instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_9900>.
CC(C)(C)OC(=O)NC[C@H]1N[C@@H]2CC[C@H]1C2.Cl
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC[C@H]1N[C@@H]2CC[C@H]1C2.Cl
<BB_9900>
What is the molecular formula for <BB_9900>?
The molecular formula for <BB_9900> (CC(C)(C)OC(=O)NC[C@H]1N[C@@H]2CC[C@H]1C2.Cl) is C12H23ClN2O2.
Describe the ring structures in building block <BB_9900>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9900>.
The molecule contains the following groups: Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9900>.
**Token:** <BB_9900> **SMILES:** CC(C)(C)OC(=O)NC[C@H]1N[C@@H]2CC[C@H]1C2.Cl **Molecular Formula:** C12H23ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9901>.
CC(F)(F)Cn1ccc(C(=O)O)n1
What is the building block token for the following molecule?
CC(F)(F)Cn1ccc(C(=O)O)n1
<BB_9901>
What is the molecular formula for <BB_9901>?
The molecular formula for <BB_9901> (CC(F)(F)Cn1ccc(C(=O)O)n1) is C7H8F2N2O2.
Describe the ring structures in building block <BB_9901>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9901>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9901>.
**Token:** <BB_9901> **SMILES:** CC(F)(F)Cn1ccc(C(=O)O)n1 **Molecular Formula:** C7H8F2N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9902>.
CC(=O)N1CCN(N=O)CC1
What is the building block token for the following molecule?
CC(=O)N1CCN(N=O)CC1
<BB_9902>
What is the molecular formula for <BB_9902>?
The molecular formula for <BB_9902> (CC(=O)N1CCN(N=O)CC1) is C6H11N3O2.
Describe the ring structures in building block <BB_9902>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9902>.
The molecule contains the following groups: Tertiary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_9902>.
**Token:** <BB_9902> **SMILES:** CC(=O)N1CCN(N=O)CC1 **Molecular Formula:** C6H11N3O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide
Provide the SMILES representation for the building block token <BB_9903>.
CC(C)(C)OC(=O)N1C(CC(=O)O)[C@H]2CCCC[C@H]21
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1C(CC(=O)O)[C@H]2CCCC[C@H]21
<BB_9903>
What is the molecular formula for <BB_9903>?
The molecular formula for <BB_9903> (CC(C)(C)OC(=O)N1C(CC(=O)O)[C@H]2CCCC[C@H]21) is C14H23NO4.
Describe the ring structures in building block <BB_9903>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9903>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9903>.
**Token:** <BB_9903> **SMILES:** CC(C)(C)OC(=O)N1C(CC(=O)O)[C@H]2CCCC[C@H]21 **Molecular Formula:** C14H23NO4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_9904>.
CCOc1ccc(OCCN)cc1.Cl
What is the building block token for the following molecule?
CCOc1ccc(OCCN)cc1.Cl
<BB_9904>
What is the molecular formula for <BB_9904>?
The molecular formula for <BB_9904> (CCOc1ccc(OCCN)cc1.Cl) is C10H16ClNO2.
Describe the ring structures in building block <BB_9904>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9904>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9904>.
**Token:** <BB_9904> **SMILES:** CCOc1ccc(OCCN)cc1.Cl **Molecular Formula:** C10H16ClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9905>.
O=Cc1cc(O)c2ccsc2c1
What is the building block token for the following molecule?
O=Cc1cc(O)c2ccsc2c1
<BB_9905>
What is the molecular formula for <BB_9905>?
The molecular formula for <BB_9905> (O=Cc1cc(O)c2ccsc2c1) is C9H6O2S.
Describe the ring structures in building block <BB_9905>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9905>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_9905>.
**Token:** <BB_9905> **SMILES:** O=Cc1cc(O)c2ccsc2c1 **Molecular Formula:** C9H6O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_9906>.
Nc1cc(-c2c(Cl)cccc2Cl)on1
What is the building block token for the following molecule?
Nc1cc(-c2c(Cl)cccc2Cl)on1
<BB_9906>
What is the molecular formula for <BB_9906>?
The molecular formula for <BB_9906> (Nc1cc(-c2c(Cl)cccc2Cl)on1) is C9H6Cl2N2O.
Describe the ring structures in building block <BB_9906>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9906>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9906>.
**Token:** <BB_9906> **SMILES:** Nc1cc(-c2c(Cl)cccc2Cl)on1 **Molecular Formula:** C9H6Cl2N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9907>.
CC(N)(C#N)C1CCCCC1
What is the building block token for the following molecule?
CC(N)(C#N)C1CCCCC1
<BB_9907>
What is the molecular formula for <BB_9907>?
The molecular formula for <BB_9907> (CC(N)(C#N)C1CCCCC1) is C9H16N2.
Describe the ring structures in building block <BB_9907>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9907>.
The molecule contains the following groups: Amine, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9907>.
**Token:** <BB_9907> **SMILES:** CC(N)(C#N)C1CCCCC1 **Molecular Formula:** C9H16N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Nitrile
Provide the SMILES representation for the building block token <BB_9908>.
COC(=O)c1csc(C=O)n1
What is the building block token for the following molecule?
COC(=O)c1csc(C=O)n1
<BB_9908>
What is the molecular formula for <BB_9908>?
The molecular formula for <BB_9908> (COC(=O)c1csc(C=O)n1) is C6H5NO3S.
Describe the ring structures in building block <BB_9908>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9908>.
The molecule contains the following groups: Ester, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_9908>.
**Token:** <BB_9908> **SMILES:** COC(=O)c1csc(C=O)n1 **Molecular Formula:** C6H5NO3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_9909>.
O=Cc1scc(-c2ccc(F)cc2)c1C(=O)O
What is the building block token for the following molecule?
O=Cc1scc(-c2ccc(F)cc2)c1C(=O)O
<BB_9909>
What is the molecular formula for <BB_9909>?
The molecular formula for <BB_9909> (O=Cc1scc(-c2ccc(F)cc2)c1C(=O)O) is C12H7FO3S.
Describe the ring structures in building block <BB_9909>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9909>.
The molecule contains the following groups: Carboxylic Acid, Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9909>.
**Token:** <BB_9909> **SMILES:** O=Cc1scc(-c2ccc(F)cc2)c1C(=O)O **Molecular Formula:** C12H7FO3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9910>.
CCOC(=O)NC1CCNCC1.Cl
What is the building block token for the following molecule?
CCOC(=O)NC1CCNCC1.Cl
<BB_9910>
What is the molecular formula for <BB_9910>?
The molecular formula for <BB_9910> (CCOC(=O)NC1CCNCC1.Cl) is C8H17ClN2O2.
Describe the ring structures in building block <BB_9910>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9910>.
The molecule contains the following groups: Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9910>.
**Token:** <BB_9910> **SMILES:** CCOC(=O)NC1CCNCC1.Cl **Molecular Formula:** C8H17ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9911>.
Cl.Cl.NCc1ncccc1Cl
What is the building block token for the following molecule?
Cl.Cl.NCc1ncccc1Cl
<BB_9911>
What is the molecular formula for <BB_9911>?
The molecular formula for <BB_9911> (Cl.Cl.NCc1ncccc1Cl) is C6H9Cl3N2.
Describe the ring structures in building block <BB_9911>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9911>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9911>.
**Token:** <BB_9911> **SMILES:** Cl.Cl.NCc1ncccc1Cl **Molecular Formula:** C6H9Cl3N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9912>.
O=C(NCCCCC(Br)C(=O)O)c1ccccc1
What is the building block token for the following molecule?
O=C(NCCCCC(Br)C(=O)O)c1ccccc1
<BB_9912>
What is the molecular formula for <BB_9912>?
The molecular formula for <BB_9912> (O=C(NCCCCC(Br)C(=O)O)c1ccccc1) is C13H16BrNO3.
Describe the ring structures in building block <BB_9912>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9912>.
The molecule contains the following groups: Carboxylic Acid, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9912>.
**Token:** <BB_9912> **SMILES:** O=C(NCCCCC(Br)C(=O)O)c1ccccc1 **Molecular Formula:** C13H16BrNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9913>.
O=Cc1cc(O)ccc1Br
What is the building block token for the following molecule?
O=Cc1cc(O)ccc1Br
<BB_9913>
What is the molecular formula for <BB_9913>?
The molecular formula for <BB_9913> (O=Cc1cc(O)ccc1Br) is C7H5BrO2.
Describe the ring structures in building block <BB_9913>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9913>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9913>.
**Token:** <BB_9913> **SMILES:** O=Cc1cc(O)ccc1Br **Molecular Formula:** C7H5BrO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9914>.
CC(C)(C)OC(=O)N1CCC(=O)CCCCC(O)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC(=O)CCCCC(O)C1
<BB_9914>
What is the molecular formula for <BB_9914>?
The molecular formula for <BB_9914> (CC(C)(C)OC(=O)N1CCC(=O)CCCCC(O)C1) is C14H25NO4.
Describe the ring structures in building block <BB_9914>.
The molecule contains 1 ring(s): an aliphatic ring of size 10.
List the primary functional groups present in <BB_9914>.
The molecule contains the following groups: Amide, Ketone, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_9914>.
**Token:** <BB_9914> **SMILES:** CC(C)(C)OC(=O)N1CCC(=O)CCCCC(O)C1 **Molecular Formula:** C14H25NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 10. **Functional Groups:** Amide, Ketone, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_9915>.
C=CCn1c(S)nnc1-c1ccc(Br)cc1
What is the building block token for the following molecule?
C=CCn1c(S)nnc1-c1ccc(Br)cc1
<BB_9915>
What is the molecular formula for <BB_9915>?
The molecular formula for <BB_9915> (C=CCn1c(S)nnc1-c1ccc(Br)cc1) is C11H10BrN3S.
Describe the ring structures in building block <BB_9915>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9915>.
The molecule contains the following groups: Thiol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9915>.
**Token:** <BB_9915> **SMILES:** C=CCn1c(S)nnc1-c1ccc(Br)cc1 **Molecular Formula:** C11H10BrN3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Thiol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9916>.
Oc1cccc(CCc2ccccc2)c1
What is the building block token for the following molecule?
Oc1cccc(CCc2ccccc2)c1
<BB_9916>
What is the molecular formula for <BB_9916>?
The molecular formula for <BB_9916> (Oc1cccc(CCc2ccccc2)c1) is C14H14O.
Describe the ring structures in building block <BB_9916>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.