instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_9933>?
The molecular formula for <BB_9933> (COC(=O)/C=C/c1ccc(Cl)s1) is C8H7ClO2S.
Describe the ring structures in building block <BB_9933>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9933>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9933>.
**Token:** <BB_9933> **SMILES:** COC(=O)/C=C/c1ccc(Cl)s1 **Molecular Formula:** C8H7ClO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9934>.
CC(=O)C1CO1
What is the building block token for the following molecule?
CC(=O)C1CO1
<BB_9934>
What is the molecular formula for <BB_9934>?
The molecular formula for <BB_9934> (CC(=O)C1CO1) is C4H6O2.
Describe the ring structures in building block <BB_9934>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9934>.
The molecule contains the following groups: Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_9934>.
**Token:** <BB_9934> **SMILES:** CC(=O)C1CO1 **Molecular Formula:** C4H6O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Ketone, Ether
Provide the SMILES representation for the building block token <BB_9935>.
CCOC(=O)C(C(=O)C(F)(F)F)C(F)(F)F
What is the building block token for the following molecule?
CCOC(=O)C(C(=O)C(F)(F)F)C(F)(F)F
<BB_9935>
What is the molecular formula for <BB_9935>?
The molecular formula for <BB_9935> (CCOC(=O)C(C(=O)C(F)(F)F)C(F)(F)F) is C7H6F6O3.
Describe the ring structures in building block <BB_9935>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9935>.
The molecule contains the following groups: Ester, Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9935>.
**Token:** <BB_9935> **SMILES:** CCOC(=O)C(C(=O)C(F)(F)F)C(F)(F)F **Molecular Formula:** C7H6F6O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9936>.
C[C@@H](O)[C@@H](N)CO
What is the building block token for the following molecule?
C[C@@H](O)[C@@H](N)CO
<BB_9936>
What is the molecular formula for <BB_9936>?
The molecular formula for <BB_9936> (C[C@@H](O)[C@@H](N)CO) is C4H11NO2.
Describe the ring structures in building block <BB_9936>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9936>.
The molecule contains the following groups: Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9936>.
**Token:** <BB_9936> **SMILES:** C[C@@H](O)[C@@H](N)CO **Molecular Formula:** C4H11NO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Alcohol
Provide the SMILES representation for the building block token <BB_9937>.
Cl.N#Cc1ccccc1Cc1cnc(N)s1
What is the building block token for the following molecule?
Cl.N#Cc1ccccc1Cc1cnc(N)s1
<BB_9937>
What is the molecular formula for <BB_9937>?
The molecular formula for <BB_9937> (Cl.N#Cc1ccccc1Cc1cnc(N)s1) is C11H10ClN3S.
Describe the ring structures in building block <BB_9937>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9937>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9937>.
**Token:** <BB_9937> **SMILES:** Cl.N#Cc1ccccc1Cc1cnc(N)s1 **Molecular Formula:** C11H10ClN3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9938>.
CN1C(=O)c2ccc(S(N)(=O)=O)cc2C1=O
What is the building block token for the following molecule?
CN1C(=O)c2ccc(S(N)(=O)=O)cc2C1=O
<BB_9938>
What is the molecular formula for <BB_9938>?
The molecular formula for <BB_9938> (CN1C(=O)c2ccc(S(N)(=O)=O)cc2C1=O) is C9H8N2O4S.
Describe the ring structures in building block <BB_9938>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9938>.
The molecule contains the following groups: Amine, Amide, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9938>.
**Token:** <BB_9938> **SMILES:** CN1C(=O)c2ccc(S(N)(=O)=O)cc2C1=O **Molecular Formula:** C9H8N2O4S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Sulfonamide
Provide the SMILES representation for the building block token <BB_9939>.
FC(F)(F)c1ccc(Br)cc1-c1nnn[nH]1
What is the building block token for the following molecule?
FC(F)(F)c1ccc(Br)cc1-c1nnn[nH]1
<BB_9939>
What is the molecular formula for <BB_9939>?
The molecular formula for <BB_9939> (FC(F)(F)c1ccc(Br)cc1-c1nnn[nH]1) is C8H4BrF3N4.
Describe the ring structures in building block <BB_9939>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9939>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9939>.
**Token:** <BB_9939> **SMILES:** FC(F)(F)c1ccc(Br)cc1-c1nnn[nH]1 **Molecular Formula:** C8H4BrF3N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9940>.
CCOC(CN)(OCC)c1ccccn1
What is the building block token for the following molecule?
CCOC(CN)(OCC)c1ccccn1
<BB_9940>
What is the molecular formula for <BB_9940>?
The molecular formula for <BB_9940> (CCOC(CN)(OCC)c1ccccn1) is C11H18N2O2.
Describe the ring structures in building block <BB_9940>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9940>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9940>.
**Token:** <BB_9940> **SMILES:** CCOC(CN)(OCC)c1ccccn1 **Molecular Formula:** C11H18N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_9941>.
CC(F)(F)c1cccnc1N
What is the building block token for the following molecule?
CC(F)(F)c1cccnc1N
<BB_9941>
What is the molecular formula for <BB_9941>?
The molecular formula for <BB_9941> (CC(F)(F)c1cccnc1N) is C7H8F2N2.
Describe the ring structures in building block <BB_9941>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9941>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9941>.
**Token:** <BB_9941> **SMILES:** CC(F)(F)c1cccnc1N **Molecular Formula:** C7H8F2N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9942>.
CNCc1ncnn1C.Cl
What is the building block token for the following molecule?
CNCc1ncnn1C.Cl
<BB_9942>
What is the molecular formula for <BB_9942>?
The molecular formula for <BB_9942> (CNCc1ncnn1C.Cl) is C5H11ClN4.
Describe the ring structures in building block <BB_9942>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9942>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9942>.
**Token:** <BB_9942> **SMILES:** CNCc1ncnn1C.Cl **Molecular Formula:** C5H11ClN4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9943>.
Cc1cc(C)cc(Oc2nn(C)cc2N)c1
What is the building block token for the following molecule?
Cc1cc(C)cc(Oc2nn(C)cc2N)c1
<BB_9943>
What is the molecular formula for <BB_9943>?
The molecular formula for <BB_9943> (Cc1cc(C)cc(Oc2nn(C)cc2N)c1) is C12H15N3O.
Describe the ring structures in building block <BB_9943>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9943>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9943>.
**Token:** <BB_9943> **SMILES:** Cc1cc(C)cc(Oc2nn(C)cc2N)c1 **Molecular Formula:** C12H15N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_9944>.
NNc1cccc(F)c1[N+](=O)[O-]
What is the building block token for the following molecule?
NNc1cccc(F)c1[N+](=O)[O-]
<BB_9944>
What is the molecular formula for <BB_9944>?
The molecular formula for <BB_9944> (NNc1cccc(F)c1[N+](=O)[O-]) is C6H6FN3O2.
Describe the ring structures in building block <BB_9944>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9944>.
The molecule contains the following groups: Amine, Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_9944>.
**Token:** <BB_9944> **SMILES:** NNc1cccc(F)c1[N+](=O)[O-] **Molecular Formula:** C6H6FN3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_9945>.
CN(C)C(=O)COc1ccc(N)cc1
What is the building block token for the following molecule?
CN(C)C(=O)COc1ccc(N)cc1
<BB_9945>
What is the molecular formula for <BB_9945>?
The molecular formula for <BB_9945> (CN(C)C(=O)COc1ccc(N)cc1) is C10H14N2O2.
Describe the ring structures in building block <BB_9945>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9945>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9945>.
**Token:** <BB_9945> **SMILES:** CN(C)C(=O)COc1ccc(N)cc1 **Molecular Formula:** C10H14N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_9946>.
CC1(c2ccc(N)cc2)CC(=O)NC1=O.Cl
What is the building block token for the following molecule?
CC1(c2ccc(N)cc2)CC(=O)NC1=O.Cl
<BB_9946>
What is the molecular formula for <BB_9946>?
The molecular formula for <BB_9946> (CC1(c2ccc(N)cc2)CC(=O)NC1=O.Cl) is C11H13ClN2O2.
Describe the ring structures in building block <BB_9946>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9946>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9946>.
**Token:** <BB_9946> **SMILES:** CC1(c2ccc(N)cc2)CC(=O)NC1=O.Cl **Molecular Formula:** C11H13ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9947>.
[N-]=[N+]=Nc1ccc2ncccc2c1
What is the building block token for the following molecule?
[N-]=[N+]=Nc1ccc2ncccc2c1
<BB_9947>
What is the molecular formula for <BB_9947>?
The molecular formula for <BB_9947> ([N-]=[N+]=Nc1ccc2ncccc2c1) is C9H6N4.
Describe the ring structures in building block <BB_9947>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9947>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9947>.
**Token:** <BB_9947> **SMILES:** [N-]=[N+]=Nc1ccc2ncccc2c1 **Molecular Formula:** C9H6N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9948>.
CP(C)(=O)c1ccccc1F
What is the building block token for the following molecule?
CP(C)(=O)c1ccccc1F
<BB_9948>
What is the molecular formula for <BB_9948>?
The molecular formula for <BB_9948> (CP(C)(=O)c1ccccc1F) is C8H10FOP.
Describe the ring structures in building block <BB_9948>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9948>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9948>.
**Token:** <BB_9948> **SMILES:** CP(C)(=O)c1ccccc1F **Molecular Formula:** C8H10FOP **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9949>.
COc1ccc(Cl)cc1Cl
What is the building block token for the following molecule?
COc1ccc(Cl)cc1Cl
<BB_9949>
What is the molecular formula for <BB_9949>?
The molecular formula for <BB_9949> (COc1ccc(Cl)cc1Cl) is C7H6Cl2O.
Describe the ring structures in building block <BB_9949>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9949>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9949>.
**Token:** <BB_9949> **SMILES:** COc1ccc(Cl)cc1Cl **Molecular Formula:** C7H6Cl2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)