instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_9833>?
The molecular formula for <BB_9833> (COc1ccc(OC)c2[nH]c(C(=O)O)cc12) is C11H11NO4.
Describe the ring structures in building block <BB_9833>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9833>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_9833>.
**Token:** <BB_9833> **SMILES:** COc1ccc(OC)c2[nH]c(C(=O)O)cc12 **Molecular Formula:** C11H11NO4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_9834>.
CC(F)(F)C(N)=NO
What is the building block token for the following molecule?
CC(F)(F)C(N)=NO
<BB_9834>
What is the molecular formula for <BB_9834>?
The molecular formula for <BB_9834> (CC(F)(F)C(N)=NO) is C3H6F2N2O.
Describe the ring structures in building block <BB_9834>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9834>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9834>.
**Token:** <BB_9834> **SMILES:** CC(F)(F)C(N)=NO **Molecular Formula:** C3H6F2N2O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9835>.
Cc1cc(F)ccc1C(=O)N[C@H]1CCC[C@H]1C(=O)O
What is the building block token for the following molecule?
Cc1cc(F)ccc1C(=O)N[C@H]1CCC[C@H]1C(=O)O
<BB_9835>
What is the molecular formula for <BB_9835>?
The molecular formula for <BB_9835> (Cc1cc(F)ccc1C(=O)N[C@H]1CCC[C@H]1C(=O)O) is C14H16FNO3.
Describe the ring structures in building block <BB_9835>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9835>.
The molecule contains the following groups: Carboxylic Acid, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9835>.
**Token:** <BB_9835> **SMILES:** Cc1cc(F)ccc1C(=O)N[C@H]1CCC[C@H]1C(=O)O **Molecular Formula:** C14H16FNO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9836>.
O=C([O-])c1cncc(F)c1F.[Li+]
What is the building block token for the following molecule?
O=C([O-])c1cncc(F)c1F.[Li+]
<BB_9836>
What is the molecular formula for <BB_9836>?
The molecular formula for <BB_9836> (O=C([O-])c1cncc(F)c1F.[Li+]) is C6H2F2LiNO2.
Describe the ring structures in building block <BB_9836>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9836>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9836>.
**Token:** <BB_9836> **SMILES:** O=C([O-])c1cncc(F)c1F.[Li+] **Molecular Formula:** C6H2F2LiNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9837>.
CNCc1ccc(SC(F)(F)F)cc1.Cl
What is the building block token for the following molecule?
CNCc1ccc(SC(F)(F)F)cc1.Cl
<BB_9837>
What is the molecular formula for <BB_9837>?
The molecular formula for <BB_9837> (CNCc1ccc(SC(F)(F)F)cc1.Cl) is C9H11ClF3NS.
Describe the ring structures in building block <BB_9837>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9837>.
The molecule contains the following groups: Secondary Amine, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9837>.
**Token:** <BB_9837> **SMILES:** CNCc1ccc(SC(F)(F)F)cc1.Cl **Molecular Formula:** C9H11ClF3NS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9838>.
CC(=O)c1cc(Br)cnc1Br
What is the building block token for the following molecule?
CC(=O)c1cc(Br)cnc1Br
<BB_9838>
What is the molecular formula for <BB_9838>?
The molecular formula for <BB_9838> (CC(=O)c1cc(Br)cnc1Br) is C7H5Br2NO.
Describe the ring structures in building block <BB_9838>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9838>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9838>.
**Token:** <BB_9838> **SMILES:** CC(=O)c1cc(Br)cnc1Br **Molecular Formula:** C7H5Br2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9839>.
O=c1oc2c(O)c(O)ccc2c2c1CCCC2
What is the building block token for the following molecule?
O=c1oc2c(O)c(O)ccc2c2c1CCCC2
<BB_9839>
What is the molecular formula for <BB_9839>?
The molecular formula for <BB_9839> (O=c1oc2c(O)c(O)ccc2c2c1CCCC2) is C13H12O4.
Describe the ring structures in building block <BB_9839>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9839>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9839>.
**Token:** <BB_9839> **SMILES:** O=c1oc2c(O)c(O)ccc2c2c1CCCC2 **Molecular Formula:** C13H12O4 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9840>.
CC1(c2ccnc(NN)c2)OCCO1
What is the building block token for the following molecule?
CC1(c2ccnc(NN)c2)OCCO1
<BB_9840>
What is the molecular formula for <BB_9840>?
The molecular formula for <BB_9840> (CC1(c2ccnc(NN)c2)OCCO1) is C9H13N3O2.
Describe the ring structures in building block <BB_9840>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9840>.
The molecule contains the following groups: Amine, Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9840>.
**Token:** <BB_9840> **SMILES:** CC1(c2ccnc(NN)c2)OCCO1 **Molecular Formula:** C9H13N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_9841>.
O=C(O)Cc1cc(F)c(F)c(F)c1
What is the building block token for the following molecule?
O=C(O)Cc1cc(F)c(F)c(F)c1
<BB_9841>
What is the molecular formula for <BB_9841>?
The molecular formula for <BB_9841> (O=C(O)Cc1cc(F)c(F)c(F)c1) is C8H5F3O2.
Describe the ring structures in building block <BB_9841>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9841>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9841>.
**Token:** <BB_9841> **SMILES:** O=C(O)Cc1cc(F)c(F)c(F)c1 **Molecular Formula:** C8H5F3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9842>.
CSCc1ccco1
What is the building block token for the following molecule?
CSCc1ccco1
<BB_9842>
What is the molecular formula for <BB_9842>?
The molecular formula for <BB_9842> (CSCc1ccco1) is C6H8OS.
Describe the ring structures in building block <BB_9842>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9842>.
The molecule contains the following groups: Sulfide.
Provide a comprehensive chemical profile for the building block <BB_9842>.
**Token:** <BB_9842> **SMILES:** CSCc1ccco1 **Molecular Formula:** C6H8OS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Sulfide
Provide the SMILES representation for the building block token <BB_9843>.
C1CCNC2(CC1)CCC2.Cl
What is the building block token for the following molecule?
C1CCNC2(CC1)CCC2.Cl
<BB_9843>
What is the molecular formula for <BB_9843>?
The molecular formula for <BB_9843> (C1CCNC2(CC1)CCC2.Cl) is C9H18ClN.
Describe the ring structures in building block <BB_9843>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aliphatic ring of size 4.
List the primary functional groups present in <BB_9843>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9843>.
**Token:** <BB_9843> **SMILES:** C1CCNC2(CC1)CCC2.Cl **Molecular Formula:** C9H18ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9844>.
C=C(CO)c1cccc(C(F)(F)F)c1
What is the building block token for the following molecule?
C=C(CO)c1cccc(C(F)(F)F)c1
<BB_9844>
What is the molecular formula for <BB_9844>?
The molecular formula for <BB_9844> (C=C(CO)c1cccc(C(F)(F)F)c1) is C10H9F3O.
Describe the ring structures in building block <BB_9844>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9844>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9844>.
**Token:** <BB_9844> **SMILES:** C=C(CO)c1cccc(C(F)(F)F)c1 **Molecular Formula:** C10H9F3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9845>.
O[C@@H]1CCCC[C@H]1F
What is the building block token for the following molecule?
O[C@@H]1CCCC[C@H]1F
<BB_9845>
What is the molecular formula for <BB_9845>?
The molecular formula for <BB_9845> (O[C@@H]1CCCC[C@H]1F) is C6H11FO.
Describe the ring structures in building block <BB_9845>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9845>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9845>.
**Token:** <BB_9845> **SMILES:** O[C@@H]1CCCC[C@H]1F **Molecular Formula:** C6H11FO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9846>.
Cc1cc(B(O)O)cc(C)c1C
What is the building block token for the following molecule?
Cc1cc(B(O)O)cc(C)c1C
<BB_9846>
What is the molecular formula for <BB_9846>?
The molecular formula for <BB_9846> (Cc1cc(B(O)O)cc(C)c1C) is C9H13BO2.
Describe the ring structures in building block <BB_9846>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9846>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9846>.
**Token:** <BB_9846> **SMILES:** Cc1cc(B(O)O)cc(C)c1C **Molecular Formula:** C9H13BO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9847>.
C=CCCC(=O)c1ccccc1F
What is the building block token for the following molecule?
C=CCCC(=O)c1ccccc1F
<BB_9847>
What is the molecular formula for <BB_9847>?
The molecular formula for <BB_9847> (C=CCCC(=O)c1ccccc1F) is C11H11FO.
Describe the ring structures in building block <BB_9847>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9847>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9847>.
**Token:** <BB_9847> **SMILES:** C=CCCC(=O)c1ccccc1F **Molecular Formula:** C11H11FO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9848>.
Cl.NCCC(F)(F)CC(=O)O
What is the building block token for the following molecule?
Cl.NCCC(F)(F)CC(=O)O
<BB_9848>
What is the molecular formula for <BB_9848>?
The molecular formula for <BB_9848> (Cl.NCCC(F)(F)CC(=O)O) is C5H10ClF2NO2.
Describe the ring structures in building block <BB_9848>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9848>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9848>.
**Token:** <BB_9848> **SMILES:** Cl.NCCC(F)(F)CC(=O)O **Molecular Formula:** C5H10ClF2NO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9849>.
O=C1NC(=O)[C@H]2[C@@H]3CC[C@@H](C3)[C@@H]12
What is the building block token for the following molecule?
O=C1NC(=O)[C@H]2[C@@H]3CC[C@@H](C3)[C@@H]12
<BB_9849>
What is the molecular formula for <BB_9849>?
The molecular formula for <BB_9849> (O=C1NC(=O)[C@H]2[C@@H]3CC[C@@H](C3)[C@@H]12) is C9H11NO2.
Describe the ring structures in building block <BB_9849>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9849>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_9849>.
**Token:** <BB_9849> **SMILES:** O=C1NC(=O)[C@H]2[C@@H]3CC[C@@H](C3)[C@@H]12 **Molecular Formula:** C9H11NO2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Amide