prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1cc2n(C[C@H](O)CO[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2n(C[C@H](S)CO[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 | Cc1cc2n(C[C@H](O)CO[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 | Cc1cc2n(C[C@H](S)CO[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@H](S)C&",
"old_substring": "C6[C@H](O)C4"
} |
Can you make molecule Cc1cc2n(C[C@H](O)CO[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2n(C[C@@H](O)C(C)(C)O[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 | Cc1cc2n(C[C@H](O)CO[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 | Cc1cc2n(C[C@@H](O)C(C)(C)O[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](O)C&(C)C",
"old_substring": "C6[C@H](O)C4"
} |
Can you make molecule Cc1cc2n(C[C@H](O)CO[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2n(C[C@@H](C)C(=O)O[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 | Cc1cc2n(C[C@H](O)CO[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 | Cc1cc2n(C[C@@H](C)C(=O)O[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](C)C&=O",
"old_substring": "C6[C@H](O)C4"
} |
Can you make molecule Cc1cc2n(C[C@H](O)CO[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2n([C@@H](C)S(=O)(=O)CO[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 | Cc1cc2n(C[C@H](O)CO[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 | Cc1cc2n([C@@H](C)S(=O)(=O)CO[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&S(=O)(=O)C&",
"old_substring": "C6[C@H](O)C4"
} |
Can you make molecule Cc1cc2n(C[C@H](O)CO[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2n(C[C@H](O)C[C@H](C)O[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 | Cc1cc2n(C[C@H](O)CO[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 | Cc1cc2n(C[C@H](O)C[C@H](C)O[C@H](c3ccccc3)c3ccccc3C)c(=O)c3ccccc3n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@H](O)C[C@@H]&C",
"old_substring": "C6[C@H](O)C4"
} |
Can you make molecule CCc1ncc(CN(C)C(=O)Nc2c(C)ccc([N+](=O)[O-])c2C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(CN(C)C(=O)Nc2c(C)ccc([N+](=O)[O-])c2C)s1 | CCc1ncc(CN(C)C(=O)Nc2c(C)ccc([N+](=O)[O-])c2C)s1 | CCc1ccc(CN(C)C(=O)Nc2c(C)ccc([N+](=O)[O-])c2C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&s1",
"old_substring": "c17ncc8s1"
} |
Can you make molecule CCc1ncc(CN(C)C(=O)Nc2c(C)ccc([N+](=O)[O-])c2C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1sc(CN(C)C(=O)Nc2c(C)ccc([N+](=O)[O-])c2C)nc1Cl | CCc1ncc(CN(C)C(=O)Nc2c(C)ccc([N+](=O)[O-])c2C)s1 | CCc1sc(CN(C)C(=O)Nc2c(C)ccc([N+](=O)[O-])c2C)nc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc&nc1Cl",
"old_substring": "c17ncc8s1"
} |
Can you make molecule CCc1ncc(CN(C)C(=O)Nc2c(C)ccc([N+](=O)[O-])c2C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2c(CN(C)C(=O)Nc3c(C)ccc([N+](=O)[O-])c3C)cccc2s1 | CCc1ncc(CN(C)C(=O)Nc2c(C)ccc([N+](=O)[O-])c2C)s1 | CCc1nc2c(CN(C)C(=O)Nc3c(C)ccc([N+](=O)[O-])c3C)cccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2c&cccc2s1",
"old_substring": "c17ncc8s1"
} |
Can you make molecule CCc1ncc(CN(C)C(=O)Nc2c(C)ccc([N+](=O)[O-])c2C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nccc(CN(C)C(=O)Nc2c(C)ccc([N+](=O)[O-])c2C)c1I | CCc1ncc(CN(C)C(=O)Nc2c(C)ccc([N+](=O)[O-])c2C)s1 | CCc1nccc(CN(C)C(=O)Nc2c(C)ccc([N+](=O)[O-])c2C)c1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&nccc&c1I",
"old_substring": "c17ncc8s1"
} |
Can you make molecule CCc1ncc(CN(C)C(=O)Nc2c(C)ccc([N+](=O)[O-])c2C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(CN(C)C(=O)Nc2c(C)ccc([N+](=O)[O-])c2C)sc1Br | CCc1ncc(CN(C)C(=O)Nc2c(C)ccc([N+](=O)[O-])c2C)s1 | CCc1cc(CN(C)C(=O)Nc2c(C)ccc([N+](=O)[O-])c2C)sc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&sc1Br",
"old_substring": "c17ncc8s1"
} |
Can you make molecule c1ccc2nc(NCCCc3nc4ccccc4[nH]3)cnc2c1 less soluble in water? The output molecule should be similar to the input molecule. | c1ccc2nc(NCCCCCc3nc4ccccc4[nH]3)cnc2c1 | c1ccc2nc(NCCCc3nc4ccccc4[nH]3)cnc2c1 | c1ccc2nc(NCCCCCc3nc4ccccc4[nH]3)cnc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C5CC7"
} |
Can you make molecule c1ccc2nc(NCCCc3nc4ccccc4[nH]3)cnc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(CCc1nc2ccccc2[nH]1)=Nc1cnc2ccccc2n1 | c1ccc2nc(NCCCc3nc4ccccc4[nH]3)cnc2c1 | CC(CCc1nc2ccccc2[nH]1)=Nc1cnc2ccccc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C5CC7"
} |
Can you make molecule c1ccc2nc(NCCCc3nc4ccccc4[nH]3)cnc2c1 less soluble in water? The output molecule should be similar to the input molecule. | c1ccc2nc(NC3CCC(c4nc5ccccc5[nH]4)CC3)cnc2c1 | c1ccc2nc(NCCCc3nc4ccccc4[nH]3)cnc2c1 | c1ccc2nc(NC3CCC(c4nc5ccccc5[nH]4)CC3)cnc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C5CC7"
} |
Can you make molecule c1ccc2nc(NCCCc3nc4ccccc4[nH]3)cnc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CNc1cnc2ccccc2n1)Cc1nc2ccccc2[nH]1 | c1ccc2nc(NCCCc3nc4ccccc4[nH]3)cnc2c1 | CC(C)(CNc1cnc2ccccc2n1)Cc1nc2ccccc2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)C&",
"old_substring": "C5CC7"
} |
Can you make molecule c1ccc2nc(NCCCc3nc4ccccc4[nH]3)cnc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1nc2ccccc2[nH]1)Nc1cnc2ccccc2n1 | c1ccc2nc(NCCCc3nc4ccccc4[nH]3)cnc2c1 | CCC[C@@H](CCc1nc2ccccc2[nH]1)Nc1cnc2ccccc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C5CC7"
} |
Can you make molecule Cc1c([C@H](C)[NH2+]Cc2cccn2C)cnn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c([C@H](C)[C@]2(Cc3cccn3C)CCC[NH2+]C2)cnn1C | Cc1c([C@H](C)[NH2+]Cc2cccn2C)cnn1C | Cc1c([C@H](C)[C@]2(Cc3cccn3C)CCC[NH2+]C2)cnn1C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH2+]34"
} |
Can you make molecule Cc1c([C@H](C)[NH2+]Cc2cccn2C)cnn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c([C@H](C)n2c[nH+]cc2Cc2cccn2C)cnn1C | Cc1c([C@H](C)[NH2+]Cc2cccn2C)cnn1C | Cc1c([C@H](C)n2c[nH+]cc2Cc2cccn2C)cnn1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule Cc1c([C@H](C)[NH2+]Cc2cccn2C)cnn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c([C@H](C)c2cc(Cc3cccn3C)[nH][nH+]2)cnn1C | Cc1c([C@H](C)[NH2+]Cc2cccn2C)cnn1C | Cc1c([C@H](C)c2cc(Cc3cccn3C)[nH][nH+]2)cnn1C | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule Cc1c([C@H](C)[NH2+]Cc2cccn2C)cnn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c([C@H](C)c2c(Cc3cccn3C)c[nH+]n2C)cnn1C | Cc1c([C@H](C)[NH2+]Cc2cccn2C)cnn1C | Cc1c([C@H](C)c2c(Cc3cccn3C)c[nH+]n2C)cnn1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule Cc1c([C@H](C)[NH2+]Cc2cccn2C)cnn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c([C@H](C)c2nc(Cc3cccn3C)c(Br)c[nH+]2)cnn1C | Cc1c([C@H](C)[NH2+]Cc2cccn2C)cnn1C | Cc1c([C@H](C)c2nc(Cc3cccn3C)c(Br)c[nH+]2)cnn1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]c&nc&c1Br",
"old_substring": "[NH2+]34"
} |
Can you make molecule CC(=O)N[C@@H](C(=O)NC1COC1)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N1Cc2nc([C@@H](C(=O)NC3COC3)C(C)C)sc2C1 | CC(=O)N[C@@H](C(=O)NC1COC1)C(C)C | CC(=O)N1Cc2nc([C@@H](C(=O)NC3COC3)C(C)C)sc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N24"
} |
Can you make molecule CC(=O)N[C@@H](C(=O)NC1COC1)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N1Cc2cnn([C@@H](C(=O)NC3COC3)C(C)C)c2C1 | CC(=O)N[C@@H](C(=O)NC1COC1)C(C)C | CC(=O)N1Cc2cnn([C@@H](C(=O)NC3COC3)C(C)C)c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2cnn&c2C1",
"old_substring": "N24"
} |
Can you make molecule CC(=O)N[C@@H](C(=O)NC1COC1)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N1CCc2noc([C@@H](C(=O)NC3COC3)C(C)C)c2C1 | CC(=O)N[C@@H](C(=O)NC1COC1)C(C)C | CC(=O)N1CCc2noc([C@@H](C(=O)NC3COC3)C(C)C)c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N24"
} |
Can you make molecule CC(=O)N[C@@H](C(=O)NC1COC1)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N1CCCn2nc([C@@H](C(=O)NC3COC3)C(C)C)cc21 | CC(=O)N[C@@H](C(=O)NC1COC1)C(C)C | CC(=O)N1CCCn2nc([C@@H](C(=O)NC3COC3)C(C)C)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc21",
"old_substring": "N24"
} |
Can you make molecule CC(=O)N[C@@H](C(=O)NC1COC1)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N1CCc2cc([C@@H](C(=O)NC3COC3)C(C)C)ccc21 | CC(=O)N[C@@H](C(=O)NC1COC1)C(C)C | CC(=O)N1CCc2cc([C@@H](C(=O)NC3COC3)C(C)C)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N24"
} |
Can you make molecule O=C(Nc1ccccc1F)c1cc2ccccc2c2cccnc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1cc2ccccc2c2cccnc12)Nc1ccccc1F | O=C(Nc1ccccc1F)c1cc2ccccc2c2cccnc12 | O=C(/C=C/Sc1cc2ccccc2c2cccnc12)Nc1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1ccccc1F)c1cc2ccccc2c2cccnc12 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(Nc2ccccc2F)nc1-c1cc2ccccc2c2cccnc12 | O=C(Nc1ccccc1F)c1cc2ccccc2c2cccnc12 | O=Cc1sc(Nc2ccccc2F)nc1-c1cc2ccccc2c2cccnc12 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1ccccc1F)c1cc2ccccc2c2cccnc12 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(Nc2ccccc2F)sc1-c1cc2ccccc2c2cccnc12 | O=C(Nc1ccccc1F)c1cc2ccccc2c2cccnc12 | O=Cc1nc(Nc2ccccc2F)sc1-c1cc2ccccc2c2cccnc12 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1ccccc1F)c1cc2ccccc2c2cccnc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccccc1F)n1nc(-c2cc3ccccc3c3cccnc23)oc1=S | O=C(Nc1ccccc1F)c1cc2ccccc2c2cccnc12 | O=C(Nc1ccccc1F)n1nc(-c2cc3ccccc3c3cccnc23)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1ccccc1F)c1cc2ccccc2c2cccnc12 less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccccc1NO/N=C/c1ccc(-c2cc3ccccc3c3cccnc23)o1 | O=C(Nc1ccccc1F)c1cc2ccccc2c2cccnc12 | Fc1ccccc1NO/N=C/c1ccc(-c2cc3ccccc3c3cccnc23)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C35"
} |
Can you make molecule Cc1ccccc1N1C(=O)C(=Cc2cccn2-c2cccc([N+](=O)[O-])c2)C([O-])=NC1=S less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2C(=O)C(=Cc3cccn3-c3cccc([N+](=O)[O-])c3)C([O-])=NC2=S)cc1I | Cc1ccccc1N1C(=O)C(=Cc2cccn2-c2cccc([N+](=O)[O-])c2)C([O-])=NC1=S | Cc1ccc(N2C(=O)C(=Cc3cccn3-c3cccc([N+](=O)[O-])c3)C([O-])=NC2=S)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "Cc1ccccc15"
} |
Can you make molecule Cc1ccccc1N1C(=O)C(=Cc2cccn2-c2cccc([N+](=O)[O-])c2)C([O-])=NC1=S less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2C(=O)C(=Cc3cccn3-c3cccc([N+](=O)[O-])c3)C([O-])=NC2=S)cc1Cl | Cc1ccccc1N1C(=O)C(=Cc2cccn2-c2cccc([N+](=O)[O-])c2)C([O-])=NC1=S | Cc1ccc(N2C(=O)C(=Cc3cccn3-c3cccc([N+](=O)[O-])c3)C([O-])=NC2=S)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1Cl",
"old_substring": "Cc1ccccc15"
} |
Can you make molecule Cc1ccccc1N1C(=O)C(=Cc2cccn2-c2cccc([N+](=O)[O-])c2)C([O-])=NC1=S less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(I)ccc1N1C(=O)C(=Cc2cccn2-c2cccc([N+](=O)[O-])c2)C([O-])=NC1=S | Cc1ccccc1N1C(=O)C(=Cc2cccn2-c2cccc([N+](=O)[O-])c2)C([O-])=NC1=S | Cc1cc(I)ccc1N1C(=O)C(=Cc2cccn2-c2cccc([N+](=O)[O-])c2)C([O-])=NC1=S | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(I)ccc1&",
"old_substring": "Cc1ccccc15"
} |
Can you make molecule Cc1ccccc1N1C(=O)C(=Cc2cccn2-c2cccc([N+](=O)[O-])c2)C([O-])=NC1=S less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(I)c(N2C(=O)C(=Cc3cccn3-c3cccc([N+](=O)[O-])c3)C([O-])=NC2=S)c1 | Cc1ccccc1N1C(=O)C(=Cc2cccn2-c2cccc([N+](=O)[O-])c2)C([O-])=NC1=S | Cc1ccc(I)c(N2C(=O)C(=Cc3cccn3-c3cccc([N+](=O)[O-])c3)C([O-])=NC2=S)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(I)c&c1",
"old_substring": "Cc1ccccc15"
} |
Can you make molecule Cc1ccccc1N1C(=O)C(=Cc2cccn2-c2cccc([N+](=O)[O-])c2)C([O-])=NC1=S less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Br)c(N2C(=O)C(=Cc3cccn3-c3cccc([N+](=O)[O-])c3)C([O-])=NC2=S)c1 | Cc1ccccc1N1C(=O)C(=Cc2cccn2-c2cccc([N+](=O)[O-])c2)C([O-])=NC1=S | Cc1ccc(Br)c(N2C(=O)C(=Cc3cccn3-c3cccc([N+](=O)[O-])c3)C([O-])=NC2=S)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(Br)c&c1",
"old_substring": "Cc1ccccc15"
} |
Can you make molecule COCCN1C[C@H](C(=O)N(Cc2cccc(Cl)c2)C(C)C)CC1=O less soluble in water? The output molecule should be similar to the input molecule. | COCCN1C[C@H](CC(=O)SN(Cc2cccc(Cl)c2)C(C)C)CC1=O | COCCN1C[C@H](C(=O)N(Cc2cccc(Cl)c2)C(C)C)CC1=O | COCCN1C[C@H](CC(=O)SN(Cc2cccc(Cl)c2)C(C)C)CC1=O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C37=O"
} |
Can you make molecule COCCN1C[C@H](C(=O)N(Cc2cccc(Cl)c2)C(C)C)CC1=O less soluble in water? The output molecule should be similar to the input molecule. | COCCN1C[C@H](CC(=C=O)CN(Cc2cccc(Cl)c2)C(C)C)CC1=O | COCCN1C[C@H](C(=O)N(Cc2cccc(Cl)c2)C(C)C)CC1=O | COCCN1C[C@H](CC(=C=O)CN(Cc2cccc(Cl)c2)C(C)C)CC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C37=O"
} |
Can you make molecule COCCN1C[C@H](C(=O)N(Cc2cccc(Cl)c2)C(C)C)CC1=O less soluble in water? The output molecule should be similar to the input molecule. | COCCN1C[C@H](C(=O)CCCC(=O)N(Cc2cccc(Cl)c2)C(C)C)CC1=O | COCCN1C[C@H](C(=O)N(Cc2cccc(Cl)c2)C(C)C)CC1=O | COCCN1C[C@H](C(=O)CCCC(=O)N(Cc2cccc(Cl)c2)C(C)C)CC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C37=O"
} |
Can you make molecule COCCN1C[C@H](C(=O)N(Cc2cccc(Cl)c2)C(C)C)CC1=O less soluble in water? The output molecule should be similar to the input molecule. | COCCN1C[C@H](C(C)(C)CC(=O)N(Cc2cccc(Cl)c2)C(C)C)CC1=O | COCCN1C[C@H](C(=O)N(Cc2cccc(Cl)c2)C(C)C)CC1=O | COCCN1C[C@H](C(C)(C)CC(=O)N(Cc2cccc(Cl)c2)C(C)C)CC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule COCCN1C[C@H](C(=O)N(Cc2cccc(Cl)c2)C(C)C)CC1=O less soluble in water? The output molecule should be similar to the input molecule. | COCCN1C[C@H](CCC[S@@+]([O-])CN(Cc2cccc(Cl)c2)C(C)C)CC1=O | COCCN1C[C@H](C(=O)N(Cc2cccc(Cl)c2)C(C)C)CC1=O | COCCN1C[C@H](CCC[S@@+]([O-])CN(Cc2cccc(Cl)c2)C(C)C)CC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C37=O"
} |
Can you make molecule COc1ccc(NC(=O)N2CCN(C(=O)Cc3csc4ccccc34)CC2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)N2CCN(C(=O)C3=C(N)CCS3)CC2)cc1OC.c1ccc2sccc2c1 | COc1ccc(NC(=O)N2CCN(C(=O)Cc3csc4ccccc34)CC2)cc1OC | COc1ccc(NC(=O)N2CCN(C(=O)C3=C(N)CCS3)CC2)cc1OC.c1ccc2sccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=C(N&)CCS1",
"old_substring": "C7(=O)C%11"
} |
Can you make molecule COc1ccc(NC(=O)N2CCN(C(=O)Cc3csc4ccccc34)CC2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)N2CCN(SC(C)=O)CC2)cc1OC.c1ccc2sccc2c1 | COc1ccc(NC(=O)N2CCN(C(=O)Cc3csc4ccccc34)CC2)cc1OC | COc1ccc(NC(=O)N2CCN(SC(C)=O)CC2)cc1OC.c1ccc2sccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C7(=O)C%11"
} |
Can you make molecule COc1ccc(NC(=O)N2CCN(C(=O)Cc3csc4ccccc34)CC2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)N2CCN(C(=O)n3scnc3=N)CC2)cc1OC.c1ccc2sccc2c1 | COc1ccc(NC(=O)N2CCN(C(=O)Cc3csc4ccccc34)CC2)cc1OC | COc1ccc(NC(=O)N2CCN(C(=O)n3scnc3=N)CC2)cc1OC.c1ccc2sccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)n1sc&nc1=N",
"old_substring": "C7(=O)C%11"
} |
Can you make molecule COc1ccc(NC(=O)N2CCN(C(=O)Cc3csc4ccccc34)CC2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)N2CCN(C(=O)N3CCCCN3C=O)CC2)cc1OC.c1ccc2sccc2c1 | COc1ccc(NC(=O)N2CCN(C(=O)Cc3csc4ccccc34)CC2)cc1OC | COc1ccc(NC(=O)N2CCN(C(=O)N3CCCCN3C=O)CC2)cc1OC.c1ccc2sccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)N1CCCCN1C&=O",
"old_substring": "C7(=O)C%11"
} |
Can you make molecule COc1ccc(NC(=O)N2CCN(C(=O)Cc3csc4ccccc34)CC2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)N2CCN(C(=O)NNc3ccccc3)CC2)cc1OC.c1ccc2sccc2c1 | COc1ccc(NC(=O)N2CCN(C(=O)Cc3csc4ccccc34)CC2)cc1OC | COc1ccc(NC(=O)N2CCN(C(=O)NNc3ccccc3)CC2)cc1OC.c1ccc2sccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)NNc1ccccc1&",
"old_substring": "C7(=O)C%11"
} |
Can you make molecule C#CCN(C[C@H]1CCCO1)C(=O)N[C@@H](C)c1cccc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCC1=C2CCN2CC(C(=O)N[C@@H](C)c2cccc([N+](=O)[O-])c2)=NC(C[C@H]2CCCO2)=N1 | C#CCN(C[C@H]1CCCO1)C(=O)N[C@@H](C)c1cccc([N+](=O)[O-])c1 | C#CCC1=C2CCN2CC(C(=O)N[C@@H](C)c2cccc([N+](=O)[O-])c2)=NC(C[C@H]2CCCO2)=N1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c&nc&nc2C1",
"old_substring": "N245"
} |
Can you make molecule C#CCN(C[C@H]1CCCO1)C(=O)N[C@@H](C)c1cccc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCC1=C2OCCN2CC(C(=O)N[C@@H](C)c2cccc([N+](=O)[O-])c2)=CC(C[C@H]2CCCO2)=C1 | C#CCN(C[C@H]1CCCO1)C(=O)N[C@@H](C)c1cccc([N+](=O)[O-])c1 | C#CCC1=C2OCCN2CC(C(=O)N[C@@H](C)c2cccc([N+](=O)[O-])c2)=CC(C[C@H]2CCCO2)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2c&cc&cc2C1",
"old_substring": "N245"
} |
Can you make molecule C#CCN(C[C@H]1CCCO1)C(=O)N[C@@H](C)c1cccc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCC1(C[C@H]2CCCO2)CCN(C(=O)N[C@@H](C)c2cccc([N+](=O)[O-])c2)C1 | C#CCN(C[C@H]1CCCO1)C(=O)N[C@@H](C)c1cccc([N+](=O)[O-])c1 | C#CCC1(C[C@H]2CCCO2)CCN(C(=O)N[C@@H](C)c2cccc([N+](=O)[O-])c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N245"
} |
Can you make molecule C#CCN(C[C@H]1CCCO1)C(=O)N[C@@H](C)c1cccc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCC1(C[C@H]2CCCO2)CCCN(C(=O)N[C@@H](C)c2cccc([N+](=O)[O-])c2)C1 | C#CCN(C[C@H]1CCCO1)C(=O)N[C@@H](C)c1cccc([N+](=O)[O-])c1 | C#CCC1(C[C@H]2CCCO2)CCCN(C(=O)N[C@@H](C)c2cccc([N+](=O)[O-])c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N245"
} |
Can you make molecule C#CCN(C[C@H]1CCCO1)C(=O)N[C@@H](C)c1cccc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCc1oc(C(=O)N[C@@H](C)c2cccc([N+](=O)[O-])c2)c(C#N)c1C[C@H]1CCCO1 | C#CCN(C[C@H]1CCCO1)C(=O)N[C@@H](C)c1cccc([N+](=O)[O-])c1 | C#CCc1oc(C(=O)N[C@@H](C)c2cccc([N+](=O)[O-])c2)c(C#N)c1C[C@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N245"
} |
Can you make molecule Cc1cccc(C2=CCN(C(=O)Nc3ccc(C(N)=O)c(Cl)c3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)c1ccc(NC(=O)N2CC=C(c3cccc(C)c3)CC2)cc1Cl | Cc1cccc(C2=CCN(C(=O)Nc3ccc(C(N)=O)c(Cl)c3)CC2)c1 | CC(=O)c1ccc(NC(=O)N2CC=C(c3cccc(C)c3)CC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)=O",
"old_substring": "C7(N)=O"
} |
Can you make molecule Cc1cccc(C2=CCN(C(=O)Nc3ccc(C(N)=O)c(Cl)c3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C2=CCN(C(=O)Nc3ccc(CCCCC(N)=O)c(Cl)c3)CC2)c1 | Cc1cccc(C2=CCN(C(=O)Nc3ccc(C(N)=O)c(Cl)c3)CC2)c1 | Cc1cccc(C2=CCN(C(=O)Nc3ccc(CCCCC(N)=O)c(Cl)c3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C7(N)=O"
} |
Can you make molecule Cc1cccc(C2=CCN(C(=O)Nc3ccc(C(N)=O)c(Cl)c3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C2=CCN(C(=O)Nc3ccc(CC/C(N)=N/O)c(Cl)c3)CC2)c1 | Cc1cccc(C2=CCN(C(=O)Nc3ccc(C(N)=O)c(Cl)c3)CC2)c1 | Cc1cccc(C2=CCN(C(=O)Nc3ccc(CC/C(N)=N/O)c(Cl)c3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N/O",
"old_substring": "C7(N)=O"
} |
Can you make molecule Cc1cccc(C2=CCN(C(=O)Nc3ccc(C(N)=O)c(Cl)c3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C2=CCN(C(=O)Nc3ccc(CC/C(N)=N\O)c(Cl)c3)CC2)c1 | Cc1cccc(C2=CCN(C(=O)Nc3ccc(C(N)=O)c(Cl)c3)CC2)c1 | Cc1cccc(C2=CCN(C(=O)Nc3ccc(CC/C(N)=N\O)c(Cl)c3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N\\O",
"old_substring": "C7(N)=O"
} |
Can you make molecule Cc1cccc(C2=CCN(C(=O)Nc3ccc(C(N)=O)c(Cl)c3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C2=CCN(C(=O)Nc3ccc(CC(N)=S)c(Cl)c3)CC2)c1 | Cc1cccc(C2=CCN(C(=O)Nc3ccc(C(N)=O)c(Cl)c3)CC2)c1 | Cc1cccc(C2=CCN(C(=O)Nc3ccc(CC(N)=S)c(Cl)c3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(N)=S",
"old_substring": "C7(N)=O"
} |
Can you make molecule COCCCN1C(=O)c2ccc(C(=O)Nc3nc(-c4ccc(C)cc4)cs3)cc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | COCCCN1C(=O)c2ccc(C(=O)Nc3nccs3)cc2C1=O.Cc1cccc(Cl)c1 | COCCCN1C(=O)c2ccc(C(=O)Nc3nc(-c4ccc(C)cc4)cs3)cc2C1=O | COCCCN1C(=O)c2ccc(C(=O)Nc3nccs3)cc2C1=O.Cc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)cc1Cl",
"old_substring": "c1%10ccc(C)cc1"
} |
Can you make molecule COCCCN1C(=O)c2ccc(C(=O)Nc3nc(-c4ccc(C)cc4)cs3)cc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | COCCCN1C(=O)c2ccc(C(=O)Nc3nccs3)cc2C1=O.Clc1cccc(I)c1 | COCCCN1C(=O)c2ccc(C(=O)Nc3nc(-c4ccc(C)cc4)cs3)cc2C1=O | COCCCN1C(=O)c2ccc(C(=O)Nc3nccs3)cc2C1=O.Clc1cccc(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c1%10ccc(C)cc1"
} |
Can you make molecule COCCCN1C(=O)c2ccc(C(=O)Nc3nc(-c4ccc(C)cc4)cs3)cc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | COCCCN1C(=O)c2ccc(C(=O)Nc3nccs3)cc2C1=O.Ic1ccccc1 | COCCCN1C(=O)c2ccc(C(=O)Nc3nc(-c4ccc(C)cc4)cs3)cc2C1=O | COCCCN1C(=O)c2ccc(C(=O)Nc3nccs3)cc2C1=O.Ic1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c1%10ccc(C)cc1"
} |
Can you make molecule COCCCN1C(=O)c2ccc(C(=O)Nc3nc(-c4ccc(C)cc4)cs3)cc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | COCCCN1C(=O)c2ccc(C(=O)Nc3nccs3)cc2C1=O.Cc1ccc(C)cc1 | COCCCN1C(=O)c2ccc(C(=O)Nc3nc(-c4ccc(C)cc4)cs3)cc2C1=O | COCCCN1C(=O)c2ccc(C(=O)Nc3nccs3)cc2C1=O.Cc1ccc(C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(C)c&c1",
"old_substring": "c1%10ccc(C)cc1"
} |
Can you make molecule COCCCN1C(=O)c2ccc(C(=O)Nc3nc(-c4ccc(C)cc4)cs3)cc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | COCCCN1C(=O)c2ccc(C(=O)Nc3nccs3)cc2C1=O.Clc1cccc(Br)c1 | COCCCN1C(=O)c2ccc(C(=O)Nc3nc(-c4ccc(C)cc4)cs3)cc2C1=O | COCCCN1C(=O)c2ccc(C(=O)Nc3nccs3)cc2C1=O.Clc1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c1%10ccc(C)cc1"
} |
Can you make molecule O=S(=O)(Nc1ccc(N2CCCS2(=O)=O)cc1)c1ccc(F)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCS(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(F)c(Cl)c2)cc1 | O=S(=O)(Nc1ccc(N2CCCS2(=O)=O)cc1)c1ccc(F)c(Cl)c1 | CCCS(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(F)c(Cl)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCS&(=O)=O",
"old_substring": "N15CCCS1(=O)=O"
} |
Can you make molecule O=S(=O)(Nc1ccc(N2CCCS2(=O)=O)cc1)c1ccc(F)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCS(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(F)c(Cl)c2)cc1 | O=S(=O)(Nc1ccc(N2CCCS2(=O)=O)cc1)c1ccc(F)c(Cl)c1 | CCCCS(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(F)c(Cl)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCS&(=O)=O",
"old_substring": "N15CCCS1(=O)=O"
} |
Can you make molecule O=S(=O)(Nc1ccc(N2CCCS2(=O)=O)cc1)c1ccc(F)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCS(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(F)c(Cl)c2)cc1 | O=S(=O)(Nc1ccc(N2CCCS2(=O)=O)cc1)c1ccc(F)c(Cl)c1 | C=CCS(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(F)c(Cl)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCS&(=O)=O",
"old_substring": "N15CCCS1(=O)=O"
} |
Can you make molecule O=S(=O)(Nc1ccc(N2CCCS2(=O)=O)cc1)c1ccc(F)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(F)c(Cl)c2)cc1 | O=S(=O)(Nc1ccc(N2CCCS2(=O)=O)cc1)c1ccc(F)c(Cl)c1 | CCS(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(F)c(Cl)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCS&(=O)=O",
"old_substring": "N15CCCS1(=O)=O"
} |
Can you make molecule O=S(=O)(Nc1ccc(N2CCCS2(=O)=O)cc1)c1ccc(F)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CCCC(=O)N1c1ccc(NS(=O)(=O)c2ccc(F)c(Cl)c2)cc1 | O=S(=O)(Nc1ccc(N2CCCS2(=O)=O)cc1)c1ccc(F)c(Cl)c1 | O=C1CCCC(=O)N1c1ccc(NS(=O)(=O)c2ccc(F)c(Cl)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&C(=O)CCCC1=O",
"old_substring": "N15CCCS1(=O)=O"
} |
Can you make molecule O=C1C(=Cc2ccccc2)Oc2c1ccc1c2CN(Cc2cccs2)CO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=Cc2ccccc2)Oc2c1ccc1c2CN(Cc2ccc(Cl)s2)CO1 | O=C1C(=Cc2ccccc2)Oc2c1ccc1c2CN(Cc2cccs2)CO1 | O=C1C(=Cc2ccccc2)Oc2c1ccc1c2CN(Cc2ccc(Cl)s2)CO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c15cccs1"
} |
Can you make molecule O=C1C(=Cc2ccccc2)Oc2c1ccc1c2CN(Cc2cccs2)CO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=Cc2ccccc2)Oc2c1ccc1c2CN(Cc2ccc(Br)s2)CO1 | O=C1C(=Cc2ccccc2)Oc2c1ccc1c2CN(Cc2cccs2)CO1 | O=C1C(=Cc2ccccc2)Oc2c1ccc1c2CN(Cc2ccc(Br)s2)CO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c15cccs1"
} |
Can you make molecule O=C1C(=Cc2ccccc2)Oc2c1ccc1c2CN(Cc2cccs2)CO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=Cc2ccccc2)Oc2c1ccc1c2CN(Cc2sccc2Br)CO1 | O=C1C(=Cc2ccccc2)Oc2c1ccc1c2CN(Cc2cccs2)CO1 | O=C1C(=Cc2ccccc2)Oc2c1ccc1c2CN(Cc2sccc2Br)CO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c15cccs1"
} |
Can you make molecule O=C1C(=Cc2ccccc2)Oc2c1ccc1c2CN(Cc2cccs2)CO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=Cc2ccccc2)Oc2c1ccc1c2CN(Cc2csc(I)c2)CO1 | O=C1C(=Cc2ccccc2)Oc2c1ccc1c2CN(Cc2cccs2)CO1 | O=C1C(=Cc2ccccc2)Oc2c1ccc1c2CN(Cc2csc(I)c2)CO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(I)c1",
"old_substring": "c15cccs1"
} |
Can you make molecule O=C1C(=Cc2ccccc2)Oc2c1ccc1c2CN(Cc2cccs2)CO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=Cc2ccccc2)Oc2c1ccc1c2CN(Cc2cc3c(s2)CSC3)CO1 | O=C1C(=Cc2ccccc2)Oc2c1ccc1c2CN(Cc2cccs2)CO1 | O=C1C(=Cc2ccccc2)Oc2c1ccc1c2CN(Cc2cc3c(s2)CSC3)CO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(s1)CSC2",
"old_substring": "c15cccs1"
} |
Can you make molecule CC[C@@H](C)[C@@H](NC(=O)c1cccc(F)c1)C(=O)N=c1[nH]c2ccccc2[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)[C@@H](NSC(=O)Cc1cccc(F)c1)C(=O)N=c1[nH]c2ccccc2[nH]1 | CC[C@@H](C)[C@@H](NC(=O)c1cccc(F)c1)C(=O)N=c1[nH]c2ccccc2[nH]1 | CC[C@@H](C)[C@@H](NSC(=O)Cc1cccc(F)c1)C(=O)N=c1[nH]c2ccccc2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule CC[C@@H](C)[C@@H](NC(=O)c1cccc(F)c1)C(=O)N=c1[nH]c2ccccc2[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)[C@@H](NC(=O)CCCC(=O)c1cccc(F)c1)C(=O)N=c1[nH]c2ccccc2[nH]1 | CC[C@@H](C)[C@@H](NC(=O)c1cccc(F)c1)C(=O)N=c1[nH]c2ccccc2[nH]1 | CC[C@@H](C)[C@@H](NC(=O)CCCC(=O)c1cccc(F)c1)C(=O)N=c1[nH]c2ccccc2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule CC[C@@H](C)[C@@H](NC(=O)c1cccc(F)c1)C(=O)N=c1[nH]c2ccccc2[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)[C@@H](NC(=O)CC(C)(C)c1cccc(F)c1)C(=O)N=c1[nH]c2ccccc2[nH]1 | CC[C@@H](C)[C@@H](NC(=O)c1cccc(F)c1)C(=O)N=c1[nH]c2ccccc2[nH]1 | CC[C@@H](C)[C@@H](NC(=O)CC(C)(C)c1cccc(F)c1)C(=O)N=c1[nH]c2ccccc2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CC[C@@H](C)[C@@H](NC(=O)c1cccc(F)c1)C(=O)N=c1[nH]c2ccccc2[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)[C@@H](NC(=O)CCC(C)(C)c1cccc(F)c1)C(=O)N=c1[nH]c2ccccc2[nH]1 | CC[C@@H](C)[C@@H](NC(=O)c1cccc(F)c1)C(=O)N=c1[nH]c2ccccc2[nH]1 | CC[C@@H](C)[C@@H](NC(=O)CCC(C)(C)c1cccc(F)c1)C(=O)N=c1[nH]c2ccccc2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CC[C@@H](C)[C@@H](NC(=O)c1cccc(F)c1)C(=O)N=c1[nH]c2ccccc2[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)[C@@H](NSC(=O)[C@@H](C)c1cccc(F)c1)C(=O)N=c1[nH]c2ccccc2[nH]1 | CC[C@@H](C)[C@@H](NC(=O)c1cccc(F)c1)C(=O)N=c1[nH]c2ccccc2[nH]1 | CC[C@@H](C)[C@@H](NSC(=O)[C@@H](C)c1cccc(F)c1)C(=O)N=c1[nH]c2ccccc2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1c(F)cc(N)cc1S(=O)(=O)N[C@@H](C)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(F)cc(N)cc1S(=O)(=O)N[C@@H](C)C1CCCCC1 | Cc1c(F)cc(N)cc1S(=O)(=O)N[C@@H](C)C1CC1 | Cc1c(F)cc(N)cc1S(=O)(=O)N[C@@H](C)C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C14CC1"
} |
Can you make molecule Cc1c(F)cc(N)cc1S(=O)(=O)N[C@@H](C)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(F)cc(N)cc1S(=O)(=O)N[C@@H](C)C1SCCCS1 | Cc1c(F)cc(N)cc1S(=O)(=O)N[C@@H](C)C1CC1 | Cc1c(F)cc(N)cc1S(=O)(=O)N[C@@H](C)C1SCCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C14CC1"
} |
Can you make molecule Cc1c(F)cc(N)cc1S(=O)(=O)N[C@@H](C)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(F)cc(N)cc1S(=O)(=O)N[C@@H](C)C1SCSCS1 | Cc1c(F)cc(N)cc1S(=O)(=O)N[C@@H](C)C1CC1 | Cc1c(F)cc(N)cc1S(=O)(=O)N[C@@H](C)C1SCSCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C14CC1"
} |
Can you make molecule Cc1c(F)cc(N)cc1S(=O)(=O)N[C@@H](C)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(F)cc(N)cc1S(=O)(=O)N[C@@H](C)C1CCCCCC1 | Cc1c(F)cc(N)cc1S(=O)(=O)N[C@@H](C)C1CC1 | Cc1c(F)cc(N)cc1S(=O)(=O)N[C@@H](C)C1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C14CC1"
} |
Can you make molecule Cc1c(F)cc(N)cc1S(=O)(=O)N[C@@H](C)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(F)cc(N)cc1S(=O)(=O)N[C@@H](C)C1CSCCSC1 | Cc1c(F)cc(N)cc1S(=O)(=O)N[C@@H](C)C1CC1 | Cc1c(F)cc(N)cc1S(=O)(=O)N[C@@H](C)C1CSCCSC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CSCCSC1",
"old_substring": "C14CC1"
} |
Can you make molecule Cc1ccc(Cn2ncc3c(N)ncnc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cn2ncc3c(N)ncnc32)cc1I | Cc1ccc(Cn2ncc3c(N)ncnc32)cc1 | Cc1ccc(Cn2ncc3c(N)ncnc32)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "Cc1ccc5cc1"
} |
Can you make molecule Cc1ccc(Cn2ncc3c(N)ncnc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C=Cn1ncc2c(N)ncnc21 | Cc1ccc(Cn2ncc3c(N)ncnc32)cc1 | Cc1ccccc1C=Cn1ncc2c(N)ncnc21 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccccc1C=&",
"old_substring": "Cc1ccc5cc1"
} |
Can you make molecule Cc1ccc(Cn2ncc3c(N)ncnc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cn2ncc3c(N)ncnc32)cc1Cl | Cc1ccc(Cn2ncc3c(N)ncnc32)cc1 | Cc1ccc(Cn2ncc3c(N)ncnc32)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1Cl",
"old_substring": "Cc1ccc5cc1"
} |
Can you make molecule Cc1ccc(Cn2ncc3c(N)ncnc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(I)ccc1Cn1ncc2c(N)ncnc21 | Cc1ccc(Cn2ncc3c(N)ncnc32)cc1 | Cc1cc(I)ccc1Cn1ncc2c(N)ncnc21 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(I)ccc1&",
"old_substring": "Cc1ccc5cc1"
} |
Can you make molecule Cc1ccc(Cn2ncc3c(N)ncnc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(I)c(Cn2ncc3c(N)ncnc32)c1 | Cc1ccc(Cn2ncc3c(N)ncnc32)cc1 | Cc1ccc(I)c(Cn2ncc3c(N)ncnc32)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(I)c&c1",
"old_substring": "Cc1ccc5cc1"
} |
Can you make molecule CCOC(=O)C(C)(C)c1nc(-c2ccccc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSOC(=O)C(C)(C)c1nc(-c2ccccc2)no1 | CCOC(=O)C(C)(C)c1nc(-c2ccccc2)no1 | C=CSOC(=O)C(C)(C)c1nc(-c2ccccc2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)C(C)(C)c1nc(-c2ccccc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOC(=O)C(C)(C)c1nc(-c2ccccc2)no1 | CCOC(=O)C(C)(C)c1nc(-c2ccccc2)no1 | C=CCCOC(=O)C(C)(C)c1nc(-c2ccccc2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)C(C)(C)c1nc(-c2ccccc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C(=O)OCCCCl)c1nc(-c2ccccc2)no1 | CCOC(=O)C(C)(C)c1nc(-c2ccccc2)no1 | CC(C)(C(=O)OCCCCl)c1nc(-c2ccccc2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)C(C)(C)c1nc(-c2ccccc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C(=O)OCCCCS)c1nc(-c2ccccc2)no1 | CCOC(=O)C(C)(C)c1nc(-c2ccccc2)no1 | CC(C)(C(=O)OCCCCS)c1nc(-c2ccccc2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)C(C)(C)c1nc(-c2ccccc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C(=O)OCCCBr)c1nc(-c2ccccc2)no1 | CCOC(=O)C(C)(C)c1nc(-c2ccccc2)no1 | CC(C)(C(=O)OCCCBr)c1nc(-c2ccccc2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)c1sc(C=Cc2nc3c(s2)CCC3)nc1C less soluble in water? The output molecule should be similar to the input molecule. | C=CSOC(=O)c1sc(C=Cc2nc3c(s2)CCC3)nc1C | CCOC(=O)c1sc(C=Cc2nc3c(s2)CCC3)nc1C | C=CSOC(=O)c1sc(C=Cc2nc3c(s2)CCC3)nc1C | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC5"
} |
Can you make molecule CCOC(=O)c1sc(C=Cc2nc3c(s2)CCC3)nc1C less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOC(=O)c1sc(C=Cc2nc3c(s2)CCC3)nc1C | CCOC(=O)c1sc(C=Cc2nc3c(s2)CCC3)nc1C | C=CCCOC(=O)c1sc(C=Cc2nc3c(s2)CCC3)nc1C | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CCOC(=O)c1sc(C=Cc2nc3c(s2)CCC3)nc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C=Cc2nc3c(s2)CCC3)sc1C(=O)OCCCCl | CCOC(=O)c1sc(C=Cc2nc3c(s2)CCC3)nc1C | Cc1nc(C=Cc2nc3c(s2)CCC3)sc1C(=O)OCCCCl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC5"
} |
Can you make molecule CCOC(=O)c1sc(C=Cc2nc3c(s2)CCC3)nc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C=Cc2nc3c(s2)CCC3)sc1C(=O)OCCCCS | CCOC(=O)c1sc(C=Cc2nc3c(s2)CCC3)nc1C | Cc1nc(C=Cc2nc3c(s2)CCC3)sc1C(=O)OCCCCS | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC5"
} |
Can you make molecule CCOC(=O)c1sc(C=Cc2nc3c(s2)CCC3)nc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C=Cc2nc3c(s2)CCC3)sc1C(=O)OCCCBr | CCOC(=O)c1sc(C=Cc2nc3c(s2)CCC3)nc1C | Cc1nc(C=Cc2nc3c(s2)CCC3)sc1C(=O)OCCCBr | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC5"
} |
Can you make molecule C[C@@H]1CC[C@@H]([NH2+]C2CCC(NS(C)(=O)=O)CC2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)S(=O)(=O)NC1CCC([NH2+][C@@H]2CC[C@@H](C)c3ccccc32)CC1 | C[C@@H]1CC[C@@H]([NH2+]C2CCC(NS(C)(=O)=O)CC2)c2ccccc21 | CC(C)S(=O)(=O)NC1CCC([NH2+][C@@H]2CC[C@@H](C)c3ccccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)S&(=O)=O",
"old_substring": "S3(C)(=O)=O"
} |
Can you make molecule C[C@@H]1CC[C@@H]([NH2+]C2CCC(NS(C)(=O)=O)CC2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CS(=O)(=O)NC1CCC([NH2+][C@@H]2CC[C@@H](C)c3ccccc32)CC1 | C[C@@H]1CC[C@@H]([NH2+]C2CCC(NS(C)(=O)=O)CC2)c2ccccc21 | CC(C)CS(=O)(=O)NC1CCC([NH2+][C@@H]2CC[C@@H](C)c3ccccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CS&(=O)=O",
"old_substring": "S3(C)(=O)=O"
} |
Can you make molecule C[C@@H]1CC[C@@H]([NH2+]C2CCC(NS(C)(=O)=O)CC2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC[C@@H]([NH2+]C2CCC(NCCCCS(C)(=O)=O)CC2)c2ccccc21 | C[C@@H]1CC[C@@H]([NH2+]C2CCC(NS(C)(=O)=O)CC2)c2ccccc21 | C[C@@H]1CC[C@@H]([NH2+]C2CCC(NCCCCS(C)(=O)=O)CC2)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS(C)(=O)=O",
"old_substring": "S3(C)(=O)=O"
} |
Can you make molecule C[C@@H]1CC[C@@H]([NH2+]C2CCC(NS(C)(=O)=O)CC2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC[C@@H]([NH2+]C2CCC(NC(=O)N=S(C)(C)=O)CC2)c2ccccc21 | C[C@@H]1CC[C@@H]([NH2+]C2CCC(NS(C)(=O)=O)CC2)c2ccccc21 | C[C@@H]1CC[C@@H]([NH2+]C2CCC(NC(=O)N=S(C)(C)=O)CC2)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CS(C)(=O)=NC&=O",
"old_substring": "S3(C)(=O)=O"
} |
Can you make molecule C[C@@H]1CC[C@@H]([NH2+]C2CCC(NS(C)(=O)=O)CC2)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)S(=O)(=O)CNC1CCC([NH2+][C@@H]2CC[C@@H](C)c3ccccc32)CC1 | C[C@@H]1CC[C@@H]([NH2+]C2CCC(NS(C)(=O)=O)CC2)c2ccccc21 | CC(C)S(=O)(=O)CNC1CCC([NH2+][C@@H]2CC[C@@H](C)c3ccccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)S(=O)(=O)C&",
"old_substring": "S3(C)(=O)=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.