instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_9866>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9866>.
**Token:** <BB_9866> **SMILES:** CCCC(CCC)c1ccc(O)cc1 **Molecular Formula:** C13H20O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9867>.
N#Cc1cc(F)ccc1N1CCOCC1
What is the building block token for the following molecule?
N#Cc1cc(F)ccc1N1CCOCC1
<BB_9867>
What is the molecular formula for <BB_9867>?
The molecular formula for <BB_9867> (N#Cc1cc(F)ccc1N1CCOCC1) is C11H11FN2O.
Describe the ring structures in building block <BB_9867>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9867>.
The molecule contains the following groups: Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9867>.
**Token:** <BB_9867> **SMILES:** N#Cc1cc(F)ccc1N1CCOCC1 **Molecular Formula:** C11H11FN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9868>.
CC1CNC(=Nc2cnc3ccccc3c2)S1
What is the building block token for the following molecule?
CC1CNC(=Nc2cnc3ccccc3c2)S1
<BB_9868>
What is the molecular formula for <BB_9868>?
The molecular formula for <BB_9868> (CC1CNC(=Nc2cnc3ccccc3c2)S1) is C13H13N3S.
Describe the ring structures in building block <BB_9868>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9868>.
The molecule contains the following groups: Secondary Amine, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_9868>.
**Token:** <BB_9868> **SMILES:** CC1CNC(=Nc2cnc3ccccc3c2)S1 **Molecular Formula:** C13H13N3S **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Sulfide
Provide the SMILES representation for the building block token <BB_9869>.
COc1cnc(CCl)cn1
What is the building block token for the following molecule?
COc1cnc(CCl)cn1
<BB_9869>
What is the molecular formula for <BB_9869>?
The molecular formula for <BB_9869> (COc1cnc(CCl)cn1) is C6H7ClN2O.
Describe the ring structures in building block <BB_9869>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9869>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9869>.
**Token:** <BB_9869> **SMILES:** COc1cnc(CCl)cn1 **Molecular Formula:** C6H7ClN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9870>.
CCC(N)c1cccc(OC)c1OC
What is the building block token for the following molecule?
CCC(N)c1cccc(OC)c1OC
<BB_9870>
What is the molecular formula for <BB_9870>?
The molecular formula for <BB_9870> (CCC(N)c1cccc(OC)c1OC) is C11H17NO2.
Describe the ring structures in building block <BB_9870>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9870>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9870>.
**Token:** <BB_9870> **SMILES:** CCC(N)c1cccc(OC)c1OC **Molecular Formula:** C11H17NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_9871>.
CC(Cl)c1cccc([N+](=O)[O-])c1
What is the building block token for the following molecule?
CC(Cl)c1cccc([N+](=O)[O-])c1
<BB_9871>
What is the molecular formula for <BB_9871>?
The molecular formula for <BB_9871> (CC(Cl)c1cccc([N+](=O)[O-])c1) is C8H8ClNO2.
Describe the ring structures in building block <BB_9871>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9871>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_9871>.
**Token:** <BB_9871> **SMILES:** CC(Cl)c1cccc([N+](=O)[O-])c1 **Molecular Formula:** C8H8ClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_9872>.
COc1ccc2c(CC(=O)O)coc2c1C
What is the building block token for the following molecule?
COc1ccc2c(CC(=O)O)coc2c1C
<BB_9872>
What is the molecular formula for <BB_9872>?
The molecular formula for <BB_9872> (COc1ccc2c(CC(=O)O)coc2c1C) is C12H12O4.
Describe the ring structures in building block <BB_9872>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9872>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_9872>.
**Token:** <BB_9872> **SMILES:** COc1ccc2c(CC(=O)O)coc2c1C **Molecular Formula:** C12H12O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_9873>.
NC1(CNS(=O)(=O)c2cc[nH]c2)CCCCC1
What is the building block token for the following molecule?
NC1(CNS(=O)(=O)c2cc[nH]c2)CCCCC1
<BB_9873>
What is the molecular formula for <BB_9873>?
The molecular formula for <BB_9873> (NC1(CNS(=O)(=O)c2cc[nH]c2)CCCCC1) is C11H19N3O2S.
Describe the ring structures in building block <BB_9873>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9873>.
The molecule contains the following groups: Amine, Secondary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9873>.
**Token:** <BB_9873> **SMILES:** NC1(CNS(=O)(=O)c2cc[nH]c2)CCCCC1 **Molecular Formula:** C11H19N3O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_9874>.
CN(C)CCS(N)(=O)=O
What is the building block token for the following molecule?
CN(C)CCS(N)(=O)=O
<BB_9874>
What is the molecular formula for <BB_9874>?
The molecular formula for <BB_9874> (CN(C)CCS(N)(=O)=O) is C4H12N2O2S.
Describe the ring structures in building block <BB_9874>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9874>.
The molecule contains the following groups: Amine, Tertiary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9874>.
**Token:** <BB_9874> **SMILES:** CN(C)CCS(N)(=O)=O **Molecular Formula:** C4H12N2O2S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Tertiary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_9875>.
O=C([O-])c1nnc(C(F)(F)F)s1.[Li+]
What is the building block token for the following molecule?
O=C([O-])c1nnc(C(F)(F)F)s1.[Li+]
<BB_9875>
What is the molecular formula for <BB_9875>?
The molecular formula for <BB_9875> (O=C([O-])c1nnc(C(F)(F)F)s1.[Li+]) is C4F3LiN2O2S.
Describe the ring structures in building block <BB_9875>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9875>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9875>.
**Token:** <BB_9875> **SMILES:** O=C([O-])c1nnc(C(F)(F)F)s1.[Li+] **Molecular Formula:** C4F3LiN2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9876>.
NCCCOCCCOCc1ccccc1
What is the building block token for the following molecule?
NCCCOCCCOCc1ccccc1
<BB_9876>
What is the molecular formula for <BB_9876>?
The molecular formula for <BB_9876> (NCCCOCCCOCc1ccccc1) is C13H21NO2.
Describe the ring structures in building block <BB_9876>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9876>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9876>.
**Token:** <BB_9876> **SMILES:** NCCCOCCCOCc1ccccc1 **Molecular Formula:** C13H21NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_9877>.
O=C(NCCc1ccccc1)c1ccccc1
What is the building block token for the following molecule?
O=C(NCCc1ccccc1)c1ccccc1
<BB_9877>
What is the molecular formula for <BB_9877>?
The molecular formula for <BB_9877> (O=C(NCCc1ccccc1)c1ccccc1) is C15H15NO.
Describe the ring structures in building block <BB_9877>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9877>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_9877>.
**Token:** <BB_9877> **SMILES:** O=C(NCCc1ccccc1)c1ccccc1 **Molecular Formula:** C15H15NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_9878>.
C=C(CC)CN1CCSC(C)(C)C1
What is the building block token for the following molecule?
C=C(CC)CN1CCSC(C)(C)C1
<BB_9878>
What is the molecular formula for <BB_9878>?
The molecular formula for <BB_9878> (C=C(CC)CN1CCSC(C)(C)C1) is C11H21NS.
Describe the ring structures in building block <BB_9878>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9878>.
The molecule contains the following groups: Tertiary Amine, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_9878>.
**Token:** <BB_9878> **SMILES:** C=C(CC)CN1CCSC(C)(C)C1 **Molecular Formula:** C11H21NS **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Sulfide
Provide the SMILES representation for the building block token <BB_9879>.
CC(C)c1ncccc1B(O)O
What is the building block token for the following molecule?
CC(C)c1ncccc1B(O)O
<BB_9879>
What is the molecular formula for <BB_9879>?
The molecular formula for <BB_9879> (CC(C)c1ncccc1B(O)O) is C8H12BNO2.
Describe the ring structures in building block <BB_9879>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9879>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9879>.
**Token:** <BB_9879> **SMILES:** CC(C)c1ncccc1B(O)O **Molecular Formula:** C8H12BNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9880>.
CC(C)c1noc(N)n1
What is the building block token for the following molecule?
CC(C)c1noc(N)n1
<BB_9880>
What is the molecular formula for <BB_9880>?
The molecular formula for <BB_9880> (CC(C)c1noc(N)n1) is C5H9N3O.
Describe the ring structures in building block <BB_9880>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9880>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9880>.
**Token:** <BB_9880> **SMILES:** CC(C)c1noc(N)n1 **Molecular Formula:** C5H9N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9881>.
CCn1cc(COc2ccc(N)cc2)c(C)n1
What is the building block token for the following molecule?
CCn1cc(COc2ccc(N)cc2)c(C)n1
<BB_9881>
What is the molecular formula for <BB_9881>?
The molecular formula for <BB_9881> (CCn1cc(COc2ccc(N)cc2)c(C)n1) is C13H17N3O.
Describe the ring structures in building block <BB_9881>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9881>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9881>.
**Token:** <BB_9881> **SMILES:** CCn1cc(COc2ccc(N)cc2)c(C)n1 **Molecular Formula:** C13H17N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_9882>.
Clc1nc(N2CCOCC2)c2ccsc2n1
What is the building block token for the following molecule?
Clc1nc(N2CCOCC2)c2ccsc2n1
<BB_9882>
What is the molecular formula for <BB_9882>?
The molecular formula for <BB_9882> (Clc1nc(N2CCOCC2)c2ccsc2n1) is C10H10ClN3OS.
Describe the ring structures in building block <BB_9882>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9882>.
The molecule contains the following groups: Tertiary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9882>.
**Token:** <BB_9882> **SMILES:** Clc1nc(N2CCOCC2)c2ccsc2n1 **Molecular Formula:** C10H10ClN3OS **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Tertiary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9883>.
CC1(C)OC2(CO)CCC1C2
What is the building block token for the following molecule?
CC1(C)OC2(CO)CCC1C2
<BB_9883>