prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCN(C(=O)NCC(=O)N1CCCC1)[C@@H](C)c1cccc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1=C2OCCN2CC(C(=O)NCC(=O)N2CCCC2)=CC([C@@H](C)c2cccc(OC)c2)=C1 | CCN(C(=O)NCC(=O)N1CCCC1)[C@@H](C)c1cccc(OC)c1 | CCC1=C2OCCN2CC(C(=O)NCC(=O)N2CCCC2)=CC([C@@H](C)c2cccc(OC)c2)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2c&cc&cc2C1",
"old_substring": "N268"
} |
Can you make molecule CCN(C(=O)NCC(=O)N1CCCC1)[C@@H](C)c1cccc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1([C@@H](C)c2cccc(OC)c2)CCN(C(=O)NCC(=O)N2CCCC2)C1 | CCN(C(=O)NCC(=O)N1CCCC1)[C@@H](C)c1cccc(OC)c1 | CCC1([C@@H](C)c2cccc(OC)c2)CCN(C(=O)NCC(=O)N2CCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N268"
} |
Can you make molecule CCN(C(=O)NCC(=O)N1CCCC1)[C@@H](C)c1cccc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1([C@@H](C)c2cccc(OC)c2)CCCN(C(=O)NCC(=O)N2CCCC2)C1 | CCN(C(=O)NCC(=O)N1CCCC1)[C@@H](C)c1cccc(OC)c1 | CCC1([C@@H](C)c2cccc(OC)c2)CCCN(C(=O)NCC(=O)N2CCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N268"
} |
Can you make molecule CCN(C(=O)NCC(=O)N1CCCC1)[C@@H](C)c1cccc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1oc(C(=O)NCC(=O)N2CCCC2)c(C#N)c1[C@@H](C)c1cccc(OC)c1 | CCN(C(=O)NCC(=O)N1CCCC1)[C@@H](C)c1cccc(OC)c1 | CCc1oc(C(=O)NCC(=O)N2CCCC2)c(C#N)c1[C@@H](C)c1cccc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N268"
} |
Can you make molecule CCN(C(=O)NCC(=O)N1CCCC1)[C@@H](C)c1cccc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1([C@@H](C)c2cccc(OC)c2)CCC(=O)N(C(=O)NCC(=O)N2CCCC2)C1 | CCN(C(=O)NCC(=O)N1CCCC1)[C@@H](C)c1cccc(OC)c1 | CCC1([C@@H](C)c2cccc(OC)c2)CCC(=O)N(C(=O)NCC(=O)N2CCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&&CCC1=O",
"old_substring": "N268"
} |
Can you make molecule N#Cc1cccc(COC(=O)c2c[nH]nc2-c2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1cccc(COSC(=O)Cc2c[nH]nc2-c2ccccc2)c1 | N#Cc1cccc(COC(=O)c2c[nH]nc2-c2ccccc2)c1 | N#Cc1cccc(COSC(=O)Cc2c[nH]nc2-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule N#Cc1cccc(COC(=O)c2c[nH]nc2-c2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1cccc(COC(=O)CCCC(=O)c2c[nH]nc2-c2ccccc2)c1 | N#Cc1cccc(COC(=O)c2c[nH]nc2-c2ccccc2)c1 | N#Cc1cccc(COC(=O)CCCC(=O)c2c[nH]nc2-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule N#Cc1cccc(COC(=O)c2c[nH]nc2-c2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)OCc1cccc(C#N)c1)c1c[nH]nc1-c1ccccc1 | N#Cc1cccc(COC(=O)c2c[nH]nc2-c2ccccc2)c1 | CC(C)(CC(=O)OCc1cccc(C#N)c1)c1c[nH]nc1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule N#Cc1cccc(COC(=O)c2c[nH]nc2-c2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)OCc1cccc(C#N)c1)c1c[nH]nc1-c1ccccc1 | N#Cc1cccc(COC(=O)c2c[nH]nc2-c2ccccc2)c1 | CC(C)(CCC(=O)OCc1cccc(C#N)c1)c1c[nH]nc1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule N#Cc1cccc(COC(=O)c2c[nH]nc2-c2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SOCc1cccc(C#N)c1)c1c[nH]nc1-c1ccccc1 | N#Cc1cccc(COC(=O)c2c[nH]nc2-c2ccccc2)c1 | C[C@H](C(=O)SOCc1cccc(C#N)c1)c1c[nH]nc1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule Fc1ccc2c(c1)[C@H]([NH2+]C1CC[NH+](CCN3CCOCC3)CC1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc2c(c1)[C@H]([NH2+]C1CC[NH+](CCN3CCCC3)CC1)CC2 | Fc1ccc2c(c1)[C@H]([NH2+]C1CC[NH+](CCN3CCOCC3)CC1)CC2 | Fc1ccc2c(c1)[C@H]([NH2+]C1CC[NH+](CCN3CCCC3)CC1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule Fc1ccc2c(c1)[C@H]([NH2+]C1CC[NH+](CCN3CCOCC3)CC1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc2c(c1)[C@H]([NH2+]C1CC[NH+](CCN3CCCCC3)CC1)CC2 | Fc1ccc2c(c1)[C@H]([NH2+]C1CC[NH+](CCN3CCOCC3)CC1)CC2 | Fc1ccc2c(c1)[C@H]([NH2+]C1CC[NH+](CCN3CCCCC3)CC1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule Fc1ccc2c(c1)[C@H]([NH2+]C1CC[NH+](CCN3CCOCC3)CC1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc2c(c1)[C@H]([NH2+]C1CC[NH+](CCN3CCSCC3)CC1)CC2 | Fc1ccc2c(c1)[C@H]([NH2+]C1CC[NH+](CCN3CCOCC3)CC1)CC2 | Fc1ccc2c(c1)[C@H]([NH2+]C1CC[NH+](CCN3CCSCC3)CC1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule Fc1ccc2c(c1)[C@H]([NH2+]C1CC[NH+](CCN3CCOCC3)CC1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc2c(c1)[C@H]([NH2+]C1CC[NH+](CCN3CC=CC3)CC1)CC2 | Fc1ccc2c(c1)[C@H]([NH2+]C1CC[NH+](CCN3CCOCC3)CC1)CC2 | Fc1ccc2c(c1)[C@H]([NH2+]C1CC[NH+](CCN3CC=CC3)CC1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=CC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule Fc1ccc2c(c1)[C@H]([NH2+]C1CC[NH+](CCN3CCOCC3)CC1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc2c(c1)[C@H]([NH2+]C1CC[NH+](CCSSN3CCOCC3)CC1)CC2 | Fc1ccc2c(c1)[C@H]([NH2+]C1CC[NH+](CCN3CCOCC3)CC1)CC2 | Fc1ccc2c(c1)[C@H]([NH2+]C1CC[NH+](CCSSN3CCOCC3)CC1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "S&SN1CCOCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule CC(C)(C)OC(=O)NNC(=O)c1csc(-c2ccsc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCBr)OC(=O)NNC(=O)c1csc(-c2ccsc2)n1 | CC(C)(C)OC(=O)NNC(=O)c1csc(-c2ccsc2)n1 | CC(C)(CCBr)OC(=O)NNC(=O)c1csc(-c2ccsc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC&(C)CCBr",
"old_substring": "CC4(C)C"
} |
Can you make molecule CC(C)(C)OC(=O)NNC(=O)c1csc(-c2ccsc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)OC(=O)NNC(=O)c1csc(-c2ccsc2)n1 | CC(C)(C)OC(=O)NNC(=O)c1csc(-c2ccsc2)n1 | CCCC(C)(C)OC(=O)NNC(=O)c1csc(-c2ccsc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "CC4(C)C"
} |
Can you make molecule CC(C)(C)OC(=O)NNC(=O)c1csc(-c2ccsc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(OC(=O)NNC(=O)c1csc(-c2ccsc2)n1)C(C)C | CC(C)(C)OC(=O)NNC(=O)c1csc(-c2ccsc2)n1 | CC(C)C(OC(=O)NNC(=O)c1csc(-c2ccsc2)n1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&C(C)C",
"old_substring": "CC4(C)C"
} |
Can you make molecule CC(C)(C)OC(=O)NNC(=O)c1csc(-c2ccsc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCCC(=O)OC(=O)NNC(=O)c1csc(-c2ccsc2)n1 | CC(C)(C)OC(=O)NNC(=O)c1csc(-c2ccsc2)n1 | CC(C)CCCC(=O)OC(=O)NNC(=O)c1csc(-c2ccsc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCCC&=O",
"old_substring": "CC4(C)C"
} |
Can you make molecule CC(C)(C)OC(=O)NNC(=O)c1csc(-c2ccsc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC(OC(=O)NNC(=O)c2csc(-c3ccsc3)n2)CC1 | CC(C)(C)OC(=O)NNC(=O)c1csc(-c2ccsc2)n1 | CC1(C)CCC(OC(=O)NNC(=O)c2csc(-c3ccsc3)n2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCC&CC1",
"old_substring": "CC4(C)C"
} |
Can you make molecule Cc1noc(CCCC(=O)N2CC(C)(C)[C@H]2c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CC(=O)N1CC(C)(C)[C@H]1c1ccccc1)c1nc(C)no1 | Cc1noc(CCCC(=O)N2CC(C)(C)[C@H]2c2ccccc2)n1 | CC[C@@H](CC(=O)N1CC(C)(C)[C@H]1c1ccccc1)c1nc(C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&CC&=O",
"old_substring": "C4CCC3=O"
} |
Can you make molecule Cc1noc(CCCC(=O)N2CC(C)(C)[C@H]2c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CC(=O)N1CC(C)(C)[C@H]1c1ccccc1)c1nc(C)no1 | Cc1noc(CCCC(=O)N2CC(C)(C)[C@H]2c2ccccc2)n1 | CC[C@H](CC(=O)N1CC(C)(C)[C@H]1c1ccccc1)c1nc(C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H]&CC&=O",
"old_substring": "C4CCC3=O"
} |
Can you make molecule Cc1noc(CCCC(=O)N2CC(C)(C)[C@H]2c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CC(=O)N1CC(C)(C)[C@H]1c1ccccc1)c1nc(C)no1 | Cc1noc(CCCC(=O)N2CC(C)(C)[C@H]2c2ccccc2)n1 | CCC[C@@H](CC(=O)N1CC(C)(C)[C@H]1c1ccccc1)c1nc(C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&=O",
"old_substring": "C4CCC3=O"
} |
Can you make molecule Cc1noc(CCCC(=O)N2CC(C)(C)[C@H]2c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CN1CC(C)(C)[C@H]1c1ccccc1)c1nc(C)no1 | Cc1noc(CCCC(=O)N2CC(C)(C)[C@H]2c2ccccc2)n1 | CCC(CC)(C(=O)CN1CC(C)(C)[C@H]1c1ccccc1)c1nc(C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C4CCC3=O"
} |
Can you make molecule Cc1noc(CCCC(=O)N2CC(C)(C)[C@H]2c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCN1CC(C)(C)[C@H]1c1ccccc1)c1nc(C)no1 | Cc1noc(CCCC(=O)N2CC(C)(C)[C@H]2c2ccccc2)n1 | CCC(CC)(C(=O)CCN1CC(C)(C)[C@H]1c1ccccc1)c1nc(C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C4CCC3=O"
} |
Can you make molecule COCCOc1ccc(NC(=O)N2C[C@@H](CO)CC[C@@H]2C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COCCOc1ccc(NC(=O)CC(C)(C)N2C[C@@H](CO)CC[C@@H]2C)cc1F | COCCOc1ccc(NC(=O)N2C[C@@H](CO)CC[C@@H]2C)cc1F | COCCOc1ccc(NC(=O)CC(C)(C)N2C[C@@H](CO)CC[C@@H]2C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule COCCOc1ccc(NC(=O)N2C[C@@H](CO)CC[C@@H]2C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COCCOc1ccc(NC(=O)CCC(C)(C)N2C[C@@H](CO)CC[C@@H]2C)cc1F | COCCOc1ccc(NC(=O)N2C[C@@H](CO)CC[C@@H]2C)cc1F | COCCOc1ccc(NC(=O)CCC(C)(C)N2C[C@@H](CO)CC[C@@H]2C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule COCCOc1ccc(NC(=O)N2C[C@@H](CO)CC[C@@H]2C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COCCOc1ccc(NC(=O)C[C@@H](Br)N2C[C@@H](CO)CC[C@@H]2C)cc1F | COCCOc1ccc(NC(=O)N2C[C@@H](CO)CC[C@@H]2C)cc1F | COCCOc1ccc(NC(=O)C[C@@H](Br)N2C[C@@H](CO)CC[C@@H]2C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule COCCOc1ccc(NC(=O)N2C[C@@H](CO)CC[C@@H]2C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COCCOc1ccc(Nc2cc(C)n(N3C[C@@H](CO)CC[C@@H]3C)c(=O)c2)cc1F | COCCOc1ccc(NC(=O)N2C[C@@H](CO)CC[C@@H]2C)cc1F | COCCOc1ccc(Nc2cc(C)n(N3C[C@@H](CO)CC[C@@H]3C)c(=O)c2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule COCCOc1ccc(NC(=O)N2C[C@@H](CO)CC[C@@H]2C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COCCOc1ccc(Nc2c(C)n(N3C[C@@H](CO)CC[C@@H]3C)ccc2=O)cc1F | COCCOc1ccc(NC(=O)N2C[C@@H](CO)CC[C@@H]2C)cc1F | COCCOc1ccc(Nc2c(C)n(N3C[C@@H](CO)CC[C@@H]3C)ccc2=O)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule CC(C)CCNC(=O)c1ccc(C=C2Sc3ccccc3NC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCNSC(=O)Cc1ccc(C=C2Sc3ccccc3NC2=O)cc1 | CC(C)CCNC(=O)c1ccc(C=C2Sc3ccccc3NC2=O)cc1 | CC(C)CCNSC(=O)Cc1ccc(C=C2Sc3ccccc3NC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule CC(C)CCNC(=O)c1ccc(C=C2Sc3ccccc3NC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCNC(=O)CCCC(=O)c1ccc(C=C2Sc3ccccc3NC2=O)cc1 | CC(C)CCNC(=O)c1ccc(C=C2Sc3ccccc3NC2=O)cc1 | CC(C)CCNC(=O)CCCC(=O)c1ccc(C=C2Sc3ccccc3NC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule CC(C)CCNC(=O)c1ccc(C=C2Sc3ccccc3NC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCNC(=O)CC(C)(C)c1ccc(C=C2Sc3ccccc3NC2=O)cc1 | CC(C)CCNC(=O)c1ccc(C=C2Sc3ccccc3NC2=O)cc1 | CC(C)CCNC(=O)CC(C)(C)c1ccc(C=C2Sc3ccccc3NC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CC(C)CCNC(=O)c1ccc(C=C2Sc3ccccc3NC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCNC(=O)CCC(C)(C)c1ccc(C=C2Sc3ccccc3NC2=O)cc1 | CC(C)CCNC(=O)c1ccc(C=C2Sc3ccccc3NC2=O)cc1 | CC(C)CCNC(=O)CCC(C)(C)c1ccc(C=C2Sc3ccccc3NC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CC(C)CCNC(=O)c1ccc(C=C2Sc3ccccc3NC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCNSC(=O)[C@@H](C)c1ccc(C=C2Sc3ccccc3NC2=O)cc1 | CC(C)CCNC(=O)c1ccc(C=C2Sc3ccccc3NC2=O)cc1 | CC(C)CCNSC(=O)[C@@H](C)c1ccc(C=C2Sc3ccccc3NC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule CCNS(=O)(=O)c1ccccc1N[C@H](C)C[C@@H]1CCC[NH2+]1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C[C@@H]1CCC[NH2+]1)Nc1ccccc1S(=O)(=O)NC1=CC=CC=C2CC2(C)C1 | CCNS(=O)(=O)c1ccccc1N[C@H](C)C[C@@H]1CCC[NH2+]1 | C[C@H](C[C@@H]1CCC[NH2+]1)Nc1ccccc1S(=O)(=O)NC1=CC=CC=C2CC2(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&Cc2ccccc2C1",
"old_substring": "CC2"
} |
Can you make molecule CCNS(=O)(=O)c1ccccc1N[C@H](C)C[C@@H]1CCC[NH2+]1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C[C@@H]1CCC[NH2+]1)Nc1ccccc1S(=O)(=O)NC1=NC2=C(CCCC1(C)C)S2 | CCNS(=O)(=O)c1ccccc1N[C@H](C)C[C@@H]1CCC[NH2+]1 | C[C@H](C[C@@H]1CCC[NH2+]1)Nc1ccccc1S(=O)(=O)NC1=NC2=C(CCCC1(C)C)S2 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCCc2sc&nc21",
"old_substring": "CC2"
} |
Can you make molecule CCNS(=O)(=O)c1ccccc1N[C@H](C)C[C@@H]1CCC[NH2+]1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C[C@@H]1CCC[NH2+]1)Nc1ccccc1S(=O)(=O)NC1=CC=C2C=C2CC(C)(C)O1 | CCNS(=O)(=O)c1ccccc1N[C@H](C)C[C@@H]1CCC[NH2+]1 | C[C@H](C[C@@H]1CCC[NH2+]1)Nc1ccccc1S(=O)(=O)NC1=CC=C2C=C2CC(C)(C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)Cc2cc&ccc2O1",
"old_substring": "CC2"
} |
Can you make molecule CCNS(=O)(=O)c1ccccc1N[C@H](C)C[C@@H]1CCC[NH2+]1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C[C@@H]1CCC[NH2+]1)Nc1ccccc1S(=O)(=O)NC1=CC=C2C=C2CCN1C | CCNS(=O)(=O)c1ccccc1N[C@H](C)C[C@@H]1CCC[NH2+]1 | C[C@H](C[C@@H]1CCC[NH2+]1)Nc1ccccc1S(=O)(=O)NC1=CC=C2C=C2CCN1C | 102 | {
"fragment_index": 0,
"new_substring": "CN1CCc2cc&ccc21",
"old_substring": "CC2"
} |
Can you make molecule CCNS(=O)(=O)c1ccccc1N[C@H](C)C[C@@H]1CCC[NH2+]1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C[C@@H]1CCC[NH2+]1)Nc1ccccc1S(=O)(=O)NCCCCC12CC1C2 | CCNS(=O)(=O)c1ccccc1N[C@H](C)C[C@@H]1CCC[NH2+]1 | C[C@H](C[C@@H]1CCC[NH2+]1)Nc1ccccc1S(=O)(=O)NCCCCC12CC1C2 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC2(CCCC2)C1",
"old_substring": "CC2"
} |
Can you make molecule Cc1cc(NC(=O)CSCC(=O)N[C@@H]2CCCC[C@H]2C)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccoc1NC(=O)CSCC(=O)N[C@@H]1CCCC[C@H]1C | Cc1cc(NC(=O)CSCC(=O)N[C@@H]2CCCC[C@H]2C)no1 | Cc1ccoc1NC(=O)CSCC(=O)N[C@@H]1CCCC[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccoc1&",
"old_substring": "Cc1cc7no1"
} |
Can you make molecule Cc1cc(NC(=O)CSCC(=O)N[C@@H]2CCCC[C@H]2C)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(NC(=O)CSCC(=O)N[C@@H]3CCCC[C@H]3C)oc2c1 | Cc1cc(NC(=O)CSCC(=O)N[C@@H]2CCCC[C@H]2C)no1 | Cc1ccc2nc(NC(=O)CSCC(=O)N[C@@H]3CCCC[C@H]3C)oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc2nc&oc2c1",
"old_substring": "Cc1cc7no1"
} |
Can you make molecule Cc1cc(NC(=O)CSCC(=O)N[C@@H]2CCCC[C@H]2C)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)CSCC(=O)N[C@@H]2CCCC[C@H]2C)ncc1Br | Cc1cc(NC(=O)CSCC(=O)N[C@@H]2CCCC[C@H]2C)no1 | Cc1cc(NC(=O)CSCC(=O)N[C@@H]2CCCC[C@H]2C)ncc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&ncc1Br",
"old_substring": "Cc1cc7no1"
} |
Can you make molecule Cc1cc(NC(=O)CSCC(=O)N[C@@H]2CCCC[C@H]2C)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)n1NC(=O)CSCC(=O)N[C@@H]1CCCC[C@H]1C | Cc1cc(NC(=O)CSCC(=O)N[C@@H]2CCCC[C@H]2C)no1 | Cc1ccc(C)n1NC(=O)CSCC(=O)N[C@@H]1CCCC[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(C)n1&",
"old_substring": "Cc1cc7no1"
} |
Can you make molecule Cc1cc(NC(=O)CSCC(=O)N[C@@H]2CCCC[C@H]2C)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)CSCC(=O)N[C@@H]2CCCC[C@H]2C)cnc1Cl | Cc1cc(NC(=O)CSCC(=O)N[C@@H]2CCCC[C@H]2C)no1 | Cc1cc(NC(=O)CSCC(=O)N[C@@H]2CCCC[C@H]2C)cnc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cnc1Cl",
"old_substring": "Cc1cc7no1"
} |
Can you make molecule O=[N+]([O-])c1ccc(SCc2ccco2)cc1N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1ccc(SCSCc2ccco2)cc1N1CCOCC1 | O=[N+]([O-])c1ccc(SCc2ccco2)cc1N1CCOCC1 | O=[N+]([O-])c1ccc(SCSCc2ccco2)cc1N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&CS&",
"old_substring": "S36"
} |
Can you make molecule O=[N+]([O-])c1ccc(SCc2ccco2)cc1N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1ccc(-c2ccc3c(c2)N(Cc2ccco2)CCS3)cc1N1CCOCC1 | O=[N+]([O-])c1ccc(SCc2ccco2)cc1N1CCOCC1 | O=[N+]([O-])c1ccc(-c2ccc3c(c2)N(Cc2ccco2)CCS3)cc1N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "S36"
} |
Can you make molecule O=[N+]([O-])c1ccc(SCc2ccco2)cc1N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | N#C/C(Nc1ccc([N+](=O)[O-])c(N2CCOCC2)c1)=C(/Cl)SCc1ccco1 | O=[N+]([O-])c1ccc(SCc2ccco2)cc1N1CCOCC1 | N#C/C(Nc1ccc([N+](=O)[O-])c(N2CCOCC2)c1)=C(/Cl)SCc1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "S&/C(Cl)=C(\\C#N)N&",
"old_substring": "S36"
} |
Can you make molecule O=[N+]([O-])c1ccc(SCc2ccco2)cc1N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1ccc(-n2c(=S)n(Cc3ccco3)c3ccccc32)cc1N1CCOCC1 | O=[N+]([O-])c1ccc(SCc2ccco2)cc1N1CCOCC1 | O=[N+]([O-])c1ccc(-n2c(=S)n(Cc3ccco3)c3ccccc32)cc1N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&c(=S)n&c2ccccc21",
"old_substring": "S36"
} |
Can you make molecule O=[N+]([O-])c1ccc(SCc2ccco2)cc1N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccc([N+](=O)[O-])c(N2CCOCC2)c1)[S@@+]([O-])CCCCc1ccco1 | O=[N+]([O-])c1ccc(SCc2ccco2)cc1N1CCOCC1 | C[C@@H](c1ccc([N+](=O)[O-])c(N2CCOCC2)c1)[S@@+]([O-])CCCCc1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC[S@](=O)[C@H]&C",
"old_substring": "S36"
} |
Can you make molecule COC(=O)[C@@H]1CCCCC[C@@H]1NC(=O)c1cc(C)nc2c1cnn2C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)N1CCC2(CCC(NC(=O)c3cc(C)nc4c3cnn4C(C)C)CC2)CC1 | COC(=O)[C@@H]1CCCCC[C@@H]1NC(=O)c1cc(C)nc2c1cnn2C(C)C | COC(=O)N1CCC2(CCC(NC(=O)c3cc(C)nc4c3cnn4C(C)C)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC2(CCC&CC2)CC1",
"old_substring": "[C@@H]16CCCCC[C@@H]15"
} |
Can you make molecule COC(=O)[C@@H]1CCCCC[C@@H]1NC(=O)c1cc(C)nc2c1cnn2C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(NC(=O)c2cc(C)nc3c2cnn3C(C)C)cc2c1CCC2(C)C | COC(=O)[C@@H]1CCCCC[C@@H]1NC(=O)c1cc(C)nc2c1cnn2C(C)C | COC(=O)c1cc(NC(=O)c2cc(C)nc3c2cnn3C(C)C)cc2c1CCC2(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc2c1CCC2(C)C",
"old_substring": "[C@@H]16CCCCC[C@@H]15"
} |
Can you make molecule COC(=O)[C@@H]1CCCCC[C@@H]1NC(=O)c1cc(C)nc2c1cnn2C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(NC(=O)c2cc(C)nc3c2cnn3C(C)C)c2c1CCCC2 | COC(=O)[C@@H]1CCCCC[C@@H]1NC(=O)c1cc(C)nc2c1cnn2C(C)C | COC(=O)c1ccc(NC(=O)c2cc(C)nc3c2cnn3C(C)C)c2c1CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&c2c1CCCC2",
"old_substring": "[C@@H]16CCCCC[C@@H]15"
} |
Can you make molecule COC(=O)[C@@H]1CCCCC[C@@H]1NC(=O)c1cc(C)nc2c1cnn2C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(C)c(NC(=O)c2cc(C)nc3c2cnn3C(C)C)cc1Cl | COC(=O)[C@@H]1CCCCC[C@@H]1NC(=O)c1cc(C)nc2c1cnn2C(C)C | COC(=O)c1cc(C)c(NC(=O)c2cc(C)nc3c2cnn3C(C)C)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(Cl)cc1&",
"old_substring": "[C@@H]16CCCCC[C@@H]15"
} |
Can you make molecule COC(=O)[C@@H]1CCCCC[C@@H]1NC(=O)c1cc(C)nc2c1cnn2C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1c(C)c(C)c(NC(=O)c2cc(C)nc3c2cnn3C(C)C)c(C)c1C | COC(=O)[C@@H]1CCCCC[C@@H]1NC(=O)c1cc(C)nc2c1cnn2C(C)C | COC(=O)c1c(C)c(C)c(NC(=O)c2cc(C)nc3c2cnn3C(C)C)c(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(C)c(C)c&c1C",
"old_substring": "[C@@H]16CCCCC[C@@H]15"
} |
Can you make molecule O=S(=O)([N-]c1ccc(Cl)c(Cl)c1)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1ccc(Cl)c(Cl)c1Cl)c1cccc(Br)c1 | O=S(=O)([N-]c1ccc(Cl)c(Cl)c1)c1cccc(Br)c1 | O=S(=O)([N-]c1ccc(Cl)c(Cl)c1Cl)c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1Cl",
"old_substring": "c13ccc(Cl)c(Cl)c1"
} |
Can you make molecule O=S(=O)([N-]c1ccc(Cl)c(Cl)c1)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1cc(Cl)cc(Cl)c1Br)c1cccc(Br)c1 | O=S(=O)([N-]c1ccc(Cl)c(Cl)c1)c1cccc(Br)c1 | O=S(=O)([N-]c1cc(Cl)cc(Cl)c1Br)c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)cc(Cl)c1Br",
"old_substring": "c13ccc(Cl)c(Cl)c1"
} |
Can you make molecule O=S(=O)([N-]c1ccc(Cl)c(Cl)c1)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1c(Cl)ccc(Cl)c1Cl)c1cccc(Br)c1 | O=S(=O)([N-]c1ccc(Cl)c(Cl)c1)c1cccc(Br)c1 | O=S(=O)([N-]c1c(Cl)ccc(Cl)c1Cl)c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)ccc(Cl)c1Cl",
"old_substring": "c13ccc(Cl)c(Cl)c1"
} |
Can you make molecule O=S(=O)([N-]c1ccc(Cl)c(Cl)c1)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1c(Cl)cc(Cl)cc1Cl)c1cccc(Br)c1 | O=S(=O)([N-]c1ccc(Cl)c(Cl)c1)c1cccc(Br)c1 | O=S(=O)([N-]c1c(Cl)cc(Cl)cc1Cl)c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc(Cl)cc1Cl",
"old_substring": "c13ccc(Cl)c(Cl)c1"
} |
Can you make molecule O=S(=O)([N-]c1ccc(Cl)c(Cl)c1)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1c(Cl)cc(Br)cc1Cl)c1cccc(Br)c1 | O=S(=O)([N-]c1ccc(Cl)c(Cl)c1)c1cccc(Br)c1 | O=S(=O)([N-]c1c(Cl)cc(Br)cc1Cl)c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc(Br)cc1Cl",
"old_substring": "c13ccc(Cl)c(Cl)c1"
} |
Can you make molecule C[C@H](NC(=O)Nc1ccncc1)c1nc(-c2ccc(Cl)cc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC(=O)Nc1ccncc1Cl)c1nc(-c2ccc(Cl)cc2)no1 | C[C@H](NC(=O)Nc1ccncc1)c1nc(-c2ccc(Cl)cc2)no1 | C[C@H](NC(=O)Nc1ccncc1Cl)c1nc(-c2ccc(Cl)cc2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c16ccncc1"
} |
Can you make molecule C[C@H](NC(=O)Nc1ccncc1)c1nc(-c2ccc(Cl)cc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC(=O)Nc1ccccc1)c1nc(-c2ccc(Cl)cc2)no1 | C[C@H](NC(=O)Nc1ccncc1)c1nc(-c2ccc(Cl)cc2)no1 | C[C@H](NC(=O)Nc1ccccc1)c1nc(-c2ccc(Cl)cc2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c16ccncc1"
} |
Can you make molecule C[C@H](NC(=O)Nc1ccncc1)c1nc(-c2ccc(Cl)cc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC(=O)Nc1cnccc1Cl)c1nc(-c2ccc(Cl)cc2)no1 | C[C@H](NC(=O)Nc1ccncc1)c1nc(-c2ccc(Cl)cc2)no1 | C[C@H](NC(=O)Nc1cnccc1Cl)c1nc(-c2ccc(Cl)cc2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnccc1Cl",
"old_substring": "c16ccncc1"
} |
Can you make molecule C[C@H](NC(=O)Nc1ccncc1)c1nc(-c2ccc(Cl)cc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC(=O)Nc1cc(Br)ncc1F)c1nc(-c2ccc(Cl)cc2)no1 | C[C@H](NC(=O)Nc1ccncc1)c1nc(-c2ccc(Cl)cc2)no1 | C[C@H](NC(=O)Nc1cc(Br)ncc1F)c1nc(-c2ccc(Cl)cc2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ncc1F",
"old_substring": "c16ccncc1"
} |
Can you make molecule C[C@H](NC(=O)Nc1ccncc1)c1nc(-c2ccc(Cl)cc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)N[C@@H](C)c2nc(-c3ccc(Cl)cc3)no2)ncc1Br | C[C@H](NC(=O)Nc1ccncc1)c1nc(-c2ccc(Cl)cc2)no1 | Cc1cc(NC(=O)N[C@@H](C)c2nc(-c3ccc(Cl)cc3)no2)ncc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&ncc1Br",
"old_substring": "c16ccncc1"
} |
Can you make molecule O=C(N[C@H](c1ccccc1)C1CC1)N1CCC(OCc2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SN1CCC(OCc2ccc(F)cc2)CC1)N[C@H](c1ccccc1)C1CC1 | O=C(N[C@H](c1ccccc1)C1CC1)N1CCC(OCc2ccc(F)cc2)CC1 | O=C(/C=C/SN1CCC(OCc2ccc(F)cc2)CC1)N[C@H](c1ccccc1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(N[C@H](c1ccccc1)C1CC1)N1CCC(OCc2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc(COC2CCN(c3ccc(/C=N/ON[C@H](c4ccccc4)C4CC4)o3)CC2)cc1 | O=C(N[C@H](c1ccccc1)C1CC1)N1CCC(OCc2ccc(F)cc2)CC1 | Fc1ccc(COC2CCN(c3ccc(/C=N/ON[C@H](c4ccccc4)C4CC4)o3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(N[C@H](c1ccccc1)C1CC1)N1CCC(OCc2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(N2CCC(OCc3ccc(F)cc3)CC2)CC1)N[C@H](c1ccccc1)C1CC1 | O=C(N[C@H](c1ccccc1)C1CC1)N1CCC(OCc2ccc(F)cc2)CC1 | O=C(NN=C1CCC(N2CCC(OCc3ccc(F)cc3)CC2)CC1)N[C@H](c1ccccc1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(N[C@H](c1ccccc1)C1CC1)N1CCC(OCc2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H](c1ccccc1)C1CC1)C1=CC[C@H](N2CCC(OCc3ccc(F)cc3)CC2)S1 | O=C(N[C@H](c1ccccc1)C1CC1)N1CCC(OCc2ccc(F)cc2)CC1 | O=C(N[C@H](c1ccccc1)C1CC1)C1=CC[C@H](N2CCC(OCc3ccc(F)cc3)CC2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(N[C@H](c1ccccc1)C1CC1)N1CCC(OCc2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/N=c1\ccccn1N1CCC(OCc2ccc(F)cc2)CC1)N[C@H](c1ccccc1)C1CC1 | O=C(N[C@H](c1ccccc1)C1CC1)N1CCC(OCc2ccc(F)cc2)CC1 | O=C(/N=c1\ccccn1N1CCC(OCc2ccc(F)cc2)CC1)N[C@H](c1ccccc1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/N=c1\\ccccn1&",
"old_substring": "O=C34"
} |
Can you make molecule Cc1nc(C[C@H](N)c2ccc3nccnc3c2)sc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(C[C@H](N)c2ccc3nccnc3c2)c1Cl | Cc1nc(C[C@H](N)c2ccc3nccnc3c2)sc1C | Cc1csc(C[C@H](N)c2ccc3nccnc3c2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1csc&c1Cl",
"old_substring": "Cc1nc4sc1C"
} |
Can you make molecule Cc1nc(C[C@H](N)c2ccc3nccnc3c2)sc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C[C@H](N)c2ccc3nccnc3c2)sc1C | Cc1nc(C[C@H](N)c2ccc3nccnc3c2)sc1C | Cc1cc(C[C@H](N)c2ccc3nccnc3c2)sc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&sc1C",
"old_substring": "Cc1nc4sc1C"
} |
Can you make molecule Cc1nc(C[C@H](N)c2ccc3nccnc3c2)sc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1C=C[C@H](N)c1ccc2nccnc2c1 | Cc1nc(C[C@H](N)c2ccc3nccnc3c2)sc1C | Cc1ccsc1C=C[C@H](N)c1ccc2nccnc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccsc1C=&",
"old_substring": "Cc1nc4sc1C"
} |
Can you make molecule Cc1nc(C[C@H](N)c2ccc3nccnc3c2)sc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2nc(C[C@H](N)c3ccc4nccnc4c3)sc2cc1C | Cc1nc(C[C@H](N)c2ccc3nccnc3c2)sc1C | Cc1cc2nc(C[C@H](N)c3ccc4nccnc4c3)sc2cc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc2nc&sc2cc1C",
"old_substring": "Cc1nc4sc1C"
} |
Can you make molecule Cc1nc(C[C@H](N)c2ccc3nccnc3c2)sc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2sc(C[C@H](N)c3ccc4nccnc4c3)nc2c1C | Cc1nc(C[C@H](N)c2ccc3nccnc3c2)sc1C | Cc1ccc2sc(C[C@H](N)c3ccc4nccnc4c3)nc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc2sc&nc2c1C",
"old_substring": "Cc1nc4sc1C"
} |
Can you make molecule C[C@H]1C(=O)N(C[C@@H]2CC[C@H](C(=O)NN)O2)C(=O)[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C(=O)N(C[C@@H]2CC[C@H](C(=O)CN)O2)C(=O)[C@@H]1C | C[C@H]1C(=O)N(C[C@@H]2CC[C@H](C(=O)NN)O2)C(=O)[C@@H]1C | C[C@H]1C(=O)N(C[C@@H]2CC[C@H](C(=O)CN)O2)C(=O)[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CN",
"old_substring": "C3(=O)NN"
} |
Can you make molecule C[C@H]1C(=O)N(C[C@@H]2CC[C@H](C(=O)NN)O2)C(=O)[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C(=O)N(C[C@@H]2CC[C@H](CCCCC(=O)NN)O2)C(=O)[C@@H]1C | C[C@H]1C(=O)N(C[C@@H]2CC[C@H](C(=O)NN)O2)C(=O)[C@@H]1C | C[C@H]1C(=O)N(C[C@@H]2CC[C@H](CCCCC(=O)NN)O2)C(=O)[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(=O)NN",
"old_substring": "C3(=O)NN"
} |
Can you make molecule C[C@H]1C(=O)N(C[C@@H]2CC[C@H](C(=O)NN)O2)C(=O)[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)NO[C@H]1CC[C@@H](CN2C(=O)[C@H](C)[C@@H](C)C2=O)O1 | C[C@H]1C(=O)N(C[C@@H]2CC[C@H](C(=O)NN)O2)C(=O)[C@@H]1C | CC(=O)NO[C@H]1CC[C@@H](CN2C(=O)[C@H](C)[C@@H](C)C2=O)O1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)NO&",
"old_substring": "C3(=O)NN"
} |
Can you make molecule C[C@H]1C(=O)N(C[C@@H]2CC[C@H](C(=O)NN)O2)C(=O)[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C(=O)N(C[C@@H]2CC[C@H](C(=O)N3CCCN3)O2)C(=O)[C@@H]1C | C[C@H]1C(=O)N(C[C@@H]2CC[C@H](C(=O)NN)O2)C(=O)[C@@H]1C | C[C@H]1C(=O)N(C[C@@H]2CC[C@H](C(=O)N3CCCN3)O2)C(=O)[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)N1CCCN1",
"old_substring": "C3(=O)NN"
} |
Can you make molecule C[C@H]1C(=O)N(C[C@@H]2CC[C@H](C(=O)NN)O2)C(=O)[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)NN)[C@H]1CC[C@@H](CN2C(=O)[C@H](C)[C@@H](C)C2=O)O1 | C[C@H]1C(=O)N(C[C@@H]2CC[C@H](C(=O)NN)O2)C(=O)[C@@H]1C | C[C@@H](C(=O)NN)[C@H]1CC[C@@H](CN2C(=O)[C@H](C)[C@@H](C)C2=O)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&C(=O)NN",
"old_substring": "C3(=O)NN"
} |
Can you make molecule C[C@H]1CCC[C@H](N(C)C(=O)CCc2ccccc2O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@H](N(C)C(=O)CC(C)(C)c2ccccc2O)C1 | C[C@H]1CCC[C@H](N(C)C(=O)CCc2ccccc2O)C1 | C[C@H]1CCC[C@H](N(C)C(=O)CC(C)(C)c2ccccc2O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)CC5"
} |
Can you make molecule C[C@H]1CCC[C@H](N(C)C(=O)CCc2ccccc2O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@H](N(C)C(=O)CCC(C)(C)c2ccccc2O)C1 | C[C@H]1CCC[C@H](N(C)C(=O)CCc2ccccc2O)C1 | C[C@H]1CCC[C@H](N(C)C(=O)CCC(C)(C)c2ccccc2O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)CC5"
} |
Can you make molecule C[C@H]1CCC[C@H](N(C)C(=O)CCc2ccccc2O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@H](N(C)C(=O)C[C@H](C)c2ccccc2O)C1 | C[C@H]1CCC[C@H](N(C)C(=O)CCc2ccccc2O)C1 | C[C@H]1CCC[C@H](N(C)C(=O)C[C@H](C)c2ccccc2O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@@H]&C",
"old_substring": "C3(=O)CC5"
} |
Can you make molecule C[C@H]1CCC[C@H](N(C)C(=O)CCc2ccccc2O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@H](N(C)C(=O)C[C@@H](Br)c2ccccc2O)C1 | C[C@H]1CCC[C@H](N(C)C(=O)CCc2ccccc2O)C1 | C[C@H]1CCC[C@H](N(C)C(=O)C[C@@H](Br)c2ccccc2O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C3(=O)CC5"
} |
Can you make molecule C[C@H]1CCC[C@H](N(C)C(=O)CCc2ccccc2O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@H](N(C)SC(=O)[C@@H](C)c2ccccc2O)C1 | C[C@H]1CCC[C@H](N(C)C(=O)CCc2ccccc2O)C1 | C[C@H]1CCC[C@H](N(C)SC(=O)[C@@H](C)c2ccccc2O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C3(=O)CC5"
} |
Can you make molecule Cc1ccccc1CNC(=O)[C@@H]1CCCN(S(=O)(=O)Cc2ccc(Cl)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CNC(=O)[C@@H]1CC[C@@H](S(=O)(=O)Cc2ccc(Cl)cc2)C1 | Cc1ccccc1CNC(=O)[C@@H]1CCCN(S(=O)(=O)Cc2ccc(Cl)cc2)C1 | Cc1ccccc1CNC(=O)[C@@H]1CC[C@@H](S(=O)(=O)Cc2ccc(Cl)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]16CCCN5C1"
} |
Can you make molecule Cc1ccccc1CNC(=O)[C@@H]1CCCN(S(=O)(=O)Cc2ccc(Cl)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CNC(=O)[C@H](CCl)CCCS(=O)(=O)Cc1ccc(Cl)cc1 | Cc1ccccc1CNC(=O)[C@@H]1CCCN(S(=O)(=O)Cc2ccc(Cl)cc2)C1 | Cc1ccccc1CNC(=O)[C@H](CCl)CCCS(=O)(=O)Cc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]16CCCN5C1"
} |
Can you make molecule Cc1ccccc1CNC(=O)[C@@H]1CCCN(S(=O)(=O)Cc2ccc(Cl)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CNC(=O)[C@H]1CCC[C@H](S(=O)(=O)Cc2ccc(Cl)cc2)C1 | Cc1ccccc1CNC(=O)[C@@H]1CCCN(S(=O)(=O)Cc2ccc(Cl)cc2)C1 | Cc1ccccc1CNC(=O)[C@H]1CCC[C@H](S(=O)(=O)Cc2ccc(Cl)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@@H]16CCCN5C1"
} |
Can you make molecule Cc1ccccc1CNC(=O)[C@@H]1CCCN(S(=O)(=O)Cc2ccc(Cl)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CNC(=O)[C@H]1CCCC[C@H](S(=O)(=O)Cc2ccc(Cl)cc2)C1 | Cc1ccccc1CNC(=O)[C@@H]1CCCN(S(=O)(=O)Cc2ccc(Cl)cc2)C1 | Cc1ccccc1CNC(=O)[C@H]1CCCC[C@H](S(=O)(=O)Cc2ccc(Cl)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@H]&C1",
"old_substring": "[C@@H]16CCCN5C1"
} |
Can you make molecule Cc1ccccc1CNC(=O)[C@@H]1CCCN(S(=O)(=O)Cc2ccc(Cl)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CNC(=O)[C@H]1CCC[C@H](S(=O)(=O)Cc2ccc(Cl)cc2)CC1 | Cc1ccccc1CNC(=O)[C@@H]1CCCN(S(=O)(=O)Cc2ccc(Cl)cc2)C1 | Cc1ccccc1CNC(=O)[C@H]1CCC[C@H](S(=O)(=O)Cc2ccc(Cl)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&CC1",
"old_substring": "[C@@H]16CCCN5C1"
} |
Can you make molecule O[C@@]12CCCC[C@@H]1[C@H](c1ccc(Cl)cc1Cl)[NH2+]CC2 less soluble in water? The output molecule should be similar to the input molecule. | O[C@@]12CCCC[C@@H]1[C@H](c1ccc(Cl)c(Cl)c1Cl)[NH2+]CC2 | O[C@@]12CCCC[C@@H]1[C@H](c1ccc(Cl)cc1Cl)[NH2+]CC2 | O[C@@]12CCCC[C@@H]1[C@H](c1ccc(Cl)c(Cl)c1Cl)[NH2+]CC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1Cl",
"old_substring": "c13ccc(Cl)cc1Cl"
} |
Can you make molecule O[C@@]12CCCC[C@@H]1[C@H](c1ccc(Cl)cc1Cl)[NH2+]CC2 less soluble in water? The output molecule should be similar to the input molecule. | O[C@@]12CCCC[C@@H]1[C@H](c1c(Cl)cc(Br)cc1Cl)[NH2+]CC2 | O[C@@]12CCCC[C@@H]1[C@H](c1ccc(Cl)cc1Cl)[NH2+]CC2 | O[C@@]12CCCC[C@@H]1[C@H](c1c(Cl)cc(Br)cc1Cl)[NH2+]CC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc(Br)cc1Cl",
"old_substring": "c13ccc(Cl)cc1Cl"
} |
Can you make molecule O[C@@]12CCCC[C@@H]1[C@H](c1ccc(Cl)cc1Cl)[NH2+]CC2 less soluble in water? The output molecule should be similar to the input molecule. | O[C@@]12CCCC[C@@H]1[C@H](c1cc(Cl)cc(Cl)c1Br)[NH2+]CC2 | O[C@@]12CCCC[C@@H]1[C@H](c1ccc(Cl)cc1Cl)[NH2+]CC2 | O[C@@]12CCCC[C@@H]1[C@H](c1cc(Cl)cc(Cl)c1Br)[NH2+]CC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)cc(Cl)c1Br",
"old_substring": "c13ccc(Cl)cc1Cl"
} |
Can you make molecule O[C@@]12CCCC[C@@H]1[C@H](c1ccc(Cl)cc1Cl)[NH2+]CC2 less soluble in water? The output molecule should be similar to the input molecule. | O[C@@]12CCCC[C@@H]1[C@H](c1cc(Br)cc(Br)c1Cl)[NH2+]CC2 | O[C@@]12CCCC[C@@H]1[C@H](c1ccc(Cl)cc1Cl)[NH2+]CC2 | O[C@@]12CCCC[C@@H]1[C@H](c1cc(Br)cc(Br)c1Cl)[NH2+]CC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)cc(Br)c1Cl",
"old_substring": "c13ccc(Cl)cc1Cl"
} |
Can you make molecule O[C@@]12CCCC[C@@H]1[C@H](c1ccc(Cl)cc1Cl)[NH2+]CC2 less soluble in water? The output molecule should be similar to the input molecule. | O[C@@]12CCCC[C@@H]1[C@H](c1c(Cl)ccc(Cl)c1Cl)[NH2+]CC2 | O[C@@]12CCCC[C@@H]1[C@H](c1ccc(Cl)cc1Cl)[NH2+]CC2 | O[C@@]12CCCC[C@@H]1[C@H](c1c(Cl)ccc(Cl)c1Cl)[NH2+]CC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)ccc(Cl)c1Cl",
"old_substring": "c13ccc(Cl)cc1Cl"
} |
Can you make molecule Cc1ccc2c(c1)CCN2C(=O)Nc1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)CCN2C(=O)CC(C)(C)Nc1ccc2c(c1)OCO2 | Cc1ccc2c(c1)CCN2C(=O)Nc1ccc2c(c1)OCO2 | Cc1ccc2c(c1)CCN2C(=O)CC(C)(C)Nc1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ccc2c(c1)CCN2C(=O)Nc1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)CCN2C(=O)CCC(C)(C)Nc1ccc2c(c1)OCO2 | Cc1ccc2c(c1)CCN2C(=O)Nc1ccc2c(c1)OCO2 | Cc1ccc2c(c1)CCN2C(=O)CCC(C)(C)Nc1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ccc2c(c1)CCN2C(=O)Nc1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)CCN2C(=O)C[C@@H](Br)Nc1ccc2c(c1)OCO2 | Cc1ccc2c(c1)CCN2C(=O)Nc1ccc2c(c1)OCO2 | Cc1ccc2c(c1)CCN2C(=O)C[C@@H](Br)Nc1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ccc2c(c1)CCN2C(=O)Nc1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)CCN2c1cc(C)n(Nc2ccc3c(c2)OCO3)c(=O)c1 | Cc1ccc2c(c1)CCN2C(=O)Nc1ccc2c(c1)OCO2 | Cc1ccc2c(c1)CCN2c1cc(C)n(Nc2ccc3c(c2)OCO3)c(=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ccc2c(c1)CCN2C(=O)Nc1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)CCN2c1c(C)n(Nc2ccc3c(c2)OCO3)ccc1=O | Cc1ccc2c(c1)CCN2C(=O)Nc1ccc2c(c1)OCO2 | Cc1ccc2c(c1)CCN2c1c(C)n(Nc2ccc3c(c2)OCO3)ccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.