N)CC2.Cl
What is the building block token for the following molecule?
CC(C)c1ccc2c(c1)[C@H](N)CC2.Cl
<BB_9774>
What is the molecular formula for <BB_9774>?
The molecular formula for <BB_9774> (CC(C)c1ccc2c(c1)[C@H](N)CC2.Cl) is C12H18ClN.
Describe the ring structures in building block <BB_9774>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9774>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9774>.
**Token:** <BB_9774> **SMILES:** CC(C)c1ccc2c(c1)[C@H](N)CC2.Cl **Molecular Formula:** C12H18ClN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9775>.
CC(C)c1cc(C(C)C)c(S)c(C(C)C)c1
What is the building block token for the following molecule?
CC(C)c1cc(C(C)C)c(S)c(C(C)C)c1
<BB_9775>
What is the molecular formula for <BB_9775>?
The molecular formula for <BB_9775> (CC(C)c1cc(C(C)C)c(S)c(C(C)C)c1) is C15H24S.
Describe the ring structures in building block <BB_9775>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9775>.
The molecule contains the following groups: Thiol.
Provide a comprehensive chemical profile for the building block <BB_9775>.
**Token:** <BB_9775> **SMILES:** CC(C)c1cc(C(C)C)c(S)c(C(C)C)c1 **Molecular Formula:** C15H24S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Thiol
Provide the SMILES representation for the building block token <BB_9776>.
Cl.c1c[nH]c(-c2ccc3c(c2)OCCO3)n1
What is the building block token for the following molecule?
Cl.c1c[nH]c(-c2ccc3c(c2)OCCO3)n1
<BB_9776>
What is the molecular formula for <BB_9776>?
The molecular formula for <BB_9776> (Cl.c1c[nH]c(-c2ccc3c(c2)OCCO3)n1) is C11H11ClN2O2.
Describe the ring structures in building block <BB_9776>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9776>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9776>.
**Token:** <BB_9776> **SMILES:** Cl.c1c[nH]c(-c2ccc3c(c2)OCCO3)n1 **Molecular Formula:** C11H11ClN2O2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9777>.
COC(=O)c1ccn(S(C)(=O)=O)n1
What is the building block token for the following molecule?
COC(=O)c1ccn(S(C)(=O)=O)n1
<BB_9777>
What is the molecular formula for <BB_9777>?
The molecular formula for <BB_9777> (COC(=O)c1ccn(S(C)(=O)=O)n1) is C6H8N2O4S.
Describe the ring structures in building block <BB_9777>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9777>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9777>.
**Token:** <BB_9777> **SMILES:** COC(=O)c1ccn(S(C)(=O)=O)n1 **Molecular Formula:** C6H8N2O4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_9778>.
O=C(Cl)CCc1cccc(Br)c1F
What is the building block token for the following molecule?
O=C(Cl)CCc1cccc(Br)c1F
<BB_9778>
What is the molecular formula for <BB_9778>?
The molecular formula for <BB_9778> (O=C(Cl)CCc1cccc(Br)c1F) is C9H7BrClFO.
Describe the ring structures in building block <BB_9778>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9778>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9778>.
**Token:** <BB_9778> **SMILES:** O=C(Cl)CCc1cccc(Br)c1F **Molecular Formula:** C9H7BrClFO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9779>.
Cl.O=C(c1cc(F)ccc1F)N1CCNCC1
What is the building block token for the following molecule?
Cl.O=C(c1cc(F)ccc1F)N1CCNCC1
<BB_9779>
What is the molecular formula for <BB_9779>?
The molecular formula for <BB_9779> (Cl.O=C(c1cc(F)ccc1F)N1CCNCC1) is C11H13ClF2N2O.
Describe the ring structures in building block <BB_9779>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9779>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9779>.
**Token:** <BB_9779> **SMILES:** Cl.O=C(c1cc(F)ccc1F)N1CCNCC1 **Molecular Formula:** C11H13ClF2N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9780>.
COC(=O)[C@H]1CCNC[C@H]1O.Cl
What is the building block token for the following molecule?
COC(=O)[C@H]1CCNC[C@H]1O.Cl
<BB_9780>
What is the molecular formula for <BB_9780>?
The molecular formula for <BB_9780> (COC(=O)[C@H]1CCNC[C@H]1O.Cl) is C7H14ClNO3.
Describe the ring structures in building block <BB_9780>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9780>.
The molecule contains the following groups: Secondary Amine, Ester, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9780>.
**Token:** <BB_9780> **SMILES:** COC(=O)[C@H]1CCNC[C@H]1O.Cl **Molecular Formula:** C7H14ClNO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9781>.
[N-]=[N+]=NCc1ncoc1C(F)(F)F
What is the building block token for the following molecule?
[N-]=[N+]=NCc1ncoc1C(F)(F)F
<BB_9781>
What is the molecular formula for <BB_9781>?
The molecular formula for <BB_9781> ([N-]=[N+]=NCc1ncoc1C(F)(F)F) is C5H3F3N4O.
Describe the ring structures in building block <BB_9781>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9781>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9781>.
**Token:** <BB_9781> **SMILES:** [N-]=[N+]=NCc1ncoc1C(F)(F)F **Molecular Formula:** C5H3F3N4O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9782>.
O=C(O)C(=O)Cc1ccc(F)cc1
What is the building block token for the following molecule?
O=C(O)C(=O)Cc1ccc(F)cc1
<BB_9782>
What is the molecular formula for <BB_9782>?
The molecular formula for <BB_9782> (O=C(O)C(=O)Cc1ccc(F)cc1) is C9H7FO3.
Describe the ring structures in building block <BB_9782>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9782>.
The molecule contains the following groups: Carboxylic Acid, Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9782>.
**Token:** <BB_9782> **SMILES:** O=C(O)C(=O)Cc1ccc(F)cc1 **Molecular Formula:** C9H7FO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9783>.
C1Cc2nc(C3CCNCC3)sc2C1.Cl
What is the building block token for the following molecule?
C1Cc2nc(C3CCNCC3)sc2C1.Cl
<BB_9783>