instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_9883>?
The molecular formula for <BB_9883> (CC1(C)OC2(CO)CCC1C2) is C9H16O2.
Describe the ring structures in building block <BB_9883>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9883>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_9883>.
**Token:** <BB_9883> **SMILES:** CC1(C)OC2(CO)CCC1C2 **Molecular Formula:** C9H16O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_9884>.
CCCC(=O)c1ccccc1
What is the building block token for the following molecule?
CCCC(=O)c1ccccc1
<BB_9884>
What is the molecular formula for <BB_9884>?
The molecular formula for <BB_9884> (CCCC(=O)c1ccccc1) is C10H12O.
Describe the ring structures in building block <BB_9884>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9884>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_9884>.
**Token:** <BB_9884> **SMILES:** CCCC(=O)c1ccccc1 **Molecular Formula:** C10H12O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_9885>.
C=CCC(C)CO
What is the building block token for the following molecule?
C=CCC(C)CO
<BB_9885>
What is the molecular formula for <BB_9885>?
The molecular formula for <BB_9885> (C=CCC(C)CO) is C6H12O.
Describe the ring structures in building block <BB_9885>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9885>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9885>.
**Token:** <BB_9885> **SMILES:** C=CCC(C)CO **Molecular Formula:** C6H12O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_9886>.
C#CC(=O)N1CCS(=O)(=O)CC1
What is the building block token for the following molecule?
C#CC(=O)N1CCS(=O)(=O)CC1
<BB_9886>
What is the molecular formula for <BB_9886>?
The molecular formula for <BB_9886> (C#CC(=O)N1CCS(=O)(=O)CC1) is C7H9NO3S.
Describe the ring structures in building block <BB_9886>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9886>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_9886>.
**Token:** <BB_9886> **SMILES:** C#CC(=O)N1CCS(=O)(=O)CC1 **Molecular Formula:** C7H9NO3S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_9887>.
Cc1ccc(/C=C/S(=O)(=O)Cl)cc1
What is the building block token for the following molecule?
Cc1ccc(/C=C/S(=O)(=O)Cl)cc1
<BB_9887>
What is the molecular formula for <BB_9887>?
The molecular formula for <BB_9887> (Cc1ccc(/C=C/S(=O)(=O)Cl)cc1) is C9H9ClO2S.
Describe the ring structures in building block <BB_9887>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9887>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9887>.
**Token:** <BB_9887> **SMILES:** Cc1ccc(/C=C/S(=O)(=O)Cl)cc1 **Molecular Formula:** C9H9ClO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9888>.
FC(F)(F)Cc1cc(Br)cc(Br)c1
What is the building block token for the following molecule?
FC(F)(F)Cc1cc(Br)cc(Br)c1
<BB_9888>
What is the molecular formula for <BB_9888>?
The molecular formula for <BB_9888> (FC(F)(F)Cc1cc(Br)cc(Br)c1) is C8H5Br2F3.
Describe the ring structures in building block <BB_9888>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9888>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9888>.
**Token:** <BB_9888> **SMILES:** FC(F)(F)Cc1cc(Br)cc(Br)c1 **Molecular Formula:** C8H5Br2F3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9889>.
CC(C)(C)Oc1cccc(S(=O)(=O)Cl)n1
What is the building block token for the following molecule?
CC(C)(C)Oc1cccc(S(=O)(=O)Cl)n1
<BB_9889>
What is the molecular formula for <BB_9889>?
The molecular formula for <BB_9889> (CC(C)(C)Oc1cccc(S(=O)(=O)Cl)n1) is C9H12ClNO3S.
Describe the ring structures in building block <BB_9889>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9889>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9889>.
**Token:** <BB_9889> **SMILES:** CC(C)(C)Oc1cccc(S(=O)(=O)Cl)n1 **Molecular Formula:** C9H12ClNO3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9890>.
Cl.Cl.O=C(NCc1cccnc1)C1CCNCC1
What is the building block token for the following molecule?
Cl.Cl.O=C(NCc1cccnc1)C1CCNCC1
<BB_9890>
What is the molecular formula for <BB_9890>?
The molecular formula for <BB_9890> (Cl.Cl.O=C(NCc1cccnc1)C1CCNCC1) is C12H19Cl2N3O.
Describe the ring structures in building block <BB_9890>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9890>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9890>.
**Token:** <BB_9890> **SMILES:** Cl.Cl.O=C(NCc1cccnc1)C1CCNCC1 **Molecular Formula:** C12H19Cl2N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9891>.
CC(C)(C(=O)O)C(F)F
What is the building block token for the following molecule?
CC(C)(C(=O)O)C(F)F
<BB_9891>
What is the molecular formula for <BB_9891>?
The molecular formula for <BB_9891> (CC(C)(C(=O)O)C(F)F) is C5H8F2O2.
Describe the ring structures in building block <BB_9891>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9891>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9891>.
**Token:** <BB_9891> **SMILES:** CC(C)(C(=O)O)C(F)F **Molecular Formula:** C5H8F2O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9892>.
O=S(=O)(Cl)c1ccc(S(=O)(=O)CF)cc1
What is the building block token for the following molecule?
O=S(=O)(Cl)c1ccc(S(=O)(=O)CF)cc1
<BB_9892>
What is the molecular formula for <BB_9892>?
The molecular formula for <BB_9892> (O=S(=O)(Cl)c1ccc(S(=O)(=O)CF)cc1) is C7H6ClFO4S2.
Describe the ring structures in building block <BB_9892>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9892>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9892>.
**Token:** <BB_9892> **SMILES:** O=S(=O)(Cl)c1ccc(S(=O)(=O)CF)cc1 **Molecular Formula:** C7H6ClFO4S2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9893>.
C=CC(=O)Nc1ccc(N(C)C)cc1
What is the building block token for the following molecule?
C=CC(=O)Nc1ccc(N(C)C)cc1
<BB_9893>
What is the molecular formula for <BB_9893>?
The molecular formula for <BB_9893> (C=CC(=O)Nc1ccc(N(C)C)cc1) is C11H14N2O.
Describe the ring structures in building block <BB_9893>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9893>.
The molecule contains the following groups: Tertiary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_9893>.
**Token:** <BB_9893> **SMILES:** C=CC(=O)Nc1ccc(N(C)C)cc1 **Molecular Formula:** C11H14N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide
Provide the SMILES representation for the building block token <BB_9894>.
CC(C)(C)c1ccc(NC(N)=S)cc1
What is the building block token for the following molecule?
CC(C)(C)c1ccc(NC(N)=S)cc1
<BB_9894>
What is the molecular formula for <BB_9894>?
The molecular formula for <BB_9894> (CC(C)(C)c1ccc(NC(N)=S)cc1) is C11H16N2S.
Describe the ring structures in building block <BB_9894>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9894>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_9894>.
**Token:** <BB_9894> **SMILES:** CC(C)(C)c1ccc(NC(N)=S)cc1 **Molecular Formula:** C11H16N2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_9895>.
O=C(O)C1(C(=O)NC2CC2)CCC1
What is the building block token for the following molecule?
O=C(O)C1(C(=O)NC2CC2)CCC1
<BB_9895>
What is the molecular formula for <BB_9895>?
The molecular formula for <BB_9895> (O=C(O)C1(C(=O)NC2CC2)CCC1) is C9H13NO3.
Describe the ring structures in building block <BB_9895>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 4.
List the primary functional groups present in <BB_9895>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_9895>.
**Token:** <BB_9895> **SMILES:** O=C(O)C1(C(=O)NC2CC2)CCC1 **Molecular Formula:** C9H13NO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_9896>.
Clc1cc(NCc2ccccc2)ccn1
What is the building block token for the following molecule?
Clc1cc(NCc2ccccc2)ccn1
<BB_9896>
What is the molecular formula for <BB_9896>?
The molecular formula for <BB_9896> (Clc1cc(NCc2ccccc2)ccn1) is C12H11ClN2.
Describe the ring structures in building block <BB_9896>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9896>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9896>.
**Token:** <BB_9896> **SMILES:** Clc1cc(NCc2ccccc2)ccn1 **Molecular Formula:** C12H11ClN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9897>.
CCC(N)Cc1ccc(F)cc1.Cl
What is the building block token for the following molecule?
CCC(N)Cc1ccc(F)cc1.Cl
<BB_9897>
What is the molecular formula for <BB_9897>?
The molecular formula for <BB_9897> (CCC(N)Cc1ccc(F)cc1.Cl) is C10H15ClFN.
Describe the ring structures in building block <BB_9897>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9897>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9897>.
**Token:** <BB_9897> **SMILES:** CCC(N)Cc1ccc(F)cc1.Cl **Molecular Formula:** C10H15ClFN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9898>.
Oc1cnn[nH]1
What is the building block token for the following molecule?
Oc1cnn[nH]1
<BB_9898>
What is the molecular formula for <BB_9898>?
The molecular formula for <BB_9898> (Oc1cnn[nH]1) is C2H3N3O.
Describe the ring structures in building block <BB_9898>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9898>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9898>.
**Token:** <BB_9898> **SMILES:** Oc1cnn[nH]1 **Molecular Formula:** C2H3N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9899>.
c1ccc2c(c1)CCCC2C1CO1
What is the building block token for the following molecule?
c1ccc2c(c1)CCCC2C1CO1
<BB_9899>
What is the molecular formula for <BB_9899>?
The molecular formula for <BB_9899> (c1ccc2c(c1)CCCC2C1CO1) is C12H14O.
Describe the ring structures in building block <BB_9899>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9899>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_9899>.
**Token:** <BB_9899> **SMILES:** c1ccc2c(c1)CCCC2C1CO1 **Molecular Formula:** C12H14O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Ether