instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_9750>.
Cc1cc(C)c(N)c(C)n1.Cl
What is the building block token for the following molecule?
Cc1cc(C)c(N)c(C)n1.Cl
<BB_9750>
What is the molecular formula for <BB_9750>?
The molecular formula for <BB_9750> (Cc1cc(C)c(N)c(C)n1.Cl) is C8H13ClN2.
Describe the ring structures in building block <BB_9750>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9750>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9750>.
**Token:** <BB_9750> **SMILES:** Cc1cc(C)c(N)c(C)n1.Cl **Molecular Formula:** C8H13ClN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9751>.
COc1cc(Br)cc(N=C=O)c1
What is the building block token for the following molecule?
COc1cc(Br)cc(N=C=O)c1
<BB_9751>
What is the molecular formula for <BB_9751>?
The molecular formula for <BB_9751> (COc1cc(Br)cc(N=C=O)c1) is C8H6BrNO2.
Describe the ring structures in building block <BB_9751>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9751>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9751>.
**Token:** <BB_9751> **SMILES:** COc1cc(Br)cc(N=C=O)c1 **Molecular Formula:** C8H6BrNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9752>.
[N-]=[N+]=NCc1conc1C1CC1
What is the building block token for the following molecule?
[N-]=[N+]=NCc1conc1C1CC1
<BB_9752>
What is the molecular formula for <BB_9752>?
The molecular formula for <BB_9752> ([N-]=[N+]=NCc1conc1C1CC1) is C7H8N4O.
Describe the ring structures in building block <BB_9752>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9752>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9752>.
**Token:** <BB_9752> **SMILES:** [N-]=[N+]=NCc1conc1C1CC1 **Molecular Formula:** C7H8N4O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9753>.
O=CCc1cc(Cl)cc(Cl)c1
What is the building block token for the following molecule?
O=CCc1cc(Cl)cc(Cl)c1
<BB_9753>
What is the molecular formula for <BB_9753>?
The molecular formula for <BB_9753> (O=CCc1cc(Cl)cc(Cl)c1) is C8H6Cl2O.
Describe the ring structures in building block <BB_9753>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9753>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9753>.
**Token:** <BB_9753> **SMILES:** O=CCc1cc(Cl)cc(Cl)c1 **Molecular Formula:** C8H6Cl2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9754>.
Cl.Nc1cnn2ccc(C(=O)O)cc12
What is the building block token for the following molecule?
Cl.Nc1cnn2ccc(C(=O)O)cc12
<BB_9754>
What is the molecular formula for <BB_9754>?
The molecular formula for <BB_9754> (Cl.Nc1cnn2ccc(C(=O)O)cc12) is C8H8ClN3O2.
Describe the ring structures in building block <BB_9754>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9754>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9754>.
**Token:** <BB_9754> **SMILES:** Cl.Nc1cnn2ccc(C(=O)O)cc12 **Molecular Formula:** C8H8ClN3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9755>.
N#Cc1cccc(Oc2cccc(F)c2)c1
What is the building block token for the following molecule?
N#Cc1cccc(Oc2cccc(F)c2)c1
<BB_9755>
What is the molecular formula for <BB_9755>?
The molecular formula for <BB_9755> (N#Cc1cccc(Oc2cccc(F)c2)c1) is C13H8FNO.
Describe the ring structures in building block <BB_9755>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9755>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9755>.
**Token:** <BB_9755> **SMILES:** N#Cc1cccc(Oc2cccc(F)c2)c1 **Molecular Formula:** C13H8FNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9756>.
CS(=N)(=O)CCCO
What is the building block token for the following molecule?
CS(=N)(=O)CCCO
<BB_9756>
What is the molecular formula for <BB_9756>?
The molecular formula for <BB_9756> (CS(=N)(=O)CCCO) is C4H11NO2S.
Describe the ring structures in building block <BB_9756>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9756>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9756>.
**Token:** <BB_9756> **SMILES:** CS(=N)(=O)CCCO **Molecular Formula:** C4H11NO2S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_9757>.
Cc1nn(C2CC2)cc1C(=O)O
What is the building block token for the following molecule?
Cc1nn(C2CC2)cc1C(=O)O
<BB_9757>
What is the molecular formula for <BB_9757>?
The molecular formula for <BB_9757> (Cc1nn(C2CC2)cc1C(=O)O) is C8H10N2O2.
Describe the ring structures in building block <BB_9757>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9757>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_9757>.
**Token:** <BB_9757> **SMILES:** Cc1nn(C2CC2)cc1C(=O)O **Molecular Formula:** C8H10N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_9758>.
Cc1c(C)c(CN)c(C)c(C)c1Br.Cl
What is the building block token for the following molecule?
Cc1c(C)c(CN)c(C)c(C)c1Br.Cl
<BB_9758>
What is the molecular formula for <BB_9758>?
The molecular formula for <BB_9758> (Cc1c(C)c(CN)c(C)c(C)c1Br.Cl) is C11H17BrClN.
Describe the ring structures in building block <BB_9758>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9758>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9758>.
**Token:** <BB_9758> **SMILES:** Cc1c(C)c(CN)c(C)c(C)c1Br.Cl **Molecular Formula:** C11H17BrClN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9759>.
Cl.NCc1cnoc1C1CC1
What is the building block token for the following molecule?
Cl.NCc1cnoc1C1CC1
<BB_9759>
What is the molecular formula for <BB_9759>?
The molecular formula for <BB_9759> (Cl.NCc1cnoc1C1CC1) is C7H11ClN2O.
Describe the ring structures in building block <BB_9759>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9759>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9759>.
**Token:** <BB_9759> **SMILES:** Cl.NCc1cnoc1C1CC1 **Molecular Formula:** C7H11ClN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9760>.
C#CC(N)C(C)(C)OC
What is the building block token for the following molecule?
C#CC(N)C(C)(C)OC
<BB_9760>
What is the molecular formula for <BB_9760>?
The molecular formula for <BB_9760> (C#CC(N)C(C)(C)OC) is C7H13NO.
Describe the ring structures in building block <BB_9760>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9760>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9760>.
**Token:** <BB_9760> **SMILES:** C#CC(N)C(C)(C)OC **Molecular Formula:** C7H13NO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_9761>.
O=S1OCC2(CCCCC2)CO1
What is the building block token for the following molecule?
O=S1OCC2(CCCCC2)CO1
<BB_9761>
What is the molecular formula for <BB_9761>?
The molecular formula for <BB_9761> (O=S1OCC2(CCCCC2)CO1) is C8H14O3S.
Describe the ring structures in building block <BB_9761>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9761>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9761>.
**Token:** <BB_9761> **SMILES:** O=S1OCC2(CCCCC2)CO1 **Molecular Formula:** C8H14O3S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9762>.
C#Cc1ccc(N)c(F)c1
What is the building block token for the following molecule?
C#Cc1ccc(N)c(F)c1
<BB_9762>
What is the molecular formula for <BB_9762>?
The molecular formula for <BB_9762> (C#Cc1ccc(N)c(F)c1) is C8H6FN.
Describe the ring structures in building block <BB_9762>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9762>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9762>.
**Token:** <BB_9762> **SMILES:** C#Cc1ccc(N)c(F)c1 **Molecular Formula:** C8H6FN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9763>.
CC(C)c1nccn1CC(=O)O
What is the building block token for the following molecule?
CC(C)c1nccn1CC(=O)O
<BB_9763>
What is the molecular formula for <BB_9763>?
The molecular formula for <BB_9763> (CC(C)c1nccn1CC(=O)O) is C8H12N2O2.
Describe the ring structures in building block <BB_9763>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9763>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_9763>.
**Token:** <BB_9763> **SMILES:** CC(C)c1nccn1CC(=O)O **Molecular Formula:** C8H12N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_9764>.
Clc1cn2c(Br)cnc2cn1
What is the building block token for the following molecule?
Clc1cn2c(Br)cnc2cn1
<BB_9764>
What is the molecular formula for <BB_9764>?
The molecular formula for <BB_9764> (Clc1cn2c(Br)cnc2cn1) is C6H3BrClN3.
Describe the ring structures in building block <BB_9764>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9764>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9764>.
**Token:** <BB_9764> **SMILES:** Clc1cn2c(Br)cnc2cn1 **Molecular Formula:** C6H3BrClN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9765>.
Cl.O=C(O)C1CNc2ccccc2C1
What is the building block token for the following molecule?
Cl.O=C(O)C1CNc2ccccc2C1
<BB_9765>
What is the molecular formula for <BB_9765>?
The molecular formula for <BB_9765> (Cl.O=C(O)C1CNc2ccccc2C1) is C10H12ClNO2.
Describe the ring structures in building block <BB_9765>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9765>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9765>.
**Token:** <BB_9765> **SMILES:** Cl.O=C(O)C1CNc2ccccc2C1 **Molecular Formula:** C10H12ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9766>.
CC1OC2(C)CC1(CO)C2
What is the building block token for the following molecule?
CC1OC2(C)CC1(CO)C2
<BB_9766>
What is the molecular formula for <BB_9766>?
The molecular formula for <BB_9766> (CC1OC2(C)CC1(CO)C2) is C8H14O2.
Describe the ring structures in building block <BB_9766>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 5.