instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_9800>.
O=C(O)C(OCC(F)(F)F)c1ccccc1
What is the building block token for the following molecule?
O=C(O)C(OCC(F)(F)F)c1ccccc1
<BB_9800>
What is the molecular formula for <BB_9800>?
The molecular formula for <BB_9800> (O=C(O)C(OCC(F)(F)F)c1ccccc1) is C10H9F3O3.
Describe the ring structures in building block <BB_9800>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9800>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9800>.
**Token:** <BB_9800> **SMILES:** O=C(O)C(OCC(F)(F)F)c1ccccc1 **Molecular Formula:** C10H9F3O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9801>.
O=C(O)c1ccc(Cl)c2[nH]cnc12
What is the building block token for the following molecule?
O=C(O)c1ccc(Cl)c2[nH]cnc12
<BB_9801>
What is the molecular formula for <BB_9801>?
The molecular formula for <BB_9801> (O=C(O)c1ccc(Cl)c2[nH]cnc12) is C8H5ClN2O2.
Describe the ring structures in building block <BB_9801>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9801>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9801>.
**Token:** <BB_9801> **SMILES:** O=C(O)c1ccc(Cl)c2[nH]cnc12 **Molecular Formula:** C8H5ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9802>.
Cl.O=C(NCc1nc(CCl)cs1)c1ccccc1
What is the building block token for the following molecule?
Cl.O=C(NCc1nc(CCl)cs1)c1ccccc1
<BB_9802>
What is the molecular formula for <BB_9802>?
The molecular formula for <BB_9802> (Cl.O=C(NCc1nc(CCl)cs1)c1ccccc1) is C12H12Cl2N2OS.
Describe the ring structures in building block <BB_9802>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9802>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9802>.
**Token:** <BB_9802> **SMILES:** Cl.O=C(NCc1nc(CCl)cs1)c1ccccc1 **Molecular Formula:** C12H12Cl2N2OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9803>.
CNC[C@@H]1C[C@H](F)CN1Cc1cnn(C)c1
What is the building block token for the following molecule?
CNC[C@@H]1C[C@H](F)CN1Cc1cnn(C)c1
<BB_9803>
What is the molecular formula for <BB_9803>?
The molecular formula for <BB_9803> (CNC[C@@H]1C[C@H](F)CN1Cc1cnn(C)c1) is C11H19FN4.
Describe the ring structures in building block <BB_9803>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_9803>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9803>.
**Token:** <BB_9803> **SMILES:** CNC[C@@H]1C[C@H](F)CN1Cc1cnn(C)c1 **Molecular Formula:** C11H19FN4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9804>.
Sc1nnc(SCc2ccccc2)s1
What is the building block token for the following molecule?
Sc1nnc(SCc2ccccc2)s1
<BB_9804>
What is the molecular formula for <BB_9804>?
The molecular formula for <BB_9804> (Sc1nnc(SCc2ccccc2)s1) is C9H8N2S3.
Describe the ring structures in building block <BB_9804>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9804>.
The molecule contains the following groups: Thiol, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_9804>.
**Token:** <BB_9804> **SMILES:** Sc1nnc(SCc2ccccc2)s1 **Molecular Formula:** C9H8N2S3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Thiol, Sulfide
Provide the SMILES representation for the building block token <BB_9805>.
O=C(O)c1c(C2CC2)nn2ccccc12
What is the building block token for the following molecule?
O=C(O)c1c(C2CC2)nn2ccccc12
<BB_9805>
What is the molecular formula for <BB_9805>?
The molecular formula for <BB_9805> (O=C(O)c1c(C2CC2)nn2ccccc12) is C11H10N2O2.
Describe the ring structures in building block <BB_9805>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3, an aromatic ring of size 6.
List the primary functional groups present in <BB_9805>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_9805>.
**Token:** <BB_9805> **SMILES:** O=C(O)c1c(C2CC2)nn2ccccc12 **Molecular Formula:** C11H10N2O2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_9806>.
C[C@@H](CCN)OC1CCCCO1
What is the building block token for the following molecule?
C[C@@H](CCN)OC1CCCCO1
<BB_9806>
What is the molecular formula for <BB_9806>?
The molecular formula for <BB_9806> (C[C@@H](CCN)OC1CCCCO1) is C9H19NO2.
Describe the ring structures in building block <BB_9806>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9806>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9806>.
**Token:** <BB_9806> **SMILES:** C[C@@H](CCN)OC1CCCCO1 **Molecular Formula:** C9H19NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_9807>.
COC(=O)c1c(F)ccc(CBr)c1F
What is the building block token for the following molecule?
COC(=O)c1c(F)ccc(CBr)c1F
<BB_9807>
What is the molecular formula for <BB_9807>?
The molecular formula for <BB_9807> (COC(=O)c1c(F)ccc(CBr)c1F) is C9H7BrF2O2.
Describe the ring structures in building block <BB_9807>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9807>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9807>.
**Token:** <BB_9807> **SMILES:** COC(=O)c1c(F)ccc(CBr)c1F **Molecular Formula:** C9H7BrF2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9808>.
CC(C)(C)OC(=O)N(N)C1CC1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N(N)C1CC1
<BB_9808>
What is the molecular formula for <BB_9808>?
The molecular formula for <BB_9808> (CC(C)(C)OC(=O)N(N)C1CC1) is C8H16N2O2.
Describe the ring structures in building block <BB_9808>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9808>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9808>.
**Token:** <BB_9808> **SMILES:** CC(C)(C)OC(=O)N(N)C1CC1 **Molecular Formula:** C8H16N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_9809>.
NCC1(c2ccc(F)cc2)CCCCC1
What is the building block token for the following molecule?
NCC1(c2ccc(F)cc2)CCCCC1
<BB_9809>
What is the molecular formula for <BB_9809>?
The molecular formula for <BB_9809> (NCC1(c2ccc(F)cc2)CCCCC1) is C13H18FN.
Describe the ring structures in building block <BB_9809>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9809>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9809>.
**Token:** <BB_9809> **SMILES:** NCC1(c2ccc(F)cc2)CCCCC1 **Molecular Formula:** C13H18FN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9810>.
OC1CCn2nccc2C1
What is the building block token for the following molecule?
OC1CCn2nccc2C1
<BB_9810>
What is the molecular formula for <BB_9810>?
The molecular formula for <BB_9810> (OC1CCn2nccc2C1) is C7H10N2O.
Describe the ring structures in building block <BB_9810>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9810>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9810>.
**Token:** <BB_9810> **SMILES:** OC1CCn2nccc2C1 **Molecular Formula:** C7H10N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_9811>.
CCOCn1cc(N)cn1
What is the building block token for the following molecule?
CCOCn1cc(N)cn1
<BB_9811>
What is the molecular formula for <BB_9811>?
The molecular formula for <BB_9811> (CCOCn1cc(N)cn1) is C6H11N3O.
Describe the ring structures in building block <BB_9811>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9811>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9811>.
**Token:** <BB_9811> **SMILES:** CCOCn1cc(N)cn1 **Molecular Formula:** C6H11N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_9812>.
C#CCSCCO
What is the building block token for the following molecule?
C#CCSCCO
<BB_9812>
What is the molecular formula for <BB_9812>?
The molecular formula for <BB_9812> (C#CCSCCO) is C5H8OS.
Describe the ring structures in building block <BB_9812>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9812>.
The molecule contains the following groups: Alcohol, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_9812>.
**Token:** <BB_9812> **SMILES:** C#CCSCCO **Molecular Formula:** C5H8OS **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol, Sulfide
Provide the SMILES representation for the building block token <BB_9813>.
CC(C)NCCC(=O)O.Cl
What is the building block token for the following molecule?
CC(C)NCCC(=O)O.Cl
<BB_9813>
What is the molecular formula for <BB_9813>?
The molecular formula for <BB_9813> (CC(C)NCCC(=O)O.Cl) is C6H14ClNO2.
Describe the ring structures in building block <BB_9813>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9813>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9813>.
**Token:** <BB_9813> **SMILES:** CC(C)NCCC(=O)O.Cl **Molecular Formula:** C6H14ClNO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9814>.
CN(c1nc2ccccc2[nH]c1=O)C1CCCCC1
What is the building block token for the following molecule?
CN(c1nc2ccccc2[nH]c1=O)C1CCCCC1
<BB_9814>
What is the molecular formula for <BB_9814>?
The molecular formula for <BB_9814> (CN(c1nc2ccccc2[nH]c1=O)C1CCCCC1) is C15H19N3O.
Describe the ring structures in building block <BB_9814>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9814>.
The molecule contains the following groups: Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9814>.
**Token:** <BB_9814> **SMILES:** CN(c1nc2ccccc2[nH]c1=O)C1CCCCC1 **Molecular Formula:** C15H19N3O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine
Provide the SMILES representation for the building block token <BB_9815>.
COc1ncc(C(=O)[O-])c(N)n1.[Li+]
What is the building block token for the following molecule?
COc1ncc(C(=O)[O-])c(N)n1.[Li+]
<BB_9815>
What is the molecular formula for <BB_9815>?
The molecular formula for <BB_9815> (COc1ncc(C(=O)[O-])c(N)n1.[Li+]) is C6H6LiN3O3.
Describe the ring structures in building block <BB_9815>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9815>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9815>.
**Token:** <BB_9815> **SMILES:** COc1ncc(C(=O)[O-])c(N)n1.[Li+] **Molecular Formula:** C6H6LiN3O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_9816>.
OC1CCc2[nH]ncc21
What is the building block token for the following molecule?
OC1CCc2[nH]ncc21
<BB_9816>
What is the molecular formula for <BB_9816>?
The molecular formula for <BB_9816> (OC1CCc2[nH]ncc21) is C6H8N2O.
Describe the ring structures in building block <BB_9816>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5.