instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_9916>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9916>.
**Token:** <BB_9916> **SMILES:** Oc1cccc(CCc2ccccc2)c1 **Molecular Formula:** C14H14O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9917>.
ClCc1sc(Cl)cc1Cl
What is the building block token for the following molecule?
ClCc1sc(Cl)cc1Cl
<BB_9917>
What is the molecular formula for <BB_9917>?
The molecular formula for <BB_9917> (ClCc1sc(Cl)cc1Cl) is C5H3Cl3S.
Describe the ring structures in building block <BB_9917>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9917>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9917>.
**Token:** <BB_9917> **SMILES:** ClCc1sc(Cl)cc1Cl **Molecular Formula:** C5H3Cl3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9918>.
Cl.NC1(c2ccccc2F)CC(F)(F)C1
What is the building block token for the following molecule?
Cl.NC1(c2ccccc2F)CC(F)(F)C1
<BB_9918>
What is the molecular formula for <BB_9918>?
The molecular formula for <BB_9918> (Cl.NC1(c2ccccc2F)CC(F)(F)C1) is C10H11ClF3N.
Describe the ring structures in building block <BB_9918>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_9918>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9918>.
**Token:** <BB_9918> **SMILES:** Cl.NC1(c2ccccc2F)CC(F)(F)C1 **Molecular Formula:** C10H11ClF3N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9919>.
O=Cc1cnn(Cc2ccccc2)c1
What is the building block token for the following molecule?
O=Cc1cnn(Cc2ccccc2)c1
<BB_9919>
What is the molecular formula for <BB_9919>?
The molecular formula for <BB_9919> (O=Cc1cnn(Cc2ccccc2)c1) is C11H10N2O.
Describe the ring structures in building block <BB_9919>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9919>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_9919>.
**Token:** <BB_9919> **SMILES:** O=Cc1cnn(Cc2ccccc2)c1 **Molecular Formula:** C11H10N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_9920>.
CC(C)(N)CN1CCCC1
What is the building block token for the following molecule?
CC(C)(N)CN1CCCC1
<BB_9920>
What is the molecular formula for <BB_9920>?
The molecular formula for <BB_9920> (CC(C)(N)CN1CCCC1) is C8H18N2.
Describe the ring structures in building block <BB_9920>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9920>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9920>.
**Token:** <BB_9920> **SMILES:** CC(C)(N)CN1CCCC1 **Molecular Formula:** C8H18N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_9921>.
COC(=O)C1CCCN1C(=O)OC(C)(C)C
What is the building block token for the following molecule?
COC(=O)C1CCCN1C(=O)OC(C)(C)C
<BB_9921>
What is the molecular formula for <BB_9921>?
The molecular formula for <BB_9921> (COC(=O)C1CCCN1C(=O)OC(C)(C)C) is C11H19NO4.
Describe the ring structures in building block <BB_9921>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9921>.
The molecule contains the following groups: Amide, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9921>.
**Token:** <BB_9921> **SMILES:** COC(=O)C1CCCN1C(=O)OC(C)(C)C **Molecular Formula:** C11H19NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Ester, Ether
Provide the SMILES representation for the building block token <BB_9922>.
O=C(O)c1cc(Br)cc(O)n1
What is the building block token for the following molecule?
O=C(O)c1cc(Br)cc(O)n1
<BB_9922>
What is the molecular formula for <BB_9922>?
The molecular formula for <BB_9922> (O=C(O)c1cc(Br)cc(O)n1) is C6H4BrNO3.
Describe the ring structures in building block <BB_9922>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9922>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9922>.
**Token:** <BB_9922> **SMILES:** O=C(O)c1cc(Br)cc(O)n1 **Molecular Formula:** C6H4BrNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9923>.
OC[C@@H]1C[C@@H]1CO
What is the building block token for the following molecule?
OC[C@@H]1C[C@@H]1CO
<BB_9923>
What is the molecular formula for <BB_9923>?
The molecular formula for <BB_9923> (OC[C@@H]1C[C@@H]1CO) is C5H10O2.
Describe the ring structures in building block <BB_9923>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9923>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9923>.
**Token:** <BB_9923> **SMILES:** OC[C@@H]1C[C@@H]1CO **Molecular Formula:** C5H10O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_9924>.
Cl.N[C@H]1COc2ccc(Br)cc21
What is the building block token for the following molecule?
Cl.N[C@H]1COc2ccc(Br)cc21
<BB_9924>
What is the molecular formula for <BB_9924>?
The molecular formula for <BB_9924> (Cl.N[C@H]1COc2ccc(Br)cc21) is C8H9BrClNO.
Describe the ring structures in building block <BB_9924>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9924>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9924>.
**Token:** <BB_9924> **SMILES:** Cl.N[C@H]1COc2ccc(Br)cc21 **Molecular Formula:** C8H9BrClNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9925>.
Cn1ncnc1Cn1cc(Br)cn1
What is the building block token for the following molecule?
Cn1ncnc1Cn1cc(Br)cn1
<BB_9925>
What is the molecular formula for <BB_9925>?
The molecular formula for <BB_9925> (Cn1ncnc1Cn1cc(Br)cn1) is C7H8BrN5.
Describe the ring structures in building block <BB_9925>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_9925>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9925>.
**Token:** <BB_9925> **SMILES:** Cn1ncnc1Cn1cc(Br)cn1 **Molecular Formula:** C7H8BrN5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9926>.
COC(=O)c1ccc(OCCCCN)cc1.Cl
What is the building block token for the following molecule?
COC(=O)c1ccc(OCCCCN)cc1.Cl
<BB_9926>
What is the molecular formula for <BB_9926>?
The molecular formula for <BB_9926> (COC(=O)c1ccc(OCCCCN)cc1.Cl) is C12H18ClNO3.
Describe the ring structures in building block <BB_9926>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9926>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9926>.
**Token:** <BB_9926> **SMILES:** COC(=O)c1ccc(OCCCCN)cc1.Cl **Molecular Formula:** C12H18ClNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9927>.
CCC(CC)(CCCN)C1OCCO1
What is the building block token for the following molecule?
CCC(CC)(CCCN)C1OCCO1
<BB_9927>
What is the molecular formula for <BB_9927>?
The molecular formula for <BB_9927> (CCC(CC)(CCCN)C1OCCO1) is C11H23NO2.
Describe the ring structures in building block <BB_9927>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9927>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9927>.
**Token:** <BB_9927> **SMILES:** CCC(CC)(CCCN)C1OCCO1 **Molecular Formula:** C11H23NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_9928>.
NC1(c2ccc(Br)cn2)CCCC1
What is the building block token for the following molecule?
NC1(c2ccc(Br)cn2)CCCC1
<BB_9928>
What is the molecular formula for <BB_9928>?
The molecular formula for <BB_9928> (NC1(c2ccc(Br)cn2)CCCC1) is C10H13BrN2.
Describe the ring structures in building block <BB_9928>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9928>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9928>.
**Token:** <BB_9928> **SMILES:** NC1(c2ccc(Br)cn2)CCCC1 **Molecular Formula:** C10H13BrN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9929>.
O=C(O)c1c(Cl)cc(Cl)cc1C(F)F
What is the building block token for the following molecule?
O=C(O)c1c(Cl)cc(Cl)cc1C(F)F
<BB_9929>
What is the molecular formula for <BB_9929>?
The molecular formula for <BB_9929> (O=C(O)c1c(Cl)cc(Cl)cc1C(F)F) is C8H4Cl2F2O2.
Describe the ring structures in building block <BB_9929>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9929>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9929>.
**Token:** <BB_9929> **SMILES:** O=C(O)c1c(Cl)cc(Cl)cc1C(F)F **Molecular Formula:** C8H4Cl2F2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9930>.
O=C(O)[C@H]1NC(=O)[C@@H]2CC[C@H]12
What is the building block token for the following molecule?
O=C(O)[C@H]1NC(=O)[C@@H]2CC[C@H]12
<BB_9930>
What is the molecular formula for <BB_9930>?
The molecular formula for <BB_9930> (O=C(O)[C@H]1NC(=O)[C@@H]2CC[C@H]12) is C7H9NO3.
Describe the ring structures in building block <BB_9930>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_9930>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_9930>.
**Token:** <BB_9930> **SMILES:** O=C(O)[C@H]1NC(=O)[C@@H]2CC[C@H]12 **Molecular Formula:** C7H9NO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_9931>.
CC(C)(C)OC(=O)c1cccc(N)c1Br
What is the building block token for the following molecule?
CC(C)(C)OC(=O)c1cccc(N)c1Br
<BB_9931>
What is the molecular formula for <BB_9931>?
The molecular formula for <BB_9931> (CC(C)(C)OC(=O)c1cccc(N)c1Br) is C11H14BrNO2.
Describe the ring structures in building block <BB_9931>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9931>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9931>.
**Token:** <BB_9931> **SMILES:** CC(C)(C)OC(=O)c1cccc(N)c1Br **Molecular Formula:** C11H14BrNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9932>.
NCc1cccc(F)c1Br
What is the building block token for the following molecule?
NCc1cccc(F)c1Br
<BB_9932>
What is the molecular formula for <BB_9932>?
The molecular formula for <BB_9932> (NCc1cccc(F)c1Br) is C7H7BrFN.
Describe the ring structures in building block <BB_9932>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9932>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9932>.
**Token:** <BB_9932> **SMILES:** NCc1cccc(F)c1Br **Molecular Formula:** C7H7BrFN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9933>.
COC(=O)/C=C/c1ccc(Cl)s1
What is the building block token for the following molecule?
COC(=O)/C=C/c1ccc(Cl)s1
<BB_9933>