instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_9850>.
COC12CC3CC(C1)C(N)C(C3)C2.Cl
What is the building block token for the following molecule?
COC12CC3CC(C1)C(N)C(C3)C2.Cl
<BB_9850>
What is the molecular formula for <BB_9850>?
The molecular formula for <BB_9850> (COC12CC3CC(C1)C(N)C(C3)C2.Cl) is C11H20ClNO.
Describe the ring structures in building block <BB_9850>.
The molecule contains 4 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9850>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9850>.
**Token:** <BB_9850> **SMILES:** COC12CC3CC(C1)C(N)C(C3)C2.Cl **Molecular Formula:** C11H20ClNO **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9851>.
Clc1ccc2cc(Cl)nc(Cl)c2c1
What is the building block token for the following molecule?
Clc1ccc2cc(Cl)nc(Cl)c2c1
<BB_9851>
What is the molecular formula for <BB_9851>?
The molecular formula for <BB_9851> (Clc1ccc2cc(Cl)nc(Cl)c2c1) is C9H4Cl3N.
Describe the ring structures in building block <BB_9851>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9851>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9851>.
**Token:** <BB_9851> **SMILES:** Clc1ccc2cc(Cl)nc(Cl)c2c1 **Molecular Formula:** C9H4Cl3N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9852>.
CNc1cc(C(F)(F)F)ccc1N
What is the building block token for the following molecule?
CNc1cc(C(F)(F)F)ccc1N
<BB_9852>
What is the molecular formula for <BB_9852>?
The molecular formula for <BB_9852> (CNc1cc(C(F)(F)F)ccc1N) is C8H9F3N2.
Describe the ring structures in building block <BB_9852>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9852>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9852>.
**Token:** <BB_9852> **SMILES:** CNc1cc(C(F)(F)F)ccc1N **Molecular Formula:** C8H9F3N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9853>.
C=CC(=O)Nc1ccc(C(=O)OC(C)(C)C)cc1
What is the building block token for the following molecule?
C=CC(=O)Nc1ccc(C(=O)OC(C)(C)C)cc1
<BB_9853>
What is the molecular formula for <BB_9853>?
The molecular formula for <BB_9853> (C=CC(=O)Nc1ccc(C(=O)OC(C)(C)C)cc1) is C14H17NO3.
Describe the ring structures in building block <BB_9853>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9853>.
The molecule contains the following groups: Amide, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9853>.
**Token:** <BB_9853> **SMILES:** C=CC(=O)Nc1ccc(C(=O)OC(C)(C)C)cc1 **Molecular Formula:** C14H17NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Ester, Ether
Provide the SMILES representation for the building block token <BB_9854>.
Br.Cc1nc(CBr)cs1
What is the building block token for the following molecule?
Br.Cc1nc(CBr)cs1
<BB_9854>
What is the molecular formula for <BB_9854>?
The molecular formula for <BB_9854> (Br.Cc1nc(CBr)cs1) is C5H7Br2NS.
Describe the ring structures in building block <BB_9854>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9854>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9854>.
**Token:** <BB_9854> **SMILES:** Br.Cc1nc(CBr)cs1 **Molecular Formula:** C5H7Br2NS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9855>.
O=C(O)c1cccc2nc(N3CCNCC3)oc12
What is the building block token for the following molecule?
O=C(O)c1cccc2nc(N3CCNCC3)oc12
<BB_9855>
What is the molecular formula for <BB_9855>?
The molecular formula for <BB_9855> (O=C(O)c1cccc2nc(N3CCNCC3)oc12) is C12H13N3O3.
Describe the ring structures in building block <BB_9855>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9855>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9855>.
**Token:** <BB_9855> **SMILES:** O=C(O)c1cccc2nc(N3CCNCC3)oc12 **Molecular Formula:** C12H13N3O3 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_9856>.
Nc1cc(I)cc(Br)n1
What is the building block token for the following molecule?
Nc1cc(I)cc(Br)n1
<BB_9856>
What is the molecular formula for <BB_9856>?
The molecular formula for <BB_9856> (Nc1cc(I)cc(Br)n1) is C5H4BrIN2.
Describe the ring structures in building block <BB_9856>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9856>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9856>.
**Token:** <BB_9856> **SMILES:** Nc1cc(I)cc(Br)n1 **Molecular Formula:** C5H4BrIN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9857>.
Nc1cccc(S(=O)(=O)C2CCCC2)c1
What is the building block token for the following molecule?
Nc1cccc(S(=O)(=O)C2CCCC2)c1
<BB_9857>
What is the molecular formula for <BB_9857>?
The molecular formula for <BB_9857> (Nc1cccc(S(=O)(=O)C2CCCC2)c1) is C11H15NO2S.
Describe the ring structures in building block <BB_9857>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9857>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9857>.
**Token:** <BB_9857> **SMILES:** Nc1cccc(S(=O)(=O)C2CCCC2)c1 **Molecular Formula:** C11H15NO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9858>.
CCn1ncc(C)c1S(=O)(=O)Cl
What is the building block token for the following molecule?
CCn1ncc(C)c1S(=O)(=O)Cl
<BB_9858>
What is the molecular formula for <BB_9858>?
The molecular formula for <BB_9858> (CCn1ncc(C)c1S(=O)(=O)Cl) is C6H9ClN2O2S.
Describe the ring structures in building block <BB_9858>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9858>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9858>.
**Token:** <BB_9858> **SMILES:** CCn1ncc(C)c1S(=O)(=O)Cl **Molecular Formula:** C6H9ClN2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9859>.
O=C(O)[C@@H](O)C1CCC1
What is the building block token for the following molecule?
O=C(O)[C@@H](O)C1CCC1
<BB_9859>
What is the molecular formula for <BB_9859>?
The molecular formula for <BB_9859> (O=C(O)[C@@H](O)C1CCC1) is C6H10O3.
Describe the ring structures in building block <BB_9859>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_9859>.
The molecule contains the following groups: Carboxylic Acid, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9859>.
**Token:** <BB_9859> **SMILES:** O=C(O)[C@@H](O)C1CCC1 **Molecular Formula:** C6H10O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Alcohol
Provide the SMILES representation for the building block token <BB_9860>.
C[C@H]1CC[C@H]1CN.Cl
What is the building block token for the following molecule?
C[C@H]1CC[C@H]1CN.Cl
<BB_9860>
What is the molecular formula for <BB_9860>?
The molecular formula for <BB_9860> (C[C@H]1CC[C@H]1CN.Cl) is C6H14ClN.
Describe the ring structures in building block <BB_9860>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_9860>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9860>.
**Token:** <BB_9860> **SMILES:** C[C@H]1CC[C@H]1CN.Cl **Molecular Formula:** C6H14ClN **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9861>.
C1CC2(C1)CNCCOC2
What is the building block token for the following molecule?
C1CC2(C1)CNCCOC2
<BB_9861>
What is the molecular formula for <BB_9861>?
The molecular formula for <BB_9861> (C1CC2(C1)CNCCOC2) is C8H15NO.
Describe the ring structures in building block <BB_9861>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 7.
List the primary functional groups present in <BB_9861>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9861>.
**Token:** <BB_9861> **SMILES:** C1CC2(C1)CNCCOC2 **Molecular Formula:** C8H15NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 7. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_9862>.
C[C@H]1CN(Cc2ccc(F)cc2)CCN1.Cl.Cl
What is the building block token for the following molecule?
C[C@H]1CN(Cc2ccc(F)cc2)CCN1.Cl.Cl
<BB_9862>
What is the molecular formula for <BB_9862>?
The molecular formula for <BB_9862> (C[C@H]1CN(Cc2ccc(F)cc2)CCN1.Cl.Cl) is C12H19Cl2FN2.
Describe the ring structures in building block <BB_9862>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9862>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9862>.
**Token:** <BB_9862> **SMILES:** C[C@H]1CN(Cc2ccc(F)cc2)CCN1.Cl.Cl **Molecular Formula:** C12H19Cl2FN2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9863>.
O=C(O)c1cc(C(F)(F)F)ccn1
What is the building block token for the following molecule?
O=C(O)c1cc(C(F)(F)F)ccn1
<BB_9863>
What is the molecular formula for <BB_9863>?
The molecular formula for <BB_9863> (O=C(O)c1cc(C(F)(F)F)ccn1) is C7H4F3NO2.
Describe the ring structures in building block <BB_9863>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9863>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9863>.
**Token:** <BB_9863> **SMILES:** O=C(O)c1cc(C(F)(F)F)ccn1 **Molecular Formula:** C7H4F3NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9864>.
Cc1ccc(N)cc1NC(=O)CCN(C)C
What is the building block token for the following molecule?
Cc1ccc(N)cc1NC(=O)CCN(C)C
<BB_9864>
What is the molecular formula for <BB_9864>?
The molecular formula for <BB_9864> (Cc1ccc(N)cc1NC(=O)CCN(C)C) is C12H19N3O.
Describe the ring structures in building block <BB_9864>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9864>.
The molecule contains the following groups: Amine, Tertiary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_9864>.
**Token:** <BB_9864> **SMILES:** Cc1ccc(N)cc1NC(=O)CCN(C)C **Molecular Formula:** C12H19N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Amide
Provide the SMILES representation for the building block token <BB_9865>.
Cl.O=C(O)CC1COc2ccccc2N1
What is the building block token for the following molecule?
Cl.O=C(O)CC1COc2ccccc2N1
<BB_9865>
What is the molecular formula for <BB_9865>?
The molecular formula for <BB_9865> (Cl.O=C(O)CC1COc2ccccc2N1) is C10H12ClNO3.
Describe the ring structures in building block <BB_9865>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9865>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9865>.
**Token:** <BB_9865> **SMILES:** Cl.O=C(O)CC1COc2ccccc2N1 **Molecular Formula:** C10H12ClNO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9866>.
CCCC(CCC)c1ccc(O)cc1
What is the building block token for the following molecule?
CCCC(CCC)c1ccc(O)cc1
<BB_9866>
What is the molecular formula for <BB_9866>?
The molecular formula for <BB_9866> (CCCC(CCC)c1ccc(O)cc1) is C13H20O.
Describe the ring structures in building block <BB_9866>.
The molecule contains 1 ring(s): an aromatic ring of size 6.