repo_name
stringlengths
6
69
path
stringlengths
6
178
copies
stringclasses
278 values
size
stringlengths
4
7
content
stringlengths
671
917k
license
stringclasses
15 values
yinlei/tgame
game/player/init.lua
1
1255
------------------------------------------------------------------------------- -- player ------------------------------------------------------------------------------- local _PACKAGE = string.gsub(...,"%.","/") or "" local pcall, assert, table_copy = pcall, assert, table.copy local tlen = table.lenght local actor = tengine.actor local _M = require(_PACKAGE.."/player") require(_PACKAGE.."/agent") local players = {} local function create(...) local _player = _M:new(...) if not _player then return end players[_player:id()] = _player return _player end local function destory(id) players[id] = nil end local function find(id) return players[id] end local function count() return tlen(players) end local _call_meta = {} _call_meta.__index = function(t, key) local context = t local f = key return function(...) local succ, ret = actor.call(context[1], "call", f, context[2], ...) return succ, ret end end _call_meta.__newindex = function(t, key, value) end local function proxy(service) local _service = table_copy(service) return setmetatable(_service, _call_meta) end return { create = create, destory = destory, find = find, proxy = proxy, }
mit
mwoz123/koreader
plugins/calibre.koplugin/main.lua
1
12753
--[[ This plugin implements KOReader integration with *some* calibre features: - metadata search - wireless transfers This module handles the UI part of the plugin. --]] local BD = require("ui/bidi") local CalibreSearch = require("search") local CalibreWireless = require("wireless") local Dispatcher = require("dispatcher") local InfoMessage = require("ui/widget/infomessage") local LuaSettings = require("luasettings") local UIManager = require("ui/uimanager") local WidgetContainer = require("ui/widget/container/widgetcontainer") local _ = require("gettext") local T = require("ffi/util").template local Calibre = WidgetContainer:new{ name = "calibre", is_doc_only = false, } function Calibre:onCalibreSearch() CalibreSearch:ShowSearch() return true end function Calibre:onCalibreBrowseTags() CalibreSearch.search_value = "" CalibreSearch:find("tags", 1) return true end function Calibre:onCalibreBrowseSeries() CalibreSearch.search_value = "" CalibreSearch:find("series", 1) return true end function Calibre:onNetworkDisconnected() self:closeWirelessConnection() end function Calibre:onSuspend() self:closeWirelessConnection() end function Calibre:onClose() self:closeWirelessConnection() end function Calibre:closeWirelessConnection() if CalibreWireless.calibre_socket then CalibreWireless:disconnect() end end function Calibre:onDispatcherRegisterActions() Dispatcher:registerAction("calibre_search", { category="none", event="CalibreSearch", title=_("Calibre metadata search"), device=true,}) Dispatcher:registerAction("calibre_browse_tags", { category="none", event="CalibreBrowseTags", title=_("Browse all calibre tags"), device=true,}) Dispatcher:registerAction("calibre_browse_series", { category="none", event="CalibreBrowseSeries", title=_("Browse all calibre series"), device=true, separator=true,}) end function Calibre:init() CalibreWireless:init() self:onDispatcherRegisterActions() self.ui.menu:registerToMainMenu(self) end function Calibre:addToMainMenu(menu_items) menu_items.calibre = { -- its name is "calibre", but all our top menu items are uppercase. text = _("Calibre"), sub_item_table = { { text_func = function() if CalibreWireless.calibre_socket then return _("Disconnect") else return _("Connect") end end, separator = true, enabled_func = function() return G_reader_settings:nilOrTrue("calibre_wireless") end, callback = function() if not CalibreWireless.calibre_socket then CalibreWireless:connect() else CalibreWireless:disconnect() end end, }, { text = _("Search settings"), keep_menu_open = true, sub_item_table = self:getSearchMenuTable(), }, { text = _("Wireless settings"), keep_menu_open = true, sub_item_table = self:getWirelessMenuTable(), }, } } -- insert the metadata search if G_reader_settings:isTrue("calibre_search_from_reader") or not self.ui.view then menu_items.find_book_in_calibre_catalog = { text = _("Calibre metadata search"), callback = function() CalibreSearch:ShowSearch() end } end end -- search options available from UI function Calibre:getSearchMenuTable() return { { text = _("Manage libraries"), separator = true, keep_menu_open = true, sub_item_table_func = function() local result = {} -- append previous scanned dirs to the list. local cache = LuaSettings:open(CalibreSearch.cache_libs.path) for path, _ in pairs(cache.data) do table.insert(result, { text = path, keep_menu_open = true, checked_func = function() return cache:isTrue(path) end, callback = function() cache:toggle(path) cache:flush() CalibreSearch:invalidateCache() end, }) end -- if there's no result then no libraries are stored if #result == 0 then table.insert(result, { text = _("No calibre libraries"), enabled = false }) end table.insert(result, 1, { text = _("Rescan disk for calibre libraries"), separator = true, callback = function() CalibreSearch:prompt() end, }) return result end, }, { text = _("Enable searches in the reader"), checked_func = function() return G_reader_settings:isTrue("calibre_search_from_reader") end, callback = function() G_reader_settings:toggle("calibre_search_from_reader") UIManager:show(InfoMessage:new{ text = _("This will take effect on next restart."), }) end, }, { text = _("Store metadata in cache"), checked_func = function() return G_reader_settings:nilOrTrue("calibre_search_cache_metadata") end, callback = function() G_reader_settings:flipNilOrTrue("calibre_search_cache_metadata") end, }, { text = _("Case sensitive search"), checked_func = function() return not G_reader_settings:nilOrTrue("calibre_search_case_insensitive") end, callback = function() G_reader_settings:flipNilOrTrue("calibre_search_case_insensitive") end, }, { text = _("Search by title"), checked_func = function() return G_reader_settings:nilOrTrue("calibre_search_find_by_title") end, callback = function() G_reader_settings:flipNilOrTrue("calibre_search_find_by_title") end, }, { text = _("Search by authors"), checked_func = function() return G_reader_settings:nilOrTrue("calibre_search_find_by_authors") end, callback = function() G_reader_settings:flipNilOrTrue("calibre_search_find_by_authors") end, }, { text = _("Search by path"), checked_func = function() return G_reader_settings:nilOrTrue("calibre_search_find_by_path") end, callback = function() G_reader_settings:flipNilOrTrue("calibre_search_find_by_path") end, }, } end -- wireless options available from UI function Calibre:getWirelessMenuTable() local function isEnabled() local enabled = G_reader_settings:nilOrTrue("calibre_wireless") return enabled and not CalibreWireless.calibre_socket end return { { text = _("Enable wireless client"), separator = true, enabled_func = function() return not CalibreWireless.calibre_socket end, checked_func = function() return G_reader_settings:nilOrTrue("calibre_wireless") end, callback = function() G_reader_settings:flipNilOrTrue("calibre_wireless") end, }, { text = _("Set password"), enabled_func = isEnabled, callback = function() CalibreWireless:setPassword() end, }, { text = _("Set inbox folder"), enabled_func = isEnabled, callback = function() CalibreWireless:setInboxDir() end, }, { text_func = function() local address = _("automatic") if G_reader_settings:has("calibre_wireless_url") then address = G_reader_settings:readSetting("calibre_wireless_url") address = string.format("%s:%s", address["address"], address["port"]) end return T(_("Server address (%1)"), BD.ltr(address)) end, enabled_func = isEnabled, sub_item_table = { { text = _("Automatic"), checked_func = function() return G_reader_settings:hasNot("calibre_wireless_url") end, callback = function() G_reader_settings:delSetting("calibre_wireless_url") end, }, { text = _("Manual"), checked_func = function() return G_reader_settings:has("calibre_wireless_url") end, callback = function(touchmenu_instance) local MultiInputDialog = require("ui/widget/multiinputdialog") local url_dialog local calibre_url = G_reader_settings:readSetting("calibre_wireless_url") local calibre_url_address, calibre_url_port if calibre_url then calibre_url_address = calibre_url["address"] calibre_url_port = calibre_url["port"] end url_dialog = MultiInputDialog:new{ title = _("Set custom calibre address"), fields = { { text = calibre_url_address, input_type = "string", hint = _("IP Address"), }, { text = calibre_url_port, input_type = "number", hint = _("Port"), }, }, buttons = { { { text = _("Cancel"), callback = function() UIManager:close(url_dialog) end, }, { text = _("OK"), callback = function() local fields = url_dialog:getFields() if fields[1] ~= "" then local port = tonumber(fields[2]) if not port or port < 1 or port > 65355 then --default port port = 9090 end G_reader_settings:saveSetting("calibre_wireless_url", {address = fields[1], port = port }) end UIManager:close(url_dialog) if touchmenu_instance then touchmenu_instance:updateItems() end end, }, }, }, } UIManager:show(url_dialog) url_dialog:onShowKeyboard() end, }, }, }, } end return Calibre
agpl-3.0
fluxxu/luape
luape/scripts/libs/asm.lua
1
1090
local asm_line_meta = { __index = { number = function (self, i) local pattern = "%x+h" local n = i or 1 local p_begin = 1, p_end for i = 0, n, 1 do p_begin, p_end = self.code_:find(pattern, p) if p_begin ~= nil then if i == n - 1 then local hex = self.code_:sub(p_begin, p_end - 1) return tonumber(hex, 16) end end end return nil end, offset = function (self, i) return self:number(i) - self.base_ end }, __tostring = function (self) return self.code_ end } local function newASM(addr, base, n) n = n or 20 local asm = luape.diasm(addr, n) if #asm then asm.base = base setmetatable(asm, { __index = { dump = function (self) for k, v in ipairs(self) do print(k, v) end end, line = function (self, n) local obj = { code_ = self[n], base_ = base } setmetatable(obj, asm_line_meta) return obj end, diasm = function (addr, n) return newASM(addr, n) end } }) return asm else return nil end end return { new = newASM }
mit
bnetcc/darkstar
scripts/zones/Western_Adoulin/npcs/Defliaa.lua
5
1653
----------------------------------- -- Area: Western Adoulin -- NPC: Defliaa -- Type: Quest NPC and Shop NPC -- Involved with Quest: 'All the Way to the Bank' -- !pos 43 2 -113 256 ----------------------------------- package.loaded["scripts/zones/Western_Adoulin/TextIDs"] = nil; ----------------------------------- require("scripts/zones/Western_Adoulin/TextIDs"); require("scripts/globals/keyitems"); require("scripts/globals/npc_util"); require("scripts/globals/shop"); function onTrade(player,npc,trade) -- ALL THE WAY TO THE BANK if (player:hasKeyItem(TARUTARU_SAUCE_INVOICE)) then local ATWTTB_Paid_Defliaa = player:getMaskBit(player:getVar("ATWTTB_Payments"), 0); if (not ATWTTB_Paid_Defliaa and npcUtil.tradeHas( trade, {{"gil",19440}} )) then player:startEvent(5069); end end end; function onTrigger(player,npc) player:showText(npc, DEFLIAA_SHOP_TEXT); local stock = { 5166, 3400, -- Coeurl Sub 4421, 1560, -- Melon Pie 5889, 19440, -- Stuffed Pitaru 5885, 18900, -- Saltena 4396, 280, -- Sausage Roll 4356, 200, -- White Bread 5686, 800, -- Cheese Sandwich } showShop(player, STATIC, stock); end; function onEventUpdate(player,csid,option) end; function onEventFinish(player,csid,option) -- ALL THE WAY TO THE BANK if (csid == 5069) then player:confirmTrade(); player:setMaskBit("ATWTTB_Payments", 0, true); if (player:isMaskFull(player:getVar("ATWTTB_Payments"), 5)) then npcUtil.giveKeyItem(player, TARUTARU_SAUCE_RECEIPT); end end end;
gpl-3.0
bnetcc/darkstar
scripts/globals/items/pear_crepe.lua
3
1221
----------------------------------------- -- ID: 5777 -- Item: Pear Crepe -- Food Effect: 30 Min, All Races ----------------------------------------- -- Intelligence +2 -- MP Healing +2 -- Magic Accuracy +20% (cap 45) -- Magic Defense +1 ----------------------------------------- require("scripts/globals/status"); ----------------------------------------- function onItemCheck(target) local result = 0; if (target:hasStatusEffect(EFFECT_FOOD) == true or target:hasStatusEffect(EFFECT_FIELD_SUPPORT_FOOD) == true) then result = 246; end return result; end; function onItemUse(target) target:addStatusEffect(EFFECT_FOOD,0,0,1800,5777); end; ----------------------------------------- -- onEffectGain Action ----------------------------------------- function onEffectGain(target,effect) target:addMod(MOD_INT, 2); target:addMod(MOD_FOOD_MACCP, 20); target:addMod(MOD_FOOD_MACC_CAP, 45); target:addMod(MOD_MDEF, 1); target:addMod(MOD_MPHEAL, 2); end; function onEffectLose(target, effect) target:delMod(MOD_INT, 2); target:delMod(MOD_FOOD_MACCP, 20); target:delMod(MOD_FOOD_MACC_CAP, 45); target:delMod(MOD_MDEF, 1); target:delMod(MOD_MPHEAL, 2); end;
gpl-3.0
Ravenlord/ddp-testing
tests/calculated_values/row-derived/02_vc_virtual-insert.lua
1
2251
--[[! - This is free and unencumbered software released into the public domain. - - Anyone is free to copy, modify, publish, use, compile, sell, or distribute this software, either in source code form - or as a compiled binary, for any purpose, commercial or non-commercial, and by any means. - - In jurisdictions that recognize copyright laws, the author or authors of this software dedicate any and all copyright - interest in the software to the public domain. We make this dedication for the benefit of the public at large and to - the detriment of our heirs and successors. We intend this dedication to be an overt act of relinquishment in - perpetuity of all present and future rights to this software under copyright law. - - THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE - WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS BE - LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, - OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. - - For more information, please refer to <http://unlicense.org/> --]] --[[ - Benchmark file for design problem "Calculated Values", truly virtual column solution. - Insert new product. - - @author Markus Deutschl <deutschl.markus@gmail.com> - @copyright 2014 Markus Deutschl - @license http://unlicense.org/ Unlicense --]] -- --------------------------------------------------------------------------------------------------------------------- Includes pathtest = string.match(test, "(.*/)") or "" -- Total reusal of preparations. dofile(pathtest .. "02_vc_virtual-select.lua") -- --------------------------------------------------------------------------------------------------------------------- Benchmark functions --- Execute the benchmark queries. -- Is called during the run command of sysbench. function benchmark() local query = [[ INSERT INTO `products` (`name`, `description`, `base_price`, `vat_rate`) VALUES ('New Product', 'New Description', 10.0, 0.2) ]] db_query('BEGIN') db_query(query) db_query('ROLLBACK') end
unlicense
Etiene/Algorithm-Implementations
Pi_Algorithms/Lua/Yonaba/pi_test.lua
26
1962
-- Tests for golden_ratio.lua local PI = require 'pi' local total, pass = 0, 0 local function dec(str, len) return #str < len and str .. (('.'):rep(len-#str)) or str:sub(1,len) end local function run(message, f) total = total + 1 local ok, err = pcall(f) if ok then pass = pass + 1 end local status = ok and 'PASSED' or 'FAILED' print(('%02d. %68s: %s'):format(total, dec(message,68), status)) end local function fuzzyEqual(a, b, eps) local eps = eps or 1e-4 return (math.abs(a - b) < eps) end run('Testing Statistical (Monte-Carlo pi)', function() assert(fuzzyEqual(PI.statistical(100000, os.time()), math.pi,1e-2)) assert(fuzzyEqual(PI.statistical(100000, os.time()), math.pi,1e-2)) end) run('Testing Madhava-Leibniz series', function() assert(fuzzyEqual(PI.madhava_leibniz( 100), math.pi,1e-8)) assert(fuzzyEqual(PI.madhava_leibniz( 500), math.pi,1e-8)) assert(fuzzyEqual(PI.madhava_leibniz(1000), math.pi,1e-8)) end) run('Testing Ramanujan series', function() assert(fuzzyEqual(PI.ramanujan(20), math.pi,1e-8)) assert(fuzzyEqual(PI.ramanujan(30), math.pi,1e-8)) assert(fuzzyEqual(PI.ramanujan(40), math.pi,1e-8)) end) run('Testing Chudnovsky series', function() assert(fuzzyEqual(PI.chudnovsky(10), math.pi,1e-8)) assert(fuzzyEqual(PI.chudnovsky(20), math.pi,1e-8)) assert(fuzzyEqual(PI.chudnovsky(25), math.pi,1e-8)) end) run('Testing Viete series', function() assert(fuzzyEqual(PI.viete( 100), math.pi,1e-8)) assert(fuzzyEqual(PI.viete( 200), math.pi,1e-8)) assert(fuzzyEqual(PI.viete(10000), math.pi,1e-8)) end) run('Testing Circle area sum method', function() assert(fuzzyEqual(PI.circle_area( 100), math.pi,1e-2)) assert(fuzzyEqual(PI.circle_area( 1000), math.pi,1e-4)) assert(fuzzyEqual(PI.circle_area(10000), math.pi,1e-5)) end) print(('-'):rep(80)) print(('Total : %02d: Pass: %02d - Failed : %02d - Success: %.2f %%') :format(total, pass, total-pass, (pass*100/total)))
mit
bnetcc/darkstar
scripts/globals/items/emerald_quiche.lua
3
1128
----------------------------------------- -- ID: 5171 -- Item: emerald_quiche -- Food Effect: 60Min, All Races ----------------------------------------- -- Magic 15 -- Agility 1 -- Ranged ACC % 7 -- Ranged ACC Cap 20 ----------------------------------------- require("scripts/globals/status"); ----------------------------------------- function onItemCheck(target) local result = 0; if (target:hasStatusEffect(EFFECT_FOOD) == true or target:hasStatusEffect(EFFECT_FIELD_SUPPORT_FOOD) == true) then result = 246; end return result; end; function onItemUse(target) target:addStatusEffect(EFFECT_FOOD,0,0,3600,5171); end; ----------------------------------------- -- onEffectGain Action ----------------------------------------- function onEffectGain(target,effect) target:addMod(MOD_MP, 15); target:addMod(MOD_AGI, 1); target:addMod(MOD_FOOD_RACCP, 7); target:addMod(MOD_FOOD_RACC_CAP, 20); end; function onEffectLose(target, effect) target:delMod(MOD_MP, 15); target:delMod(MOD_AGI, 1); target:delMod(MOD_FOOD_RACCP, 7); target:delMod(MOD_FOOD_RACC_CAP, 20); end;
gpl-3.0
bnetcc/darkstar
scripts/zones/Ghelsba_Outpost/npcs/Hut_Door.lua
5
2017
----------------------------------- -- Area: Ghelsba_Outpost -- NPC: Hut Door -- !pos -165.357 -11.672 77.771 140 ------------------------------------- package.loaded["scripts/zones/Ghelsba_Outpost/TextIDs"] = nil; package.loaded["scripts/globals/bcnm"] = nil; ------------------------------------- require("scripts/globals/bcnm"); require("scripts/globals/titles"); require("scripts/globals/keyitems"); require("scripts/globals/quests"); require("scripts/globals/missions"); require("scripts/zones/Ghelsba_Outpost/TextIDs"); ---- 0: ---- 1: ---- 2: ---- 3: ---- 4: ---- 5: ---- 6: ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) if (TradeBCNM(player,player:getZoneID(),trade,npc)) then return; end end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) if (player:hasKeyItem(ORCISH_HUT_KEY)) then if (player:hasCompletedMission(SANDORIA,SAVE_THE_CHILDREN)) then player:startEvent(3); else player:startEvent(55); end else if (EventTriggerBCNM(player,npc)) then return; end end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("onUpdate CSID: %u",csid); -- printf("onUpdate RESULT: %u",option); if (EventUpdateBCNM(player,csid,option)) then return; end end; ----------------------------------- -- onEventFinish Action ----------------------------------- function onEventFinish(player,csid,option) -- printf("onFinish CSID: %u",csid); -- printf("onFinish RESULT: %u",option); if (csid == 3 or csid == 55) then player:delKeyItem(ORCISH_HUT_KEY); player:setVar("MissionStatus",4); else if (EventFinishBCNM(player,csid,option)) then return; end end end;
gpl-3.0
bnetcc/darkstar
scripts/zones/Apollyon/mobs/Evil_Armory.lua
5
1091
----------------------------------- -- Area: Apollyon SE -- NPC: Evil_Armory ----------------------------------- package.loaded["scripts/zones/Apollyon/TextIDs"] = nil; ----------------------------------- require("scripts/globals/limbus"); require("scripts/zones/Apollyon/TextIDs"); ----------------------------------- function onMobSpawn(mob) end; function onMobEngaged(mob,target) GetMobByID(16933033):updateEnmity(target); GetMobByID(16933034):updateEnmity(target); GetMobByID(16933035):updateEnmity(target); GetMobByID(16933036):updateEnmity(target); GetMobByID(16933037):updateEnmity(target); GetMobByID(16933038):updateEnmity(target); GetMobByID(16933039):updateEnmity(target); GetMobByID(16933040):updateEnmity(target); end; function onMobDeath(mob, player, isKiller) end; function onMobDespawn(mob) local mobID = mob:getID(); -- print(mobID); local mobX = mob:getXPos(); local mobY = mob:getYPos(); local mobZ = mob:getZPos(); GetNPCByID(16932864+263):setPos(mobX,mobY,mobZ); GetNPCByID(16932864+263):setStatus(STATUS_NORMAL); end;
gpl-3.0
bnetcc/darkstar
scripts/globals/items/clear_drop.lua
1
2074
----------------------------------------- -- ID: 4259 -- Item: Clear Drop -- Intelligence 5 ----------------------------------------- require("scripts/globals/status"); require("scripts/globals/msg"); function onItemCheck(target) --[[ if (target:hasStatusEffect(EFFECT_MEDICINE)) then return msgBasic.ITEM_NO_USE_MEDICATED; end ]] if (target:hasStatusEffect(EFFECT_FOOD) == true or target:hasStatusEffect(EFFECT_FIELD_SUPPORT_FOOD) == true) then return 246; end return 0; end; function onItemUse(target) --[[ target:addStatusEffect(EFFECT_INT_BOOST,5,0,600); target:addStatusEffect(EFFECT_MEDICINE,0,0,3600); ]] target:addStatusEffect(EFFECT_FOOD,0,0,2700,4259); end; ---------------------------------------- -- onEffectGain ---------------------------------------- function onEffectGain(target,effect) target:addMod(MOD_INT, 6); target:addMod(MOD_MP, 40); target:addMod(MOD_MATT, 12); target:addMod(MOD_MDEF, 5); target:addMod(MOD_MACC, 8); target:addMod(MOD_MEVA, 10); target:addMod(MOD_FASTCAST, 4); target:addMod(MOD_BLACK_MAGIC_CAST, -4); target:addMod(MOD_BLACK_MAGIC_RECAST, -4); target:addMod(MOD_MAG_BURST_BONUS, 5); target:addMod(MOD_MAGIC_CRITHITRATE, 5); target:addMod(MOD_MPHEAL, 5); target:addMod(MOD_ETUDE_EFFECT, 2); target:addMod(MOD_BALLAD_EFFECT, 2); end; ----------------------------------------- -- onEffectLose Action ----------------------------------------- function onEffectLose(target,effect) target:delMod(MOD_INT, 6); target:delMod(MOD_MP, 40); target:delMod(MOD_MATT, 11); target:delMod(MOD_MDEF, 5); target:delMod(MOD_MACC, 8); target:delMod(MOD_MEVA, 10); target:delMod(MOD_FASTCAST, 4); target:delMod(MOD_BLACK_MAGIC_CAST, -4); target:delMod(MOD_BLACK_MAGIC_RECAST, -4); target:delMod(MOD_MAG_BURST_BONUS, 5); target:delMod(MOD_MAGIC_CRITHITRATE, 5); target:delMod(MOD_MPHEAL, 5); target:delMod(MOD_ETUDE_EFFECT, 2); target:delMod(MOD_BALLAD_EFFECT, 2); end;
gpl-3.0
knyghtmare/War_of_Legends
lua/equipment-system/item-list.lua
1
3053
item_types = { Helmet = { Cloth = { level = 1, armor = { impact = 10, }, image = "icons/cloak_leather_brown.png", ground_icon = "items/fur_hat.png", category = "light", type = "armor", value = 6, }, Leather = { level = 1, armor = { impact = 5, pierce = 10, blade = 10, }, image = "icons/helmet_leather-cap.png", ground_icon = "items/coif.png", category = "medium", type = "armor", value = 8, }, Bronze = { level = 1, armor = { pierce = 15, blade = 15, }, image = "icons/helmet_conical.png", ground_icon = "items/helmet_rusty.png", category = "heavy", type = "armor", value = 10, }, }, Armor = { Cloth = { level = 1, armor = { impact = 5, pierce = 10, blade = 10, }, image = "icons/dress_silk_green.png", ground_icon = "items/brigandine_vest.png", category = "light", type = "armor", value = 15, }, Leather = { level = 1, armor = { impact = 10, pierce = 10, blade = 10, }, image = "icons/armor_leather.png", ground_icon = "items/leather_vest.png", category = "medium", type = "armor", value = 18, }, Bronze = { level = 1, armor = { pierce = 20, blade = 20, }, image = "icons/cuirass_muscled.png", ground_icon = "items/breastplate.png", category = "heavy", type = "armor", value = 20, }, Studded = { level = 5, armor = { impact = 15, pierce = 15, blade = 15, }, image = "icons/cuirass_leather_studded.png", ground_icon = "items/armor-leather.png", category = "medium", type = "armor", value = 32, }, }, Ring = { Gold = { image = "icons/ring_gold.png", ground_icon = "items/ring-gold.png", level = 2, ranged_damage = "10%", category = "ring", type = "ranged_buff", value = 22, }, Uncommon = { image = "icons/skull_ring.png", ground_icon = "items/ring-brown.png", level = 2, melee_damage = "10%", category = "ring", type = "melee_buff", value = 22, }, }, Amulet = { Ankh = { image = "icons/ankh_necklace.png", ground_icon = "items/ankh-necklace.png", level = 2, ranged_damage = "10%", category = "amulet", type = "ranged_buff", value = 22, }, Jade = { image = "icons/jewelry_butterfly_pin.png", ground_icon = "items/rock.png", level = 2, melee_damage = "10%", category = "amulet", type = "melee_buff", value = 22, }, }, } modifiers = { armor = { Refined = { name = "Refined", hitpoints = 6, }, Augmented = { name = "Augmented", hitpoints = 12, }, }, } item_cache = {}
gpl-2.0
Atebite/NutScript
gamemode/core/derma/cl_attribute.lua
3
3007
local PANEL = {} local gradient = nut.util.getMaterial("vgui/gradient-u") local gradient2 = nut.util.getMaterial("vgui/gradient-d") function PANEL:Init() self:SetTall(20) self.add = self:Add("DImageButton") self.add:SetSize(16, 16) self.add:Dock(RIGHT) self.add:DockMargin(2, 2, 2, 2) self.add:SetImage("icon16/add.png") self.add.OnMousePressed = function() self.pressing = 1 self:doChange() self.add:SetAlpha(150) end self.add.OnMouseReleased = function() if (self.pressing) then self.pressing = nil self.add:SetAlpha(255) end end self.add.OnCursorExited = self.add.OnMouseReleased self.sub = self:Add("DImageButton") self.sub:SetSize(16, 16) self.sub:Dock(LEFT) self.sub:DockMargin(2, 2, 2, 2) self.sub:SetImage("icon16/delete.png") self.sub.OnMousePressed = function() self.pressing = -1 self:doChange() self.sub:SetAlpha(150) end self.sub.OnMouseReleased = function() if (self.pressing) then self.pressing = nil self.sub:SetAlpha(255) end end self.sub.OnCursorExited = self.sub.OnMouseReleased self.value = 0 self.deltaValue = self.value self.max = 10 self.bar = self:Add("DPanel") self.bar:Dock(FILL) self.bar.Paint = function(this, w, h) surface.SetDrawColor(35, 35, 35, 250) surface.DrawRect(0, 0, w, h) w, h = w - 4, h - 4 local value = self.deltaValue / self.max if (value > 0) then local color = nut.config.get("color") local add = 0 if (self.deltaValue != self.value) then add = 35 end surface.SetDrawColor(color.r + add, color.g + add, color.b + add, 230) surface.DrawRect(2, 2, w * value, h) surface.SetDrawColor(255, 255, 255, 35) surface.SetMaterial(gradient) surface.DrawTexturedRect(2, 2, w * value, h) end surface.SetDrawColor(255, 255, 255, 5) surface.SetMaterial(gradient2) surface.DrawTexturedRect(2, 2, w, h) end self.label = self.bar:Add("DLabel") self.label:Dock(FILL) self.label:SetExpensiveShadow(1, Color(0, 0, 60)) self.label:SetContentAlignment(5) end function PANEL:Think() if (self.pressing) then if ((self.nextPress or 0) < CurTime()) then self:doChange() end end self.deltaValue = math.Approach(self.deltaValue, self.value, FrameTime() * 7.5) end function PANEL:doChange() if ((self.value == 0 and self.pressing == -1) or (self.value == self.max and self.pressing == 1)) then return end self.nextPress = CurTime() + 0.2 if (self:onChanged(self.pressing) != false) then self.value = math.Clamp(self.value + self.pressing, 0, self.max) end end function PANEL:onChanged(difference) end function PANEL:getValue() return self.value end function PANEL:setValue(value) self.value = value end function PANEL:setMax(max) self.max = max end function PANEL:setText(text) self.label:SetText(text) end function PANEL:setReadOnly() self.sub:Remove() self.add:Remove() end vgui.Register("nutAttribBar", PANEL, "DPanel")
mit
awesomeWM/awesome
lib/awful/widget/only_on_screen.lua
1
3980
--------------------------------------------------------------------------- -- -- A container that makes a widget display only on a specified screen. -- -- @author Uli Schlachter -- @copyright 2017 Uli Schlachter -- @containermod awful.widget.only_on_screen -- @supermodule wibox.widget.base --------------------------------------------------------------------------- local type = type local pairs = pairs local setmetatable = setmetatable local base = require("wibox.widget.base") local gtable = require("gears.table") local capi = { screen = screen, awesome = awesome } local only_on_screen = { mt = {} } local instances = setmetatable({}, { __mode = "k" }) local function should_display_on(self, s) if not self._private.widget then return false end local own_s = self._private.screen if type(own_s) == "number" and (own_s < 1 or own_s > capi.screen.count()) then -- Invalid screen number return false end return capi.screen[self._private.screen] == s end -- Layout this layout function only_on_screen:layout(context, ...) if not should_display_on(self, context.screen) then return end return { base.place_widget_at(self._private.widget, 0, 0, ...) } end -- Fit this layout into the given area function only_on_screen:fit(context, ...) if not should_display_on(self, context.screen) then return 0, 0 end return base.fit_widget(self, context, self._private.widget, ...) end --- The widget to be displayed -- @property widget -- @tparam[opt=nil] widget|nil widget only_on_screen.set_widget = base.set_widget_common function only_on_screen:get_widget() return self._private.widget end function only_on_screen:get_children() return {self._private.widget} end function only_on_screen:set_children(children) self:set_widget(children[1]) end --- The screen to display on. -- Can be a screen object, a screen index, a screen -- name ("VGA1") or the string "primary" for the primary screen. -- @property screen -- @tparam[opt="primary"] screen screen function only_on_screen:set_screen(s) self._private.screen = s self:emit_signal("widget::layout_changed") end function only_on_screen:get_screen() return self._private.screen end --- Returns a new `awful.widget.only_on_screen` container. -- This widget makes some other widget visible on just some screens. Use -- `:set_widget()` to set the widget and `:set_screen()` to set the screen. -- @tparam[opt=nil] widget widget The widget to display. -- @tparam[opt="primary"] screen s The screen to display on. -- @treturn table A new only_on_screen container -- @constructorfct awful.widget.only_on_screen local function new(widget, s) local ret = base.make_widget(nil, nil, {enable_properties = true}) gtable.crush(ret, only_on_screen, true) ret:set_widget(widget) ret:set_screen(s or "primary") instances[ret] = true return ret end function only_on_screen.mt:__call(...) return new(...) end -- Handle lots of cases where a screen changes and thus this widget jumps around capi.screen.connect_signal("primary_changed", function() for widget in pairs(instances) do if widget._private.widget and widget._private.screen == "primary" then widget:emit_signal("widget::layout_changed") end end end) capi.screen.connect_signal("list", function() for widget in pairs(instances) do if widget._private.widget and type(widget._private.screen) == "number" then widget:emit_signal("widget::layout_changed") end end end) capi.screen.connect_signal("property::outputs", function() for widget in pairs(instances) do if widget._private.widget and type(widget._private.screen) == "string" then widget:emit_signal("widget::layout_changed") end end end) return setmetatable(only_on_screen, only_on_screen.mt) -- vim: filetype=lua:expandtab:shiftwidth=4:tabstop=8:softtabstop=4:textwidth=80
gpl-2.0
mwoz123/koreader
spec/unit/filemanagerconverter_spec.lua
8
2252
describe("FileConverter module", function() local FileConverter setup(function() require("commonrequire") FileConverter = require("apps/filemanager/filemanagerconverter") end) it("should show conversion support for Markdown", function() assert.is_true(FileConverter:isSupported("/markdown_file.md")) end) it("should not show conversion support for PDF", function() assert.is_false(FileConverter:isSupported("/pdf_file.pdf")) end) it("should convert Markdown to HTML", function() local markdown = [[ # KOReader Quickstart Guide Welcome to KOreader. You can activate the menu by swiping down from the top of the screen. Clicking outside the menu or swiping up on the menu will discard it. Turning pages can be done either by swiping left and right or by single taps on the left or right side of the screen. **Main menu** ![Menu](../resources/menu.svg) You can always view this quickstart guide again through *Help* → *Quickstart guide* in the top right menu. **Settings** ![Settings](../resources/settings.svg) You can change the language and other settings through the gear icon. ------------ Generated by KOReader v2015.11-982-g704d4238. ]] local title = "KOReader Quickstart Guide" local html_expected = [[<!DOCTYPE html> <html> <head> <title>KOReader Quickstart Guide</title> </head> <body> <h1>KOReader Quickstart Guide</h1> <p>Welcome to KOreader. You can activate the menu by swiping down from the top of the screen. Clicking outside the menu or swiping up on the menu will discard it. Turning pages can be done either by swiping left and right or by single taps on the left or right side of the screen.</p> <p><strong>Main menu</strong></p> <p><img alt="Menu" src="../resources/menu.svg"> You can always view this quickstart guide again through <em>Help</em> → <em>Quickstart guide</em> in the top right menu.</p> <p><strong>Settings</strong></p> <p><img alt="Settings" src="../resources/settings.svg"> You can change the language and other settings through the gear icon.</p> <hr> <p>Generated by KOReader v2015.11-982-g704d4238.</p> </body> </html>]] assert.are.same(html_expected, FileConverter:mdToHtml(markdown, title)) end) end)
agpl-3.0
Ravenlord/ddp-testing
tests/calculated_values/dependent/01_trivial-select.lua
1
2637
--[[! - This is free and unencumbered software released into the public domain. - - Anyone is free to copy, modify, publish, use, compile, sell, or distribute this software, either in source code form - or as a compiled binary, for any purpose, commercial or non-commercial, and by any means. - - In jurisdictions that recognize copyright laws, the author or authors of this software dedicate any and all copyright - interest in the software to the public domain. We make this dedication for the benefit of the public at large and to - the detriment of our heirs and successors. We intend this dedication to be an overt act of relinquishment in - perpetuity of all present and future rights to this software under copyright law. - - THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE - WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS BE - LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, - OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. - - For more information, please refer to <http://unlicense.org/> --]] --[[ - Benchmark file for design problem "Calculated Values (dependent)", trivial solution. - Select top 20 most ordered products. - - @author Markus Deutschl <deutschl.markus@gmail.com> - @copyright 2014 Markus Deutschl - @license http://unlicense.org/ Unlicense --]] -- --------------------------------------------------------------------------------------------------------------------- Includes pathtest = string.match(test, "(.*/)") or "" dofile(pathtest .. "../../common.inc") dofile(pathtest .. "prepare.inc") -- --------------------------------------------------------------------------------------------------------------------- Preparation functions --- Prepare data for the benchmark. -- Is called during the prepare command of sysbench in common.lua. function prepare_data() -- Reuse data preparation. prepare_dependent() end -- --------------------------------------------------------------------------------------------------------------------- Benchmark functions --- Execute the benchmark queries. -- Is called during the run command of sysbench. function benchmark() local query = [[ SELECT p.`id`, p.`name`, SUM(l.`amount`) AS `amount_ordered` FROM `products` AS p INNER JOIN `line_items` AS `l` ON p.`id` = l.`product_id` GROUP BY p.`id`, p.`name` ORDER BY `amount_ordered` DESC LIMIT 20 ]] rs = db_query(query) end
unlicense
yswifi/APlan
build_dir/target-mipsel_24kec+dsp_uClibc-0.9.33.2/luci/applications/luci-firewall/luasrc/model/cbi/firewall/zone-details.lua
47
6266
--[[ LuCI - Lua Configuration Interface Copyright 2008 Steven Barth <steven@midlink.org> Copyright 2010-2011 Jo-Philipp Wich <xm@subsignal.org> Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 $Id$ ]]-- local nw = require "luci.model.network" local fw = require "luci.model.firewall" local ds = require "luci.dispatcher" local ut = require "luci.util" local m, p, i, v local s, name, net, family, msrc, mdest, log, lim local s2, out, inp m = Map("firewall", translate("Firewall - Zone Settings")) m.redirect = luci.dispatcher.build_url("admin/network/firewall/zones") fw.init(m.uci) nw.init(m.uci) local zone = fw:get_zone(arg[1]) if not zone then luci.http.redirect(dsp.build_url("admin/network/firewall/zones")) return else m.title = "%s - %s" %{ translate("Firewall - Zone Settings"), translatef("Zone %q", zone:name() or "?") } end s = m:section(NamedSection, zone.sid, "zone", translatef("Zone %q", zone:name()), translatef("This section defines common properties of %q. \ The <em>input</em> and <em>output</em> options set the default \ policies for traffic entering and leaving this zone while the \ <em>forward</em> option describes the policy for forwarded traffic \ between different networks within the zone. \ <em>Covered networks</em> specifies which available networks are \ member of this zone.", zone:name())) s.anonymous = true s.addremove = false m.on_commit = function(map) local zone = fw:get_zone(arg[1]) if zone then s.section = zone.sid s2.section = zone.sid end end s:tab("general", translate("General Settings")) s:tab("advanced", translate("Advanced Settings")) name = s:taboption("general", Value, "name", translate("Name")) name.optional = false name.forcewrite = true name.datatype = "uciname" function name.write(self, section, value) if zone:name() ~= value then fw:rename_zone(zone:name(), value) out.exclude = value inp.exclude = value end m.redirect = ds.build_url("admin/network/firewall/zones", value) m.title = "%s - %s" %{ translate("Firewall - Zone Settings"), translatef("Zone %q", value or "?") } end p = { s:taboption("general", ListValue, "input", translate("Input")), s:taboption("general", ListValue, "output", translate("Output")), s:taboption("general", ListValue, "forward", translate("Forward")) } for i, v in ipairs(p) do v:value("REJECT", translate("reject")) v:value("DROP", translate("drop")) v:value("ACCEPT", translate("accept")) end s:taboption("general", Flag, "masq", translate("Masquerading")) s:taboption("general", Flag, "mtu_fix", translate("MSS clamping")) net = s:taboption("general", Value, "network", translate("Covered networks")) net.template = "cbi/network_netlist" net.widget = "checkbox" net.cast = "string" function net.formvalue(self, section) return Value.formvalue(self, section) or "-" end function net.cfgvalue(self, section) return Value.cfgvalue(self, section) or name:cfgvalue(section) end function net.write(self, section, value) zone:clear_networks() local n for n in ut.imatch(value) do zone:add_network(n) end end family = s:taboption("advanced", ListValue, "family", translate("Restrict to address family")) family.rmempty = true family:value("", translate("IPv4 and IPv6")) family:value("ipv4", translate("IPv4 only")) family:value("ipv6", translate("IPv6 only")) msrc = s:taboption("advanced", DynamicList, "masq_src", translate("Restrict Masquerading to given source subnets")) msrc.optional = true msrc.datatype = "list(neg(or(uciname,hostname,ip4addr)))" msrc.placeholder = "0.0.0.0/0" msrc:depends("family", "") msrc:depends("family", "ipv4") mdest = s:taboption("advanced", DynamicList, "masq_dest", translate("Restrict Masquerading to given destination subnets")) mdest.optional = true mdest.datatype = "list(neg(or(uciname,hostname,ip4addr)))" mdest.placeholder = "0.0.0.0/0" mdest:depends("family", "") mdest:depends("family", "ipv4") s:taboption("advanced", Flag, "conntrack", translate("Force connection tracking")) log = s:taboption("advanced", Flag, "log", translate("Enable logging on this zone")) log.rmempty = true log.enabled = "1" lim = s:taboption("advanced", Value, "log_limit", translate("Limit log messages")) lim.placeholder = "10/minute" lim:depends("log", "1") s2 = m:section(NamedSection, zone.sid, "fwd_out", translate("Inter-Zone Forwarding"), translatef("The options below control the forwarding policies between \ this zone (%s) and other zones. <em>Destination zones</em> cover \ forwarded traffic <strong>originating from %q</strong>. \ <em>Source zones</em> match forwarded traffic from other zones \ <strong>targeted at %q</strong>. The forwarding rule is \ <em>unidirectional</em>, e.g. a forward from lan to wan does \ <em>not</em> imply a permission to forward from wan to lan as well.", zone:name(), zone:name(), zone:name() )) out = s2:option(Value, "out", translate("Allow forward to <em>destination zones</em>:")) out.nocreate = true out.widget = "checkbox" out.exclude = zone:name() out.template = "cbi/firewall_zonelist" inp = s2:option(Value, "in", translate("Allow forward from <em>source zones</em>:")) inp.nocreate = true inp.widget = "checkbox" inp.exclude = zone:name() inp.template = "cbi/firewall_zonelist" function out.cfgvalue(self, section) local v = { } local f for _, f in ipairs(zone:get_forwardings_by("src")) do v[#v+1] = f:dest() end return table.concat(v, " ") end function inp.cfgvalue(self, section) local v = { } local f for _, f in ipairs(zone:get_forwardings_by("dest")) do v[#v+1] = f:src() end return v end function out.formvalue(self, section) return Value.formvalue(self, section) or "-" end function inp.formvalue(self, section) return Value.formvalue(self, section) or "-" end function out.write(self, section, value) zone:del_forwardings_by("src") local f for f in ut.imatch(value) do zone:add_forwarding_to(f) end end function inp.write(self, section, value) zone:del_forwardings_by("dest") local f for f in ut.imatch(value) do zone:add_forwarding_from(f) end end return m
gpl-2.0
UniverseMelowdi/TheMelowdi
plugins/help.lua
2
1654
do -- Returns true if is not empty local function has_usage_data(dict) if (dict.usage == nil or dict.usage == '') then return false end return true end -- Get commands for that plugin local function plugin_help(name) local plugin = plugins[name] if not plugin then return nil end local text = "" if (type(plugin.usage) == "table") then for ku,usage in pairs(plugin.usage) do text = text..usage..'\n' end text = text..'\n' elseif has_usage_data(plugin) then -- Is not empty text = text..plugin.usage..'\n\n' end return text end -- !help command local function telegram_help() local text = "Plugin list: \n\n" -- Plugins names for name in pairs(plugins) do text = text..name..'\n' end text = text..'\n'..'Write "!help [plugin name]" for more info.' text = text..'\n'..'Or "!help all" to show all info.' return text end -- !help all command local function help_all() local ret = "" for name in pairs(plugins) do ret = ret .. plugin_help(name) end return ret end local function run(msg, matches) if matches[1] == "!help" then return telegram_help() elseif matches[1] == "!help all" then return help_all() else local text = plugin_help(matches[1]) if not text then text = telegram_help() end return text end end return { description = "Help plugin. Get info from other plugins. ", usage = { "#help: Show list of plugins.", "#help all: Show all commands for every plugin.", "#help [plugin name]: Commands for that plugin." }, patterns = { "^#help$", "^#help all", "^#help (.+)" }, run = run } end
gpl-2.0
bnetcc/darkstar
scripts/zones/Port_Bastok/npcs/Rosswald.lua
5
1360
----------------------------------- -- Area: Port Bastok -- NPC: Rosswald -- Only sells when Bastok controlls Zulkheim Region -- Confirmed shop stock, August 2013 ----------------------------------- package.loaded["scripts/zones/Port_Bastok/TextIDs"] = nil; ----------------------------------- require("scripts/zones/Port_Bastok/TextIDs"); require("scripts/globals/conquest"); require("scripts/globals/shop"); ----------------------------------- function onTrade(player,npc,trade) end; function onTrigger(player,npc) local RegionOwner = GetRegionOwner(ZULKHEIM); if (RegionOwner ~= NATION_BASTOK) then player:showText(npc,ROSSWALD_CLOSED_DIALOG); else player:showText(npc,ROSSWALD_OPEN_DIALOG); local stock = { 4372, 44, -- Giant Sheep Meat 622, 44, -- Dried Marjoram 610, 55, -- San d'Orian Flour 611, 36, -- Rye Flour 1840, 1840, -- Semolina 4366, 22, -- La Theine Cabbage 4378, 55 -- Selbina Milk } showShop(player,BASTOK,stock); end end; function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end;
gpl-3.0
bnetcc/darkstar
scripts/zones/Newton_Movalpolos/npcs/Furnace_Hatch.lua
1
2805
----------------------------------- -- Area: Newton Movalpolos -- NPC: Furnace_Hatch ----------------------------------- package.loaded["scripts/zones/Newton_Movalpolos/TextIDs"] = nil; ----------------------------------- require("scripts/zones/Newton_Movalpolos/TextIDs"); ----------------------------------- function onTrade(player,npc,trade) if (trade:getItemCount() == 1 and trade:hasItemQty(947,1)) then player:tradeComplete(); -- player:messageSpecial(???); -- Needs retail info local npcid = npc:getID(); local Door_Offset = 16826582; -- _0c0 in NPC_List if (npcid == Door_Offset+29 or npcid == Door_Offset+28 or npcid == Door_Offset+27) then if (GetNPCByID(Door_Offset+10):getAnimation() == 8) then GetNPCByID(Door_Offset+10):setAnimation(9); GetNPCByID(Door_Offset+11):setAnimation(8); GetNPCByID(Door_Offset+8):setAnimation(9); GetNPCByID(Door_Offset+9):setAnimation(8); else GetNPCByID(Door_Offset+10):setAnimation(8); GetNPCByID(Door_Offset+11):setAnimation(9); GetNPCByID(Door_Offset+8):setAnimation(8); GetNPCByID(Door_Offset+9):setAnimation(9); end elseif (npcid == Door_Offset+25) then if (GetNPCByID(Door_Offset+3):getAnimation() == 8) then GetNPCByID(Door_Offset+3):setAnimation(9); GetNPCByID(Door_Offset+2):setAnimation(8); GetNPCByID(Door_Offset+1):setAnimation(9); GetNPCByID(Door_Offset):setAnimation(8); else GetNPCByID(Door_Offset+3):setAnimation(8); GetNPCByID(Door_Offset+2):setAnimation(9); GetNPCByID(Door_Offset+1):setAnimation(8); GetNPCByID(Door_Offset):setAnimation(9); end elseif (npcid == Door_Offset+26) then if (GetNPCByID(Door_Offset+4):getAnimation() == 8) then GetNPCByID(Door_Offset+4):setAnimation(9); GetNPCByID(Door_Offset+5):setAnimation(8); GetNPCByID(Door_Offset+6):setAnimation(9); GetNPCByID(Door_Offset+7):setAnimation(8); else GetNPCByID(Door_Offset+4):setAnimation(8); GetNPCByID(Door_Offset+5):setAnimation(9); GetNPCByID(Door_Offset+6):setAnimation(8); GetNPCByID(Door_Offset+7):setAnimation(9); end end end end; function onTrigger(player,npc) end; function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end;
gpl-3.0
TeleDALAD/test
plugins/lyrics.lua
695
2113
do local BASE_LNM_URL = 'http://api.lyricsnmusic.com/songs' local LNM_APIKEY = '1f5ea5cf652d9b2ba5a5118a11dba5' local BASE_LYRICS_URL = 'http://api.chartlyrics.com/apiv1.asmx/SearchLyricDirect' local function getInfo(query) print('Getting info of ' .. query) local url = BASE_LNM_URL..'?api_key='..LNM_APIKEY ..'&q='..URL.escape(query) local b, c = http.request(url) if c ~= 200 then return nil end local result = json:decode(b) local artist = result[1].artist.name local track = result[1].title return artist, track end local function getLyrics(query) local artist, track = getInfo(query) if artist and track then local url = BASE_LYRICS_URL..'?artist='..URL.escape(artist) ..'&song='..URL.escape(track) local b, c = http.request(url) if c ~= 200 then return nil end local xml = require("xml") local result = xml.load(b) if not result then return nil end if xml.find(result, 'LyricSong') then track = xml.find(result, 'LyricSong')[1] end if xml.find(result, 'LyricArtist') then artist = xml.find(result, 'LyricArtist')[1] end local lyric if xml.find(result, 'Lyric') then lyric = xml.find(result, 'Lyric')[1] else lyric = nil end local cover if xml.find(result, 'LyricCovertArtUrl') then cover = xml.find(result, 'LyricCovertArtUrl')[1] else cover = nil end return artist, track, lyric, cover else return nil end end local function run(msg, matches) local artist, track, lyric, cover = getLyrics(matches[1]) if track and artist and lyric then if cover then local receiver = get_receiver(msg) send_photo_from_url(receiver, cover) end return '🎵 ' .. artist .. ' - ' .. track .. ' 🎵\n----------\n' .. lyric else return 'Oops! Lyrics not found or something like that! :/' end end return { description = 'Getting lyrics of a song', usage = '!lyrics [track or artist - track]: Search and get lyrics of the song', patterns = { '^!lyrics? (.*)$' }, run = run } end
gpl-2.0
bnetcc/darkstar
scripts/zones/Rolanberry_Fields/npcs/Legion_Moogle.lua
1
6749
----------------------------------- -- Area: Rolanberry Fields (110) -- NPC: Legion Moogle -- Type: Legion +1 Helper ----------------------------------- package.loaded["scripts/zones/Rolanberry_Fields/TextIDs"] = nil; ----------------------------------- require("scripts/zones/Rolanberry_Fields/TextIDs"); local LegionPointPrice = 2000; -- It's up here so it can be seen by both functions ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) local PRIZE; if (player:getCurrency("legion_point") >= LegionPointPrice) then -------------------------- -- Legion Gear +1 upgrades -------------------------- -- Gorney +1 - ilvl 119 if (trade:hasItemQty(3925, 10) and trade:hasItemQty(27761,1) and trade:getItemCount() == 11) then -- head PRIZE = 27711; elseif (trade:hasItemQty(3925, 20) and trade:hasItemQty(27907,1) and trade:getItemCount() == 21) then -- body PRIZE = 27863; elseif (trade:hasItemQty(3925, 10) and trade:hasItemQty(28046,1) and trade:getItemCount() == 11) then -- hands PRIZE = 28010; elseif (trade:hasItemQty(3925, 10) and trade:hasItemQty(28188,1) and trade:getItemCount() == 11) then -- legs PRIZE = 28152; elseif (trade:hasItemQty(3925, 10) and trade:hasItemQty(28327,1) and trade:getItemCount() == 11) then -- feet PRIZE = 28289; -- Shneddick +1 ilvl 119 elseif (trade:hasItemQty(3925, 10) and trade:hasItemQty(27762,1) and trade:getItemCount() == 11) then -- head PRIZE = 27712; elseif (trade:hasItemQty(3925, 20) and trade:hasItemQty(27908,1) and trade:getItemCount() == 21) then -- body PRIZE = 27864; elseif (trade:hasItemQty(3925, 10) and trade:hasItemQty(28047,1) and trade:getItemCount() == 11) then -- hands PRIZE = 28011; elseif (trade:hasItemQty(3925, 10) and trade:hasItemQty(28189,1) and trade:getItemCount() == 11) then -- legs PRIZE = 28153; elseif (trade:hasItemQty(3925, 10) and trade:hasItemQty(28328,1) and trade:getItemCount() == 11) then -- feet PRIZE = 28290; -- Weatherspoon +1 ilvl 119 elseif (trade:hasItemQty(3925, 10) and trade:hasItemQty(27763,1) and trade:getItemCount() == 11) then -- head PRIZE = 27713; elseif (trade:hasItemQty(3925, 20) and trade:hasItemQty(27909,1) and trade:getItemCount() == 21) then -- body PRIZE = 27865; elseif (trade:hasItemQty(3925, 10) and trade:hasItemQty(28048,1) and trade:getItemCount() == 11) then -- hands PRIZE = 28012; elseif (trade:hasItemQty(3925, 10) and trade:hasItemQty(28190,1) and trade:getItemCount() == 11) then -- legs PRIZE = 28154; elseif (trade:hasItemQty(3925, 10) and trade:hasItemQty(28329,1) and trade:getItemCount() == 11) then -- feet PRIZE = 28291; -- Karieyh ilvl 109 elseif (trade:hasItemQty(3925, 5) and trade:hasItemQty(27785,1) and trade:getItemCount() == 6) then -- head PRIZE = 27752; elseif (trade:hasItemQty(3925, 10) and trade:hasItemQty(27925,1) and trade:getItemCount() == 11) then -- body PRIZE = 27895; elseif (trade:hasItemQty(3925, 5) and trade:hasItemQty(28065,1) and trade:getItemCount() == 6) then -- hands PRIZE = 28042; elseif (trade:hasItemQty(3925, 5) and trade:hasItemQty(28205,1) and trade:getItemCount() == 6) then -- legs PRIZE = 28182; elseif (trade:hasItemQty(3925, 5) and trade:hasItemQty(28345,1) and trade:getItemCount() == 6) then -- feet PRIZE = 28320; -- Thurandaunts ilvl 109 elseif (trade:hasItemQty(3925, 5) and trade:hasItemQty(27784,1) and trade:getItemCount() == 6) then -- head PRIZE = 27753; elseif (trade:hasItemQty(3925, 10) and trade:hasItemQty(27924,1) and trade:getItemCount() == 11) then -- body PRIZE = 27896; elseif (trade:hasItemQty(3925, 5) and trade:hasItemQty(28064,1) and trade:getItemCount() == 6) then -- hands PRIZE = 28043; elseif (trade:hasItemQty(3925, 5) and trade:hasItemQty(28204,1) and trade:getItemCount() == 6) then -- legs PRIZE = 28183; elseif (trade:hasItemQty(3925, 5) and trade:hasItemQty(28344,1) and trade:getItemCount() == 6) then -- feet PRIZE = 28321; -- Orvail ilvl 109 elseif (trade:hasItemQty(3925, 5) and trade:hasItemQty(27782,1) and trade:getItemCount() == 6) then -- head PRIZE = 27754; elseif (trade:hasItemQty(3925, 10) and trade:hasItemQty(27922,1) and trade:getItemCount() == 11) then -- body PRIZE = 27897; elseif (trade:hasItemQty(3925, 5) and trade:hasItemQty(28061,1) and trade:getItemCount() == 6) then -- hands PRIZE = 28044; elseif (trade:hasItemQty(3925, 5) and trade:hasItemQty(28203,1) and trade:getItemCount() == 6) then -- legs PRIZE = 28184; elseif (trade:hasItemQty(3925, 5) and trade:hasItemQty(28342,1) and trade:getItemCount() == 6) then -- feet PRIZE = 28322; end if (PRIZE ~= nil) then if (player:getFreeSlotsCount() >= 1) then player:delCurrency("legion_point", LegionPointPrice); player:messageSpecial(ITEM_OBTAINED, PRIZE); player:tradeComplete(); player:addItem(PRIZE, 1); else player:messageSpecial(ITEM_CANNOT_BE_OBTAINED, PRIZE); end end else player:PrintToPlayer("You do not have enough Legion points for the upgrade!", chatType.SAY, npc:getName()); end end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) local MSG1 = string.format("Hello %s! I'm here to help you upgrade your Legion Armor. ", player:getName()); local MSG2 = string.format("This service will cost %s Legion points and some Tanzanite Jewels, Kupo! ", LegionPointPrice); player:PrintToPlayer(MSG1, chatType.SAY, npc:getName()); player:PrintToPlayer(MSG2, chatType.SAY, npc:getName()); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("onUpdate CSID: %u", csid); -- printf("onUpdate RESULT: %u", option); end; ----------------------------------- -- onEventFinish Action ----------------------------------- function onEventFinish(player,csid,option) -- printf("onUpdate CSID: %u", csid); -- printf("onUpdate RESULT: %u", option); end;
gpl-3.0
best98ir/SASAN
plugins/fun.lua
1
17395
--Begin Fun.lua By @BeyondTeam --Special Thx To @To0fan -------------------------------- local function run_bash(str) local cmd = io.popen(str) local result = cmd:read('*all') return result end -------------------------------- local api_key = nil local base_api = "https://maps.googleapis.com/maps/api" -------------------------------- local function get_latlong(area) local api = base_api .. "/geocode/json?" local parameters = "address=".. (URL.escape(area) or "") if api_key ~= nil then parameters = parameters .. "&key="..api_key end local res, code = https.request(api..parameters) if code ~=200 then return nil end local data = json:decode(res) if (data.status == "ZERO_RESULTS") then return nil end if (data.status == "OK") then lat = data.results[1].geometry.location.lat lng = data.results[1].geometry.location.lng acc = data.results[1].geometry.location_type types= data.results[1].types return lat,lng,acc,types end end -------------------------------- local function get_staticmap(area) local api = base_api .. "/staticmap?" local lat,lng,acc,types = get_latlong(area) local scale = types[1] if scale == "locality" then zoom=8 elseif scale == "country" then zoom=4 else zoom = 13 end local parameters = "size=600x300" .. "&zoom=" .. zoom .. "&center=" .. URL.escape(area) .. "&markers=color:red"..URL.escape("|"..area) if api_key ~= nil and api_key ~= "" then parameters = parameters .. "&key="..api_key end return lat, lng, api..parameters end -------------------------------- local function get_weather(location) print("Finding weather in ", location) local BASE_URL = "http://api.openweathermap.org/data/2.5/weather" local url = BASE_URL url = url..'?q='..location..'&APPID=eedbc05ba060c787ab0614cad1f2e12b' url = url..'&units=metric' local b, c, h = http.request(url) if c ~= 200 then return nil end local weather = json:decode(b) local city = weather.name local country = weather.sys.country local temp = 'دمای شهر '..city..' هم اکنون '..weather.main.temp..' درجه سانتی گراد می باشد\n____________________' local conditions = 'شرایط فعلی آب و هوا : ' if weather.weather[1].main == 'Clear' then conditions = conditions .. 'آفتابی☀' elseif weather.weather[1].main == 'Clouds' then conditions = conditions .. 'ابری ☁☁' elseif weather.weather[1].main == 'Rain' then conditions = conditions .. 'بارانی ☔' elseif weather.weather[1].main == 'Thunderstorm' then conditions = conditions .. 'طوفانی ☔☔☔☔' elseif weather.weather[1].main == 'Mist' then conditions = conditions .. 'مه 💨' end return temp .. '\n' .. conditions end -------------------------------- local function calc(exp) url = 'http://api.mathjs.org/v1/' url = url..'?expr='..URL.escape(exp) b,c = http.request(url) text = nil if c == 200 then text = 'Result = '..b..'\n____________________'..msg_caption elseif c == 400 then text = b else text = 'Unexpected error\n' ..'Is api.mathjs.org up?' end return text end -------------------------------- function exi_file(path, suffix) local files = {} local pth = tostring(path) local psv = tostring(suffix) for k, v in pairs(scandir(pth)) do if (v:match('.'..psv..'$')) then table.insert(files, v) end end return files end -------------------------------- function file_exi(name, path, suffix) local fname = tostring(name) local pth = tostring(path) local psv = tostring(suffix) for k,v in pairs(exi_file(pth, psv)) do if fname == v then return true end end return false end -------------------------------- function run(msg, matches) local Chash = "cmd_lang:"..msg.to.id local Clang = redis:get(Chash) if (matches[1]:lower() == 'calc' and not Clang) or (matches[1]:lower() == 'ماشین حساب' and Clang) and matches[2] then if msg.to.type == "pv" then return end return calc(matches[2]) end -------------------------------- if (matches[1]:lower() == 'praytime' and not Clang) or (matches[1]:lower() == 'ساعات شرعی' and Clang) then if matches[2] then city = matches[2] elseif not matches[2] then city = 'Tehran' end local lat,lng,url = get_staticmap(city) local dumptime = run_bash('date +%s') local code = http.request('http://api.aladhan.com/timings/'..dumptime..'?latitude='..lat..'&longitude='..lng..'&timezonestring=Asia/Tehran&method=7') local jdat = json:decode(code) local data = jdat.data.timings local text = 'شهر: '..city text = text..'\nاذان صبح: '..data.Fajr text = text..'\nطلوع آفتاب: '..data.Sunrise text = text..'\nاذان ظهر: '..data.Dhuhr text = text..'\nغروب آفتاب: '..data.Sunset text = text..'\nاذان مغرب: '..data.Maghrib text = text..'\nعشاء : '..data.Isha text = text..msg_caption return tdcli.sendMessage(msg.chat_id_, 0, 1, text, 1, 'html') end -------------------------------- if (matches[1]:lower() == 'tophoto' and not Clang) or (matches[1]:lower() == 'تبدیل به عکس' and Clang) and msg.reply_id then function tophoto(arg, data) function tophoto_cb(arg,data) if data.content_.sticker_ then local file = data.content_.sticker_.sticker_.path_ local secp = tostring(tcpath)..'/data/sticker/' local ffile = string.gsub(file, '-', '') local fsecp = string.gsub(secp, '-', '') local name = string.gsub(ffile, fsecp, '') local sname = string.gsub(name, 'webp', 'jpg') local pfile = 'data/photos/'..sname local pasvand = 'webp' local apath = tostring(tcpath)..'/data/sticker' if file_exi(tostring(name), tostring(apath), tostring(pasvand)) then os.rename(file, pfile) tdcli.sendPhoto(msg.to.id, 0, 0, 1, nil, pfile, msg_caption, dl_cb, nil) else tdcli.sendMessage(msg.to.id, msg.id_, 1, '_This sticker does not exist. Send sticker again._'..msg_caption, 1, 'md') end else tdcli.sendMessage(msg.to.id, msg.id_, 1, '_This is not a sticker._', 1, 'md') end end tdcli_function ({ ID = 'GetMessage', chat_id_ = msg.chat_id_, message_id_ = data.id_ }, tophoto_cb, nil) end tdcli_function ({ ID = 'GetMessage', chat_id_ = msg.chat_id_, message_id_ = msg.reply_id }, tophoto, nil) end -------------------------------- if (matches[1]:lower() == 'tosticker' and not Clang) or (matches[1]:lower() == 'تبدیل به استیکر' and Clang) and msg.reply_id then function tosticker(arg, data) function tosticker_cb(arg,data) if data.content_.ID == 'MessagePhoto' then file = data.content_.photo_.id_ local pathf = tcpath..'/data/photo/'..file..'_(1).jpg' local pfile = 'data/photos/'..file..'.webp' if file_exi(file..'_(1).jpg', tcpath..'/data/photo', 'jpg') then os.rename(pathf, pfile) tdcli.sendDocument(msg.chat_id_, 0, 0, 1, nil, pfile, msg_caption, dl_cb, nil) else tdcli.sendMessage(msg.to.id, msg.id_, 1, '_This photo does not exist. Send photo again._', 1, 'md') end else tdcli.sendMessage(msg.to.id, msg.id_, 1, '_This is not a photo._', 1, 'md') end end tdcli_function ({ ID = 'GetMessage', chat_id_ = msg.chat_id_, message_id_ = data.id_ }, tosticker_cb, nil) end tdcli_function ({ ID = 'GetMessage', chat_id_ = msg.chat_id_, message_id_ = msg.reply_id }, tosticker, nil) end -------------------------------- if (matches[1]:lower() == 'weather' and not Clang) or (matches[1]:lower() == 'اب و هوا' and Clang) then city = matches[2] local wtext = get_weather(city) if not wtext then wtext = 'مکان وارد شده صحیح نیست' end return wtext end -------------------------------- if (matches[1]:lower() == 'time' and not Clang) or (matches[1]:lower() == 'ساعت' and Clang) then local url , res = http.request('http://api.beyond-dev.ir/time/') if res ~= 200 then return "No connection" end local colors = {'blue','green','yellow','magenta','Orange','DarkOrange','red'} local fonts = {'mathbf','mathit','mathfrak','mathrm'} local jdat = json:decode(url) local url = 'http://latex.codecogs.com/png.download?'..'\\dpi{600}%20\\huge%20\\'..fonts[math.random(#fonts)]..'{{\\color{'..colors[math.random(#colors)]..'}'..jdat.ENtime..'}}' local file = download_to_file(url,'time.webp') tdcli.sendDocument(msg.to.id, 0, 0, 1, nil, file, msg_caption, dl_cb, nil) end -------------------------------- if (matches[1]:lower() == 'voice' and not Clang) or (matches[1]:lower() == 'تبدیل به صدا' and Clang) then local text = matches[2] textc = text:gsub(' ','.') if msg.to.type == 'pv' then return nil else local url = "http://tts.baidu.com/text2audio?lan=en&ie=UTF-8&text="..textc local file = download_to_file(url,'BD-Reborn.mp3') tdcli.sendDocument(msg.to.id, 0, 0, 1, nil, file, msg_caption, dl_cb, nil) end end -------------------------------- if (matches[1]:lower() == 'tr' and not Clang) or (matches[1]:lower() == 'ترجمه' and Clang) then url = https.request('https://translate.yandex.net/api/v1.5/tr.json/translate?key=trnsl.1.1.20160119T111342Z.fd6bf13b3590838f.6ce9d8cca4672f0ed24f649c1b502789c9f4687a&format=plain&lang='..URL.escape(matches[2])..'&text='..URL.escape(matches[3])) data = json:decode(url) return 'زبان : '..data.lang..'\nترجمه : '..data.text[1]..'\n____________________'..msg_caption end -------------------------------- if (matches[1]:lower() == 'short' and not Clang) or (matches[1]:lower() == 'لینک کوتاه' and Clang) then if matches[2]:match("[Hh][Tt][Tt][Pp][Ss]://") then shortlink = matches[2] elseif not matches[2]:match("[Hh][Tt][Tt][Pp][Ss]://") then shortlink = "https://"..matches[2] end local yon = http.request('http://api.yon.ir/?url='..URL.escape(shortlink)) local jdat = json:decode(yon) local bitly = https.request('https://api-ssl.bitly.com/v3/shorten?access_token=f2d0b4eabb524aaaf22fbc51ca620ae0fa16753d&longUrl='..URL.escape(shortlink)) local data = json:decode(bitly) local u2s = http.request('http://u2s.ir/?api=1&return_text=1&url='..URL.escape(shortlink)) local llink = http.request('http://llink.ir/yourls-api.php?signature=a13360d6d8&action=shorturl&url='..URL.escape(shortlink)..'&format=simple') local text = ' 🌐لینک اصلی :\n'..check_markdown(data.data.long_url)..'\n\nلینکهای کوتاه شده با 6 سایت کوتاه ساز لینک : \n》کوتاه شده با bitly :\n___________________________\n'..(check_markdown(data.data.url) or '---')..'\n___________________________\n》کوتاه شده با u2s :\n'..(check_markdown(u2s) or '---')..'\n___________________________\n》کوتاه شده با llink : \n'..(check_markdown(llink) or '---')..'\n___________________________\n》لینک کوتاه شده با yon : \nyon.ir/'..(check_markdown(jdat.output) or '---')..'\n____________________'..msg_caption return tdcli.sendMessage(msg.chat_id_, 0, 1, text, 1, 'html') end -------------------------------- if (matches[1]:lower() == 'sticker' and not Clang) or (matches[1]:lower() == 'استیکر' and Clang) then local eq = URL.escape(matches[2]) local w = "500" local h = "500" local txtsize = "100" local txtclr = "ff2e4357" if matches[3] then txtclr = matches[3] end if matches[4] then txtsize = matches[4] end if matches[5] and matches[6] then w = matches[5] h = matches[6] end local url = "https://assets.imgix.net/examples/clouds.jpg?blur=150&w="..w.."&h="..h.."&fit=crop&txt="..eq.."&txtsize="..txtsize.."&txtclr="..txtclr.."&txtalign=middle,center&txtfont=Futura%20Condensed%20Medium&mono=ff6598cc" local receiver = msg.to.id local file = download_to_file(url,'text.webp') tdcli.sendDocument(msg.to.id, 0, 0, 1, nil, file, msg_caption, dl_cb, nil) end -------------------------------- if (matches[1]:lower() == 'عکس' and not Clang) or (matches[1]:lower() == 'عکس' and Clang) then local eq = URL.escape(matches[2]) local w = "500" local h = "500" local txtsize = "100" local txtclr = "ff2e4357" if matches[3] then txtclr = matches[3] end if matches[4] then txtsize = matches[4] end if matches[5] and matches[6] then w = matches[5] h = matches[6] end local url = "https://assets.imgix.net/examples/clouds.jpg?blur=150&w="..w.."&h="..h.."&fit=crop&txt="..eq.."&txtsize="..txtsize.."&txtclr="..txtclr.."&txtalign=middle,center&txtfont=Futura%20Condensed%20Medium&mono=ff6598cc" local receiver = msg.to.id local file = download_to_file(url,'text.jpg') tdcli.sendPhoto(msg.to.id, 0, 0, 1, nil, file, msg_caption, dl_cb, nil) end -------------------------------- if matches[1] == "helpfun" and not Clang then local hash = "gp_lang:"..msg.to.id local lang = redis:get(hash) if not lang then helpfun_en = [[ _ 🎮 Fun Help Commands:_ *🔰 /time* _🔸 Get time in a sticker_ *🔰 /short* `[link]` _🔸 Make short url_ *🔰 /voice* `[text]` _🔸 Convert text to voice_ *🔰 /tr* `[lang] [word]` _🔸 Translates FA to EN and EN to FA_ *🔰 /sticker* `[word]` _🔸 Convert text to sticker_ *🔰 /photo* `[word]` _🔸 Convert text to photo_ *🔰 /calc* `[number]` _🔸 Calculator_ *🔰 /praytime* `[city]` _🔸 Get Patent (Pray Time)_ *🔰 /tosticker* `[reply]` _🔸 Convert photo to sticker_ *🔰 /tophoto* `[reply]` _🔸 Convert text to photo_ *🔰 /weather* `[city]` _🔸 Get weather_ _✅ You can use_ *[!/#]* _at the beginning of commands._ *Good luck ;)*]] else helpfun_en = [[ _🎮 راهنمای فان_ *!time* _دریافت ساعت به صورت استیکر_ *🔰 /short* `[link]` _🔸 کوتاه کننده لینک_ *🔰 /voice* `[text]` _🔸 تبدیل متن به صدا_ *🔰 /tr* `[lang]` `[word]` _🔸 ترجمه متن فارسی به انگلیسی وبرعکس_ *🔰 /sticker* `[word]` _🔸 تبدیل متن به استیکر_ *🔰 /photo* `[word]` _🔸 تبدیل متن به عکس_ *🔰 /calc* `[number]` _🔸 ماشین حساب_ *🔰 /praytime* `[city]` _🔸 اعلام ساعات شرعی_ *🔰 /tosticker* `[reply]` _🔸 تبدیل عکس به استیکر_ *🔰 /tophoto* `[reply]` _🔸 تبدیل استیکر‌به عکس_ *🔰 /weather* `[city]` _🔸 دریافت اب وهوا_ *✅ شما میتوانید از [!/#] در اول دستورات برای اجرای آنها بهره بگیرید* موفق باشید ;)]] end return helpfun_en..msg_caption end if matches[1] == "راهنمای سرگرمی" and Clang then local hash = "gp_lang:"..msg.to.id local lang = redis:get(hash) if not lang then helpfun_fa = [[ _🎮 Fun Help Commands:_ *🔰 ساعت* _🔸 Get time in a sticker_ *🔰 لینک کوتاه* `[لینک]` _🔸 Make short url_ *🔰 تبدیل به صدا* `[متن]` _🔸 Convert text to voice_ *🔰 ترجمه* `[زبان] [کلمه]` _🔸 Translates FA to EN and EN to FA_ *🔰 استیکر* `[متن]` _🔸 Convert text to sticker_ *🔰 عکس* `[متن]` _🔸 Convert text to photo_ *🔰 ماشین حساب* `[معادله]` _🔸 Calculator_ *🔰 ساعات شرعی* `[شهر]` _🔸 Get Patent (Pray Time)_ *🔰 تبدیل به استیکر* `[ریپلی]` _🔸 Convert photo to sticker_ *🔰 تبدیل به عکس* `[ریپلی]` _🔸 Convert text to photo_ *🔰 اب و هوا* `[شهر]` _🔸 Get weather_ *Good luck ;)*]] else helpfun_fa = [[ _🎮 راهنمای فان_ *🔰 ساعت* _🔸 دریافت ساعت به صورت استیکر_ *🔰 لینک کوتاه* `[لینک]` _🔸 کوتاه کننده لینک_ *🔰 تبدیل به صدا* `[متن]` _🔸 تبدیل متن به صدا_ *🔰 ترجمه* `[زبان]` `[متن]` _🔸 ترجمه متن فارسی به انگلیسی وبرعکس_ *🔰 استیکر* `[متن]` _🔸 تبدیل متن به استیکر_ *🔰 استیکر* `[متن]` _🔸 تبدیل متن به عکس_ *🔰 ماشین حساب* `[معادله]` _🔸 ماشین حساب_ *🔰 ساعات شرعی* `[شهر]` _🔸 اعلام ساعات شرعی_ *🔰 تبدیل به استیکر* `[ریپلی]` _🔸 تبدیل عکس به استیکر_ *🔰 تبدیل به عکس* `[ریپلی]` _🔸 تبدیل استیکر‌به عکس_ *🔰 اب و هوا* `[شهر]` _🔸 دریافت اب وهوا_ موفق باشید ;)]] end return helpfun_fa..msg_caption end end -------------------------------- return { patterns = { "^[!/#](helpfun)$", "^[!/#](weather) (.*)$", "^[!/](calc) (.*)$", "^[#!/](time)$", "^[#!/](tophoto)$", "^[#!/](tosticker)$", "^[!/#](voice) +(.*)$", "^[/!#]([Pp]raytime) (.*)$", "^[/!#](praytime)$", "^[!/]([Tt]r) ([^%s]+) (.*)$", "^[!/]([Ss]hort) (.*)$", "^[!/](photo) (.+)$", "^[!/](sticker) (.+)$", "^(راهنمای سرگرمی)$", "^(اب و هوا) (.*)$", "^(ماشین حساب) (.*)$", "^(ساعت)$", "^(تبدیل به عکس)$", "^(تبدیل به استیکر)$", "^(تبدیل به صدا) +(.*)$", "^(ساعات شرعی) (.*)$", "^(ساعات شرعی)$", "^(ترجمه) ([^%s]+) (.*)$", "^(لینک کوتاه) (.*)$", "^(عکس) (.+)$", "^(استیکر) (.+)$" }, run = run, } --#by @BeyondTeam :)
gpl-3.0
awesomeWM/awesome
lib/wibox/layout/grid.lua
1
34818
--------------------------------------------------------------------------- --- Place multiple widgets in multiple rows and columns. -- -- Widgets spanning several columns or rows cannot be included using the -- declarative system. -- Instead, create the grid layout and call the `add_widget_at` method. -- --@DOC_wibox_layout_grid_imperative_EXAMPLE@ -- -- Using the declarative system, widgets are automatically added next to each -- other spanning only one cell. -- --@DOC_wibox_layout_defaults_grid_EXAMPLE@ -- @author getzze -- @copyright 2017 getzze -- @layoutmod wibox.layout.grid -- @supermodule wibox.widget.base --------------------------------------------------------------------------- local setmetatable = setmetatable local unpack = unpack or table.unpack -- luacheck: globals unpack (compatibility with Lua 5.1) local table = table local pairs = pairs local ipairs = ipairs local math = math local gtable = require("gears.table") local base = require("wibox.widget.base") local grid = { mt = {} } local properties = { "orientation", "superpose", "forced_num_rows", "forced_num_cols", "min_cols_size", "min_rows_size", } local dir_properties = { "spacing", "homogeneous", "expand" } --- Set the preferred orientation of the grid layout. -- -- When calling `get_next_empty`, empty cells are browsed differently. -- --@DOC_wibox_layout_grid_orientation_EXAMPLE@ -- @tparam[opt="vertical"] string orientation Preferred orientation. -- @propertyvalue "horizontal" The grid can be extended horizontally. The current -- column is filled first; if no empty cell is found up to `forced_num_rows`, -- the next column is filled, creating it if it does not exist. -- @propertyvalue "vertical" The grid can be extended vertically. The current row is -- filled first; if no empty cell is found up to `forced_num_cols`, the next -- row is filled, creating it if it does not exist. -- @property orientation --- Allow to superpose widgets in the same cell. -- If false, check before adding a new widget if it will superpose with another -- widget and prevent from adding it. -- --@DOC_wibox_layout_grid_superpose_EXAMPLE@ -- @tparam[opt=false] boolean superpose -- @property superpose --- Force the number of rows of the layout. -- @property forced_num_rows -- @tparam[opt=nil] number|nil forced_num_rows -- @propertytype nil Automatically determine the number of rows. -- @propertyunit rows -- @negativeallowed false -- @see forced_num_cols --- Force the number of columns of the layout. -- @property forced_num_cols -- @tparam[opt=nil] number|nil forced_num_cols -- @propertytype nil Automatically determine the number of columns.' -- @propertyunit columns -- @negativeallowed false -- @see forced_num_rows --- Set the minimum size for the columns. -- --@DOC_wibox_layout_grid_min_size_EXAMPLE@ -- @tparam[opt=0] number min_cols_size Minimum size of the columns. -- @property min_cols_size -- @propertyunit pixel -- @negativeallowed false -- @see min_rows_size --- Set the minimum size for the rows. -- @tparam[opt=0] number min_rows_size Minimum size of the rows. -- @property min_rows_size -- @propertyunit pixel -- @negativeallowed false -- @see min_cols_size --- The spacing between columns. -- -- @tparam[opt=0] number horizontal_spacing -- @property horizontal_spacing -- @propertyunit pixel -- @negativeallowed false -- @see spacing -- @see vertical_spacing --- The spacing between rows. -- -- @tparam[opt=0] number vertical_spacing -- @property vertical_spacing -- @propertyunit pixel -- @negativeallowed false -- @see spacing -- @see horizontal_spacing --- The spacing between rows and columns. -- -- Get the value `horizontal_spacing` or `vertical_spacing` defined by the -- preferred `orientation`. -- --@DOC_wibox_layout_grid_spacing_EXAMPLE@ -- @tparam[opt=0] number spacing -- @property spacing -- @negativeallowed false -- @see vertical_spacing -- @see horizontal_spacing --- Controls if the columns are expanded to use all the available width. -- -- @tparam[opt=false] boolean horizontal_expand Expand the grid into the available space -- @property horizontal_expand -- @see expand -- @see vertical_expand --- Controls if the rows are expanded to use all the available height. -- -- @tparam[opt=false] boolean vertical_expand Expand the grid into the available space -- @property vertical_expand -- @see expand -- @see horizontal_expand --- Controls if the columns/rows are expanded to use all the available space. -- -- Get the value `horizontal_expand` or `vertical_expand` defined by the -- preferred `orientation`. -- --@DOC_wibox_layout_grid_expand_EXAMPLE@ -- @tparam[opt=false] boolean expand Expand the grid into the available space -- @property expand -- @see horizontal_expand -- @see vertical_expand --- Controls if the columns all have the same width or if the width of each -- column depends on the content. -- -- see `homogeneous` -- -- @tparam[opt=true] boolean horizontal_homogeneous All the columns have the same width. -- @property horizontal_homogeneous -- @see vertical_homogeneous -- @see homogeneous --- Controls if the rows all have the same height or if the height of each row -- depends on the content. -- -- see `homogeneous` -- -- @tparam[opt=true] boolean vertical_homogeneous All the rows have the same height. -- @property vertical_homogeneous -- @see homogeneous -- @see horizontal_homogeneous --- Controls if the columns/rows all have the same size or if the size depends -- on the content. -- Set both `horizontal_homogeneous` and `vertical_homogeneous` to the same value. -- Get the value `horizontal_homogeneous` or `vertical_homogeneous` defined -- by the preferred `orientation`. -- --@DOC_wibox_layout_grid_expand_EXAMPLE@ -- @tparam[opt=true] boolean homogeneous All the columns/rows have the same size. -- @property homogeneous -- @see vertical_homogeneous -- @see horizontal_homogeneous --- Child widget position. Return of `get_widget_position`. -- @field row Top row index -- @field col Left column index -- @field row_span Number of rows to span -- @field col_span Number of columns to span -- @table position -- Return the maximum value of a table. local function max_value(t) local m = 0 for _,v in ipairs(t) do if m < v then m = v end end return m end -- Return the sum of the values in the table. local function sum_values(t) local m = 0 for _,v in ipairs(t) do m = m + v end return m end -- Find a widget in a widget_table, by matching the coordinates. -- Using the `row`:`col` coordinates, and the spans `row_span` and `col_span` -- @tparam table widgets_table Table of the widgets present in the grid -- @tparam number row Row number for the top left corner of the widget -- @tparam number col Column number for the top left corner of the widget -- @tparam number row_span The number of rows the widget spans (default to 1) -- @tparam number col_span The number of columns the widget spans (default to 1) -- @treturn table Table of index of widget_table local function find_widgets_at(widgets_table, row, col, row_span, col_span) if not row or row < 1 or not col or col < 1 then return nil end row_span = (row_span and row_span > 0) and row_span or 1 col_span = (col_span and col_span > 0) and col_span or 1 local ret = {} for index, data in ipairs(widgets_table) do -- If one rectangular widget is on left side of other local test_horizontal = not (row > data.row + data.row_span - 1 or data.row > row + row_span - 1) -- If one rectangular widget is above other local test_vertical = not (col > data.col + data.col_span - 1 or data.col > col + col_span - 1) if test_horizontal and test_vertical then table.insert(ret, index) end end -- reverse sort for safe removal of indices table.sort(ret, function(a,b) return a>b end) return #ret > 0 and ret or nil end -- Find a widget in a widget_table, by matching the object. -- @tparam table widgets_table Table of the widgets present in the grid -- @param widget The widget to find -- @treturn number|nil The index of the widget in widget_table, `nil` if not found local function find_widget(widgets_table, widget) for index, data in ipairs(widgets_table) do if data.widget == widget then return index end end return nil end --- Get the number of rows and columns occupied by the widgets in the grid. -- @method get_dimension -- @treturn number,number The number of rows and columns function grid:get_dimension() return self._private.num_rows, self._private.num_cols end -- Update the number of rows and columns occupied by the widgets in the grid. local function update_dimension(self) local num_rows, num_cols = 0, 0 if self._private.forced_num_rows then num_rows = self._private.forced_num_rows end if self._private.forced_num_cols then num_cols = self._private.forced_num_cols end for _, data in ipairs(self._private.widgets) do num_rows = math.max(num_rows, data.row + data.row_span - 1) num_cols = math.max(num_cols, data.col + data.col_span - 1) end self._private.num_rows = num_rows self._private.num_cols = num_cols end --- Find the next available cell to insert a widget. -- The grid is browsed according to the `orientation`. -- @method get_next_empty -- @tparam[opt=1] number hint_row The row coordinate of the last occupied cell. -- @tparam[opt=1] number hint_column The column coordinate of the last occupied cell. -- @return number,number The row,column coordinate of the next empty cell function grid:get_next_empty(hint_row, hint_column) local row = (hint_row and hint_row > 0) and hint_row or 1 local column = (hint_column and hint_column > 0) and hint_column or 1 local next_field if self._private.orientation == "vertical" then next_field = function(x, y) if y < self._private.num_cols then return x, y+1 end return x+1,1 end elseif self._private.orientation == "horizontal" then next_field = function(x, y) if x < self._private.num_rows then return x+1, y end return 1,y+1 end end while true do if find_widgets_at(self._private.widgets, row, column, 1, 1) == nil then return row, column end row, column = next_field(row, column) end end --- Add some widgets to the given grid layout. -- -- The widgets are assumed to span one cell. -- -- @method add -- @tparam wibox.widget ... Widgets that should be added (must at least be one) -- @interface layout -- @noreturn function grid:add(...) local args = { n=select('#', ...), ... } assert(args.n > 0, "need at least one widget to add") local row, column for i=1, args.n do -- Get the next empty coordinate to insert the widget row, column = self:get_next_empty(row, column) self:add_widget_at(args[i], row, column, 1, 1) end end --- Add a widget to the grid layout at specific coordinate. -- --@DOC_wibox_layout_grid_add_EXAMPLE@ -- -- @method add_widget_at -- @tparam wibox.widget child Widget that should be added -- @tparam number row Row number for the top left corner of the widget -- @tparam number col Column number for the top left corner of the widget -- @tparam[opt=1] number row_span The number of rows the widget spans. -- @tparam[opt=1] number col_span The number of columns the widget spans. -- @treturn boolean index If the operation is successful function grid:add_widget_at(child, row, col, row_span, col_span) if not row or row < 1 or not col or col < 1 then return false end row_span = (row_span and row_span > 0) and row_span or 1 col_span = (col_span and col_span > 0) and col_span or 1 -- check if the object is a widget child = base.make_widget_from_value(child) base.check_widget(child) -- test if the new widget superpose with existing ones local superpose = find_widgets_at( self._private.widgets, row, col, row_span, col_span ) if not self._private.superpose and superpose then return false end -- Add grid information attached to the widget local child_data = { widget = child, row = row, col = col, row_span = row_span, col_span = col_span } table.insert(self._private.widgets, child_data) -- Update the row and column numbers self._private.num_rows = math.max(self._private.num_rows, row + row_span - 1) self._private.num_cols = math.max(self._private.num_cols, col + col_span - 1) self:emit_signal("widget::layout_changed") self:emit_signal("widget::redraw_needed") return true end --- Remove one or more widgets from the layout. -- @method remove -- @param ... Widgets that should be removed (must at least be one) -- @treturn boolean If the operation is successful function grid:remove(...) local args = { ... } local ret = false for _, rem_widget in ipairs(args) do local index = find_widget(self._private.widgets, rem_widget) if index ~= nil then table.remove(self._private.widgets, index) ret = true end end if ret then -- Recalculate num_rows and num_cols update_dimension(self) self:emit_signal("widget::layout_changed") self:emit_signal("widget::redraw_needed") end return ret end --- Remove widgets at the coordinates. -- --@DOC_wibox_layout_grid_remove_EXAMPLE@ -- -- @method remove_widgets_at -- @tparam number row The row coordinate of the widget to remove -- @tparam number col The column coordinate of the widget to remove -- @tparam[opt=1] number row_span The number of rows the area to remove spans. -- @tparam[opt=1] number col_span The number of columns the area to remove spans. -- @treturn boolean If the operation is successful (widgets found) function grid:remove_widgets_at(row, col, row_span, col_span) local widget_indices = find_widgets_at( self._private.widgets, row, col, row_span, col_span ) if widget_indices == nil then return false end for _,index in ipairs(widget_indices) do table.remove(self._private.widgets, index) end -- Recalculate num_rows and num_cols update_dimension(self) self:emit_signal("widget::layout_changed") self:emit_signal("widget::redraw_needed") return true end --- Return the coordinates of the widget. -- @method get_widget_position -- @tparam widget widget The widget -- @treturn table The `position` table of the coordinates in the grid, with -- fields `row`, `col`, `row_span` and `col_span`. function grid:get_widget_position(widget) local index = find_widget(self._private.widgets, widget) if index == nil then return nil end local data = self._private.widgets[index] local ret = {} ret["row"] = data.row ret["col"] = data.col ret["row_span"] = data.row_span ret["col_span"] = data.col_span return ret end --- Return the widgets at the coordinates. -- @method get_widgets_at -- @tparam number row The row coordinate of the widget -- @tparam number col The column coordinate of the widget -- @tparam[opt=1] number row_span The number of rows to span. -- @tparam[opt=1] number col_span The number of columns to span. -- @treturn table The widget(s) found at the specific coordinates, nil if no widgets found function grid:get_widgets_at(row, col, row_span, col_span) local widget_indices = find_widgets_at( self._private.widgets, row, col, row_span, col_span ) if widget_indices == nil then return nil end local ret = {} for _,index in ipairs(widget_indices) do local data = self._private.widgets[index] table.insert(ret, data.widget) end return #ret > 0 and ret or nil end --- Replace old widget by new widget, spanning the same columns and rows. -- @method replace_widget -- @tparam widget old The widget to remove -- @tparam widget new The widget to add -- @treturn boolean If the operation is successful (widget found) function grid:replace_widget(old, new) -- check if the new object is a widget local status = pcall(function () base.check_widget(new) end) if not status then return false end -- find the old widget local index = find_widget(self._private.widgets, old) if index == nil then return false end -- get old widget position local data = self._private.widgets[index] local row, col, row_span, col_span = data.row, data.col, data.row_span, data.col_span table.remove(self._private.widgets, index) return self:add_widget_at(new, row, col, row_span, col_span) end -- Update position of the widgets when inserting, adding or removing a row or a column. -- @tparam table table_widgets Table of widgets -- @tparam string orientation Orientation of the line: "horizontal" -> column, "vertical" -> row -- @tparam number index Index of the line -- @tparam string mode insert, extend or remove -- @tparam boolean after Add the line after the index instead of inserting it before. -- @tparam boolean extend Extend the line at index instead of inserting an empty line. local function update_widgets_position(table_widgets, orientation, index, mode) local t = orientation == "horizontal" and "col" or "row" local to_remove = {} -- inc : Index increment or decrement -- first : Offset index for top-left cell of the widgets to shift -- last : Offset index for bottom-right cell of the widgets to resize local inc, first, last if mode == "remove" then inc, first, last = -1, 1, 1 elseif mode == "insert" then inc, first, last = 1, 0, 0 elseif mode == "extend" then inc, first, last = 1, 1, 0 else return end for i, data in ipairs(table_widgets) do -- single widget in the line if mode == "remove" and data[t] == index and data[t .. "_span"] == 1 then table.insert(to_remove, i) -- widgets to shift elseif data[t] >= index + first then data[t] = data[t] + inc -- widgets to resize elseif data[t] + data[t .. "_span"] - 1 >= index + last then data[t .. "_span"] = data[t .. "_span"] + inc end end if mode == "remove" then -- reverse sort to remove table.sort(to_remove, function(a,b) return a>b end) -- Remove widgets for _,i in ipairs(to_remove) do table.remove(table_widgets, i) end end end --- Insert column at index. -- --@DOC_wibox_layout_grid_insert_column_EXAMPLE@ -- -- @method insert_column -- @tparam number|nil index Insert the new column at index. If `nil`, the column is added at the end. -- @treturn number The index of the inserted column function grid:insert_column(index) if index == nil or index > self._private.num_cols + 1 or index < 1 then index = self._private.num_cols + 1 end -- Update widget positions update_widgets_position(self._private.widgets, "horizontal", index, "insert") -- Recalculate number of rows and columns self._private.num_cols = self._private.num_cols + 1 return index end --- Extend column at index. --@DOC_wibox_layout_grid_extend_column_EXAMPLE@ -- -- @method extend_column -- @tparam number|nil index Extend the column at index. If `nil`, the last column is extended. -- @treturn number The index of the extended column function grid:extend_column(index) if index == nil or index > self._private.num_cols or index < 1 then index = self._private.num_cols end -- Update widget positions update_widgets_position(self._private.widgets, "horizontal", index, "extend") -- Recalculate number of rows and columns self._private.num_cols = self._private.num_cols + 1 return index end --- Remove column at index. -- --@DOC_wibox_layout_grid_remove_column_EXAMPLE@ -- -- @method remove_column -- @tparam number|nil index Remove column at index. If `nil`, the last column is removed. -- @treturn number The index of the removed column function grid:remove_column(index) if index == nil or index > self._private.num_cols or index < 1 then index = self._private.num_cols end -- Update widget positions update_widgets_position(self._private.widgets, "horizontal", index, "remove") -- Recalculate number of rows and columns update_dimension(self) return index end --- Insert row at index. -- -- see `insert_column` -- -- @method insert_row -- @tparam number|nil index Insert the new row at index. If `nil`, the row is added at the end. -- @treturn number The index of the inserted row function grid:insert_row(index) if index == nil or index > self._private.num_rows + 1 or index < 1 then index = self._private.num_rows + 1 end -- Update widget positions update_widgets_position(self._private.widgets, "vertical", index, "insert") -- Recalculate number of rows and columns self._private.num_rows = self._private.num_rows + 1 return index end --- Extend row at index. -- -- see `extend_column` -- -- @method extend_row -- @tparam number|nil index Extend the row at index. If `nil`, the last row is extended. -- @treturn number The index of the extended row function grid:extend_row(index) if index == nil or index > self._private.num_rows or index < 1 then index = self._private.num_rows end -- Update widget positions update_widgets_position(self._private.widgets, "vertical", index, "extend") -- Recalculate number of rows and columns self._private.num_rows = self._private.num_rows + 1 return index end --- Remove row at index. -- -- see `remove_column` -- -- @method remove_row -- @tparam number|nil index Remove row at index. If `nil`, the last row is removed. -- @treturn number The index of the removed row function grid:remove_row(index) if index == nil or index > self._private.num_rows or index < 1 then index = self._private.num_rows end -- Update widget positions update_widgets_position(self._private.widgets, "vertical", index, "remove") -- Recalculate number of rows and columns update_dimension(self) return index end -- Return list of children function grid:get_children() local ret = {} for _, data in ipairs(self._private.widgets) do table.insert(ret, data.widget) end return ret end -- Add list of children to the layout. function grid:set_children(children) self:reset() if #children > 0 then self:add(unpack(children)) end end -- Set the preferred orientation of the grid layout. function grid:set_orientation(val) if self._private.orientation ~= val and (val == "horizontal" or val == "vertical") then self._private.orientation = val end end -- Set the minimum size for the columns. function grid:set_min_cols_size(val) if self._private.min_cols_size ~= val and val >= 0 then self._private.min_cols_size = val end end -- Set the minimum size for the rows. function grid:set_min_rows_size(val) if self._private.min_rows_size ~= val and val >= 0 then self._private.min_rows_size = val end end -- Force the number of columns of the layout. function grid:set_forced_num_cols(val) if self._private.forced_num_cols ~= val then self._private.forced_num_cols = val update_dimension(self) self:emit_signal("widget::layout_changed") end end -- Force the number of rows of the layout. function grid:set_forced_num_rows(val) if self._private.forced_num_rows ~= val then self._private.forced_num_rows = val update_dimension(self) self:emit_signal("widget::layout_changed") end end -- Set the grid properties for _, prop in ipairs(properties) do if not grid["set_" .. prop] then grid["set_"..prop] = function(self, value) if self._private[prop] ~= value then self._private[prop] = value self:emit_signal("widget::layout_changed") end end end if not grid["get_" .. prop] then grid["get_"..prop] = function(self) return self._private[prop] end end end -- Set the directional grid properties -- create a couple of properties by prepending `horizontal_` and `vertical_` -- create a common property for the two directions: -- setting the common property sets both directional properties -- getting the common property returns the directional property -- defined by the `orientation` property for _, prop in ipairs(dir_properties) do for _,dir in ipairs{"horizontal", "vertical"} do local dir_prop = dir .. "_" .. prop grid["set_"..dir_prop] = function(self, value) if self._private[dir_prop] ~= value then self._private[dir_prop] = value self:emit_signal("widget::layout_changed") end end grid["get_"..dir_prop] = function(self) return self._private[dir_prop] end end -- Non-directional options grid["set_"..prop] = function(self, value) if self._private["horizontal_"..prop] ~= value or self._private["vertical_"..prop] ~= value then self._private["horizontal_"..prop] = value self._private["vertical_"..prop] = value self:emit_signal("widget::layout_changed") end end grid["get_"..prop] = function(self) return self._private[self._private.orientation .. "_" .. prop] end end -- Return two tables of the fitted sizes of the rows and columns -- @treturn table,table Tables of row heights and column widths local function get_grid_sizes(self, context, orig_width, orig_height) local rows_size = {} local cols_size = {} -- Set the row and column sizes to the minimum value for i = 1,self._private.num_rows do rows_size[i] = self._private.min_rows_size end for j = 1,self._private.num_cols do cols_size[j] = self._private.min_cols_size end -- Calculate cell sizes for _, data in ipairs(self._private.widgets) do local w, h = base.fit_widget(self, context, data.widget, orig_width, orig_height) h = math.max( self._private.min_rows_size, h / data.row_span ) w = math.max( self._private.min_cols_size, w / data.col_span ) -- update the row and column maximum size for i = data.row, data.row + data.row_span - 1 do if h > rows_size[i] then rows_size[i] = h end end for j = data.col, data.col + data.col_span - 1 do if w > cols_size[j] then cols_size[j] = w end end end return rows_size, cols_size end -- Fit the grid layout into the given space. -- @param context The context in which we are fit. -- @param orig_width The available width. -- @param orig_height The available height. function grid:fit(context, orig_width, orig_height) local width, height = orig_width, orig_height -- Calculate the space needed local function fit_direction(dir, sizes) local m = 0 if self._private[dir .. "_homogeneous"] then -- all the columns/rows have the same size m = #sizes * max_value(sizes) + (#sizes - 1) * self._private[dir .. "_spacing"] else -- sum the columns/rows size for _,s in ipairs(sizes) do m = m + s + self._private[dir .. "_spacing"] end m = m - self._private[dir .. "_spacing"] end return m end -- fit matrix cells local rows_size, cols_size = get_grid_sizes(self, context, width, height) -- compute the width local used_width_max = fit_direction("horizontal", cols_size) local used_height_max = fit_direction("vertical", rows_size) return used_width_max, used_height_max end -- Layout a grid layout. -- @param context The context in which we are drawn. -- @param width The available width. -- @param height The available height. function grid:layout(context, width, height) local result = {} local hspacing, vspacing = self._private.horizontal_spacing, self._private.vertical_spacing -- Fit matrix cells local rows_size, cols_size = get_grid_sizes(self, context, width, height) local total_expected_width, total_expected_height = sum_values(cols_size), sum_values(rows_size) -- Figure out the maximum size we can give out to sub-widgets local single_width, single_height = max_value(cols_size), max_value(rows_size) if self._private.horizontal_expand then single_width = (width - (self._private.num_cols-1)*hspacing) / self._private.num_cols end if self._private.vertical_expand then single_height = (height - (self._private.num_rows-1)*vspacing) / self._private.num_rows end -- Calculate the position and size to place the widgets local cumul_width, cumul_height = {}, {} local cw, ch = 0, 0 for j = 1, #cols_size do cumul_width[j] = cw if self._private.horizontal_homogeneous then cols_size[j] = math.max(self._private.min_cols_size, single_width) elseif self._private.horizontal_expand then local hpercent = self._private.num_cols * single_width * cols_size[j] / total_expected_width cols_size[j] = math.max(self._private.min_cols_size, hpercent) end cw = cw + cols_size[j] + hspacing end cumul_width[#cols_size + 1] = cw for i = 1, #rows_size do cumul_height[i] = ch if self._private.vertical_homogeneous then rows_size[i] = math.max(self._private.min_rows_size, single_height) elseif self._private.vertical_expand then local vpercent = self._private.num_rows * single_height * rows_size[i] / total_expected_height rows_size[i] = math.max(self._private.min_rows_size, vpercent) end ch = ch + rows_size[i] + vspacing end cumul_height[#rows_size + 1] = ch -- Place widgets local fill_space = true -- should be fill_space property? for _, v in pairs(self._private.widgets) do local x, y, w, h -- Round numbers to avoid decimals error, force to place tight widgets -- and avoid redraw glitches x = math.floor(cumul_width[v.col]) y = math.floor(cumul_height[v.row]) w = math.floor(cumul_width[v.col + v.col_span] - hspacing - x) h = math.floor(cumul_height[v.row + v.row_span] - vspacing - y) -- Recalculate the width so the last widget fits if (fill_space or self._private.horizontal_expand) and x + w > width then w = math.floor(math.max(self._private.min_cols_size, width - x)) end -- Recalculate the height so the last widget fits if (fill_space or self._private.vertical_expand) and y + h > height then h = math.floor(math.max(self._private.min_rows_size, height - y)) end -- Place the widget if it fits in the area if x + w <= width and y + h <= height then table.insert(result, base.place_widget_at(v.widget, x, y, w, h)) end end return result end --- Reset the grid layout. -- Remove all widgets and reset row and column counts -- -- @method reset -- @emits reset -- @noreturn function grid:reset() self._private.widgets = {} -- reset the number of columns and rows to the forced value or to 0 self._private.num_rows = self._private.forced_num_rows ~= nil and self._private.forced_num_rows or 0 self._private.num_cols = self._private.forced_num_cols ~= nil and self._private.forced_num_cols or 0 -- emit signals self:emit_signal("widget::layout_changed") self:emit_signal("widget::reset") end --- When the layout is reset. -- This signal is emitted when the layout has been reset, -- all the widgets removed and the row and column counts reset. -- @signal widget::reset --- Return a new grid layout. -- -- A grid layout sets widgets in a grids of custom number of rows and columns. -- @tparam[opt="y"] string orientation The preferred grid extension direction. -- @constructorfct wibox.layout.grid local function new(orientation) -- Preference for vertical direction: fill rows first, extend grid with new row local dir = (orientation == "horizontal"or orientation == "vertical") and orientation or "vertical" local ret = base.make_widget(nil, nil, {enable_properties = true}) gtable.crush(ret, grid, true) ret._private.orientation = dir ret._private.widgets = {} ret._private.num_rows = 0 ret._private.num_cols = 0 ret._private.rows_size = {} ret._private.cols_size = {} ret._private.superpose = false ret._private.forced_num_rows = nil ret._private.forced_num_cols = nil ret._private.min_rows_size = 0 ret._private.min_cols_size = 0 ret._private.horizontal_homogeneous = true ret._private.vertical_homogeneous = true ret._private.horizontal_expand = false ret._private.vertical_expand = false ret._private.horizontal_spacing = 0 ret._private.vertical_spacing = 0 return ret end --- Return a new horizontal grid layout. -- -- Each new widget is positioned below the last widget on the same column -- up to `forced_num_rows`. Then the next column is filled, creating it if it doesn't exist. -- @tparam number|nil forced_num_rows Forced number of rows (`nil` for automatic). -- @tparam widget ... Widgets that should be added to the layout. -- @constructorfct wibox.layout.grid.horizontal function grid.horizontal(forced_num_rows, widget, ...) local ret = new("horizontal") ret:set_forced_num_rows(forced_num_rows) if widget then ret:add(widget, ...) end return ret end --- Return a new vertical grid layout. -- -- Each new widget is positioned left of the last widget on the same row -- up to `forced_num_cols`. Then the next row is filled, creating it if it doesn't exist. -- @tparam number|nil forced_num_cols Forced number of columns (`nil` for automatic). -- @tparam widget ... Widgets that should be added to the layout. -- @constructorfct wibox.layout.grid.vertical function grid.vertical(forced_num_cols, widget, ...) local ret = new("vertical") ret:set_forced_num_cols(forced_num_cols) if widget then ret:add(widget, ...) end return ret end function grid.mt:__call(...) return new(...) end --@DOC_fixed_COMMON@ return setmetatable(grid, grid.mt) -- vim: filetype=lua:expandtab:shiftwidth=4:tabstop=8:softtabstop=4:textwidth=80
gpl-2.0
bnetcc/darkstar
scripts/zones/Southern_San_dOria/npcs/Simmie.lua
5
1084
----------------------------------- -- Area: Southern San d'Oria -- NPC: Simmie -- General Info NPC ------------------------------------- package.loaded["scripts/zones/Southern_San_dOria/TextIDs"] = nil; ----------------------------------- require("scripts/zones/Southern_San_dOria/TextIDs"); require("scripts/globals/settings"); require("scripts/globals/quests"); function onTrade(player,npc,trade) -- "Flyers for Regine" conditional script local FlyerForRegine = player:getQuestStatus(SANDORIA,FLYERS_FOR_REGINE); if (FlyerForRegine == 1) then local count = trade:getItemCount(); local MagicFlyer = trade:hasItemQty(532,1); if (MagicFlyer == true and count == 1) then player:messageSpecial(FLYER_REFUSED); end end end; function onTrigger(player,npc) player:startEvent(673); end; function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end;
gpl-3.0
bnetcc/darkstar
scripts/globals/magic.lua
1
52800
require("scripts/globals/magicburst"); require("scripts/globals/settings"); require("scripts/globals/weather"); require("scripts/globals/status"); require("scripts/globals/utils"); require("scripts/globals/msg"); DIVINE_MAGIC_SKILL = 32; HEALING_MAGIC_SKILL = 33; ENHANCING_MAGIC_SKILL = 34; ENFEEBLING_MAGIC_SKILL = 35; ELEMENTAL_MAGIC_SKILL = 36; DARK_MAGIC_SKILL = 37; NINJUTSU_SKILL = 39; SUMMONING_SKILL = 38; SINGING_SKILL = 40; STRING_SKILL = 41; WIND_SKILL = 42; BLUE_SKILL = 43; FIRESDAY = 0; EARTHSDAY = 1; WATERSDAY = 2; WINDSDAY = 3; ICEDAY = 4; LIGHTNINGDAY = 5; LIGHTSDAY = 6; DARKSDAY = 7; ELE_NONE = 0; ELE_FIRE = 1; ELE_EARTH = 2; ELE_WATER = 3; ELE_WIND = 4; ELE_ICE = 5; ELE_LIGHTNING = 6; -- added both because monsterstpmoves calls it thunder ELE_THUNDER = 6; ELE_LIGHT = 7; ELE_DARK = 8; dayStrong = {FIRESDAY, EARTHSDAY, WATERSDAY, WINDSDAY, ICEDAY, LIGHTNINGDAY, LIGHTSDAY, DARKSDAY}; dayWeak = {WATERSDAY, WINDSDAY, LIGHTNINGDAY, ICEDAY, FIRESDAY, EARTHSDAY, DARKSDAY, LIGHTSDAY}; singleWeatherStrong = {WEATHER_HOT_SPELL, WEATHER_DUST_STORM, WEATHER_RAIN, WEATHER_WIND, WEATHER_SNOW, WEATHER_THUNDER, WEATHER_AURORAS, WEATHER_GLOOM}; doubleWeatherStrong = {WEATHER_HEAT_WAVE, WEATHER_SAND_STORM, WEATHER_SQUALL, WEATHER_GALES, WEATHER_BLIZZARDS, WEATHER_THUNDERSTORMS, WEATHER_STELLAR_GLARE, WEATHER_DARKNESS}; singleWeatherWeak = {WEATHER_RAIN, WEATHER_WIND, WEATHER_THUNDER, WEATHER_SNOW, WEATHER_HOT_SPELL, WEATHER_DUST_STORM, WEATHER_GLOOM, WEATHER_AURORAS}; doubleWeatherWeak = {WEATHER_SQUALL, WEATHER_GALES, WEATHER_THUNDERSTORMS, WEATHER_BLIZZARDS, WEATHER_HEAT_WAVE, WEATHER_SAND_STORM, WEATHER_DARKNESS, WEATHER_STELLAR_GLARE}; elementalObi = {MOD_FORCE_FIRE_DWBONUS, MOD_FORCE_EARTH_DWBONUS, MOD_FORCE_WATER_DWBONUS, MOD_FORCE_WIND_DWBONUS, MOD_FORCE_ICE_DWBONUS, MOD_FORCE_LIGHTNING_DWBONUS, MOD_FORCE_LIGHT_DWBONUS, MOD_FORCE_DARK_DWBONUS}; elementalObiWeak = {MOD_FORCE_WATER_DWBONUS, MOD_FORCE_WIND_DWBONUS, MOD_FORCE_LIGHTNING_DWBONUS, MOD_FORCE_ICE_DWBONUS, MOD_FORCE_FIRE_DWBONUS, MOD_FORCE_EARTH_DWBONUS, MOD_FORCE_DARK_DWBONUS, MOD_FORCE_LIGHT_DWBONUS}; spellAcc = {MOD_FIREACC, MOD_EARTHACC, MOD_WATERACC, MOD_WINDACC, MOD_ICEACC, MOD_THUNDERACC, MOD_LIGHTACC, MOD_DARKACC}; strongAffinityDmg = {MOD_FIRE_AFFINITY_DMG, MOD_EARTH_AFFINITY_DMG, MOD_WATER_AFFINITY_DMG, MOD_WIND_AFFINITY_DMG, MOD_ICE_AFFINITY_DMG, MOD_THUNDER_AFFINITY_DMG, MOD_LIGHT_AFFINITY_DMG, MOD_DARK_AFFINITY_DMG}; strongAffinityAcc = {MOD_FIRE_AFFINITY_ACC, MOD_EARTH_AFFINITY_ACC, MOD_WATER_AFFINITY_ACC, MOD_WIND_AFFINITY_ACC, MOD_ICE_AFFINITY_ACC, MOD_THUNDER_AFFINITY_ACC, MOD_LIGHT_AFFINITY_ACC, MOD_DARK_AFFINITY_ACC}; resistMod = {MOD_FIRERES, MOD_EARTHRES, MOD_WATERRES, MOD_WINDRES, MOD_ICERES, MOD_THUNDERRES, MOD_LIGHTRES, MOD_DARKRES}; defenseMod = {MOD_FIREDEF, MOD_EARTHDEF, MOD_WATERDEF, MOD_WINDDEF, MOD_ICEDEF, MOD_THUNDERDEF, MOD_LIGHTDEF, MOD_DARKDEF}; absorbMod = {MOD_FIRE_ABSORB, MOD_EARTH_ABSORB, MOD_WATER_ABSORB, MOD_WIND_ABSORB, MOD_ICE_ABSORB, MOD_LTNG_ABSORB, MOD_LIGHT_ABSORB, MOD_DARK_ABSORB}; nullMod = {MOD_FIRE_NULL, MOD_EARTH_NULL, MOD_WATER_NULL, MOD_WIND_NULL, MOD_ICE_NULL, MOD_LTNG_NULL, MOD_LIGHT_NULL, MOD_DARK_NULL}; blmMerit = {MERIT_FIRE_MAGIC_POTENCY, MERIT_EARTH_MAGIC_POTENCY, MERIT_WATER_MAGIC_POTENCY, MERIT_WIND_MAGIC_POTENCY, MERIT_ICE_MAGIC_POTENCY, MERIT_LIGHTNING_MAGIC_POTENCY}; rdmMerit = {MERIT_FIRE_MAGIC_ACCURACY, MERIT_EARTH_MAGIC_ACCURACY, MERIT_WATER_MAGIC_ACCURACY, MERIT_WIND_MAGIC_ACCURACY, MERIT_ICE_MAGIC_ACCURACY, MERIT_LIGHTNING_MAGIC_ACCURACY}; blmAMIIMerit = {MERIT_FLARE_II, MERIT_QUAKE_II, MERIT_FLOOD_II, MERIT_TORNADO_II, MERIT_FREEZE_II, MERIT_BURST_II}; barSpells = {EFFECT_BARFIRE, EFFECT_BARSTONE, EFFECT_BARWATER, EFFECT_BARAERO, EFFECT_BARBLIZZARD, EFFECT_BARTHUNDER}; -- USED FOR DAMAGING MAGICAL SPELLS (Stages 1 and 2 in Calculating Magic Damage on wiki) --Calculates magic damage using the standard magic damage calc. --Does NOT handle resistance. -- Inputs: -- dmg - The base damage of the spell -- multiplier - The INT multiplier of the spell -- skilltype - The skill ID of the spell. -- atttype - The attribute type (usually MOD_INT , except for things like Banish which is MOD_MND) -- hasMultipleTargetReduction - true ifdamage is reduced on AoE. False otherwise (e.g. Charged Whisker vs -ga3 spells) -- -- Output: -- The total damage, before resistance and before equipment (so no HQ staff bonus worked out here). SOFT_CAP = 60; --guesstimated HARD_CAP = 120; --guesstimated function calculateMagicDamage(caster, target, spell, params) local dINT = caster:getStat(params.attribute) - target:getStat(params.attribute); local dmg = params.dmg; if (dINT <= 0) then --if dINT penalises, it's always M=1 dmg = dmg + dINT; if (dmg <= 0) then --dINT penalty cannot result in negative damage (target absorption) return 0; end elseif (dINT > 0 and dINT <= SOFT_CAP) then --The standard calc, most spells hit this dmg = dmg + (dINT * params.multiplier); elseif (dINT > 0 and dINT > SOFT_CAP and dINT < HARD_CAP) then --After SOFT_CAP, INT is only half effective dmg = dmg + SOFT_CAP * params.multiplier + ((dINT - SOFT_CAP) * params.multiplier) / 2; elseif (dINT > 0 and dINT > SOFT_CAP and dINT >= HARD_CAP) then --After HARD_CAP, INT has no effect. dmg = dmg + HARD_CAP * params.multiplier; end if (params.skillType == DIVINE_MAGIC_SKILL and target:isUndead()) then -- 150% bonus damage dmg = dmg * 1.5; end -- printf("dmg: %d dINT: %d\n", dmg, dINT); return dmg; end; function doBoostGain(caster,target,spell,effect) local duration = 300; if (caster:hasStatusEffect(EFFECT_COMPOSURE) == true and caster:getID() == target:getID()) then duration = duration * 3; end --calculate potency local magicskill = target:getSkillLevel(ENHANCING_MAGIC_SKILL); local potency = math.floor((magicskill - 300) / 10) + 5; if (potency > 25) then potency = 25; elseif (potency < 5) then potency = 5; end --printf("BOOST-GAIN: POTENCY = %d", potency); --Only one Boost Effect can be active at once, so if the player has any we have to cancel & overwrite local effectOverwrite = {80, 81, 82, 83, 84, 85, 86}; for i, effect in ipairs(effectOverwrite) do --printf("BOOST-GAIN: CHECKING FOR EFFECT %d...",effect); if (caster:hasStatusEffect(effect)) then --printf("BOOST-GAIN: HAS EFFECT %d, DELETING...",effect); caster:delStatusEffect(effect); end end if (target:addStatusEffect(effect,potency,0,duration)) then spell:setMsg(msgBasic.MAGIC_GAIN_EFFECT); else spell:setMsg(msgBasic.MAGIC_NO_EFFECT); end end; function doEnspell(caster,target,spell,effect) if (effect==EFFECT_BLOOD_WEAPON) then target:addStatusEffect(EFFECT_BLOOD_WEAPON,1,0,30); return; end local duration = 180; if (caster:hasStatusEffect(EFFECT_COMPOSURE) == true and caster:getID() == target:getID()) then duration = duration * 3; end --calculate potency local magicskill = target:getSkillLevel(ENHANCING_MAGIC_SKILL); local potency = 3 + math.floor((6*magicskill)/100); if (magicskill>200) then potency = 5 + math.floor((5*magicskill)/100); end if (target:addStatusEffect(effect,potency,0,duration)) then spell:setMsg(msgBasic.MAGIC_GAIN_EFFECT); else spell:setMsg(msgBasic.MAGIC_NO_EFFECT); end end; --------------------------------- -- getCurePower returns the caster's cure power -- getCureFinal returns the final cure amount -- Source: http://members.shaw.ca/pizza_steve/cure/Cure_Calculator.html --------------------------------- function getCurePower(caster,isBlueMagic) local MND = caster:getStat(MOD_MND); local VIT = caster:getStat(MOD_VIT); local skill = caster:getSkillLevel(HEALING_MAGIC_SKILL); local power = math.floor(MND/2) + math.floor(VIT/4) + skill; return power; end; function getCurePowerOld(caster) local MND = caster:getStat(MOD_MND); local VIT = caster:getStat(MOD_VIT); local skill = caster:getSkillLevel(HEALING_MAGIC_SKILL); -- it's healing magic skill for the BLU cures as well local power = ((3 * MND) + VIT + (3 * math.floor(skill/5))); return power; end; function getBaseCure(power,divisor,constant,basepower) return ((power - basepower) / divisor) + constant; end; function getBaseCureOld(power,divisor,constant) return (power / 2) / divisor + constant; end; function getCureFinal(caster,spell,basecure,minCure,isBlueMagic) if (basecure < minCure) then basecure = minCure; end local potency = 1 + (caster:getMod(MOD_CURE_POTENCY) / 100); if (potency > 1.5) then potency = 1.5; end local dSeal = 1; if (caster:hasStatusEffect(EFFECT_DIVINE_SEAL)) then dSeal = 2; end local rapture = 1; if (isBlueMagic == false) then --rapture doesn't affect BLU cures as they're not white magic if (caster:hasStatusEffect(EFFECT_RAPTURE)) then rapture = 1.5 + caster:getMod(MOD_RAPTURE_AMOUNT)/100; caster:delStatusEffectSilent(EFFECT_RAPTURE); end end local dayWeatherBonus = 1; local ele = spell:getElement(); local castersWeather = caster:getWeather(); if (castersWeather == singleWeatherStrong[ele]) then if (caster:getMod(MOD_IRIDESCENCE) >= 1) then if (math.random() < 0.33 or caster:getMod(elementalObi[ele]) >= 1) then dayWeatherBonus = dayWeatherBonus + 0.10; end end if (math.random() < 0.33 or caster:getMod(elementalObi[ele]) >= 1) then dayWeatherBonus = dayWeatherBonus + 0.10; end elseif (castersWeather == singleWeatherWeak[ele]) then if (math.random() < 0.33 or caster:getMod(elementalObi[ele]) >= 1) then dayWeatherBonus = dayWeatherBonus - 0.10; end elseif (castersWeather == doubleWeatherStrong[ele]) then if (caster:getMod(MOD_IRIDESCENCE) >= 1) then if (math.random() < 0.33 or caster:getMod(elementalObi[ele]) >= 1) then dayWeatherBonus = dayWeatherBonus + 0.10; end end if (math.random() < 0.33 or caster:getMod(elementalObi[ele]) >= 1) then dayWeatherBonus = dayWeatherBonus + 0.25; end elseif (castersWeather == doubleWeatherWeak[ele]) then if (math.random() < 0.33 or caster:getMod(elementalObi[ele]) >= 1) then dayWeatherBonus = dayWeatherBonus - 0.25; end end local dayElement = VanadielDayElement(); if (dayElement == dayStrong[ele]) then if (math.random() < 0.33 or caster:getMod(elementalObi[ele]) >= 1) then dayWeatherBonus = dayWeatherBonus + 0.10; end elseif (dayElement == dayWeak[ele]) then if (math.random() < 0.33 or caster:getMod(elementalObi[ele]) >= 1) then dayWeatherBonus = dayWeatherBonus - 0.10; end end if (dayWeatherBonus > 1.4) then dayWeatherBonus = 1.4; end local final = math.floor(math.floor(math.floor(math.floor(basecure) * potency) * dayWeatherBonus) * rapture) * dSeal; return final; end; function getCureAsNukeFinal(caster,spell,power,divisor,constant,basepower) return getCureFinal(caster,spell,power,divisor,constant,basepower); end; ----------------------------------- -- Returns the staff bonus for the caster and spell. ----------------------------------- -- affinities that strengthen/weaken the index element function AffinityBonusDmg(caster,ele) local affinity = caster:getMod(strongAffinityDmg[ele]); local bonus = 1.00 + affinity * 0.05; -- 5% per level of affinity -- print(bonus); return bonus; end; function AffinityBonusAcc(caster,ele) local affinity = caster:getMod(strongAffinityAcc[ele]); local bonus = 0 + affinity * 10; -- 10 acc per level of affinity -- print(bonus); return bonus; end; -- USED FOR DAMAGING MAGICAL SPELLS. Stage 3 of Calculating Magic Damage on wiki -- Reduces damage ifit resists. -- -- Output: -- The factor to multiply down damage (1/2 1/4 1/8 1/16) - In this format so this func can be used for enfeebs on duration. function applyResistance(caster, target, spell, params) return applyResistanceEffect(caster, target, spell, params); end; -- USED FOR Status Effect Enfeebs (blind, slow, para, etc.) -- Output: -- The factor to multiply down duration (1/2 1/4 1/8 1/16) --[[ local params = {}; params.attribute = $2; params.skillType = $3; params.bonus = $4; params.effect = $5; ]] function applyResistanceEffect(caster, target, spell, params) local diff = params.diff or (caster:getStat(params.attribute) - target:getStat(params.attribute)); local skill = params.skillType; local bonus = params.bonus; local effect = params.effect; if (math.random(1,1000) <= customResCheck(target, effect)) then return 0; end -- If Stymie is active, as long as the mob is not immune then the effect is not resisted if (effect ~= nil) then -- Dispel's script doesn't have an "effect" to send here, nor should it. if (skill == ENFEEBLING_MAGIC_SKILL and caster:hasStatusEffect(EFFECT_STYMIE) and target:canGainStatusEffect(effect)) then caster:delStatusEffect(EFFECT_STYMIE); return 1; end end if (skill == SINGING_SKILL and caster:hasStatusEffect(EFFECT_TROUBADOUR)) then if (math.random(0,99) < caster:getMerit(MERIT_TROUBADOUR)-25) then return 1.0; end end local element = spell:getElement(); local percentBonus = 0; local magicaccbonus = getSpellBonusAcc(caster, target, spell); if (diff > 10) then magicaccbonus = magicaccbonus + 10 + (diff - 10)/2; else magicaccbonus = magicaccbonus + diff; end if (bonus ~= nil) then magicaccbonus = magicaccbonus + bonus; end if (effect ~= nil) then percentBonus = percentBonus - getEffectResistance(target, effect); end local p = getMagicHitRate(caster, target, skill, element, percentBonus, magicaccbonus); return getMagicResist(p); end; -- Applies resistance for things that may not be spells - ie. Quick Draw function applyResistanceAbility(player,target,element,skill,bonus) local p = getMagicHitRate(player, target, skill, element, 0, bonus); return getMagicResist(p); end; -- Applies resistance for additional effects function applyResistanceAddEffect(player,target,element,bonus) local p = getMagicHitRate(player, target, 0, element, 0, bonus); return getMagicResist(p); end; function getMagicHitRate(caster, target, skillType, element, percentBonus, bonusAcc) -- resist everything if magic shield is active --[[ if (target:hasStatusEffect(EFFECT_MAGIC_SHIELD, 0)) then return 0; end ]] if (target:hasStatusEffect(EFFECT_MAGIC_SHIELD)) then if (target:getStatusEffect(EFFECT_MAGIC_SHIELD):getPower() ~= 100) then return 0; end end local magiceva = 0; if (bonusAcc == nil) then bonusAcc = 0; end local magicacc = caster:getMod(MOD_MACC) + caster:getILvlMacc(); -- Get the base acc (just skill + skill mod (79 + skillID = ModID) + magic acc mod) if (skillType ~= 0) then magicacc = magicacc + caster:getSkillLevel(skillType); else -- for mob skills / additional effects which don't have a skill magicacc = magicacc + utils.getSkillLvl(1, caster:getMainLvl()); end local resMod = 0; -- Some spells may possibly be non elemental, but have status effects. if (element ~= ELE_NONE) then resMod = target:getMod(resistMod[element]); -- Add acc for elemental affinity accuracy and element specific accuracy local affinityBonus = AffinityBonusAcc(caster, element); local elementBonus = caster:getMod(spellAcc[element]); -- print(elementBonus); bonusAcc = bonusAcc + affinityBonus + elementBonus; end -- Base magic evasion (base magic evasion plus resistances(players), plus elemental defense(mobs) local magiceva = target:getMod(MOD_MEVA) + resMod; magicacc = magicacc + bonusAcc; -- Add macc% from food local maccFood = magicacc * (caster:getMod(MOD_FOOD_MACCP)/100); magicacc = magicacc + utils.clamp(maccFood, 0, caster:getMod(MOD_FOOD_MACC_CAP)); return calculateMagicHitRate(magicacc, magiceva, percentBonus, caster:getMainLvl(), target:getMainLvl()); end function calculateMagicHitRate(magicacc, magiceva, percentBonus, casterLvl, targetLvl) local p = 0; --add a scaling bonus or penalty based on difference of targets level from caster local levelDiff = utils.clamp(casterLvl - targetLvl, -5, 5); p = 70 - 0.5 * (magiceva - magicacc) + levelDiff * 3 + percentBonus; return utils.clamp(p, 5, 95); end -- Returns resistance value from given magic hit rate (p) function getMagicResist(magicHitRate) local p = magicHitRate / 100; local resist = 1; -- Resistance thresholds based on p. A higher p leads to lower resist rates, and a lower p leads to higher resist rates. local half = (1 - p); local quart = ((1 - p)^2); local eighth = ((1 - p)^3); local sixteenth = ((1 - p)^4); -- print("HALF: "..half); -- print("QUART: "..quart); -- print("EIGHTH: "..eighth); -- print("SIXTEENTH: "..sixteenth); local resvar = math.random(); -- Determine final resist based on which thresholds have been crossed. if (resvar <= sixteenth) then resist = 0.0625; --printf("Spell resisted to 1/16!!! Threshold = %u",sixteenth); elseif (resvar <= eighth) then resist = 0.125; --printf("Spell resisted to 1/8! Threshold = %u",eighth); elseif (resvar <= quart) then resist = 0.25; --printf("Spell resisted to 1/4. Threshold = %u",quart); elseif (resvar <= half) then resist = 0.5; --printf("Spell resisted to 1/2. Threshold = %u",half); else resist = 1.0; --printf("1.0"); end return resist; end -- Returns the amount of resistance the -- target has to the given effect (stun, sleep, etc..) function getEffectResistance(target, effect) local effectres = 0; if (effect == EFFECT_SLEEP_I or effect == EFFECT_SLEEP_II) then effectres = MOD_SLEEPRES; elseif (effect == EFFECT_LULLABY) then effectres = MOD_LULLABYRES; elseif (effect == EFFECT_POISON) then effectres = MOD_POISONRES; elseif (effect == EFFECT_PARALYSIS) then effectres = MOD_PARALYZERES; elseif (effect == EFFECT_BLINDNESS) then effectres = MOD_BLINDRES elseif (effect == EFFECT_SILENCE) then effectres = MOD_SILENCERES; elseif (effect == EFFECT_PLAGUE or effect == EFFECT_DISEASE) then effectres = MOD_VIRUSRES; elseif (effect == EFFECT_PETRIFICATION) then effectres = MOD_PETRIFYRES; elseif (effect == EFFECT_BIND) then effectres = MOD_BINDRES; elseif (effect == EFFECT_CURSE_I or effect == EFFECT_CURSE_II or effect == EFFECT_BANE) then effectres = MOD_CURSERES; elseif (effect == EFFECT_WEIGHT) then effectres = MOD_GRAVITYRES; elseif (effect == EFFECT_SLOW or effect == EFFECT_ELEGY) then effectres = MOD_SLOWRES; elseif (effect == EFFECT_STUN) then effectres = MOD_STUNRES; elseif (effect == EFFECT_CHARM) then effectres = MOD_CHARMRES; elseif (effect == EFFECT_AMNESIA) then effectres = MOD_AMNESIARES; elseif (effect == EFFECT_TERROR) then effectres = MOD_TERRORRES; -- Don't put MOD_DOOMRES here. end if (effectres ~= 0) then return target:getMod(effectres); end return 0; end; -- Returns the bonus magic accuracy for any spell function getSpellBonusAcc(caster, target, spell) local magicAccBonus = 0; local spellId = spell:getID(); local element = spell:getElement(); local castersWeather = caster:getWeather(); local skill = spell:getSkillType(); local spellGroup = spell:getSpellGroup(); if caster:hasStatusEffect(EFFECT_ALTRUISM) and spellGroup == SPELLGROUP_WHITE then magicAccBonus = magicAccBonus + caster:getStatusEffect(EFFECT_ALTRUISM):getPower(); end if caster:hasStatusEffect(EFFECT_FOCALIZATION) and spellGroup == SPELLGROUP_BLACK then magicAccBonus = magicAccBonus + caster:getStatusEffect(EFFECT_FOCALIZATION):getPower(); end local skillchainTier, skillchainCount = FormMagicBurst(element, target); --add acc for BLM AMII spells if (spellId == 205 or spellId == 207 or spellId == 209 or spellId == 211 or spellId == 213 or spellId == 215) then -- no bonus if the caster has zero merit investment - don't want to give them a negative bonus if (caster:getMerit(blmAMIIMerit[element]) ~= 0) then -- bonus value granted by merit is 1; subtract 1 since unlock doesn't give an accuracy bonus magicAccBonus = magicAccBonus + (caster:getMerit(blmAMIIMerit[element]) - 1) * 5; end end --add acc for skillchains if (skillchainTier > 0) then magicAccBonus = magicAccBonus + 25; end --Add acc for klimaform if (caster:hasStatusEffect(EFFECT_KLIMAFORM) and (castersWeather == singleWeatherStrong[element] or castersWeather == doubleWeatherStrong[element])) then magicAccBonus = magicAccBonus + 15; end --Add acc for dark seal if (skill == DARK_MAGIC_SKILL and caster:hasStatusEffect(EFFECT_DARK_SEAL)) then magicAccBonus = magicAccBonus + 256; end --add acc for RDM group 1 merits if (element > 0 and element <= 6) then magicAccBonus = magicAccBonus + caster:getMerit(rdmMerit[element]); end -- BLU mag acc merits - nuke acc is handled in bluemagic.lua if (skill == BLUE_SKILL) then magicAccBonus = magicAccBonus + caster:getMerit(MERIT_MAGICAL_ACCURACY); end return magicAccBonus; end; function handleAfflatusMisery(caster, spell, dmg) if (caster:hasStatusEffect(EFFECT_AFFLATUS_MISERY)) then local misery = caster:getMod(MOD_AFFLATUS_MISERY); local miseryMax = caster:getMaxHP() / 4; -- BGwiki puts the boost capping at 200% bonus at 1/4th max HP. if (misery > miseryMax) then misery = miseryMax; end; -- Damage is 2x at boost cap. local boost = 1 + (misery / miseryMax); dmg = math.floor(dmg * boost); -- printf("AFFLATUS MISERY: Damage boosted by %f to %d", boost, dmg); --Afflatus Mod is Used Up... caster:setMod(MOD_AFFLATUS_MISERY, 0) end return dmg; end; function finalMagicAdjustments(caster,target,spell,dmg) --Handles target's HP adjustment and returns UNSIGNED dmg (absorb message is set in this function) -- handle multiple targets if (caster:isSpellAoE(spell:getID())) then local total = spell:getTotalTargets(); if (total > 9) then -- ga spells on 10+ targets = 0.4 dmg = dmg * 0.4; elseif (total > 1) then -- -ga spells on 2 to 9 targets = 0.9 - 0.05T where T = number of targets dmg = dmg * (0.9 - 0.05 * total); end -- kill shadows -- target:delStatusEffect(EFFECT_COPY_IMAGE); -- target:delStatusEffect(EFFECT_BLINK); else -- this logic will eventually be moved here -- dmg = utils.takeShadows(target, dmg, 1); -- if (dmg == 0) then -- spell:setMsg(msgBasic.SHADOW_ABSORB); -- return 1; -- end end local skill = spell:getSkillType(); if (skill == ELEMENTAL_MAGIC_SKILL) then dmg = dmg * ELEMENTAL_POWER; elseif (skill == DARK_MAGIC_SKILL) then dmg = dmg * DARK_POWER; elseif (skill == NINJUTSU_SKILL) then dmg = dmg * NINJUTSU_POWER; elseif (skill == DIVINE_MAGIC_SKILL) then dmg = dmg * DIVINE_POWER; end dmg = target:magicDmgTaken(dmg); if (dmg > 0) then dmg = dmg - target:getMod(MOD_PHALANX); dmg = utils.clamp(dmg, 0, 99999); end --handling stoneskin dmg = utils.stoneskin(target, dmg); dmg = utils.clamp(dmg, -99999, 99999); if (dmg < 0) then dmg = target:addHP(-dmg); spell:setMsg(msgBasic.MAGIC_RECOVERS_HP); else target:delHP(dmg); target:handleAfflatusMiseryDamage(dmg); target:updateEnmityFromDamage(caster,dmg*customEnmityAdjust(caster,spell)); -- Only add TP if the target is a mob if (target:getObjType() ~= TYPE_PC) then target:addTP(100); end end -- debugSpellDamageEnmity(caster,target,dmg,customEnmityAdjust(caster,spell),spell); return dmg; end; function finalMagicNonSpellAdjustments(caster,target,ele,dmg) --Handles target's HP adjustment and returns SIGNED dmg (negative values on absorb) dmg = target:magicDmgTaken(dmg); if (dmg > 0) then dmg = dmg - target:getMod(MOD_PHALANX); dmg = utils.clamp(dmg, 0, 99999); end --handling stoneskin dmg = utils.stoneskin(target, dmg); dmg = utils.clamp(dmg, -99999, 99999); if (dmg < 0) then dmg = -(target:addHP(-dmg)); else target:delHP(dmg); end --Not updating enmity from damage, as this is primarily used for additional effects (which don't generate emnity) -- in the case that updating enmity is needed, do it manually after calling this --target:updateEnmityFromDamage(caster,dmg); return dmg; end; function adjustForTarget(target,dmg,ele) if (dmg > 0 and math.random(0,99) < target:getMod(absorbMod[ele])) then return -dmg; end if (math.random(0,99) < target:getMod(nullMod[ele])) then return 0; end --Moved non element specific absorb and null mod checks to core --TODO: update all lua calls to magicDmgTaken with appropriate element and remove this function return dmg; end; function calculateMagicBurst(caster, spell, target) local burst = 1.0; if (spell:getSpellGroup() == 3 and not caster:hasStatusEffect(EFFECT_BURST_AFFINITY)) then return burst; end local skillchainTier, skillchainCount = FormMagicBurst(spell:getElement(), target); if (skillchainTier > 0) then if (skillchainCount == 1) then burst = 1.3; elseif (skillchainCount == 2) then burst = 1.35; elseif (skillchainCount == 3) then burst = 1.40; elseif (skillchainCount == 4) then burst = 1.45; elseif (skillchainCount == 5) then burst = 1.50; else -- Something strange is going on if this occurs. burst = 1.0; end --add burst bonus for BLM AMII spells if (spell:getID() == 205 or spell:getID() == 207 or spell:getID() == 209 or spell:getID() == 211 or spell:getID() == 213 or spell:getID() == 215) then if (caster:getMerit(blmAMIIMerit[spell:getElement()]) ~= 0) then -- no bonus if the caster has zero merit investment - don't want to give them a negative bonus burst = burst + (caster:getMerit(blmAMIIMerit[spell:getElement()]) - 1) * 0.03; -- bonus value granted by merit is 1; subtract 1 since unlock doesn't give a magic burst bonus -- print((caster:getMerit(blmAMIIMerit[spell:getElement()]) - 1) * 0.03) end end end -- Add in Magic Burst Bonus Modifier if (burst > 1) then burst = burst + (caster:getMod(MOD_MAG_BURST_BONUS) / 100); end return burst; end; function addBonuses(caster, spell, target, dmg, bonusmab) local ele = spell:getElement(); local affinityBonus = AffinityBonusDmg(caster, ele); dmg = math.floor(dmg * affinityBonus); if (bonusmab == nil) then bonusmab = 0; end local magicDefense = getElementalDamageReduction(target, ele); dmg = math.floor(dmg * magicDefense); local dayWeatherBonus = 1.00; local weather = caster:getWeather(); if (weather == singleWeatherStrong[ele]) then if (caster:getMod(MOD_IRIDESCENCE) >= 1) then if (math.random() < 0.33 or caster:getMod(elementalObi[ele]) >= 1 or isHelixSpell(spell)) then dayWeatherBonus = dayWeatherBonus + 0.10; end end if (math.random() < 0.33 or caster:getMod(elementalObi[ele]) >= 1 or isHelixSpell(spell)) then dayWeatherBonus = dayWeatherBonus + 0.10; end elseif (caster:getWeather() == singleWeatherWeak[ele]) then if (math.random() < 0.33 or caster:getMod(elementalObiWeak[ele]) >= 1 or isHelixSpell(spell)) then dayWeatherBonus = dayWeatherBonus - 0.10; end elseif (weather == doubleWeatherStrong[ele]) then if (caster:getMod(MOD_IRIDESCENCE) >= 1) then if (math.random() < 0.33 or caster:getMod(elementalObi[ele]) >= 1 or isHelixSpell(spell)) then dayWeatherBonus = dayWeatherBonus + 0.10; end end if (math.random() < 0.33 or caster:getMod(elementalObi[ele]) >= 1 or isHelixSpell(spell)) then dayWeatherBonus = dayWeatherBonus + 0.25; end elseif (weather == doubleWeatherWeak[ele]) then if (math.random() < 0.33 or caster:getMod(elementalObiWeak[ele]) >= 1 or isHelixSpell(spell)) then dayWeatherBonus = dayWeatherBonus - 0.25; end end local dayElement = VanadielDayElement(); if (dayElement == dayStrong[ele]) then dayWeatherBonus = dayWeatherBonus + caster:getMod(MOD_DAY_NUKE_BONUS)/100; -- sorc. tonban(+1)/zodiac ring if (math.random() < 0.33 or caster:getMod(elementalObi[ele]) >= 1 or isHelixSpell(spell)) then dayWeatherBonus = dayWeatherBonus + 0.10; end elseif (dayElement == dayWeak[ele]) then if (math.random() < 0.33 or caster:getMod(elementalObiWeak[ele]) >= 1 or isHelixSpell(spell)) then dayWeatherBonus = dayWeatherBonus - 0.10; end end if dayWeatherBonus > 1.4 then dayWeatherBonus = 1.4; end dmg = math.floor(dmg * dayWeatherBonus); local burst = calculateMagicBurst(caster, spell, target); if (burst > 1.0) then spell:setMsg(spell:getMagicBurstMessage()); -- "Magic Burst!" end dmg = math.floor(dmg * burst); local mabbonus = 0; if (spell:getID() >= 245 and spell:getID() <= 248) then -- Drain/Aspir (II) mabbonus = 1 + caster:getMod(MOD_ENH_DRAIN_ASPIR)/100; -- print(mabbonus); else local mab = caster:getMod(MOD_MATT) + bonusmab; local mab_crit = caster:getMod(MOD_MAGIC_CRITHITRATE); if ( math.random(1,100) < mab_crit ) then mab = mab + ( 10 + caster:getMod(MOD_MAGIC_CRIT_DMG_INCREASE ) ); end local mdefBarBonus = 0; if (ele > 0 and ele <= 6) then mab = mab + caster:getMerit(blmMerit[ele]); if (target:hasStatusEffect(barSpells[ele])) then -- bar- spell magic defense bonus mdefBarBonus = target:getStatusEffect(barSpells[ele]):getSubPower(); end end mabbonus = (100 + mab) / (100 + target:getMod(MOD_MDEF) + mdefBarBonus); end if (mabbonus < 0) then mabbonus = 0; end dmg = math.floor(dmg * mabbonus); if (caster:hasStatusEffect(EFFECT_EBULLIENCE)) then dmg = dmg * (1.2 + caster:getMod(MOD_EBULLIENCE_AMOUNT)/100); caster:delStatusEffectSilent(EFFECT_EBULLIENCE); end dmg = math.floor(dmg); -- print(affinityBonus); -- print(speciesReduction); -- print(dayWeatherBonus); -- print(burst); -- print(mab); -- print(magicDmgMod); return dmg; end; function addBonusesAbility(caster, ele, target, dmg, params) local affinityBonus = AffinityBonusDmg(caster, ele); dmg = math.floor(dmg * affinityBonus); local magicDefense = getElementalDamageReduction(target, ele); dmg = math.floor(dmg * magicDefense); local dayWeatherBonus = 1.00; local weather = caster:getWeather(); if (weather == singleWeatherStrong[ele]) then if (caster:getMod(MOD_IRIDESCENCE) >= 1) then if (math.random() < 0.33 or caster:getMod(elementalObi[ele]) >= 1) then dayWeatherBonus = dayWeatherBonus + 0.10; end end if (math.random() < 0.33 or caster:getMod(elementalObi[ele]) >= 1) then dayWeatherBonus = dayWeatherBonus + 0.10; end elseif (caster:getWeather() == singleWeatherWeak[ele]) then if (math.random() < 0.33 or caster:getMod(elementalObiWeak[ele]) >= 1) then dayWeatherBonus = dayWeatherBonus - 0.10; end elseif (weather == doubleWeatherStrong[ele]) then if (caster:getMod(MOD_IRIDESCENCE) >= 1) then if (math.random() < 0.33 or caster:getMod(elementalObi[ele]) >= 1) then dayWeatherBonus = dayWeatherBonus + 0.10; end end if (math.random() < 0.33 or caster:getMod(elementalObi[ele]) >= 1) then dayWeatherBonus = dayWeatherBonus + 0.25; end elseif (weather == doubleWeatherWeak[ele]) then if (math.random() < 0.33 or caster:getMod(elementalObiWeak[ele]) >= 1) then dayWeatherBonus = dayWeatherBonus - 0.25; end end local dayElement = VanadielDayElement(); if (dayElement == dayStrong[ele]) then dayWeatherBonus = dayWeatherBonus + caster:getMod(MOD_DAY_NUKE_BONUS)/100; -- sorc. tonban(+1)/zodiac ring if (math.random() < 0.33 or caster:getMod(elementalObi[ele]) >= 1) then dayWeatherBonus = dayWeatherBonus + 0.10; end elseif (dayElement == dayWeak[ele]) then if (math.random() < 0.33 or caster:getMod(elementalObiWeak[ele]) >= 1) then dayWeatherBonus = dayWeatherBonus - 0.10; end end if dayWeatherBonus > 1.4 then dayWeatherBonus = 1.4; end dmg = math.floor(dmg * dayWeatherBonus); local mab = 1; local mdefBarBonus = 0; if (ele > 0 and ele <= 6 and target:hasStatusEffect(barSpells[ele])) then -- bar- spell magic defense bonus mdefBarBonus = target:getStatusEffect(barSpells[ele]):getSubPower(); end if (params ~= nil and params.bonusmab ~= nil and params.includemab == true) then mab = (100 + caster:getMod(MOD_MATT) + params.bonusmab) / (100 + target:getMod(MOD_MDEF) + mdefBarBonus); elseif (params == nil or (params ~= nil and params.includemab == true)) then mab = (100 + caster:getMod(MOD_MATT)) / (100 + target:getMod(MOD_MDEF) + mdefBarBonus); end if (mab < 0) then mab = 0; end dmg = math.floor(dmg * mab); -- print(affinityBonus); -- print(speciesReduction); -- print(dayWeatherBonus); -- print(burst); -- print(mab); -- print(magicDmgMod); return dmg; end; -- get elemental damage reduction function getElementalDamageReduction(target, element) local defense = 1; if (element > 0) then defense = 1 - (target:getMod(defenseMod[element]) / 256); return utils.clamp(defense, 0.0, 2.0); end return defense; end --------------------------------------------- -- Elemental Debuff Potency functions --------------------------------------------- function getElementalDebuffDOT(INT) local DOT = 0; if (INT<= 39) then DOT = 1; elseif (INT <= 69) then DOT = 2; elseif (INT <= 99) then DOT = 3; elseif (INT <= 149) then DOT = 4; else DOT = 5; end return DOT; end; function getElementalDebuffStatDownFromDOT(dot) local stat_down = 0; if (dot == 1) then stat_down = 5; elseif (dot == 2) then stat_down = 7; elseif (dot == 3) then stat_down = 9; elseif (dot == 4) then stat_down = 11; else stat_down = 13; end return stat_down; end; function getHelixDuration(caster) --Dark Arts will further increase Helix duration, but testing is ongoing. local casterLevel = caster:getMainLvl(); local duration = 30; --fallthrough if (casterLevel <= 39) then duration = 30; elseif (casterLevel <= 59) then duration = 60; elseif (casterLevel <= 99) then duration = 90; end return duration; end; function isHelixSpell(spell) --Dark Arts will further increase Helix duration, but testing is ongoing. local id = spell:getID(); if id >= 278 and id <= 285 then return true; end return false; end; function handleThrenody(caster, target, spell, basePower, baseDuration, modifier) -- Process resitances local staff = AffinityBonusAcc(caster, spell:getElement()); -- print("staff=" .. staff); local dCHR = (caster:getStat(MOD_CHR) - target:getStat(MOD_CHR)); -- print("dCHR=" .. dCHR); local params = {}; params.attribute = MOD_CHR; params.skillType = SINGING_SKILL; params.bonus = staff; local resm = applyResistance(caster, target, spell, params); -- print("rsem=" .. resm); if (resm < 0.5) then -- print("resm resist"); spell:setMsg(msgBasic.MAGIC_RESIST); return EFFECT_THRENODY; end -- Remove previous Threnody target:delStatusEffect(EFFECT_THRENODY); local iBoost = caster:getMod(MOD_THRENODY_EFFECT) + caster:getMod(MOD_ALL_SONGS_EFFECT); local power = basePower + iBoost*5; local duration = baseDuration * ((iBoost * 0.1) + (caster:getMod(MOD_SONG_DURATION_BONUS)/100) + 1); if (caster:hasStatusEffect(EFFECT_SOUL_VOICE)) then power = power * 2; elseif (caster:hasStatusEffect(EFFECT_MARCATO)) then power = power * 1.5; end if (caster:hasStatusEffect(EFFECT_TROUBADOUR)) then duration = duration * 2; end -- Set spell message and apply status effect target:addStatusEffect(EFFECT_THRENODY, power, 0, duration, 0, modifier, 0); return EFFECT_THRENODY; end; function handleNinjutsuDebuff(caster, target, spell, basePower, baseDuration, modifier) -- Add new target:addStatusEffectEx(EFFECT_NINJUTSU_ELE_DEBUFF, 0, basePower, 0, baseDuration, 0, modifier, 0); return EFFECT_NINJUTSU_ELE_DEBUFF; end; -- Returns true if you can overwrite the effect -- Example: canOverwrite(target, EFFECT_SLOW, 25) function canOverwrite(target, effect, power, mod) mod = mod or 1; local statusEffect = target:getStatusEffect(effect); -- effect not found so overwrite if (statusEffect == nil) then return true; end -- overwrite if its weaker if (statusEffect:getPower()*mod > power) then return false; end return true; end function doElementalNuke(caster, spell, target, spellParams) local DMG = 0; local V = 0; local M = 0; local dINT = caster:getStat(MOD_INT) - target:getStat(MOD_INT); local hasMultipleTargetReduction = spellParams.hasMultipleTargetReduction; --still unused!!! local resistBonus = spellParams.resistBonus; local mDMG = caster:getMod(MOD_MAGIC_DAMAGE); --[[ Calculate base damage: D = mDMG + V + (dINT × M) D is then floored For dINT reduce by amount factored into the V value (example: at 134 INT, when using V100 in the calculation, use dINT = 134-100 = 34) ]] if (dINT <= 49) then V = spellParams.V0; M = spellParams.M0; DMG = math.floor(DMG + mDMG + V + (dINT * M)); if (DMG <= 0) then return 0; end elseif (dINT >= 50 and dINT <= 99) then V = spellParams.V50; M = spellParams.M50; DMG = math.floor(DMG + mDMG + V + ((dINT - 50) * M)); elseif (dINT >= 100 and dINT <= 199) then V = spellParams.V100; M = spellParams.M100; DMG = math.floor(DMG + mDMG + V + ((dINT - 100) * M)); elseif (dINT > 199) then V = spellParams.V200; M = spellParams.M200; DMG = math.floor(DMG + mDMG + V + ((dINT - 200) * M)); end --get resist multiplier (1x if no resist) local params = {}; params.attribute = MOD_INT; params.skillType = ELEMENTAL_MAGIC_SKILL; params.resistBonus = resistBonus; local resist = applyResistance(caster, target, spell, params); --get the resisted damage DMG = DMG * resist; --add on bonuses (staff/day/weather/jas/mab/etc all go in this function) DMG = addBonuses(caster, spell, target, DMG); --add in target adjustment local ele = spell:getElement(); DMG = adjustForTarget(target, DMG, ele); --add in final adjustments DMG = finalMagicAdjustments(caster, target, spell, DMG); return DMG; end function doDivineNuke(caster, target, spell, params) params.skillType = DIVINE_MAGIC_SKILL; params.attribute = MOD_MND; return doNuke(caster, target, spell, params); end function doNinjutsuNuke(caster, target, spell, params) local mabBonus = params.mabBonus; mabBonus = mabBonus or 0; mabBonus = mabBonus + caster:getMod(MOD_NIN_NUKE_BONUS); -- "enhances ninjutsu damage" bonus if (caster:hasStatusEffect(EFFECT_INNIN) and caster:isBehind(target, 23)) then -- Innin mag atk bonus from behind, guesstimating angle at 23 degrees mabBonus = mabBonus + caster:getStatusEffect(EFFECT_INNIN):getPower(); end params.skillType = NINJUTSU_SKILL; params.attribute = MOD_INT; params.mabBonus = mabBonus; return doNuke(caster, target, spell, params); end function doNuke(caster, target, spell, params) --calculate raw damage local dmg = calculateMagicDamage(caster, target, spell, params); --get resist multiplier (1x if no resist) local resist = applyResistance(caster, target, spell, params); --get the resisted damage dmg = dmg*resist; if (skill == NINJUTSU_SKILL) then if (caster:getMainJob() == JOBS.NIN) then -- NIN main gets a bonus to their ninjutsu nukes local ninSkillBonus = 100; if (spell:getID() % 3 == 2) then -- ichi nuke spell ids are 320, 323, 326, 329, 332, and 335 ninSkillBonus = 100 + math.floor((caster:getSkillLevel(SKILL_NIN) - 50)/2); -- getSkillLevel includes bonuses from merits and modifiers (ie. gear) elseif (spell:getID() % 3 == 0) then -- ni nuke spell ids are 1 more than their corresponding ichi spell ninSkillBonus = 100 + math.floor((caster:getSkillLevel(SKILL_NIN) - 125)/2); else -- san nuke spell, also has ids 1 more than their corresponding ni spell ninSkillBonus = 100 + math.floor((caster:getSkillLevel(SKILL_NIN) - 275)/2); end ninSkillBonus = utils.clamp(ninSkillBonus, 100, 200); -- bonus caps at +100%, and does not go negative dmg = dmg * ninSkillBonus/100; end -- boost with Futae if (caster:hasStatusEffect(EFFECT_FUTAE)) then dmg = math.floor(dmg * 1.50); caster:delStatusEffect(EFFECT_FUTAE); end end --add on bonuses (staff/day/weather/jas/mab/etc all go in this function) dmg = addBonuses(caster,spell,target,dmg,mabBonus); --add in target adjustment dmg = adjustForTarget(target,dmg,spell:getElement()); --add in final adjustments dmg = finalMagicAdjustments(caster,target,spell,dmg); return dmg; end function doDivineBanishNuke(caster, target, spell, params) params.skillType = DIVINE_MAGIC_SKILL; params.attribute = MOD_MND; --calculate raw damage local dmg = calculateMagicDamage(caster, target, spell, params); --get resist multiplier (1x if no resist) local resist = applyResistance(caster, target, spell, params); --get the resisted damage dmg = dmg*resist; --add on bonuses (staff/day/weather/jas/mab/etc all go in this function) dmg = addBonuses(caster,spell,target,dmg); --add in target adjustment dmg = adjustForTarget(target,dmg,spell:getElement()); --handling afflatus misery dmg = handleAfflatusMisery(caster, spell, dmg); --add in final adjustments dmg = finalMagicAdjustments(caster,target,spell,dmg); return dmg; end function calculateDurationForLvl(duration, spellLvl, targetLvl) if (targetLvl < spellLvl) then return duration * targetLvl / spellLvl; end return duration; end function calculateBarspellPower(caster,enhanceSkill) local meritBonus = caster:getMerit(MERIT_BAR_SPELL_EFFECT); local equipBonus = caster:getMod(MOD_BARSPELL_AMOUNT); --printf("Barspell: Merit Bonus +%d", meritBonus); if (enhanceSkill == nil or enhanceSkill < 0) then enhanceSkill = 0; end local power = 40 + 0.2 * enhanceSkill + meritBonus + equipBonus; return power; end -- Output magic hit rate for all levels function outputMagicHitRateInfo() for casterLvl = 1, 75 do printf(""); printf("-------- CasterLvl: %d", casterLvl); for lvlMod = -5, 20 do local targetLvl = casterLvl + lvlMod; if (targetLvl >= 0) then -- assume BLM spell, A+ local magicAcc = utils.getSkillLvl(6, casterLvl); -- assume default monster magic eva, D local magicEvaRank = 3; local rate = 0; local magicEva = utils.getMobSkillLvl(magicEvaRank, targetLvl); local dINT = (lvlMod + 1) * -1; if (dINT > 10) then magicAcc = magicAcc + 10 + (dINT - 10)/2; else magicAcc = magicAcc + dINT; end local magicHitRate = calculateMagicHitRate(magicAcc, magicEva, 0, casterLvl, targetLvl); printf("Lvl: %d vs %d, %d%%, MA: %d, ME: %d", casterLvl, targetLvl, magicHitRate, magicAcc, magicEva); end end end end; -- outputMagicHitRateInfo(); -- Had to create this because DSP treats status resist traits like additional magic evasion.. function customResCheck(target, effect) local effectRes = 0; if (effect == EFFECT_SLEEP_I or effect == EFFECT_SLEEP_II) then effectRes = target:getMod(MOD_SLEEPRES); elseif(effect == EFFECT_LULLABY) then effectRes = target:getMod(MOD_LULLABYRES); elseif (effect == EFFECT_POISON) then if (target:hasStatusEffect(EFFECT_NEGATE_POISON)) then return 1000; end effectRes = target:getMod(MOD_POISONRES); elseif (effect == EFFECT_PARALYZE) then effectRes = target:getMod(MOD_PARALYZERES); elseif (effect == EFFECT_BLINDNESS) then effectRes = target:getMod(MOD_BLINDRES) elseif (effect == EFFECT_SILENCE) then effectRes = target:getMod(MOD_SILENCERES); elseif (effect == EFFECT_PLAGUE or effect == EFFECT_DISEASE) then if (target:hasStatusEffect(EFFECT_NEGATE_VIRUS)) then return 1000; end effectRes = target:getMod(MOD_VIRUSRES); elseif (effect == EFFECT_PETRIFICATION) then if (target:hasStatusEffect(EFFECT_NEGATE_PETRIFY)) then return 1000; end effectRes = target:getMod(MOD_PETRIFYRES); elseif (effect == EFFECT_BIND) then effectRes = target:getMod(MOD_BINDRES); elseif (effect == EFFECT_CURSE_I or effect == EFFECT_CURSE_II or effect == EFFECT_BANE) then if (target:hasStatusEffect(EFFECT_NEGATE_CURSE)) then return 1000; end effectRes = target:getMod(MOD_CURSERES); elseif (effect == EFFECT_WEIGHT) then effectRes = target:getMod(MOD_GRAVITYRES); elseif (effect == EFFECT_SLOW or effect == EFFECT_ELEGY) then effectRes = target:getMod(MOD_SLOWRES); elseif (effect == EFFECT_STUN) then effectRes = target:getMod(MOD_STUNRES); elseif (effect == EFFECT_CHARM) then if (target:hasStatusEffect(EFFECT_NEGATE_CHARM)) then return 1000; end effectRes = target:getMod(MOD_CHARMRES); elseif (effect == EFFECT_AMNESIA) then if (target:hasStatusEffect(EFFECT_NEGATE_AMNESIA)) then return 1000; end effectRes = target:getMod(MOD_AMNESIARES); elseif (effect == EFFECT_TERROR) then if (target:hasStatusEffect(EFFECT_NEGATE_TERROR)) then return 1000; end effectRes = target:getMod(MOD_TERRORRES); elseif (effect == EFFECT_DOOM) then if (target:hasStatusEffect(EFFECT_NEGATE_DOOM)) then return 1000; end effectRes = target:getMod(MOD_DOOMRES); end -- Temp! DSP seems to be using x/100 where data suggests x/1000ths or possibly x/1024ths effectRes = effectRes*10; -- just going to fudge it for now because actually raising the modifier total -- would effect DSP's garbage magic evasion calculations. if (effectRes > 400) then -- I pulled this threshold number outa my ass, because there -- is zero data for very high values of status resist trait. effectRes = (400+((effectRes -400)*0.5)); -- modifier amount above 400 worth half as much, because I say so.. end if (effectRes > 950) then effectRes = 950; -- 95% cap! -- I don't think it would even be possible to reach this on retail.. -- In theory LegionDS might stack augments later though. end return effectRes; end; -- This is used to modify enmity for damage type spells ONLY! function customEnmityAdjust(caster,spell,params) local multiplier = 1; -- Don't even check all this if not a player.. if (caster:getObjType() == TYPE_PC) then -- Spell specific adjustments.. if (spell:getID() == 21) then -- Holy multiplier = multiplier*1.2; elseif (spell:getID() == 22) then -- Holy 2 multiplier = multiplier*1.2; end -- Main Job specific adjustments.. local mJob = caster:getMainJob(); if (mJob == JOBS.PLD) then multiplier = multiplier*1.11; end -- Sub Job specific adjustments.. local sJob = caster:getSubJob(); if (sJob == JOBS.DRK) then multiplier = multiplier*1.11; end -- Skill specific adjustments.. local skill = spell:getSkillType(); if (skill == ELEMENTAL_MAGIC_SKILL) then multiplier = multiplier*0.9; elseif (skill == NINJUTSU_SKILL) then multiplier = multiplier*1.11; --[[ Rethinking blue magic enmity.. People are tanking intentionally with blue spells. elseif (skill == BLUE_SKILL and params ~= nil) then if (params.dmgtype == nil) then -- This will be nil unless physical type multiplier = multiplier*1.25; elseif (params.dmgtype == DMGTYPE_BLUNT or params.dmgtype == DMGTYPE_PIERCE or params.dmgtype == DMGTYPE_SLASH or params.dmgtype == DMGTYPE_H2H) then multiplier = multiplier*1.11; end ]] end end -- Remember multiple conditions can be tripped and stacked, -- but if it doesn't do damage it doesn't get adjusted! -- Other spells are handled in the database table instead. -- print(multiplier) return multiplier; end; -- Big huge pile of debug code, replicating a lot of core shit to be less spammy than a core print.. function debugSpellDamageEnmity(caster,target,dmg,multiplier,spell) local levelMod; if (target == nil) then levelMod = utils.clamp(caster:getMainLvl(), 0, 99); -- same as "default fallback" in core else levelMod = utils.clamp(target:getMainLvl(), 0, 99); -- core says "correct mod value" end levelMod = ((31*levelMod)/50)+6; -- And this is the math core does to it.. local CE = (80 / levelMod * dmg); local VE = (240 / levelMod * dmg); print("[EnmityFromDamage-Spell]\n Caster: "..caster:getName().."\t Target: "..target:getName().."\n CE: "..CE.."\t VE: "..VE.."\n Spell ID: "..spell:getID().."\t\t Dmg: "..dmg.."\n levelMod: "..levelMod.."\t\t multiplier: "..multiplier); end;
gpl-3.0
erosennin/koreader
plugins/zsync.koplugin/main.lua
1
9988
local FileManagerHistory = require("apps/filemanager/filemanagerhistory") local FileManagerMenu = require("apps/filemanager/filemanagermenu") local InputContainer = require("ui/widget/container/inputcontainer") local FrameContainer = require("ui/widget/container/framecontainer") local FileManager = require("apps/filemanager/filemanager") local VerticalGroup = require("ui/widget/verticalgroup") local VerticalSpan = require("ui/widget/verticalspan") local ButtonDialog = require("ui/widget/buttondialog") local InfoMessage = require("ui/widget/infomessage") local TextWidget = require("ui/widget/textwidget") local DocSettings = require("docsettings") local UIManager = require("ui/uimanager") local Screen = require("ui/screen") local Event = require("ui/event") local Font = require("ui/font") local ltn12 = require("ltn12") local DEBUG = require("dbg") local _ = require("gettext") local util = require("ffi/util") -- lfs local ffi = require("ffi") ffi.cdef[[ int remove(const char *); int rmdir(const char *); ]] local dummy = require("ffi/zeromq_h") local ZSync = InputContainer:new{ name = "zsync", } function ZSync:init() self.ui.menu:registerToMainMenu(self) self.outbox = self.path.."/outbox" self.server_config = self.path.."/server.cfg" self.client_config = self.path.."/client.cfg" end function ZSync:addToMainMenu(tab_item_table) table.insert(tab_item_table.plugins, { text = _("ZSync"), sub_item_table = { { text_func = function() return not self.filemq_server and _("Publish this document") or _("Stop publisher") end, enabled_func = function() return self.filemq_client == nil end, callback = function() if not self.filemq_server then self:publish() else self:unpublish() end end }, { text_func = function() return not self.filemq_client and _("Subscribe documents") or _("Stop subscriber") end, enabled_func = function() return self.filemq_server == nil end, callback = function() if not self.filemq_client then self:subscribe() else self:unsubscribe() end end } } }) end function ZSync:initServerZyreMQ() local ZyreMessageQueue = require("ui/message/zyremessagequeue") if self.zyre_messagequeue == nil then self.server_zyre = ZyreMessageQueue:new{ header = {["FILEMQ-SERVER"] = tostring(self.fmq_port)}, } self.server_zyre:start() self.zyre_messagequeue = UIManager:insertZMQ(self.server_zyre) end end function ZSync:initClientZyreMQ() local ZyreMessageQueue = require("ui/message/zyremessagequeue") if self.zyre_messagequeue == nil then self.client_zyre = ZyreMessageQueue:new{} self.client_zyre:start() self.zyre_messagequeue = UIManager:insertZMQ(self.client_zyre) end end function ZSync:initServerFileMQ(outboxes) local FileMessageQueue = require("ui/message/filemessagequeue") local filemq = ffi.load("libs/libfmq.so.1") if self.file_messagequeue == nil then self.filemq_server = filemq.fmq_server_new() self.file_messagequeue = UIManager:insertZMQ(FileMessageQueue:new{ server = self.filemq_server }) self.fmq_port = filemq.fmq_server_bind(self.filemq_server, "tcp://*:*") filemq.fmq_server_configure(self.filemq_server, self.server_config) filemq.fmq_server_set_anonymous(self.filemq_server, true) end UIManager:scheduleIn(1, function() for _, outbox in ipairs(outboxes) do DEBUG("publish", outbox.path, outbox.alias) filemq.fmq_server_publish(self.filemq_server, outbox.path, outbox.alias) end end) end function ZSync:initClientFileMQ(inbox) local FileMessageQueue = require("ui/message/filemessagequeue") local filemq = ffi.load("libs/libfmq.so.1") if self.file_messagequeue == nil then self.filemq_client = filemq.fmq_client_new() self.file_messagequeue = UIManager:insertZMQ(FileMessageQueue:new{ client = self.filemq_client }) filemq.fmq_client_configure(self.filemq_client, self.client_config) end UIManager:scheduleIn(1, function() filemq.fmq_client_set_inbox(self.filemq_client, inbox) end) end local function clearDirectory(dir, rmdir) for f in lfs.dir(dir) do local path = dir.."/"..f local mode = lfs.attributes(path, "mode") if mode == "file" then ffi.C.remove(path) elseif mode == "directory" and f ~= "." and f ~= ".." then clearDirectory(path, true) end end if rmdir then ffi.C.rmdir(dir) end end local function mklink(path, filename) local basename = filename:match(".*/(.*)") or filename local linkname = path .. "/" .. basename .. ".ln" local linkfile = io.open(linkname, "w") if linkfile then linkfile:write(filename .. "\n") linkfile:close() end end -- add directory directly into outboxes function ZSync:outboxesAddDirectory(outboxes, dir) if lfs.attributes(dir, "mode") == "directory" then local basename = dir:match(".*/(.*)") or dir table.insert(outboxes, { path = dir, alias = "/"..basename, }) end end -- link file in root outbox function ZSync:outboxAddFileLink(filename) local mode = lfs.attributes(filename, "mode") if mode == "file" then mklink(self.outbox, filename) end end -- copy directory content into root outbox(no recursively) function ZSync:outboxCopyDirectory(dir) local basename = dir:match(".*/(.*)") or dir local newdir = self.outbox.."/"..basename lfs.mkdir(newdir) if pcall(lfs.dir, dir) then for f in lfs.dir(dir) do local filename = dir.."/"..f if lfs.attributes(filename, "mode") == "file" then local newfile = newdir.."/"..f ltn12.pump.all( ltn12.source.file(assert(io.open(filename, "rb"))), ltn12.sink.file(assert(io.open(newfile, "wb"))) ) end end end end function ZSync:publish() DEBUG("publish document", self.view.document.file) lfs.mkdir(self.outbox) clearDirectory(self.outbox) local file = self.view.document.file local sidecar = file:match("(.*)%.")..".sdr" self:outboxAddFileLink(file) self:outboxCopyDirectory(sidecar) local outboxes = {} table.insert(outboxes, { path = self.outbox, alias = "/", }) -- init filemq first to get filemq port self:initServerFileMQ(outboxes) self:initServerZyreMQ() end function ZSync:unpublish() DEBUG("ZSync unpublish") clearDirectory(self.outbox) self:stopZyreMQ() self:stopFileMQ() end function ZSync:onChooseInbox(inbox) DEBUG("choose inbox", inbox) self.inbox = inbox -- init zyre first for filemq endpoint self:initClientZyreMQ() self:initClientFileMQ(inbox) return true end function ZSync:subscribe() DEBUG("subscribe documents") self.received = {} local zsync = self require("ui/downloadmgr"):new{ title = _("Choose inbox"), onConfirm = function(inbox) G_reader_settings:saveSetting("inbox_dir", inbox) zsync:onChooseInbox(inbox) end, }:chooseDir() end function ZSync:unsubscribe() DEBUG("ZSync unsubscribe") self.received = {} self:stopFileMQ() self:stopZyreMQ() end function ZSync:onZyreEnter(id, name, header, endpoint) local filemq = ffi.load("libs/libfmq.so.1") if header and endpoint and header["FILEMQ-SERVER"] then self.server_zyre_endpoint = endpoint local port = header["FILEMQ-SERVER"] local host = endpoint:match("(.*:)") or "*:" local fmq_server_endpoint = host..port DEBUG("connect filemq server at", fmq_server_endpoint) -- wait for filemq server setup befor connecting UIManager:scheduleIn(2, function() filemq.fmq_client_set_resync(self.filemq_client, true) filemq.fmq_client_subscribe(self.filemq_client, "/") filemq.fmq_client_connect(self.filemq_client, fmq_server_endpoint) end) end return true end function ZSync:onFileDeliver(filename, fullname) -- sometimes several FileDelever msgs are sent from filemq if self.received[filename] then return end UIManager:show(InfoMessage:new{ text = _("Received file:") .. "\n" .. filename, timeout = 1, }) self.received[filename] = true end --[[ -- We assume that ZSync is running in either server mode or client mode -- but never both. The zyre_messagequeue may be a server_zyre or client_zyre. -- And the file_messagequeue may be a filemq_server or filemq_client. --]] function ZSync:stopZyreMQ() if self.zyre_messagequeue then self.zyre_messagequeue:stop() UIManager:removeZMQ(self.zyre_messagequeue) self.zyre_messagequeue = nil self.server_zyre = nil self.client_zyre = nil end end function ZSync:stopFileMQ() if self.file_messagequeue then self.file_messagequeue:stop() UIManager:removeZMQ(self.file_messagequeue) self.file_messagequeue = nil self.filemq_server = nil self.filemq_client = nil end end function ZSync:onCloseReader() self:stopZyreMQ() self:stopFileMQ() end return ZSync
agpl-3.0
awesomeWM/awesome
tests/examples/wibox/awidget/tasklist/style_bg_focus.lua
1
1681
--DOC_HIDE_START --DOC_GEN_IMAGE local parent = ... local beautiful = require("beautiful") local wibox = require("wibox") local awful = { widget = { tasklist = require("awful.widget.tasklist") } } local gears = { color = require("gears.color") } local t_real = require("awful.tag").add("Test", {screen=screen[1]}) local s = screen[1] parent.spacing = 5 beautiful.tasklist_fg_focus = "#000000" for i=1, 5 do client.gen_fake{ class = "client", name = "Client #"..i, icon = beautiful.awesome_icon, tags = {t_real} } end client.get()[1].name = "Client 1# (floating)" client.get()[2].name = "Client 2# (sticky)" client.get()[3].name = "Client 3# (focus)" client.get()[4].name = "Client 4# (urgent)" client.get()[5].name = "Client 5# (minimized)" client.get()[1].floating = true client.get()[2].sticky = true client.get()[4].urgent = true client.get()[5].minimized = true client.focus = client.get()[3] --DOC_HIDE_END local grad = gears.color { type = "linear", from = { 0, 0 }, to = { 0, 22 }, stops = { { 0, "#ff0000" }, { 1, "#0000ff" }, } } --DOC_NEWLINE for _, col in ipairs { "#ff0000", "#00ff00", "#0000ff", grad } do beautiful.tasklist_bg_focus = col --DOC_HIDE_START local tasklist = awful.widget.tasklist { screen = s, filter = awful.widget.tasklist.filter.currenttags, layout = wibox.layout.fixed.horizontal } tasklist._do_tasklist_update_now() parent:add(_memento(tasklist, nil, 22)) --luacheck: globals _memento --DOC_HIDE_END end --DOC_HIDE vim: filetype=lua:expandtab:shiftwidth=4:tabstop=8:softtabstop=4:textwidth=80
gpl-2.0
mwoz123/koreader
plugins/terminal.koplugin/main.lua
1
17116
local ButtonDialog = require("ui/widget/buttondialog") local CenterContainer = require("ui/widget/container/centercontainer") local DataStorage = require("datastorage") local Dispatcher = require("dispatcher") local Font = require("ui/font") local InfoMessage = require("ui/widget/infomessage") local InputDialog = require("ui/widget/inputdialog") local LuaSettings = require("luasettings") local Menu = require("ui/widget/menu") local TextViewer = require("ui/widget/textviewer") local Trapper = require("ui/trapper") local UIManager = require("ui/uimanager") local WidgetContainer = require("ui/widget/container/widgetcontainer") local logger = require("logger") local util = require("ffi/util") local _ = require("gettext") local N_ = _.ngettext local Screen = require("device").screen local T = util.template local Terminal = WidgetContainer:new{ name = "terminal", command = "", dump_file = util.realpath(DataStorage:getDataDir()) .. "/terminal_output.txt", items_per_page = 16, settings = LuaSettings:open(DataStorage:getSettingsDir() .. "/terminal_shortcuts.lua"), shortcuts_dialog = nil, shortcuts_menu = nil, -- shortcuts_file = DataStorage:getSettingsDir() .. "/terminal_shortcuts.lua", shortcuts = {}, source = "terminal", } function Terminal:onDispatcherRegisterActions() Dispatcher:registerAction("show_terminal", { category = "none", event = "TerminalStart", title = _("Show terminal"), device = true, }) end function Terminal:init() self:onDispatcherRegisterActions() self.ui.menu:registerToMainMenu(self) self.items_per_page = G_reader_settings:readSetting("items_per_page") or 16 self.shortcuts = self.settings:readSetting("shortcuts", {}) end function Terminal:saveShortcuts() self.settings:flush() UIManager:show(InfoMessage:new{ text = _("Shortcuts saved"), timeout = 2 }) end function Terminal:manageShortcuts() self.shortcuts_dialog = CenterContainer:new { dimen = Screen:getSize(), } self.shortcuts_menu = Menu:new{ show_parent = self.ui, width = Screen:getWidth(), height = Screen:getHeight(), covers_fullscreen = true, -- hint for UIManager:_repaint() is_borderless = true, is_popout = false, perpage = self.items_per_page, onMenuHold = self.onMenuHoldShortcuts, _manager = self, } table.insert(self.shortcuts_dialog, self.shortcuts_menu) self.shortcuts_menu.close_callback = function() UIManager:close(self.shortcuts_dialog) end -- sort the shortcuts: if #self.shortcuts > 0 then table.sort(self.shortcuts, function(v1, v2) return v1.text < v2.text end) end self:updateItemTable() end function Terminal:updateItemTable() local item_table = {} if #self.shortcuts > 0 then local actions_count = 3 -- separator + actions for nr, f in ipairs(self.shortcuts) do local item = { nr = nr, text = f.text, commands = f.commands, editable = true, deletable = true, callback = function() -- so we know which middle button to display in the results: self.source = "shortcut" -- execute immediately, skip terminal dialog: self.command = self:ensureWhitelineAfterCommands(f.commands) Trapper:wrap(function() self:execute() end) end } table.insert(item_table, item) -- add page actions at end of each page with shortcuts: local factor = self.items_per_page - actions_count if nr % factor == 0 or nr == #self.shortcuts then -- insert "separator": table.insert(item_table, { text = " ", deletable = false, editable = false, callback = function() self:manageShortcuts() end, }) -- actions: self:insertPageActions(item_table) end end -- no shortcuts defined yet: else self:insertPageActions(item_table) end local title = N_("Terminal shortcut", "Terminal shortcuts", #self.shortcuts) self.shortcuts_menu:switchItemTable(tostring(#self.shortcuts) .. " " .. title, item_table) UIManager:show(self.shortcuts_dialog) end function Terminal:insertPageActions(item_table) table.insert(item_table, { text = " " .. _("to terminal…"), deletable = false, editable = false, callback = function() self:terminal() end, }) table.insert(item_table, { text = " " .. _("close…"), deletable = false, editable = false, callback = function() return false end, }) end function Terminal:onMenuHoldShortcuts(item) if item.deletable or item.editable then local shortcut_shortcuts_dialog shortcut_shortcuts_dialog = ButtonDialog:new{ buttons = {{ { text = _("Edit name"), enabled = item.editable, callback = function() UIManager:close(shortcut_shortcuts_dialog) if self._manager.shortcuts_dialog ~= nil then UIManager:close(self._manager.shortcuts_dialog) self._manager.shortcuts_dialog = nil end self._manager:editName(item) end }, { text = _("Edit commands"), enabled = item.editable, callback = function() UIManager:close(shortcut_shortcuts_dialog) if self._manager.shortcuts_dialog ~= nil then UIManager:close(self._manager.shortcuts_dialog) self._manager.shortcuts_dialog = nil end self._manager:editCommands(item) end }, }, { { text = _("Copy"), enabled = item.editable, callback = function() UIManager:close(shortcut_shortcuts_dialog) if self._manager.shortcuts_dialog ~= nil then UIManager:close(self._manager.shortcuts_dialog) self._manager.shortcuts_dialog = nil end self._manager:copyCommands(item) end }, { text = _("Delete"), enabled = item.deletable, callback = function() UIManager:close(shortcut_shortcuts_dialog) if self._manager.shortcuts_dialog ~= nil then UIManager:close(self._manager.shortcuts_dialog) self._manager.shortcuts_dialog = nil end self._manager:deleteShortcut(item) end } }} } UIManager:show(shortcut_shortcuts_dialog) return true end end function Terminal:copyCommands(item) local new_item = { text = item.text .. " (copy)", commands = item.commands } table.insert(self.shortcuts, new_item) UIManager:show(InfoMessage:new{ text = _("Shortcut copied"), timeout = 2 }) self:saveShortcuts() self:manageShortcuts() end function Terminal:editCommands(item) local edit_dialog edit_dialog = InputDialog:new{ title = T(_('Edit commands for "%1"'), item.text), input = item.commands, width = Screen:getWidth() * 0.9, para_direction_rtl = false, -- force LTR input_type = "string", allow_newline = true, cursor_at_end = true, fullscreen = true, buttons = {{{ text = _("Cancel"), callback = function() UIManager:close(edit_dialog) edit_dialog = nil self:manageShortcuts() end, }, { text = _("Save"), callback = function() local input = edit_dialog:getInputText() UIManager:close(edit_dialog) edit_dialog = nil if input:match("[A-Za-z]") then self.shortcuts[item.nr]["commands"] = input self:saveShortcuts() self:manageShortcuts() end end, }}}, } UIManager:show(edit_dialog) edit_dialog:onShowKeyboard() end function Terminal:editName(item) local edit_dialog edit_dialog = InputDialog:new{ title = _("Edit name"), input = item.text, width = Screen:getWidth() * 0.9, para_direction_rtl = false, -- force LTR input_type = "string", allow_newline = false, cursor_at_end = true, fullscreen = true, buttons = {{{ text = _("Cancel"), callback = function() UIManager:close(edit_dialog) edit_dialog = nil self:manageShortcuts() end, }, { text = _("Save"), callback = function() local input = edit_dialog:getInputText() UIManager:close(edit_dialog) edit_dialog = nil if input:match("[A-Za-z]") then self.shortcuts[item.nr]["text"] = input self:saveShortcuts() self:manageShortcuts() end end, }}}, } UIManager:show(edit_dialog) edit_dialog:onShowKeyboard() end function Terminal:deleteShortcut(item) for i = #self.shortcuts, 1, -1 do local element = self.shortcuts[i] if element.text == item.text and element.commands == item.commands then table.remove(self.shortcuts, i) end end self:saveShortcuts() self:manageShortcuts() end function Terminal:onTerminalStart() -- if shortcut commands are defined, go directly to the the shortcuts manager (so we can execute scripts more quickly): if #self.shortcuts == 0 then self:terminal() else self:manageShortcuts() end end function Terminal:terminal() self.input = InputDialog:new{ title = _("Enter a command and press \"Execute\""), input = self.command:gsub("\n+$", ""), para_direction_rtl = false, -- force LTR input_type = "string", allow_newline = true, cursor_at_end = true, fullscreen = true, buttons = {{{ text = _("Cancel"), callback = function() UIManager:close(self.input) end, }, { text = _("Shortcuts"), callback = function() UIManager:close(self.input) self:manageShortcuts() end, }, { text = _("Save"), callback = function() local input = self.input:getInputText() if input:match("[A-Za-z]") then local function callback(name) local new_shortcut = { text = name, commands = input, } table.insert(self.shortcuts, new_shortcut) self:saveShortcuts() end local prompt prompt = InputDialog:new{ title = _("Name"), input = "", input_type = "text", fullscreen = true, condensed = true, allow_newline = false, cursor_at_end = true, buttons = {{{ text = _("Cancel"), callback = function() UIManager:close(prompt) end, }, { text = _("Save"), is_enter_default = true, callback = function() local newval = prompt:getInputText() UIManager:close(prompt) callback(newval) end, }}} } UIManager:show(prompt) prompt:onShowKeyboard() end end, }, { text = _("Execute"), callback = function() UIManager:close(self.input) -- so we know which middle button to display in the results: self.source = "terminal" self.command = self:ensureWhitelineAfterCommands(self.input:getInputText()) Trapper:wrap(function() self:execute() end) end, }}}, } UIManager:show(self.input) self.input:onShowKeyboard() end -- for prettier formatting of output by separating commands and result thereof with a whiteline: function Terminal:ensureWhitelineAfterCommands(commands) if string.sub(commands, -1) ~= "\n" then commands = commands .. "\n" end return commands end function Terminal:execute() local wait_msg = InfoMessage:new{ text = _("Executing…"), } UIManager:show(wait_msg) local entries = { self.command } local command = self.command .. " 2>&1 ; echo" -- ensure we get stderr and output something local completed, result_str = Trapper:dismissablePopen(command, wait_msg) if completed then table.insert(entries, result_str) self:dump(entries) table.insert(entries, _("Output was also written to")) table.insert(entries, self.dump_file) else table.insert(entries, _("Execution canceled.")) end UIManager:close(wait_msg) local viewer local buttons_table local back_button = { text = _("Back"), callback = function() UIManager:close(viewer) if self.source == "terminal" then self:terminal() else self:manageShortcuts() end end, } local close_button = { text = _("Close"), callback = function() UIManager:close(viewer) end, } if self.source == "terminal" then buttons_table = { { back_button, { text = _("Shortcuts"), -- switch to shortcuts: callback = function() UIManager:close(viewer) self:manageShortcuts() end, }, close_button, }, } else buttons_table = { { back_button, { text = _("Terminal"), -- switch to terminal: callback = function() UIManager:close(viewer) self:terminal() end, }, close_button, }, } end viewer = TextViewer:new{ title = _("Command output"), text = table.concat(entries, "\n"), justified = false, text_face = Font:getFace("smallinfont"), buttons_table = buttons_table, } UIManager:show(viewer) end function Terminal:dump(entries) local content = table.concat(entries, "\n") local file = io.open(self.dump_file, "w") if file then file:write(content) file:close() else logger.warn("Failed to dump terminal output " .. content .. " to " .. self.dump_file) end end function Terminal:addToMainMenu(menu_items) menu_items.terminal = { text = _("Terminal emulator"), keep_menu_open = true, callback = function() self:onTerminalStart() end, } end return Terminal
agpl-3.0
bnetcc/darkstar
scripts/globals/effects/sigil.lua
1
3517
----------------------------------- -- -- EFFECT_SIGIL -- ----------------------------------- ----------------------------------- -- onEffectGain Action ----------------------------------- function onEffectGain(target,effect) local power = effect:getPower(); -- Tracks which bonus effects are in use. local subPower = effect:getSubPower(); -- subPower sets % required to trigger regen/refresh. if (power == 1 or power == 3 or power == 5 or power == 7 or power == 9 or power == 11 or power == 13 or power == 15) then -- target:addLatent(LATENT_SIGIL_REGEN, subPower+10, MOD_REGEN, 1); -- Not yet implemented target:addMod(MOD_REGEN,1); -- Todo: should be latent end if (power == 2 or power == 3 or power == 6 or power == 7 or power == 10 or power == 11 or power >= 14) then -- target:addLatent(LATENT_SIGIL_REFRESH, subPower, MOD_REFRESH, 1); -- Not yet implemented target:addMod(MOD_REFRESH,1); -- Todo: should be latent end if (power >= 4 and power <= 7) then -- target:addMod(MOD_FOOD_DURATION), ???); -- food duration not implemented. elseif (power >= 8 and power <= 11) then -- target:addMod(MOD_EXPLOSS_REDUCTION), ???); -- exp loss reduction not implemented. elseif (power >= 12) then -- Possibly handle exp loss reduction in core instead..Maybe the food bonus also? -- target:addMod(MOD_FOOD_DURATION), ???); -- food duration not implemented. -- target:addLatent(LATENT_SIGIL_EXPLOSS, ?, MOD_EXPLOSS_REDUCTION, ?); -- exp loss reduction not implemented. end -- Begin Custom stuff if (target:isPC()) then target:addMod(MOD_RERAISE_III,1); end -- End Custom Stuff end; ----------------------------------- -- onEffectTick Action ----------------------------------- function onEffectTick(target,effect) end; ----------------------------------- -- onEffectLose Action ----------------------------------- function onEffectLose(target,effect) local power = effect:getPower(); -- Tracks which bonus effects are in use. local subPower = effect:getSubPower(); -- subPower sets % required to trigger regen/refresh. if (power == 1 or power == 3 or power == 5 or power == 7 or power == 9 or power == 11 or power == 13 or power == 15) then -- target:delLatent(LATENT_SIGIL_REGEN, subPower+10, MOD_REGEN, 1); -- Not yet implemented target:delMod(MOD_REGEN,1); -- Todo: should be latent end if (power == 2 or power == 3 or power == 6 or power == 7 or power == 10 or power == 11 or power >= 14) then -- target:delLatent(LATENT_SIGIL_REFRESH, subPower, MOD_REFRESH, 1); -- Not yet implemented target:delMod(MOD_REFRESH,1); -- Todo: should be latent end if (effect:getPower() >= 4 and effect:getPower() <= 7) then -- target:delMod(MOD_FOOD_DURATION), ???); -- food duration not implemented. elseif (effect:getPower() >= 8 and effect:getPower() <= 11) then -- target:delMod(MOD_EXPLOSS_REDUCTION), ???); -- exp loss reduction not implemented. elseif (effect:getPower() >= 12) then -- target:delMod(MOD_FOOD_DURATION), ???); -- food duration not implemented. -- target:delMod(MOD_EXPLOSS_REDUCTION), ???); -- exp loss reduction not implemented. end -- Begin Custom stuff if (target:isPC()) then target:delMod(MOD_RERAISE_III,1); end -- End Custom Stuff end;
gpl-3.0
graphdat/plugin-pingcheck
init.lua
1
2627
local framework = require('framework') local CommandOutputDataSource = framework.CommandOutputDataSource local PollerCollection = framework.PollerCollection local DataSourcePoller = framework.DataSourcePoller local Plugin = framework.Plugin local os = require('os') local table = require('table') local string = require('string') local isEmpty = framework.string.isEmpty local clone = framework.table.clone local params = framework.params local commands = { linux = { path = '/bin/ping', args = {'-n', '-w 2', '-c 1'} }, win32 = { path = 'C:/windows/system32/ping.exe', args = {'-n', '1', '-w', '3000'} }, darwin = { path = '/sbin/ping', args = {'-n', '-t 2', '-c 1'} } } local ping_command = commands[string.lower(os.type())] if ping_command == nil then print("_bevent:"..(Plugin.name or params.name)..":"..(Plugin.version or params.version)..":Your platform is not supported. We currently support Linux, Windows and OSX|t:error|tags:lua,plugin"..(Plugin.tags and framework.string.concat(Plugin.tags, ',') or params.tags)) process:exit(-1) end local function createPollers (params, cmd) local pollers = PollerCollection:new() for _, item in ipairs(params.items) do cmd = clone(cmd) table.insert(cmd.args, item.host) cmd.info = item.source local data_source = CommandOutputDataSource:new(cmd) local poll_interval = tonumber(item.pollInterval or params.pollInterval) * 1000 local poller = DataSourcePoller:new(poll_interval, data_source) pollers:add(poller) end return pollers end local function parseOutput(context, output) assert(output ~= nil, 'parseOutput expect some data') if isEmpty(output) then context:emit('error', 'Unable to obtain any output.') return end if (string.find(output, "unknown host") or string.find(output, "could not find host.")) then context:emit('error', 'The host ' .. context.args[#context.args] .. ' was not found.') return end local index local prevIndex = 0 while true do index = string.find(output, '\n', prevIndex+1) if not index then break end local line = string.sub(output, prevIndex, index-1) local _, _, time = string.find(line, "time=([0-9]*%.?[0-9]+)") if time then return tonumber(time) end prevIndex = index end return -1 end local pollers = createPollers(params, ping_command) local plugin = Plugin:new(params, pollers) function plugin:onParseValues(data) local result = {} local value = parseOutput(self, data['output']) result['PING_RESPONSETIME'] = { value = value, source = data['info'] } return result end plugin:run()
apache-2.0
tahashakiba/booooooo
plugins/inrealm.lua
71
25005
-- data saved to moderation.json -- check moderation plugin do local function create_group(msg) -- superuser and admins only (because sudo are always has privilege) if is_sudo(msg) or is_realm(msg) and is_admin(msg) then local group_creator = msg.from.print_name create_group_chat (group_creator, group_name, ok_cb, false) return 'Group [ '..string.gsub(group_name, '_', ' ')..' ] has been created.' end end local function create_realm(msg) -- superuser and admins only (because sudo are always has privilege) if is_sudo(msg) or is_realm(msg) and is_admin(msg) then local group_creator = msg.from.print_name create_group_chat (group_creator, group_name, ok_cb, false) return 'Realm [ '..string.gsub(group_name, '_', ' ')..' ] has been created.' end end local function killchat(cb_extra, success, result) local receiver = cb_extra.receiver local chat_id = "chat#id"..result.id local chatname = result.print_name for k,v in pairs(result.members) do kick_user_any(v.id, result.id) end end local function killrealm(cb_extra, success, result) local receiver = cb_extra.receiver local chat_id = "chat#id"..result.id local chatname = result.print_name for k,v in pairs(result.members) do kick_user_any(v.id, result.id) end end local function get_group_type(msg) local data = load_data(_config.moderation.data) if data[tostring(msg.to.id)] then if not data[tostring(msg.to.id)]['group_type'] then return 'No group type available.' end local group_type = data[tostring(msg.to.id)]['group_type'] return group_type else return 'Chat type not found.' end end local function callbackres(extra, success, result) --vardump(result) local user = result.id local name = string.gsub(result.print_name, "_", " ") local chat = 'chat#id'..extra.chatid send_large_msg(chat, user..'\n'..name) return user end local function set_description(msg, data, target, about) if not is_admin(msg) then return "For admins only!" end local data_cat = 'description' data[tostring(target)][data_cat] = about save_data(_config.moderation.data, data) return 'Set group description to:\n'..about end local function set_rules(msg, data, target) if not is_admin(msg) then return "For admins only!" end local data_cat = 'rules' data[tostring(target)][data_cat] = rules save_data(_config.moderation.data, data) return 'Set group rules to:\n'..rules end -- lock/unlock group name. bot automatically change group name when locked local function lock_group_name(msg, data, target) if not is_admin(msg) then return "For admins only!" end local group_name_set = data[tostring(target)]['settings']['set_name'] local group_name_lock = data[tostring(target)]['settings']['lock_name'] if group_name_lock == 'yes' then return 'Group name is already locked' else data[tostring(target)]['settings']['lock_name'] = 'yes' save_data(_config.moderation.data, data) rename_chat('chat#id'..target, group_name_set, ok_cb, false) return 'Group name has been locked' end end local function unlock_group_name(msg, data, target) if not is_admin(msg) then return "For admins only!" end local group_name_set = data[tostring(target)]['settings']['set_name'] local group_name_lock = data[tostring(target)]['settings']['lock_name'] if group_name_lock == 'no' then return 'Group name is already unlocked' else data[tostring(target)]['settings']['lock_name'] = 'no' save_data(_config.moderation.data, data) return 'Group name has been unlocked' end end --lock/unlock group member. bot automatically kick new added user when locked local function lock_group_member(msg, data, target) if not is_admin(msg) then return "For admins only!" end local group_member_lock = data[tostring(target)]['settings']['lock_member'] if group_member_lock == 'yes' then return 'Group members are already locked' else data[tostring(target)]['settings']['lock_member'] = 'yes' save_data(_config.moderation.data, data) end return 'Group members has been locked' end local function unlock_group_member(msg, data, target) if not is_admin(msg) then return "For admins only!" end local group_member_lock = data[tostring(target)]['settings']['lock_member'] if group_member_lock == 'no' then return 'Group members are not locked' else data[tostring(target)]['settings']['lock_member'] = 'no' save_data(_config.moderation.data, data) return 'Group members has been unlocked' end end --lock/unlock group photo. bot automatically keep group photo when locked local function lock_group_photo(msg, data, target) if not is_admin(msg) then return "For admins only!" end local group_photo_lock = data[tostring(target)]['settings']['lock_photo'] if group_photo_lock == 'yes' then return 'Group photo is already locked' else data[tostring(target)]['settings']['set_photo'] = 'waiting' save_data(_config.moderation.data, data) end return 'Please send me the group photo now' end local function unlock_group_photo(msg, data, target) if not is_admin(msg) then return "For admins only!" end local group_photo_lock = data[tostring(target)]['settings']['lock_photo'] if group_photo_lock == 'no' then return 'Group photo is not locked' else data[tostring(target)]['settings']['lock_photo'] = 'no' save_data(_config.moderation.data, data) return 'Group photo has been unlocked' end end local function lock_group_flood(msg, data, target) if not is_admin(msg) then return "For admins only!" end local group_flood_lock = data[tostring(target)]['settings']['flood'] if group_flood_lock == 'yes' then return 'Group flood is locked' else data[tostring(target)]['settings']['flood'] = 'yes' save_data(_config.moderation.data, data) return 'Group flood has been locked' end end local function unlock_group_flood(msg, data, target) if not is_admin(msg) then return "For admins only!" end local group_flood_lock = data[tostring(target)]['settings']['flood'] if group_flood_lock == 'no' then return 'Group flood is not locked' else data[tostring(target)]['settings']['flood'] = 'no' save_data(_config.moderation.data, data) return 'Group flood has been unlocked' end end -- show group settings local function show_group_settings(msg, data, target) local data = load_data(_config.moderation.data, data) if not is_admin(msg) then return "For admins only!" end local settings = data[tostring(target)]['settings'] local text = "Group settings:\nLock group name : "..settings.lock_name.."\nLock group photo : "..settings.lock_photo.."\nLock group member : "..settings.lock_member return text end local function returnids(cb_extra, success, result) local receiver = cb_extra.receiver local chat_id = "chat#id"..result.id local chatname = result.print_name local text = 'Users in '..string.gsub(chatname,"_"," ")..' ('..result.id..'):'..'\n'..'' for k,v in pairs(result.members) do if v.print_name then local username = "" text = text .. "- " .. string.gsub(v.print_name,"_"," ") .. " (" .. v.id .. ") \n" end end send_large_msg(receiver, text) local file = io.open("./groups/lists/"..result.id.."memberlist.txt", "w") file:write(text) file:flush() file:close() end local function returnidsfile(cb_extra, success, result) local receiver = cb_extra.receiver local chat_id = "chat#id"..result.id local chatname = result.print_name local text = 'Users in '..string.gsub(chatname,"_"," ")..' ('..result.id..'):'..'\n'..'' for k,v in pairs(result.members) do if v.print_name then local username = "" text = text .. "- " .. string.gsub(v.print_name,"_"," ") .. " (" .. v.id .. ") \n" end end local file = io.open("./groups/lists/"..result.id.."memberlist.txt", "w") file:write(text) file:flush() file:close() send_document("chat#id"..result.id,"./groups/lists/"..result.id.."memberlist.txt", ok_cb, false) end local function admin_promote(msg, admin_id) if not is_sudo(msg) then return "Access denied!" end local admins = 'admins' if not data[tostring(admins)] then data[tostring(admins)] = {} save_data(_config.moderation.data, data) end if data[tostring(admins)][tostring(admin_id)] then return admin_name..' is already an admin.' end data[tostring(admins)][tostring(admin_id)] = admin_id save_data(_config.moderation.data, data) return admin_id..' has been promoted as admin.' end local function admin_demote(msg, admin_id) if not is_sudo(msg) then return "Access denied!" end local data = load_data(_config.moderation.data) local admins = 'admins' if not data[tostring(admins)] then data[tostring(admins)] = {} save_data(_config.moderation.data, data) end if not data[tostring(admins)][tostring(admin_id)] then return admin_id..' is not an admin.' end data[tostring(admins)][tostring(admin_id)] = nil save_data(_config.moderation.data, data) return admin_id..' has been demoted from admin.' end local function admin_list(msg) local data = load_data(_config.moderation.data) local admins = 'admins' if not data[tostring(admins)] then data[tostring(admins)] = {} save_data(_config.moderation.data, data) end local message = 'List for Realm admins:\n' for k,v in pairs(data[tostring(admins)]) do message = message .. '- (at)' .. v .. ' [' .. k .. '] ' ..'\n' end return message end local function groups_list(msg) local data = load_data(_config.moderation.data) local groups = 'groups' if not data[tostring(groups)] then return 'No groups at the moment' end local message = 'List of groups:\n' for k,v in pairs(data[tostring(groups)]) do local settings = data[tostring(v)]['settings'] for m,n in pairs(settings) do if m == 'set_name' then name = n end end local group_owner = "No owner" if data[tostring(v)]['set_owner'] then group_owner = tostring(data[tostring(v)]['set_owner']) end local group_link = "No link" if data[tostring(v)]['settings']['set_link'] then group_link = data[tostring(v)]['settings']['set_link'] end message = message .. '- '.. name .. ' (' .. v .. ') ['..group_owner..'] \n {'..group_link.."}\n" end local file = io.open("./groups/lists/groups.txt", "w") file:write(message) file:flush() file:close() return message end local function realms_list(msg) local data = load_data(_config.moderation.data) local realms = 'realms' if not data[tostring(realms)] then return 'No Realms at the moment' end local message = 'List of Realms:\n' for k,v in pairs(data[tostring(realms)]) do local settings = data[tostring(v)]['settings'] for m,n in pairs(settings) do if m == 'set_name' then name = n end end local group_owner = "No owner" if data[tostring(v)]['admins_in'] then group_owner = tostring(data[tostring(v)]['admins_in']) end local group_link = "No link" if data[tostring(v)]['settings']['set_link'] then group_link = data[tostring(v)]['settings']['set_link'] end message = message .. '- '.. name .. ' (' .. v .. ') ['..group_owner..'] \n {'..group_link.."}\n" end local file = io.open("./groups/lists/realms.txt", "w") file:write(message) file:flush() file:close() return message end local function admin_user_promote(receiver, member_username, member_id) local data = load_data(_config.moderation.data) if not data['admins'] then data['admins'] = {} save_data(_config.moderation.data, data) end if data['admins'][tostring(member_id)] then return send_large_msg(receiver, member_username..' is already as admin.') end data['admins'][tostring(member_id)] = member_username save_data(_config.moderation.data, data) return send_large_msg(receiver, '@'..member_username..' has been promoted as admin.') end local function admin_user_demote(receiver, member_username, member_id) local data = load_data(_config.moderation.data) if not data['admins'] then data['admins'] = {} save_data(_config.moderation.data, data) end if not data['admins'][tostring(member_id)] then return send_large_msg(receiver, member_username..' is not an admin.') end data['admins'][tostring(member_id)] = nil save_data(_config.moderation.data, data) return send_large_msg(receiver, 'Admin '..member_username..' has been demoted.') end local function username_id(cb_extra, success, result) local mod_cmd = cb_extra.mod_cmd local receiver = cb_extra.receiver local member = cb_extra.member local text = 'No user @'..member..' in this group.' for k,v in pairs(result.members) do vusername = v.username if vusername == member then member_username = member member_id = v.id if mod_cmd == 'addadmin' then return admin_user_promote(receiver, member_username, member_id) elseif mod_cmd == 'removeadmin' then return admin_user_demote(receiver, member_username, member_id) end end end send_large_msg(receiver, text) end local function set_log_group(msg) if not is_admin(msg) then return end local log_group = data[tostring(groups)][tostring(msg.to.id)]['log_group'] if log_group == 'yes' then return 'Log group is already set' else data[tostring(groups)][tostring(msg.to.id)]['log_group'] = 'yes' save_data(_config.moderation.data, data) return 'Log group has been set' end end local function unset_log_group(msg) if not is_admin(msg) then return end local log_group = data[tostring(groups)][tostring(msg.to.id)]['log_group'] if log_group == 'no' then return 'Log group is already disabled' else data[tostring(groups)][tostring(msg.to.id)]['log_group'] = 'no' save_data(_config.moderation.data, data) return 'log group has been disabled' end end local function help() local help_text = tostring(_config.help_text_realm) return help_text end function run(msg, matches) --vardump(msg) local name_log = user_print_name(msg.from) if matches[1] == 'log' and is_owner(msg) then savelog(msg.to.id, "log file created by owner") send_document("chat#id"..msg.to.id,"./groups/"..msg.to.id.."log.txt", ok_cb, false) end if matches[1] == 'who' and is_momod(msg) then local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] requested member list ") local receiver = get_receiver(msg) chat_info(receiver, returnidsfile, {receiver=receiver}) end if matches[1] == 'wholist' and is_momod(msg) then local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] requested member list in a file") local receiver = get_receiver(msg) chat_info(receiver, returnids, {receiver=receiver}) end if matches[1] == 'creategroup' and matches[2] then group_name = matches[2] group_type = 'group' return create_group(msg) end if not is_sudo(msg) or not is_admin(msg) and not is_realm(msg) then return --Do nothing end if matches[1] == 'createrealm' and matches[2] then group_name = matches[2] group_type = 'realm' return create_realm(msg) end local data = load_data(_config.moderation.data) local receiver = get_receiver(msg) if matches[2] then if data[tostring(matches[2])] then local settings = data[tostring(matches[2])]['settings'] if matches[1] == 'setabout' and matches[2] then local target = matches[2] local about = matches[3] return set_description(msg, data, target, about) end if matches[1] == 'setrules' then rules = matches[3] local target = matches[2] return set_rules(msg, data, target) end if matches[1] == 'lock' then --group lock * local target = matches[2] if matches[3] == 'name' then return lock_group_name(msg, data, target) end if matches[3] == 'member' then return lock_group_member(msg, data, target) end if matches[3] == 'photo' then return lock_group_photo(msg, data, target) end if matches[3] == 'flood' then return lock_group_flood(msg, data, target) end end if matches[1] == 'unlock' then --group unlock * local target = matches[2] if matches[3] == 'name' then return unlock_group_name(msg, data, target) end if matches[3] == 'member' then return unlock_group_member(msg, data, target) end if matches[3] == 'photo' then return unlock_group_photo(msg, data, target) end if matches[3] == 'flood' then return unlock_group_flood(msg, data, target) end end if matches[1] == 'settings' and data[tostring(matches[2])]['settings'] then local target = matches[2] return show_group_settings(msg, data, target) end if matches[1] == 'setname' and is_realm(msg) then local new_name = string.gsub(matches[2], '_', ' ') data[tostring(msg.to.id)]['settings']['set_name'] = new_name save_data(_config.moderation.data, data) local group_name_set = data[tostring(msg.to.id)]['settings']['set_name'] local to_rename = 'chat#id'..msg.to.id rename_chat(to_rename, group_name_set, ok_cb, false) savelog(msg.to.id, "Realm { "..msg.to.print_name.." } name changed to [ "..new_name.." ] by "..name_log.." ["..msg.from.id.."]") end if matches[1] == 'setgpname' and is_admin(msg) then local new_name = string.gsub(matches[3], '_', ' ') data[tostring(matches[2])]['settings']['set_name'] = new_name save_data(_config.moderation.data, data) local group_name_set = data[tostring(matches[2])]['settings']['set_name'] local to_rename = 'chat#id'..matches[2] rename_chat(to_rename, group_name_set, ok_cb, false) savelog(msg.to.id, "Group { "..msg.to.print_name.." } name changed to [ "..new_name.." ] by "..name_log.." ["..msg.from.id.."]") end end end if matches[1] == 'help' and is_realm(msg) then savelog(msg.to.id, name_log.." ["..msg.from.id.."] Used /help") return help() end if matches[1] == 'set' then if matches[2] == 'loggroup' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] set as log group") return set_log_group(msg) end end if matches[1] == 'kill' and matches[2] == 'chat' then if not is_admin(msg) then return nil end if is_realm(msg) then local receiver = 'chat#id'..matches[3] return modrem(msg), print("Closing Group: "..receiver), chat_info(receiver, killchat, {receiver=receiver}) else return 'Error: Group '..matches[3]..' not found' end end if matches[1] == 'kill' and matches[2] == 'realm' then if not is_admin(msg) then return nil end if is_realm(msg) then local receiver = 'chat#id'..matches[3] return realmrem(msg), print("Closing realm: "..receiver), chat_info(receiver, killrealm, {receiver=receiver}) else return 'Error: Realm '..matches[3]..' not found' end end if matches[1] == 'chat_add_user' then if not msg.service then return "Are you trying to troll me?" end local user = 'user#id'..msg.action.user.id local chat = 'chat#id'..msg.to.id if not is_admin(msg) then chat_del_user(chat, user, ok_cb, true) end end if matches[1] == 'addadmin' then if string.match(matches[2], '^%d+$') then local admin_id = matches[2] print("user "..admin_id.." has been promoted as admin") return admin_promote(msg, admin_id) else local member = string.gsub(matches[2], "@", "") local mod_cmd = "addadmin" chat_info(receiver, username_id, {mod_cmd= mod_cmd, receiver=receiver, member=member}) end end if matches[1] == 'removeadmin' then if string.match(matches[2], '^%d+$') then local admin_id = matches[2] print("user "..admin_id.." has been demoted") return admin_demote(msg, admin_id) else local member = string.gsub(matches[2], "@", "") local mod_cmd = "removeadmin" chat_info(receiver, username_id, {mod_cmd= mod_cmd, receiver=receiver, member=member}) end end if matches[1] == 'type'then local group_type = get_group_type(msg) return group_type end if matches[1] == 'list' and matches[2] == 'admins' then return admin_list(msg) end if matches[1] == 'list' and matches[2] == 'groups' then if msg.to.type == 'chat' then groups_list(msg) send_document("chat#id"..msg.to.id, "./groups/lists/groups.txt", ok_cb, false) return "Group list created" --group_list(msg) elseif msg.to.type == 'user' then groups_list(msg) send_document("user#id"..msg.from.id, "./groups/lists/groups.txt", ok_cb, false) return "Group list created" --group_list(msg) end end if matches[1] == 'list' and matches[2] == 'realms' then if msg.to.type == 'chat' then realms_list(msg) send_document("chat#id"..msg.to.id, "./groups/lists/realms.txt", ok_cb, false) return "Realms list created" --realms_list(msg) elseif msg.to.type == 'user' then realms_list(msg) send_document("user#id"..msg.from.id, "./groups/lists/realms.txt", ok_cb, false) return "Realms list created" --realms_list(msg) end end if matches[1] == 'res' and is_momod(msg) then local cbres_extra = { chatid = msg.to.id } local username = matches[2] local username = username:gsub("@","") savelog(msg.to.id, name_log.." ["..msg.from.id.."] Used /res "..username) return res_user(username, callbackres, cbres_extra) end end return { patterns = { "^(creategroup) (.*)$", "^(createrealm) (.*)$", "^(setabout) (%d+) (.*)$", "^(setrules) (%d+) (.*)$", "^(setname) (.*)$", "^(setgpname) (%d+) (.*)$", "^(setname) (%d+) (.*)$", "^(lock) (%d+) (.*)$", "^(unlock) (%d+) (.*)$", "^(setting) (%d+)$", "^(wholist)$", "^(who)$", "^(type)$", "^(kill) (chat) (%d+)$", "^(kill) (realm) (%d+)$", "^(addadmin) (.*)$", -- sudoers only "^(removeadmin) (.*)$", -- sudoers only "^(list) (.*)$", "^(log)$", "^(help)$", "^!!tgservice (.+)$", }, run = run } end
gpl-2.0
bnetcc/darkstar
scripts/globals/items/bottle_of_barbarians_drink.lua
1
1102
----------------------------------------- -- ID: 5385 -- Item: Bottle of Barbarian's Drink -- Item Effect: +50% Attk -- Durration: 60 Secs ----------------------------------------- require("scripts/globals/status"); ----------------------------------------- -- OnItemCheck ----------------------------------------- function onItemCheck(target) result = 0; if (target:hasStatusEffect(EFFECT_MEDICINE)) then result = 111; end return result; end; ----------------------------------------- -- OnItemUse ----------------------------------------- function onItemUse(target) if (target:addStatusEffect(EFFECT_MEDICINE,0,0,60,5835)) then target:messageBasic(205); else target:messageBasic(423); -- no effect end end; ----------------------------------------- -- onEffectGain Action ----------------------------------------- function onEffectGain(target,effect) target:addMod(MOD_ATTP, 50); end; ----------------------------------------- -- onEffectLose Action ----------------------------------------- function onEffectLose(target,effect) target:delMod(MOD_ATTP, 50); end;
gpl-3.0
TurkeyMan/premake-core
modules/vstudio/tests/vc2010/test_ensure_nuget_imports.lua
11
1951
-- -- tests/actions/vstudio/vc2010/test_ensure_nuget_imports.lua -- Check the EnsureNuGetPackageBuildImports block of a VS 2010 project. -- Copyright (c) 2016 Jason Perkins and the Premake project -- local p = premake local suite = test.declare("vs2010_ensure_nuget_imports") local vc2010 = p.vstudio.vc2010 local project = p.project -- -- Setup -- local wks function suite.setup() p.action.set("vs2010") wks = test.createWorkspace() end local function prepare() local prj = p.workspace.getproject(wks, 1) vc2010.ensureNuGetPackageBuildImports(prj) end -- -- Should not output anything if no packages have been set. -- function suite.noOutputIfNoPackages() prepare() test.isemptycapture() end -- -- Writes the pre-build check that makes sure that all packages are installed. -- function suite.structureIsCorrect() nuget { "boost:1.59.0-b1", "sdl2.v140:2.0.3", "sdl2.v140.redist:2.0.3" } prepare() test.capture [[ <Target Name="EnsureNuGetPackageBuildImports" BeforeTargets="PrepareForBuild"> <PropertyGroup> <ErrorText>This project references NuGet package(s) that are missing on this computer. Use NuGet Package Restore to download them. For more information, see http://go.microsoft.com/fwlink/?LinkID=322105. The missing file is {0}.</ErrorText> </PropertyGroup> <Error Condition="!Exists('packages\boost.1.59.0-b1\build\native\boost.targets')" Text="$([System.String]::Format('$(ErrorText)', 'packages\boost.1.59.0-b1\build\native\boost.targets'))" /> <Error Condition="!Exists('packages\sdl2.v140.2.0.3\build\native\sdl2.v140.targets')" Text="$([System.String]::Format('$(ErrorText)', 'packages\sdl2.v140.2.0.3\build\native\sdl2.v140.targets'))" /> <Error Condition="!Exists('packages\sdl2.v140.redist.2.0.3\build\native\sdl2.v140.redist.targets')" Text="$([System.String]::Format('$(ErrorText)', 'packages\sdl2.v140.redist.2.0.3\build\native\sdl2.v140.redist.targets'))" /> </Target> ]] end
bsd-3-clause
bnetcc/darkstar
scripts/globals/spells/bluemagic/thermal_pulse.lua
1
1666
----------------------------------------- -- Spell: Thermal Pulse ----------------------------------------- require("scripts/globals/bluemagic"); require("scripts/globals/status"); require("scripts/globals/magic"); require("scripts/globals/msg"); ----------------------------------------- function onMagicCastingCheck(caster,target,spell) return 0; end; function onSpellCast(caster,target,spell) local params = {}; params.attribute = MOD_INT; params.skillType = BLUE_SKILL; params.effect = EFFECT_BLINDNESS; params.multiplier = 4.0; params.tMultiplier = 2.0; params.duppercap = 90; params.str_wsc = 0.0; params.dex_wsc = 0.0; params.vit_wsc = 0.4; params.agi_wsc = 0.0; params.int_wsc = 0.0; params.mnd_wsc = 0.0; params.chr_wsc = 0.0; local damage = BlueMagicalSpell(caster, target, spell, params, INT_BASED); damage = BlueFinalAdjustments(caster, target, spell, damage, params); local resist = applyResistance(caster, target, spell, params); if (caster:hasStatusEffect(EFFECT_AZURE_LORE)) then multi = multi + 0.50; end if (damage > 0 and resist < 0.4) then -- Def nawt retail at all, there is no info for how strong the blind is local nawtRetail = (caster:getStat(MOD_MND) - target:getStat(MOD_INT)); local nawtRetail = math.floor(nawtRetail * 3/8) + 45; if (nawtRetail < 15) then nawtRetail = 15; elseif (nawtRetail > 90) then nawtRetail = 90; end target:addStatusEffect(params.effect,nawtRetail,0,getBlueEffectDuration(caster,resist,params.effect)); end return damage; end;
gpl-3.0
yswifi/APlan
build_dir/target-mipsel_24kec+dsp_uClibc-0.9.33.2/luci/libs/sys/luasrc/sys.lua
43
25825
--[[ LuCI - System library Description: Utilities for interaction with the Linux system FileId: $Id$ License: Copyright 2008 Steven Barth <steven@midlink.org> Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. ]]-- local io = require "io" local os = require "os" local table = require "table" local nixio = require "nixio" local fs = require "nixio.fs" local uci = require "luci.model.uci" local luci = {} luci.util = require "luci.util" luci.ip = require "luci.ip" local tonumber, ipairs, pairs, pcall, type, next, setmetatable, require, select = tonumber, ipairs, pairs, pcall, type, next, setmetatable, require, select --- LuCI Linux and POSIX system utilities. module "luci.sys" --- Execute a given shell command and return the error code -- @class function -- @name call -- @param ... Command to call -- @return Error code of the command function call(...) return os.execute(...) / 256 end --- Execute a given shell command and capture its standard output -- @class function -- @name exec -- @param command Command to call -- @return String containg the return the output of the command exec = luci.util.exec --- Retrieve information about currently mounted file systems. -- @return Table containing mount information function mounts() local data = {} local k = {"fs", "blocks", "used", "available", "percent", "mountpoint"} local ps = luci.util.execi("df") if not ps then return else ps() end for line in ps do local row = {} local j = 1 for value in line:gmatch("[^%s]+") do row[k[j]] = value j = j + 1 end if row[k[1]] then -- this is a rather ugly workaround to cope with wrapped lines in -- the df output: -- -- /dev/scsi/host0/bus0/target0/lun0/part3 -- 114382024 93566472 15005244 86% /mnt/usb -- if not row[k[2]] then j = 2 line = ps() for value in line:gmatch("[^%s]+") do row[k[j]] = value j = j + 1 end end table.insert(data, row) end end return data end --- Retrieve environment variables. If no variable is given then a table -- containing the whole environment is returned otherwise this function returns -- the corresponding string value for the given name or nil if no such variable -- exists. -- @class function -- @name getenv -- @param var Name of the environment variable to retrieve (optional) -- @return String containg the value of the specified variable -- @return Table containing all variables if no variable name is given getenv = nixio.getenv --- Get or set the current hostname. -- @param String containing a new hostname to set (optional) -- @return String containing the system hostname function hostname(newname) if type(newname) == "string" and #newname > 0 then fs.writefile( "/proc/sys/kernel/hostname", newname ) return newname else return nixio.uname().nodename end end --- Returns the contents of a documented referred by an URL. -- @param url The URL to retrieve -- @param stream Return a stream instead of a buffer -- @param target Directly write to target file name -- @return String containing the contents of given the URL function httpget(url, stream, target) if not target then local source = stream and io.popen or luci.util.exec return source("wget -qO- '"..url:gsub("'", "").."'") else return os.execute("wget -qO '%s' '%s'" % {target:gsub("'", ""), url:gsub("'", "")}) end end --- Returns the system load average values. -- @return String containing the average load value 1 minute ago -- @return String containing the average load value 5 minutes ago -- @return String containing the average load value 15 minutes ago function loadavg() local info = nixio.sysinfo() return info.loads[1], info.loads[2], info.loads[3] end --- Initiate a system reboot. -- @return Return value of os.execute() function reboot() return os.execute("reboot >/dev/null 2>&1") end --- Returns the system type, cpu name and installed physical memory. -- @return String containing the system or platform identifier -- @return String containing hardware model information -- @return String containing the total memory amount in kB -- @return String containing the memory used for caching in kB -- @return String containing the memory used for buffering in kB -- @return String containing the free memory amount in kB -- @return String containing the cpu bogomips (number) function sysinfo() local cpuinfo = fs.readfile("/proc/cpuinfo") local meminfo = fs.readfile("/proc/meminfo") local memtotal = tonumber(meminfo:match("MemTotal:%s*(%d+)")) local memcached = tonumber(meminfo:match("\nCached:%s*(%d+)")) local memfree = tonumber(meminfo:match("MemFree:%s*(%d+)")) local membuffers = tonumber(meminfo:match("Buffers:%s*(%d+)")) local bogomips = tonumber(cpuinfo:match("[Bb]ogo[Mm][Ii][Pp][Ss].-: ([^\n]+)")) or 0 local swaptotal = tonumber(meminfo:match("SwapTotal:%s*(%d+)")) local swapcached = tonumber(meminfo:match("SwapCached:%s*(%d+)")) local swapfree = tonumber(meminfo:match("SwapFree:%s*(%d+)")) local system = cpuinfo:match("system type\t+: ([^\n]+)") or cpuinfo:match("Processor\t+: ([^\n]+)") or cpuinfo:match("model name\t+: ([^\n]+)") local model = luci.util.pcdata(fs.readfile("/tmp/sysinfo/model")) or cpuinfo:match("machine\t+: ([^\n]+)") or cpuinfo:match("Hardware\t+: ([^\n]+)") or luci.util.pcdata(fs.readfile("/proc/diag/model")) or nixio.uname().machine or system return system, model, memtotal, memcached, membuffers, memfree, bogomips, swaptotal, swapcached, swapfree end --- Retrieves the output of the "logread" command. -- @return String containing the current log buffer function syslog() return luci.util.exec("logread") end --- Retrieves the output of the "dmesg" command. -- @return String containing the current log buffer function dmesg() return luci.util.exec("dmesg") end --- Generates a random id with specified length. -- @param bytes Number of bytes for the unique id -- @return String containing hex encoded id function uniqueid(bytes) local rand = fs.readfile("/dev/urandom", bytes) return rand and nixio.bin.hexlify(rand) end --- Returns the current system uptime stats. -- @return String containing total uptime in seconds function uptime() return nixio.sysinfo().uptime end --- LuCI system utilities / network related functions. -- @class module -- @name luci.sys.net net = {} --- Returns the current arp-table entries as two-dimensional table. -- @return Table of table containing the current arp entries. -- The following fields are defined for arp entry objects: -- { "IP address", "HW address", "HW type", "Flags", "Mask", "Device" } function net.arptable(callback) local arp = (not callback) and {} or nil local e, r, v if fs.access("/proc/net/arp") then for e in io.lines("/proc/net/arp") do local r = { }, v for v in e:gmatch("%S+") do r[#r+1] = v end if r[1] ~= "IP" then local x = { ["IP address"] = r[1], ["HW type"] = r[2], ["Flags"] = r[3], ["HW address"] = r[4], ["Mask"] = r[5], ["Device"] = r[6] } if callback then callback(x) else arp = arp or { } arp[#arp+1] = x end end end end return arp end local function _nethints(what, callback) local _, k, e, mac, ip, name local cur = uci.cursor() local ifn = { } local hosts = { } local function _add(i, ...) local k = select(i, ...) if k then if not hosts[k] then hosts[k] = { } end hosts[k][1] = select(1, ...) or hosts[k][1] hosts[k][2] = select(2, ...) or hosts[k][2] hosts[k][3] = select(3, ...) or hosts[k][3] hosts[k][4] = select(4, ...) or hosts[k][4] end end if fs.access("/proc/net/arp") then for e in io.lines("/proc/net/arp") do ip, mac = e:match("^([%d%.]+)%s+%S+%s+%S+%s+([a-fA-F0-9:]+)%s+") if ip and mac then _add(what, mac:upper(), ip, nil, nil) end end end if fs.access("/etc/ethers") then for e in io.lines("/etc/ethers") do mac, ip = e:match("^([a-f0-9]%S+) (%S+)") if mac and ip then _add(what, mac:upper(), ip, nil, nil) end end end if fs.access("/var/dhcp.leases") then for e in io.lines("/var/dhcp.leases") do mac, ip, name = e:match("^%d+ (%S+) (%S+) (%S+)") if mac and ip then _add(what, mac:upper(), ip, nil, name ~= "*" and name) end end end cur:foreach("dhcp", "host", function(s) for mac in luci.util.imatch(s.mac) do _add(what, mac:upper(), s.ip, nil, s.name) end end) for _, e in ipairs(nixio.getifaddrs()) do if e.name ~= "lo" then ifn[e.name] = ifn[e.name] or { } if e.family == "packet" and e.addr and #e.addr == 17 then ifn[e.name][1] = e.addr:upper() elseif e.family == "inet" then ifn[e.name][2] = e.addr elseif e.family == "inet6" then ifn[e.name][3] = e.addr end end end for _, e in pairs(ifn) do if e[what] and (e[2] or e[3]) then _add(what, e[1], e[2], e[3], e[4]) end end for _, e in luci.util.kspairs(hosts) do callback(e[1], e[2], e[3], e[4]) end end --- Returns a two-dimensional table of mac address hints. -- @return Table of table containing known hosts from various sources. -- Each entry contains the values in the following order: -- [ "mac", "name" ] function net.mac_hints(callback) if callback then _nethints(1, function(mac, v4, v6, name) name = name or nixio.getnameinfo(v4 or v6, nil, 100) or v4 if name and name ~= mac then callback(mac, name or nixio.getnameinfo(v4 or v6, nil, 100) or v4) end end) else local rv = { } _nethints(1, function(mac, v4, v6, name) name = name or nixio.getnameinfo(v4 or v6, nil, 100) or v4 if name and name ~= mac then rv[#rv+1] = { mac, name or nixio.getnameinfo(v4 or v6, nil, 100) or v4 } end end) return rv end end --- Returns a two-dimensional table of IPv4 address hints. -- @return Table of table containing known hosts from various sources. -- Each entry contains the values in the following order: -- [ "ip", "name" ] function net.ipv4_hints(callback) if callback then _nethints(2, function(mac, v4, v6, name) name = name or nixio.getnameinfo(v4, nil, 100) or mac if name and name ~= v4 then callback(v4, name) end end) else local rv = { } _nethints(2, function(mac, v4, v6, name) name = name or nixio.getnameinfo(v4, nil, 100) or mac if name and name ~= v4 then rv[#rv+1] = { v4, name } end end) return rv end end --- Returns a two-dimensional table of IPv6 address hints. -- @return Table of table containing known hosts from various sources. -- Each entry contains the values in the following order: -- [ "ip", "name" ] function net.ipv6_hints(callback) if callback then _nethints(3, function(mac, v4, v6, name) name = name or nixio.getnameinfo(v6, nil, 100) or mac if name and name ~= v6 then callback(v6, name) end end) else local rv = { } _nethints(3, function(mac, v4, v6, name) name = name or nixio.getnameinfo(v6, nil, 100) or mac if name and name ~= v6 then rv[#rv+1] = { v6, name } end end) return rv end end --- Returns conntrack information -- @return Table with the currently tracked IP connections function net.conntrack(callback) local connt = {} if fs.access("/proc/net/nf_conntrack", "r") then for line in io.lines("/proc/net/nf_conntrack") do line = line:match "^(.-( [^ =]+=).-)%2" local entry, flags = _parse_mixed_record(line, " +") if flags[6] ~= "TIME_WAIT" then entry.layer3 = flags[1] entry.layer4 = flags[3] for i=1, #entry do entry[i] = nil end if callback then callback(entry) else connt[#connt+1] = entry end end end elseif fs.access("/proc/net/ip_conntrack", "r") then for line in io.lines("/proc/net/ip_conntrack") do line = line:match "^(.-( [^ =]+=).-)%2" local entry, flags = _parse_mixed_record(line, " +") if flags[4] ~= "TIME_WAIT" then entry.layer3 = "ipv4" entry.layer4 = flags[1] for i=1, #entry do entry[i] = nil end if callback then callback(entry) else connt[#connt+1] = entry end end end else return nil end return connt end --- Determine the current IPv4 default route. If multiple default routes exist, -- return the one with the lowest metric. -- @return Table with the properties of the current default route. -- The following fields are defined: -- { "dest", "gateway", "metric", "refcount", "usecount", "irtt", -- "flags", "device" } function net.defaultroute() local route net.routes(function(rt) if rt.dest:prefix() == 0 and (not route or route.metric > rt.metric) then route = rt end end) return route end --- Determine the current IPv6 default route. If multiple default routes exist, -- return the one with the lowest metric. -- @return Table with the properties of the current default route. -- The following fields are defined: -- { "source", "dest", "nexthop", "metric", "refcount", "usecount", -- "flags", "device" } function net.defaultroute6() local route net.routes6(function(rt) if rt.dest:prefix() == 0 and rt.device ~= "lo" and (not route or route.metric > rt.metric) then route = rt end end) if not route then local global_unicast = luci.ip.IPv6("2000::/3") net.routes6(function(rt) if rt.dest:equal(global_unicast) and (not route or route.metric > rt.metric) then route = rt end end) end return route end --- Determine the names of available network interfaces. -- @return Table containing all current interface names function net.devices() local devs = {} for k, v in ipairs(nixio.getifaddrs()) do if v.family == "packet" then devs[#devs+1] = v.name end end return devs end --- Return information about available network interfaces. -- @return Table containing all current interface names and their information function net.deviceinfo() local devs = {} for k, v in ipairs(nixio.getifaddrs()) do if v.family == "packet" then local d = v.data d[1] = d.rx_bytes d[2] = d.rx_packets d[3] = d.rx_errors d[4] = d.rx_dropped d[5] = 0 d[6] = 0 d[7] = 0 d[8] = d.multicast d[9] = d.tx_bytes d[10] = d.tx_packets d[11] = d.tx_errors d[12] = d.tx_dropped d[13] = 0 d[14] = d.collisions d[15] = 0 d[16] = 0 devs[v.name] = d end end return devs end -- Determine the MAC address belonging to the given IP address. -- @param ip IPv4 address -- @return String containing the MAC address or nil if it cannot be found function net.ip4mac(ip) local mac = nil net.arptable(function(e) if e["IP address"] == ip then mac = e["HW address"] end end) return mac end --- Returns the current kernel routing table entries. -- @return Table of tables with properties of the corresponding routes. -- The following fields are defined for route entry tables: -- { "dest", "gateway", "metric", "refcount", "usecount", "irtt", -- "flags", "device" } function net.routes(callback) local routes = { } for line in io.lines("/proc/net/route") do local dev, dst_ip, gateway, flags, refcnt, usecnt, metric, dst_mask, mtu, win, irtt = line:match( "([^%s]+)\t([A-F0-9]+)\t([A-F0-9]+)\t([A-F0-9]+)\t" .. "(%d+)\t(%d+)\t(%d+)\t([A-F0-9]+)\t(%d+)\t(%d+)\t(%d+)" ) if dev then gateway = luci.ip.Hex( gateway, 32, luci.ip.FAMILY_INET4 ) dst_mask = luci.ip.Hex( dst_mask, 32, luci.ip.FAMILY_INET4 ) dst_ip = luci.ip.Hex( dst_ip, dst_mask:prefix(dst_mask), luci.ip.FAMILY_INET4 ) local rt = { dest = dst_ip, gateway = gateway, metric = tonumber(metric), refcount = tonumber(refcnt), usecount = tonumber(usecnt), mtu = tonumber(mtu), window = tonumber(window), irtt = tonumber(irtt), flags = tonumber(flags, 16), device = dev } if callback then callback(rt) else routes[#routes+1] = rt end end end return routes end --- Returns the current ipv6 kernel routing table entries. -- @return Table of tables with properties of the corresponding routes. -- The following fields are defined for route entry tables: -- { "source", "dest", "nexthop", "metric", "refcount", "usecount", -- "flags", "device" } function net.routes6(callback) if fs.access("/proc/net/ipv6_route", "r") then local routes = { } for line in io.lines("/proc/net/ipv6_route") do local dst_ip, dst_prefix, src_ip, src_prefix, nexthop, metric, refcnt, usecnt, flags, dev = line:match( "([a-f0-9]+) ([a-f0-9]+) " .. "([a-f0-9]+) ([a-f0-9]+) " .. "([a-f0-9]+) ([a-f0-9]+) " .. "([a-f0-9]+) ([a-f0-9]+) " .. "([a-f0-9]+) +([^%s]+)" ) if dst_ip and dst_prefix and src_ip and src_prefix and nexthop and metric and refcnt and usecnt and flags and dev then src_ip = luci.ip.Hex( src_ip, tonumber(src_prefix, 16), luci.ip.FAMILY_INET6, false ) dst_ip = luci.ip.Hex( dst_ip, tonumber(dst_prefix, 16), luci.ip.FAMILY_INET6, false ) nexthop = luci.ip.Hex( nexthop, 128, luci.ip.FAMILY_INET6, false ) local rt = { source = src_ip, dest = dst_ip, nexthop = nexthop, metric = tonumber(metric, 16), refcount = tonumber(refcnt, 16), usecount = tonumber(usecnt, 16), flags = tonumber(flags, 16), device = dev, -- lua number is too small for storing the metric -- add a metric_raw field with the original content metric_raw = metric } if callback then callback(rt) else routes[#routes+1] = rt end end end return routes end end --- Tests whether the given host responds to ping probes. -- @param host String containing a hostname or IPv4 address -- @return Number containing 0 on success and >= 1 on error function net.pingtest(host) return os.execute("ping -c1 '"..host:gsub("'", '').."' >/dev/null 2>&1") end --- LuCI system utilities / process related functions. -- @class module -- @name luci.sys.process process = {} --- Get the current process id. -- @class function -- @name process.info -- @return Number containing the current pid function process.info(key) local s = {uid = nixio.getuid(), gid = nixio.getgid()} return not key and s or s[key] end --- Retrieve information about currently running processes. -- @return Table containing process information function process.list() local data = {} local k local ps = luci.util.execi("/bin/busybox top -bn1") if not ps then return end for line in ps do local pid, ppid, user, stat, vsz, mem, cpu, cmd = line:match( "^ *(%d+) +(%d+) +(%S.-%S) +([RSDZTW][W ][<N ]) +(%d+) +(%d+%%) +(%d+%%) +(.+)" ) local idx = tonumber(pid) if idx then data[idx] = { ['PID'] = pid, ['PPID'] = ppid, ['USER'] = user, ['STAT'] = stat, ['VSZ'] = vsz, ['%MEM'] = mem, ['%CPU'] = cpu, ['COMMAND'] = cmd } end end return data end --- Set the gid of a process identified by given pid. -- @param gid Number containing the Unix group id -- @return Boolean indicating successful operation -- @return String containing the error message if failed -- @return Number containing the error code if failed function process.setgroup(gid) return nixio.setgid(gid) end --- Set the uid of a process identified by given pid. -- @param uid Number containing the Unix user id -- @return Boolean indicating successful operation -- @return String containing the error message if failed -- @return Number containing the error code if failed function process.setuser(uid) return nixio.setuid(uid) end --- Send a signal to a process identified by given pid. -- @class function -- @name process.signal -- @param pid Number containing the process id -- @param sig Signal to send (default: 15 [SIGTERM]) -- @return Boolean indicating successful operation -- @return Number containing the error code if failed process.signal = nixio.kill --- LuCI system utilities / user related functions. -- @class module -- @name luci.sys.user user = {} --- Retrieve user informations for given uid. -- @class function -- @name getuser -- @param uid Number containing the Unix user id -- @return Table containing the following fields: -- { "uid", "gid", "name", "passwd", "dir", "shell", "gecos" } user.getuser = nixio.getpw --- Retrieve the current user password hash. -- @param username String containing the username to retrieve the password for -- @return String containing the hash or nil if no password is set. -- @return Password database entry function user.getpasswd(username) local pwe = nixio.getsp and nixio.getsp(username) or nixio.getpw(username) local pwh = pwe and (pwe.pwdp or pwe.passwd) if not pwh or #pwh < 1 or pwh == "!" or pwh == "x" then return nil, pwe else return pwh, pwe end end --- Test whether given string matches the password of a given system user. -- @param username String containing the Unix user name -- @param pass String containing the password to compare -- @return Boolean indicating wheather the passwords are equal function user.checkpasswd(username, pass) local pwh, pwe = user.getpasswd(username) if pwe then return (pwh == nil or nixio.crypt(pass, pwh) == pwh) end return false end --- Change the password of given user. -- @param username String containing the Unix user name -- @param password String containing the password to compare -- @return Number containing 0 on success and >= 1 on error function user.setpasswd(username, password) if password then password = password:gsub("'", [['"'"']]) end if username then username = username:gsub("'", [['"'"']]) end return os.execute( "(echo '" .. password .. "'; sleep 1; echo '" .. password .. "') | " .. "passwd '" .. username .. "' >/dev/null 2>&1" ) end --- LuCI system utilities / wifi related functions. -- @class module -- @name luci.sys.wifi wifi = {} --- Get wireless information for given interface. -- @param ifname String containing the interface name -- @return A wrapped iwinfo object instance function wifi.getiwinfo(ifname) local stat, iwinfo = pcall(require, "iwinfo") if ifname then local c = 0 local u = uci.cursor_state() local d, n = ifname:match("^(%w+)%.network(%d+)") if d and n then ifname = d n = tonumber(n) u:foreach("wireless", "wifi-iface", function(s) if s.device == d then c = c + 1 if c == n then ifname = s.ifname or s.device return false end end end) elseif u:get("wireless", ifname) == "wifi-device" then u:foreach("wireless", "wifi-iface", function(s) if s.device == ifname and s.ifname then ifname = s.ifname return false end end) end local t = stat and iwinfo.type(ifname) local x = t and iwinfo[t] or { } return setmetatable({}, { __index = function(t, k) if k == "ifname" then return ifname elseif x[k] then return x[k](ifname) end end }) end end --- LuCI system utilities / init related functions. -- @class module -- @name luci.sys.init init = {} init.dir = "/etc/init.d/" --- Get the names of all installed init scripts -- @return Table containing the names of all inistalled init scripts function init.names() local names = { } for name in fs.glob(init.dir.."*") do names[#names+1] = fs.basename(name) end return names end --- Get the index of he given init script -- @param name Name of the init script -- @return Numeric index value function init.index(name) if fs.access(init.dir..name) then return call("env -i sh -c 'source %s%s enabled; exit ${START:-255}' >/dev/null" %{ init.dir, name }) end end local function init_action(action, name) if fs.access(init.dir..name) then return call("env -i %s%s %s >/dev/null" %{ init.dir, name, action }) end end --- Test whether the given init script is enabled -- @param name Name of the init script -- @return Boolean indicating whether init is enabled function init.enabled(name) return (init_action("enabled", name) == 0) end --- Enable the given init script -- @param name Name of the init script -- @return Boolean indicating success function init.enable(name) return (init_action("enable", name) == 1) end --- Disable the given init script -- @param name Name of the init script -- @return Boolean indicating success function init.disable(name) return (init_action("disable", name) == 0) end --- Start the given init script -- @param name Name of the init script -- @return Boolean indicating success function init.start(name) return (init_action("start", name) == 0) end --- Stop the given init script -- @param name Name of the init script -- @return Boolean indicating success function init.stop(name) return (init_action("stop", name) == 0) end -- Internal functions function _parse_mixed_record(cnt, delimiter) delimiter = delimiter or " " local data = {} local flags = {} for i, l in pairs(luci.util.split(luci.util.trim(cnt), "\n")) do for j, f in pairs(luci.util.split(luci.util.trim(l), delimiter, nil, true)) do local k, x, v = f:match('([^%s][^:=]*) *([:=]*) *"*([^\n"]*)"*') if k then if x == "" then table.insert(flags, k) else data[k] = v end end end end return data, flags end
gpl-2.0
samihacker01616/x
plugins/xy.lua
2
1143
do local function run(msg, matches) local bot_id = 212833120 local x = 212833120 local y = 207248520 local z = 125871286 local w = 189716959 if matches[1] == 'bye' and is_admin(msg) or msg.action.type == "chat_add_user" and msg.action.user.id == tonumber(bot_id) and not is_sudo(msg) then chat_del_user("chat#id"..msg.to.id, 'user#id'..bot_id, ok_cb, false) elseif msg.action.type == "chat_del_user" and msg.action.user.id == tonumber(x) then chat_add_user("chat#id"..msg.to.id, 'user#id'..x, ok_cb, false) end elseif msg.action.type == "chat_del_user" and msg.action.user.id == tonumber(y) then chat_add_user("chat#id"..msg.to.id, 'user#id'..y, ok_cb, false) end elseif msg.action.type == "chat_del_user" and msg.action.user.id == tonumber(z) then chat_add_user("chat#id"..msg.to.id, 'user#id'..z, ok_cb, false) end elseif msg.action.type == "chat_del_user" and msg.action.user.id == tonumber(w) then chat_add_user("chat#id"..msg.to.id, 'user#id'..w, ok_cb, false) end end return { patterns = { "^[!/](bye)$", "^!!tgservice (.+)$", }, run = run } end
gpl-2.0
jpcy/bgfx
scripts/texturev.lua
2
3279
project ("texturev") uuid (os.uuid("texturev") ) kind "ConsoleApp" configuration {} includedirs { path.join(BX_DIR, "include"), path.join(BIMG_DIR, "include"), path.join(BGFX_DIR, "include"), path.join(BGFX_DIR, "3rdparty"), path.join(BGFX_DIR, "examples/common"), path.join(MODULE_DIR, "include"), path.join(MODULE_DIR, "3rdparty"), } files { path.join(MODULE_DIR, "tools/texturev/**"), } links { "example-common", "bimg_decode", "bimg", "bgfx", "bx", } if _OPTIONS["with-sdl"] then defines { "ENTRY_CONFIG_USE_SDL=1" } links { "SDL2" } configuration { "x32", "windows" } libdirs { "$(SDL2_DIR)/lib/x86" } configuration { "x64", "windows" } libdirs { "$(SDL2_DIR)/lib/x64" } configuration {} end if _OPTIONS["with-glfw"] then defines { "ENTRY_CONFIG_USE_GLFW=1" } links { "glfw3" } configuration { "linux or freebsd" } links { "Xrandr", "Xinerama", "Xi", "Xxf86vm", "Xcursor", } configuration { "osx" } linkoptions { "-framework CoreVideo", "-framework IOKit", } configuration {} end configuration { "vs*" } linkoptions { "/ignore:4199", -- LNK4199: /DELAYLOAD:*.dll ignored; no imports found from *.dll } links { -- this is needed only for testing with GLES2/3 on Windows with VS2008 "DelayImp", } configuration { "vs201*" } linkoptions { -- this is needed only for testing with GLES2/3 on Windows with VS201x "/DELAYLOAD:\"libEGL.dll\"", "/DELAYLOAD:\"libGLESv2.dll\"", } configuration { "mingw-*" } targetextension ".exe" configuration { "vs20* or mingw*" } links { "comdlg32", "gdi32", "psapi", } configuration { "winstore*" } removelinks { "DelayImp", "gdi32", "psapi" } links { "d3d11", "d3d12", "dxgi" } linkoptions { "/ignore:4264" -- LNK4264: archiving object file compiled with /ZW into a static library; note that when authoring Windows Runtime types it is not recommended to link with a static library that contains Windows Runtime metadata } -- WinRT targets need their own output directories are build files stomp over each other targetdir (path.join(BGFX_BUILD_DIR, "arm_" .. _ACTION, "bin", _name)) objdir (path.join(BGFX_BUILD_DIR, "arm_" .. _ACTION, "obj", _name)) configuration { "mingw-clang" } kind "ConsoleApp" configuration { "android*" } kind "ConsoleApp" targetextension ".so" linkoptions { "-shared", } links { "EGL", "GLESv2", } configuration { "wasm*" } kind "ConsoleApp" configuration { "linux-* or freebsd" } links { "X11", "GL", "pthread", } configuration { "rpi" } links { "X11", "GLESv2", "EGL", "bcm_host", "vcos", "vchiq_arm", "pthread", } configuration { "osx" } linkoptions { "-framework Cocoa", "-framework Metal", "-framework QuartzCore", "-framework OpenGL", } configuration { "ios*" } kind "ConsoleApp" linkoptions { "-framework CoreFoundation", "-framework Foundation", "-framework OpenGLES", "-framework UIKit", "-framework QuartzCore", } configuration { "xcode*", "ios" } kind "WindowedApp" configuration { "qnx*" } targetextension "" links { "EGL", "GLESv2", } configuration {} strip()
bsd-2-clause
virus322/selfbot
libs/JSON.lua
3765
34843
-- -*- coding: utf-8 -*- -- -- Simple JSON encoding and decoding in pure Lua. -- -- Copyright 2010-2014 Jeffrey Friedl -- http://regex.info/blog/ -- -- Latest version: http://regex.info/blog/lua/json -- -- This code is released under a Creative Commons CC-BY "Attribution" License: -- http://creativecommons.org/licenses/by/3.0/deed.en_US -- -- It can be used for any purpose so long as the copyright notice above, -- the web-page links above, and the 'AUTHOR_NOTE' string below are -- maintained. Enjoy. -- local VERSION = 20141223.14 -- version history at end of file local AUTHOR_NOTE = "-[ JSON.lua package by Jeffrey Friedl (http://regex.info/blog/lua/json) version 20141223.14 ]-" -- -- The 'AUTHOR_NOTE' variable exists so that information about the source -- of the package is maintained even in compiled versions. It's also -- included in OBJDEF below mostly to quiet warnings about unused variables. -- local OBJDEF = { VERSION = VERSION, AUTHOR_NOTE = AUTHOR_NOTE, } -- -- Simple JSON encoding and decoding in pure Lua. -- http://www.json.org/ -- -- -- JSON = assert(loadfile "JSON.lua")() -- one-time load of the routines -- -- local lua_value = JSON:decode(raw_json_text) -- -- local raw_json_text = JSON:encode(lua_table_or_value) -- local pretty_json_text = JSON:encode_pretty(lua_table_or_value) -- "pretty printed" version for human readability -- -- -- -- DECODING (from a JSON string to a Lua table) -- -- -- JSON = assert(loadfile "JSON.lua")() -- one-time load of the routines -- -- local lua_value = JSON:decode(raw_json_text) -- -- If the JSON text is for an object or an array, e.g. -- { "what": "books", "count": 3 } -- or -- [ "Larry", "Curly", "Moe" ] -- -- the result is a Lua table, e.g. -- { what = "books", count = 3 } -- or -- { "Larry", "Curly", "Moe" } -- -- -- The encode and decode routines accept an optional second argument, -- "etc", which is not used during encoding or decoding, but upon error -- is passed along to error handlers. It can be of any type (including nil). -- -- -- -- ERROR HANDLING -- -- With most errors during decoding, this code calls -- -- JSON:onDecodeError(message, text, location, etc) -- -- with a message about the error, and if known, the JSON text being -- parsed and the byte count where the problem was discovered. You can -- replace the default JSON:onDecodeError() with your own function. -- -- The default onDecodeError() merely augments the message with data -- about the text and the location if known (and if a second 'etc' -- argument had been provided to decode(), its value is tacked onto the -- message as well), and then calls JSON.assert(), which itself defaults -- to Lua's built-in assert(), and can also be overridden. -- -- For example, in an Adobe Lightroom plugin, you might use something like -- -- function JSON:onDecodeError(message, text, location, etc) -- LrErrors.throwUserError("Internal Error: invalid JSON data") -- end -- -- or even just -- -- function JSON.assert(message) -- LrErrors.throwUserError("Internal Error: " .. message) -- end -- -- If JSON:decode() is passed a nil, this is called instead: -- -- JSON:onDecodeOfNilError(message, nil, nil, etc) -- -- and if JSON:decode() is passed HTML instead of JSON, this is called: -- -- JSON:onDecodeOfHTMLError(message, text, nil, etc) -- -- The use of the fourth 'etc' argument allows stronger coordination -- between decoding and error reporting, especially when you provide your -- own error-handling routines. Continuing with the the Adobe Lightroom -- plugin example: -- -- function JSON:onDecodeError(message, text, location, etc) -- local note = "Internal Error: invalid JSON data" -- if type(etc) = 'table' and etc.photo then -- note = note .. " while processing for " .. etc.photo:getFormattedMetadata('fileName') -- end -- LrErrors.throwUserError(note) -- end -- -- : -- : -- -- for i, photo in ipairs(photosToProcess) do -- : -- : -- local data = JSON:decode(someJsonText, { photo = photo }) -- : -- : -- end -- -- -- -- -- -- DECODING AND STRICT TYPES -- -- Because both JSON objects and JSON arrays are converted to Lua tables, -- it's not normally possible to tell which original JSON type a -- particular Lua table was derived from, or guarantee decode-encode -- round-trip equivalency. -- -- However, if you enable strictTypes, e.g. -- -- JSON = assert(loadfile "JSON.lua")() --load the routines -- JSON.strictTypes = true -- -- then the Lua table resulting from the decoding of a JSON object or -- JSON array is marked via Lua metatable, so that when re-encoded with -- JSON:encode() it ends up as the appropriate JSON type. -- -- (This is not the default because other routines may not work well with -- tables that have a metatable set, for example, Lightroom API calls.) -- -- -- ENCODING (from a lua table to a JSON string) -- -- JSON = assert(loadfile "JSON.lua")() -- one-time load of the routines -- -- local raw_json_text = JSON:encode(lua_table_or_value) -- local pretty_json_text = JSON:encode_pretty(lua_table_or_value) -- "pretty printed" version for human readability -- local custom_pretty = JSON:encode(lua_table_or_value, etc, { pretty = true, indent = "| ", align_keys = false }) -- -- On error during encoding, this code calls: -- -- JSON:onEncodeError(message, etc) -- -- which you can override in your local JSON object. -- -- The 'etc' in the error call is the second argument to encode() -- and encode_pretty(), or nil if it wasn't provided. -- -- -- PRETTY-PRINTING -- -- An optional third argument, a table of options, allows a bit of -- configuration about how the encoding takes place: -- -- pretty = JSON:encode(val, etc, { -- pretty = true, -- if false, no other options matter -- indent = " ", -- this provides for a three-space indent per nesting level -- align_keys = false, -- see below -- }) -- -- encode() and encode_pretty() are identical except that encode_pretty() -- provides a default options table if none given in the call: -- -- { pretty = true, align_keys = false, indent = " " } -- -- For example, if -- -- JSON:encode(data) -- -- produces: -- -- {"city":"Kyoto","climate":{"avg_temp":16,"humidity":"high","snowfall":"minimal"},"country":"Japan","wards":11} -- -- then -- -- JSON:encode_pretty(data) -- -- produces: -- -- { -- "city": "Kyoto", -- "climate": { -- "avg_temp": 16, -- "humidity": "high", -- "snowfall": "minimal" -- }, -- "country": "Japan", -- "wards": 11 -- } -- -- The following three lines return identical results: -- JSON:encode_pretty(data) -- JSON:encode_pretty(data, nil, { pretty = true, align_keys = false, indent = " " }) -- JSON:encode (data, nil, { pretty = true, align_keys = false, indent = " " }) -- -- An example of setting your own indent string: -- -- JSON:encode_pretty(data, nil, { pretty = true, indent = "| " }) -- -- produces: -- -- { -- | "city": "Kyoto", -- | "climate": { -- | | "avg_temp": 16, -- | | "humidity": "high", -- | | "snowfall": "minimal" -- | }, -- | "country": "Japan", -- | "wards": 11 -- } -- -- An example of setting align_keys to true: -- -- JSON:encode_pretty(data, nil, { pretty = true, indent = " ", align_keys = true }) -- -- produces: -- -- { -- "city": "Kyoto", -- "climate": { -- "avg_temp": 16, -- "humidity": "high", -- "snowfall": "minimal" -- }, -- "country": "Japan", -- "wards": 11 -- } -- -- which I must admit is kinda ugly, sorry. This was the default for -- encode_pretty() prior to version 20141223.14. -- -- -- AMBIGUOUS SITUATIONS DURING THE ENCODING -- -- During the encode, if a Lua table being encoded contains both string -- and numeric keys, it fits neither JSON's idea of an object, nor its -- idea of an array. To get around this, when any string key exists (or -- when non-positive numeric keys exist), numeric keys are converted to -- strings. -- -- For example, -- JSON:encode({ "one", "two", "three", SOMESTRING = "some string" })) -- produces the JSON object -- {"1":"one","2":"two","3":"three","SOMESTRING":"some string"} -- -- To prohibit this conversion and instead make it an error condition, set -- JSON.noKeyConversion = true -- -- -- SUMMARY OF METHODS YOU CAN OVERRIDE IN YOUR LOCAL LUA JSON OBJECT -- -- assert -- onDecodeError -- onDecodeOfNilError -- onDecodeOfHTMLError -- onEncodeError -- -- If you want to create a separate Lua JSON object with its own error handlers, -- you can reload JSON.lua or use the :new() method. -- --------------------------------------------------------------------------- local default_pretty_indent = " " local default_pretty_options = { pretty = true, align_keys = false, indent = default_pretty_indent } local isArray = { __tostring = function() return "JSON array" end } isArray.__index = isArray local isObject = { __tostring = function() return "JSON object" end } isObject.__index = isObject function OBJDEF:newArray(tbl) return setmetatable(tbl or {}, isArray) end function OBJDEF:newObject(tbl) return setmetatable(tbl or {}, isObject) end local function unicode_codepoint_as_utf8(codepoint) -- -- codepoint is a number -- if codepoint <= 127 then return string.char(codepoint) elseif codepoint <= 2047 then -- -- 110yyyxx 10xxxxxx <-- useful notation from http://en.wikipedia.org/wiki/Utf8 -- local highpart = math.floor(codepoint / 0x40) local lowpart = codepoint - (0x40 * highpart) return string.char(0xC0 + highpart, 0x80 + lowpart) elseif codepoint <= 65535 then -- -- 1110yyyy 10yyyyxx 10xxxxxx -- local highpart = math.floor(codepoint / 0x1000) local remainder = codepoint - 0x1000 * highpart local midpart = math.floor(remainder / 0x40) local lowpart = remainder - 0x40 * midpart highpart = 0xE0 + highpart midpart = 0x80 + midpart lowpart = 0x80 + lowpart -- -- Check for an invalid character (thanks Andy R. at Adobe). -- See table 3.7, page 93, in http://www.unicode.org/versions/Unicode5.2.0/ch03.pdf#G28070 -- if ( highpart == 0xE0 and midpart < 0xA0 ) or ( highpart == 0xED and midpart > 0x9F ) or ( highpart == 0xF0 and midpart < 0x90 ) or ( highpart == 0xF4 and midpart > 0x8F ) then return "?" else return string.char(highpart, midpart, lowpart) end else -- -- 11110zzz 10zzyyyy 10yyyyxx 10xxxxxx -- local highpart = math.floor(codepoint / 0x40000) local remainder = codepoint - 0x40000 * highpart local midA = math.floor(remainder / 0x1000) remainder = remainder - 0x1000 * midA local midB = math.floor(remainder / 0x40) local lowpart = remainder - 0x40 * midB return string.char(0xF0 + highpart, 0x80 + midA, 0x80 + midB, 0x80 + lowpart) end end function OBJDEF:onDecodeError(message, text, location, etc) if text then if location then message = string.format("%s at char %d of: %s", message, location, text) else message = string.format("%s: %s", message, text) end end if etc ~= nil then message = message .. " (" .. OBJDEF:encode(etc) .. ")" end if self.assert then self.assert(false, message) else assert(false, message) end end OBJDEF.onDecodeOfNilError = OBJDEF.onDecodeError OBJDEF.onDecodeOfHTMLError = OBJDEF.onDecodeError function OBJDEF:onEncodeError(message, etc) if etc ~= nil then message = message .. " (" .. OBJDEF:encode(etc) .. ")" end if self.assert then self.assert(false, message) else assert(false, message) end end local function grok_number(self, text, start, etc) -- -- Grab the integer part -- local integer_part = text:match('^-?[1-9]%d*', start) or text:match("^-?0", start) if not integer_part then self:onDecodeError("expected number", text, start, etc) end local i = start + integer_part:len() -- -- Grab an optional decimal part -- local decimal_part = text:match('^%.%d+', i) or "" i = i + decimal_part:len() -- -- Grab an optional exponential part -- local exponent_part = text:match('^[eE][-+]?%d+', i) or "" i = i + exponent_part:len() local full_number_text = integer_part .. decimal_part .. exponent_part local as_number = tonumber(full_number_text) if not as_number then self:onDecodeError("bad number", text, start, etc) end return as_number, i end local function grok_string(self, text, start, etc) if text:sub(start,start) ~= '"' then self:onDecodeError("expected string's opening quote", text, start, etc) end local i = start + 1 -- +1 to bypass the initial quote local text_len = text:len() local VALUE = "" while i <= text_len do local c = text:sub(i,i) if c == '"' then return VALUE, i + 1 end if c ~= '\\' then VALUE = VALUE .. c i = i + 1 elseif text:match('^\\b', i) then VALUE = VALUE .. "\b" i = i + 2 elseif text:match('^\\f', i) then VALUE = VALUE .. "\f" i = i + 2 elseif text:match('^\\n', i) then VALUE = VALUE .. "\n" i = i + 2 elseif text:match('^\\r', i) then VALUE = VALUE .. "\r" i = i + 2 elseif text:match('^\\t', i) then VALUE = VALUE .. "\t" i = i + 2 else local hex = text:match('^\\u([0123456789aAbBcCdDeEfF][0123456789aAbBcCdDeEfF][0123456789aAbBcCdDeEfF][0123456789aAbBcCdDeEfF])', i) if hex then i = i + 6 -- bypass what we just read -- We have a Unicode codepoint. It could be standalone, or if in the proper range and -- followed by another in a specific range, it'll be a two-code surrogate pair. local codepoint = tonumber(hex, 16) if codepoint >= 0xD800 and codepoint <= 0xDBFF then -- it's a hi surrogate... see whether we have a following low local lo_surrogate = text:match('^\\u([dD][cdefCDEF][0123456789aAbBcCdDeEfF][0123456789aAbBcCdDeEfF])', i) if lo_surrogate then i = i + 6 -- bypass the low surrogate we just read codepoint = 0x2400 + (codepoint - 0xD800) * 0x400 + tonumber(lo_surrogate, 16) else -- not a proper low, so we'll just leave the first codepoint as is and spit it out. end end VALUE = VALUE .. unicode_codepoint_as_utf8(codepoint) else -- just pass through what's escaped VALUE = VALUE .. text:match('^\\(.)', i) i = i + 2 end end end self:onDecodeError("unclosed string", text, start, etc) end local function skip_whitespace(text, start) local _, match_end = text:find("^[ \n\r\t]+", start) -- [http://www.ietf.org/rfc/rfc4627.txt] Section 2 if match_end then return match_end + 1 else return start end end local grok_one -- assigned later local function grok_object(self, text, start, etc) if text:sub(start,start) ~= '{' then self:onDecodeError("expected '{'", text, start, etc) end local i = skip_whitespace(text, start + 1) -- +1 to skip the '{' local VALUE = self.strictTypes and self:newObject { } or { } if text:sub(i,i) == '}' then return VALUE, i + 1 end local text_len = text:len() while i <= text_len do local key, new_i = grok_string(self, text, i, etc) i = skip_whitespace(text, new_i) if text:sub(i, i) ~= ':' then self:onDecodeError("expected colon", text, i, etc) end i = skip_whitespace(text, i + 1) local new_val, new_i = grok_one(self, text, i) VALUE[key] = new_val -- -- Expect now either '}' to end things, or a ',' to allow us to continue. -- i = skip_whitespace(text, new_i) local c = text:sub(i,i) if c == '}' then return VALUE, i + 1 end if text:sub(i, i) ~= ',' then self:onDecodeError("expected comma or '}'", text, i, etc) end i = skip_whitespace(text, i + 1) end self:onDecodeError("unclosed '{'", text, start, etc) end local function grok_array(self, text, start, etc) if text:sub(start,start) ~= '[' then self:onDecodeError("expected '['", text, start, etc) end local i = skip_whitespace(text, start + 1) -- +1 to skip the '[' local VALUE = self.strictTypes and self:newArray { } or { } if text:sub(i,i) == ']' then return VALUE, i + 1 end local VALUE_INDEX = 1 local text_len = text:len() while i <= text_len do local val, new_i = grok_one(self, text, i) -- can't table.insert(VALUE, val) here because it's a no-op if val is nil VALUE[VALUE_INDEX] = val VALUE_INDEX = VALUE_INDEX + 1 i = skip_whitespace(text, new_i) -- -- Expect now either ']' to end things, or a ',' to allow us to continue. -- local c = text:sub(i,i) if c == ']' then return VALUE, i + 1 end if text:sub(i, i) ~= ',' then self:onDecodeError("expected comma or '['", text, i, etc) end i = skip_whitespace(text, i + 1) end self:onDecodeError("unclosed '['", text, start, etc) end grok_one = function(self, text, start, etc) -- Skip any whitespace start = skip_whitespace(text, start) if start > text:len() then self:onDecodeError("unexpected end of string", text, nil, etc) end if text:find('^"', start) then return grok_string(self, text, start, etc) elseif text:find('^[-0123456789 ]', start) then return grok_number(self, text, start, etc) elseif text:find('^%{', start) then return grok_object(self, text, start, etc) elseif text:find('^%[', start) then return grok_array(self, text, start, etc) elseif text:find('^true', start) then return true, start + 4 elseif text:find('^false', start) then return false, start + 5 elseif text:find('^null', start) then return nil, start + 4 else self:onDecodeError("can't parse JSON", text, start, etc) end end function OBJDEF:decode(text, etc) if type(self) ~= 'table' or self.__index ~= OBJDEF then OBJDEF:onDecodeError("JSON:decode must be called in method format", nil, nil, etc) end if text == nil then self:onDecodeOfNilError(string.format("nil passed to JSON:decode()"), nil, nil, etc) elseif type(text) ~= 'string' then self:onDecodeError(string.format("expected string argument to JSON:decode(), got %s", type(text)), nil, nil, etc) end if text:match('^%s*$') then return nil end if text:match('^%s*<') then -- Can't be JSON... we'll assume it's HTML self:onDecodeOfHTMLError(string.format("html passed to JSON:decode()"), text, nil, etc) end -- -- Ensure that it's not UTF-32 or UTF-16. -- Those are perfectly valid encodings for JSON (as per RFC 4627 section 3), -- but this package can't handle them. -- if text:sub(1,1):byte() == 0 or (text:len() >= 2 and text:sub(2,2):byte() == 0) then self:onDecodeError("JSON package groks only UTF-8, sorry", text, nil, etc) end local success, value = pcall(grok_one, self, text, 1, etc) if success then return value else -- if JSON:onDecodeError() didn't abort out of the pcall, we'll have received the error message here as "value", so pass it along as an assert. if self.assert then self.assert(false, value) else assert(false, value) end -- and if we're still here, return a nil and throw the error message on as a second arg return nil, value end end local function backslash_replacement_function(c) if c == "\n" then return "\\n" elseif c == "\r" then return "\\r" elseif c == "\t" then return "\\t" elseif c == "\b" then return "\\b" elseif c == "\f" then return "\\f" elseif c == '"' then return '\\"' elseif c == '\\' then return '\\\\' else return string.format("\\u%04x", c:byte()) end end local chars_to_be_escaped_in_JSON_string = '[' .. '"' -- class sub-pattern to match a double quote .. '%\\' -- class sub-pattern to match a backslash .. '%z' -- class sub-pattern to match a null .. '\001' .. '-' .. '\031' -- class sub-pattern to match control characters .. ']' local function json_string_literal(value) local newval = value:gsub(chars_to_be_escaped_in_JSON_string, backslash_replacement_function) return '"' .. newval .. '"' end local function object_or_array(self, T, etc) -- -- We need to inspect all the keys... if there are any strings, we'll convert to a JSON -- object. If there are only numbers, it's a JSON array. -- -- If we'll be converting to a JSON object, we'll want to sort the keys so that the -- end result is deterministic. -- local string_keys = { } local number_keys = { } local number_keys_must_be_strings = false local maximum_number_key for key in pairs(T) do if type(key) == 'string' then table.insert(string_keys, key) elseif type(key) == 'number' then table.insert(number_keys, key) if key <= 0 or key >= math.huge then number_keys_must_be_strings = true elseif not maximum_number_key or key > maximum_number_key then maximum_number_key = key end else self:onEncodeError("can't encode table with a key of type " .. type(key), etc) end end if #string_keys == 0 and not number_keys_must_be_strings then -- -- An empty table, or a numeric-only array -- if #number_keys > 0 then return nil, maximum_number_key -- an array elseif tostring(T) == "JSON array" then return nil elseif tostring(T) == "JSON object" then return { } else -- have to guess, so we'll pick array, since empty arrays are likely more common than empty objects return nil end end table.sort(string_keys) local map if #number_keys > 0 then -- -- If we're here then we have either mixed string/number keys, or numbers inappropriate for a JSON array -- It's not ideal, but we'll turn the numbers into strings so that we can at least create a JSON object. -- if self.noKeyConversion then self:onEncodeError("a table with both numeric and string keys could be an object or array; aborting", etc) end -- -- Have to make a shallow copy of the source table so we can remap the numeric keys to be strings -- map = { } for key, val in pairs(T) do map[key] = val end table.sort(number_keys) -- -- Throw numeric keys in there as strings -- for _, number_key in ipairs(number_keys) do local string_key = tostring(number_key) if map[string_key] == nil then table.insert(string_keys , string_key) map[string_key] = T[number_key] else self:onEncodeError("conflict converting table with mixed-type keys into a JSON object: key " .. number_key .. " exists both as a string and a number.", etc) end end end return string_keys, nil, map end -- -- Encode -- -- 'options' is nil, or a table with possible keys: -- pretty -- if true, return a pretty-printed version -- indent -- a string (usually of spaces) used to indent each nested level -- align_keys -- if true, align all the keys when formatting a table -- local encode_value -- must predeclare because it calls itself function encode_value(self, value, parents, etc, options, indent) if value == nil then return 'null' elseif type(value) == 'string' then return json_string_literal(value) elseif type(value) == 'number' then if value ~= value then -- -- NaN (Not a Number). -- JSON has no NaN, so we have to fudge the best we can. This should really be a package option. -- return "null" elseif value >= math.huge then -- -- Positive infinity. JSON has no INF, so we have to fudge the best we can. This should -- really be a package option. Note: at least with some implementations, positive infinity -- is both ">= math.huge" and "<= -math.huge", which makes no sense but that's how it is. -- Negative infinity is properly "<= -math.huge". So, we must be sure to check the ">=" -- case first. -- return "1e+9999" elseif value <= -math.huge then -- -- Negative infinity. -- JSON has no INF, so we have to fudge the best we can. This should really be a package option. -- return "-1e+9999" else return tostring(value) end elseif type(value) == 'boolean' then return tostring(value) elseif type(value) ~= 'table' then self:onEncodeError("can't convert " .. type(value) .. " to JSON", etc) else -- -- A table to be converted to either a JSON object or array. -- local T = value if type(options) ~= 'table' then options = {} end if type(indent) ~= 'string' then indent = "" end if parents[T] then self:onEncodeError("table " .. tostring(T) .. " is a child of itself", etc) else parents[T] = true end local result_value local object_keys, maximum_number_key, map = object_or_array(self, T, etc) if maximum_number_key then -- -- An array... -- local ITEMS = { } for i = 1, maximum_number_key do table.insert(ITEMS, encode_value(self, T[i], parents, etc, options, indent)) end if options.pretty then result_value = "[ " .. table.concat(ITEMS, ", ") .. " ]" else result_value = "[" .. table.concat(ITEMS, ",") .. "]" end elseif object_keys then -- -- An object -- local TT = map or T if options.pretty then local KEYS = { } local max_key_length = 0 for _, key in ipairs(object_keys) do local encoded = encode_value(self, tostring(key), parents, etc, options, indent) if options.align_keys then max_key_length = math.max(max_key_length, #encoded) end table.insert(KEYS, encoded) end local key_indent = indent .. tostring(options.indent or "") local subtable_indent = key_indent .. string.rep(" ", max_key_length) .. (options.align_keys and " " or "") local FORMAT = "%s%" .. string.format("%d", max_key_length) .. "s: %s" local COMBINED_PARTS = { } for i, key in ipairs(object_keys) do local encoded_val = encode_value(self, TT[key], parents, etc, options, subtable_indent) table.insert(COMBINED_PARTS, string.format(FORMAT, key_indent, KEYS[i], encoded_val)) end result_value = "{\n" .. table.concat(COMBINED_PARTS, ",\n") .. "\n" .. indent .. "}" else local PARTS = { } for _, key in ipairs(object_keys) do local encoded_val = encode_value(self, TT[key], parents, etc, options, indent) local encoded_key = encode_value(self, tostring(key), parents, etc, options, indent) table.insert(PARTS, string.format("%s:%s", encoded_key, encoded_val)) end result_value = "{" .. table.concat(PARTS, ",") .. "}" end else -- -- An empty array/object... we'll treat it as an array, though it should really be an option -- result_value = "[]" end parents[T] = false return result_value end end function OBJDEF:encode(value, etc, options) if type(self) ~= 'table' or self.__index ~= OBJDEF then OBJDEF:onEncodeError("JSON:encode must be called in method format", etc) end return encode_value(self, value, {}, etc, options or nil) end function OBJDEF:encode_pretty(value, etc, options) if type(self) ~= 'table' or self.__index ~= OBJDEF then OBJDEF:onEncodeError("JSON:encode_pretty must be called in method format", etc) end return encode_value(self, value, {}, etc, options or default_pretty_options) end function OBJDEF.__tostring() return "JSON encode/decode package" end OBJDEF.__index = OBJDEF function OBJDEF:new(args) local new = { } if args then for key, val in pairs(args) do new[key] = val end end return setmetatable(new, OBJDEF) end return OBJDEF:new() -- -- Version history: -- -- 20141223.14 The encode_pretty() routine produced fine results for small datasets, but isn't really -- appropriate for anything large, so with help from Alex Aulbach I've made the encode routines -- more flexible, and changed the default encode_pretty() to be more generally useful. -- -- Added a third 'options' argument to the encode() and encode_pretty() routines, to control -- how the encoding takes place. -- -- Updated docs to add assert() call to the loadfile() line, just as good practice so that -- if there is a problem loading JSON.lua, the appropriate error message will percolate up. -- -- 20140920.13 Put back (in a way that doesn't cause warnings about unused variables) the author string, -- so that the source of the package, and its version number, are visible in compiled copies. -- -- 20140911.12 Minor lua cleanup. -- Fixed internal reference to 'JSON.noKeyConversion' to reference 'self' instead of 'JSON'. -- (Thanks to SmugMug's David Parry for these.) -- -- 20140418.11 JSON nulls embedded within an array were being ignored, such that -- ["1",null,null,null,null,null,"seven"], -- would return -- {1,"seven"} -- It's now fixed to properly return -- {1, nil, nil, nil, nil, nil, "seven"} -- Thanks to "haddock" for catching the error. -- -- 20140116.10 The user's JSON.assert() wasn't always being used. Thanks to "blue" for the heads up. -- -- 20131118.9 Update for Lua 5.3... it seems that tostring(2/1) produces "2.0" instead of "2", -- and this caused some problems. -- -- 20131031.8 Unified the code for encode() and encode_pretty(); they had been stupidly separate, -- and had of course diverged (encode_pretty didn't get the fixes that encode got, so -- sometimes produced incorrect results; thanks to Mattie for the heads up). -- -- Handle encoding tables with non-positive numeric keys (unlikely, but possible). -- -- If a table has both numeric and string keys, or its numeric keys are inappropriate -- (such as being non-positive or infinite), the numeric keys are turned into -- string keys appropriate for a JSON object. So, as before, -- JSON:encode({ "one", "two", "three" }) -- produces the array -- ["one","two","three"] -- but now something with mixed key types like -- JSON:encode({ "one", "two", "three", SOMESTRING = "some string" })) -- instead of throwing an error produces an object: -- {"1":"one","2":"two","3":"three","SOMESTRING":"some string"} -- -- To maintain the prior throw-an-error semantics, set -- JSON.noKeyConversion = true -- -- 20131004.7 Release under a Creative Commons CC-BY license, which I should have done from day one, sorry. -- -- 20130120.6 Comment update: added a link to the specific page on my blog where this code can -- be found, so that folks who come across the code outside of my blog can find updates -- more easily. -- -- 20111207.5 Added support for the 'etc' arguments, for better error reporting. -- -- 20110731.4 More feedback from David Kolf on how to make the tests for Nan/Infinity system independent. -- -- 20110730.3 Incorporated feedback from David Kolf at http://lua-users.org/wiki/JsonModules: -- -- * When encoding lua for JSON, Sparse numeric arrays are now handled by -- spitting out full arrays, such that -- JSON:encode({"one", "two", [10] = "ten"}) -- returns -- ["one","two",null,null,null,null,null,null,null,"ten"] -- -- In 20100810.2 and earlier, only up to the first non-null value would have been retained. -- -- * When encoding lua for JSON, numeric value NaN gets spit out as null, and infinity as "1+e9999". -- Version 20100810.2 and earlier created invalid JSON in both cases. -- -- * Unicode surrogate pairs are now detected when decoding JSON. -- -- 20100810.2 added some checking to ensure that an invalid Unicode character couldn't leak in to the UTF-8 encoding -- -- 20100731.1 initial public release --
gpl-3.0
UniverseMelowdi/TheMelowdi
libs/JSON.lua
3765
34843
-- -*- coding: utf-8 -*- -- -- Simple JSON encoding and decoding in pure Lua. -- -- Copyright 2010-2014 Jeffrey Friedl -- http://regex.info/blog/ -- -- Latest version: http://regex.info/blog/lua/json -- -- This code is released under a Creative Commons CC-BY "Attribution" License: -- http://creativecommons.org/licenses/by/3.0/deed.en_US -- -- It can be used for any purpose so long as the copyright notice above, -- the web-page links above, and the 'AUTHOR_NOTE' string below are -- maintained. Enjoy. -- local VERSION = 20141223.14 -- version history at end of file local AUTHOR_NOTE = "-[ JSON.lua package by Jeffrey Friedl (http://regex.info/blog/lua/json) version 20141223.14 ]-" -- -- The 'AUTHOR_NOTE' variable exists so that information about the source -- of the package is maintained even in compiled versions. It's also -- included in OBJDEF below mostly to quiet warnings about unused variables. -- local OBJDEF = { VERSION = VERSION, AUTHOR_NOTE = AUTHOR_NOTE, } -- -- Simple JSON encoding and decoding in pure Lua. -- http://www.json.org/ -- -- -- JSON = assert(loadfile "JSON.lua")() -- one-time load of the routines -- -- local lua_value = JSON:decode(raw_json_text) -- -- local raw_json_text = JSON:encode(lua_table_or_value) -- local pretty_json_text = JSON:encode_pretty(lua_table_or_value) -- "pretty printed" version for human readability -- -- -- -- DECODING (from a JSON string to a Lua table) -- -- -- JSON = assert(loadfile "JSON.lua")() -- one-time load of the routines -- -- local lua_value = JSON:decode(raw_json_text) -- -- If the JSON text is for an object or an array, e.g. -- { "what": "books", "count": 3 } -- or -- [ "Larry", "Curly", "Moe" ] -- -- the result is a Lua table, e.g. -- { what = "books", count = 3 } -- or -- { "Larry", "Curly", "Moe" } -- -- -- The encode and decode routines accept an optional second argument, -- "etc", which is not used during encoding or decoding, but upon error -- is passed along to error handlers. It can be of any type (including nil). -- -- -- -- ERROR HANDLING -- -- With most errors during decoding, this code calls -- -- JSON:onDecodeError(message, text, location, etc) -- -- with a message about the error, and if known, the JSON text being -- parsed and the byte count where the problem was discovered. You can -- replace the default JSON:onDecodeError() with your own function. -- -- The default onDecodeError() merely augments the message with data -- about the text and the location if known (and if a second 'etc' -- argument had been provided to decode(), its value is tacked onto the -- message as well), and then calls JSON.assert(), which itself defaults -- to Lua's built-in assert(), and can also be overridden. -- -- For example, in an Adobe Lightroom plugin, you might use something like -- -- function JSON:onDecodeError(message, text, location, etc) -- LrErrors.throwUserError("Internal Error: invalid JSON data") -- end -- -- or even just -- -- function JSON.assert(message) -- LrErrors.throwUserError("Internal Error: " .. message) -- end -- -- If JSON:decode() is passed a nil, this is called instead: -- -- JSON:onDecodeOfNilError(message, nil, nil, etc) -- -- and if JSON:decode() is passed HTML instead of JSON, this is called: -- -- JSON:onDecodeOfHTMLError(message, text, nil, etc) -- -- The use of the fourth 'etc' argument allows stronger coordination -- between decoding and error reporting, especially when you provide your -- own error-handling routines. Continuing with the the Adobe Lightroom -- plugin example: -- -- function JSON:onDecodeError(message, text, location, etc) -- local note = "Internal Error: invalid JSON data" -- if type(etc) = 'table' and etc.photo then -- note = note .. " while processing for " .. etc.photo:getFormattedMetadata('fileName') -- end -- LrErrors.throwUserError(note) -- end -- -- : -- : -- -- for i, photo in ipairs(photosToProcess) do -- : -- : -- local data = JSON:decode(someJsonText, { photo = photo }) -- : -- : -- end -- -- -- -- -- -- DECODING AND STRICT TYPES -- -- Because both JSON objects and JSON arrays are converted to Lua tables, -- it's not normally possible to tell which original JSON type a -- particular Lua table was derived from, or guarantee decode-encode -- round-trip equivalency. -- -- However, if you enable strictTypes, e.g. -- -- JSON = assert(loadfile "JSON.lua")() --load the routines -- JSON.strictTypes = true -- -- then the Lua table resulting from the decoding of a JSON object or -- JSON array is marked via Lua metatable, so that when re-encoded with -- JSON:encode() it ends up as the appropriate JSON type. -- -- (This is not the default because other routines may not work well with -- tables that have a metatable set, for example, Lightroom API calls.) -- -- -- ENCODING (from a lua table to a JSON string) -- -- JSON = assert(loadfile "JSON.lua")() -- one-time load of the routines -- -- local raw_json_text = JSON:encode(lua_table_or_value) -- local pretty_json_text = JSON:encode_pretty(lua_table_or_value) -- "pretty printed" version for human readability -- local custom_pretty = JSON:encode(lua_table_or_value, etc, { pretty = true, indent = "| ", align_keys = false }) -- -- On error during encoding, this code calls: -- -- JSON:onEncodeError(message, etc) -- -- which you can override in your local JSON object. -- -- The 'etc' in the error call is the second argument to encode() -- and encode_pretty(), or nil if it wasn't provided. -- -- -- PRETTY-PRINTING -- -- An optional third argument, a table of options, allows a bit of -- configuration about how the encoding takes place: -- -- pretty = JSON:encode(val, etc, { -- pretty = true, -- if false, no other options matter -- indent = " ", -- this provides for a three-space indent per nesting level -- align_keys = false, -- see below -- }) -- -- encode() and encode_pretty() are identical except that encode_pretty() -- provides a default options table if none given in the call: -- -- { pretty = true, align_keys = false, indent = " " } -- -- For example, if -- -- JSON:encode(data) -- -- produces: -- -- {"city":"Kyoto","climate":{"avg_temp":16,"humidity":"high","snowfall":"minimal"},"country":"Japan","wards":11} -- -- then -- -- JSON:encode_pretty(data) -- -- produces: -- -- { -- "city": "Kyoto", -- "climate": { -- "avg_temp": 16, -- "humidity": "high", -- "snowfall": "minimal" -- }, -- "country": "Japan", -- "wards": 11 -- } -- -- The following three lines return identical results: -- JSON:encode_pretty(data) -- JSON:encode_pretty(data, nil, { pretty = true, align_keys = false, indent = " " }) -- JSON:encode (data, nil, { pretty = true, align_keys = false, indent = " " }) -- -- An example of setting your own indent string: -- -- JSON:encode_pretty(data, nil, { pretty = true, indent = "| " }) -- -- produces: -- -- { -- | "city": "Kyoto", -- | "climate": { -- | | "avg_temp": 16, -- | | "humidity": "high", -- | | "snowfall": "minimal" -- | }, -- | "country": "Japan", -- | "wards": 11 -- } -- -- An example of setting align_keys to true: -- -- JSON:encode_pretty(data, nil, { pretty = true, indent = " ", align_keys = true }) -- -- produces: -- -- { -- "city": "Kyoto", -- "climate": { -- "avg_temp": 16, -- "humidity": "high", -- "snowfall": "minimal" -- }, -- "country": "Japan", -- "wards": 11 -- } -- -- which I must admit is kinda ugly, sorry. This was the default for -- encode_pretty() prior to version 20141223.14. -- -- -- AMBIGUOUS SITUATIONS DURING THE ENCODING -- -- During the encode, if a Lua table being encoded contains both string -- and numeric keys, it fits neither JSON's idea of an object, nor its -- idea of an array. To get around this, when any string key exists (or -- when non-positive numeric keys exist), numeric keys are converted to -- strings. -- -- For example, -- JSON:encode({ "one", "two", "three", SOMESTRING = "some string" })) -- produces the JSON object -- {"1":"one","2":"two","3":"three","SOMESTRING":"some string"} -- -- To prohibit this conversion and instead make it an error condition, set -- JSON.noKeyConversion = true -- -- -- SUMMARY OF METHODS YOU CAN OVERRIDE IN YOUR LOCAL LUA JSON OBJECT -- -- assert -- onDecodeError -- onDecodeOfNilError -- onDecodeOfHTMLError -- onEncodeError -- -- If you want to create a separate Lua JSON object with its own error handlers, -- you can reload JSON.lua or use the :new() method. -- --------------------------------------------------------------------------- local default_pretty_indent = " " local default_pretty_options = { pretty = true, align_keys = false, indent = default_pretty_indent } local isArray = { __tostring = function() return "JSON array" end } isArray.__index = isArray local isObject = { __tostring = function() return "JSON object" end } isObject.__index = isObject function OBJDEF:newArray(tbl) return setmetatable(tbl or {}, isArray) end function OBJDEF:newObject(tbl) return setmetatable(tbl or {}, isObject) end local function unicode_codepoint_as_utf8(codepoint) -- -- codepoint is a number -- if codepoint <= 127 then return string.char(codepoint) elseif codepoint <= 2047 then -- -- 110yyyxx 10xxxxxx <-- useful notation from http://en.wikipedia.org/wiki/Utf8 -- local highpart = math.floor(codepoint / 0x40) local lowpart = codepoint - (0x40 * highpart) return string.char(0xC0 + highpart, 0x80 + lowpart) elseif codepoint <= 65535 then -- -- 1110yyyy 10yyyyxx 10xxxxxx -- local highpart = math.floor(codepoint / 0x1000) local remainder = codepoint - 0x1000 * highpart local midpart = math.floor(remainder / 0x40) local lowpart = remainder - 0x40 * midpart highpart = 0xE0 + highpart midpart = 0x80 + midpart lowpart = 0x80 + lowpart -- -- Check for an invalid character (thanks Andy R. at Adobe). -- See table 3.7, page 93, in http://www.unicode.org/versions/Unicode5.2.0/ch03.pdf#G28070 -- if ( highpart == 0xE0 and midpart < 0xA0 ) or ( highpart == 0xED and midpart > 0x9F ) or ( highpart == 0xF0 and midpart < 0x90 ) or ( highpart == 0xF4 and midpart > 0x8F ) then return "?" else return string.char(highpart, midpart, lowpart) end else -- -- 11110zzz 10zzyyyy 10yyyyxx 10xxxxxx -- local highpart = math.floor(codepoint / 0x40000) local remainder = codepoint - 0x40000 * highpart local midA = math.floor(remainder / 0x1000) remainder = remainder - 0x1000 * midA local midB = math.floor(remainder / 0x40) local lowpart = remainder - 0x40 * midB return string.char(0xF0 + highpart, 0x80 + midA, 0x80 + midB, 0x80 + lowpart) end end function OBJDEF:onDecodeError(message, text, location, etc) if text then if location then message = string.format("%s at char %d of: %s", message, location, text) else message = string.format("%s: %s", message, text) end end if etc ~= nil then message = message .. " (" .. OBJDEF:encode(etc) .. ")" end if self.assert then self.assert(false, message) else assert(false, message) end end OBJDEF.onDecodeOfNilError = OBJDEF.onDecodeError OBJDEF.onDecodeOfHTMLError = OBJDEF.onDecodeError function OBJDEF:onEncodeError(message, etc) if etc ~= nil then message = message .. " (" .. OBJDEF:encode(etc) .. ")" end if self.assert then self.assert(false, message) else assert(false, message) end end local function grok_number(self, text, start, etc) -- -- Grab the integer part -- local integer_part = text:match('^-?[1-9]%d*', start) or text:match("^-?0", start) if not integer_part then self:onDecodeError("expected number", text, start, etc) end local i = start + integer_part:len() -- -- Grab an optional decimal part -- local decimal_part = text:match('^%.%d+', i) or "" i = i + decimal_part:len() -- -- Grab an optional exponential part -- local exponent_part = text:match('^[eE][-+]?%d+', i) or "" i = i + exponent_part:len() local full_number_text = integer_part .. decimal_part .. exponent_part local as_number = tonumber(full_number_text) if not as_number then self:onDecodeError("bad number", text, start, etc) end return as_number, i end local function grok_string(self, text, start, etc) if text:sub(start,start) ~= '"' then self:onDecodeError("expected string's opening quote", text, start, etc) end local i = start + 1 -- +1 to bypass the initial quote local text_len = text:len() local VALUE = "" while i <= text_len do local c = text:sub(i,i) if c == '"' then return VALUE, i + 1 end if c ~= '\\' then VALUE = VALUE .. c i = i + 1 elseif text:match('^\\b', i) then VALUE = VALUE .. "\b" i = i + 2 elseif text:match('^\\f', i) then VALUE = VALUE .. "\f" i = i + 2 elseif text:match('^\\n', i) then VALUE = VALUE .. "\n" i = i + 2 elseif text:match('^\\r', i) then VALUE = VALUE .. "\r" i = i + 2 elseif text:match('^\\t', i) then VALUE = VALUE .. "\t" i = i + 2 else local hex = text:match('^\\u([0123456789aAbBcCdDeEfF][0123456789aAbBcCdDeEfF][0123456789aAbBcCdDeEfF][0123456789aAbBcCdDeEfF])', i) if hex then i = i + 6 -- bypass what we just read -- We have a Unicode codepoint. It could be standalone, or if in the proper range and -- followed by another in a specific range, it'll be a two-code surrogate pair. local codepoint = tonumber(hex, 16) if codepoint >= 0xD800 and codepoint <= 0xDBFF then -- it's a hi surrogate... see whether we have a following low local lo_surrogate = text:match('^\\u([dD][cdefCDEF][0123456789aAbBcCdDeEfF][0123456789aAbBcCdDeEfF])', i) if lo_surrogate then i = i + 6 -- bypass the low surrogate we just read codepoint = 0x2400 + (codepoint - 0xD800) * 0x400 + tonumber(lo_surrogate, 16) else -- not a proper low, so we'll just leave the first codepoint as is and spit it out. end end VALUE = VALUE .. unicode_codepoint_as_utf8(codepoint) else -- just pass through what's escaped VALUE = VALUE .. text:match('^\\(.)', i) i = i + 2 end end end self:onDecodeError("unclosed string", text, start, etc) end local function skip_whitespace(text, start) local _, match_end = text:find("^[ \n\r\t]+", start) -- [http://www.ietf.org/rfc/rfc4627.txt] Section 2 if match_end then return match_end + 1 else return start end end local grok_one -- assigned later local function grok_object(self, text, start, etc) if text:sub(start,start) ~= '{' then self:onDecodeError("expected '{'", text, start, etc) end local i = skip_whitespace(text, start + 1) -- +1 to skip the '{' local VALUE = self.strictTypes and self:newObject { } or { } if text:sub(i,i) == '}' then return VALUE, i + 1 end local text_len = text:len() while i <= text_len do local key, new_i = grok_string(self, text, i, etc) i = skip_whitespace(text, new_i) if text:sub(i, i) ~= ':' then self:onDecodeError("expected colon", text, i, etc) end i = skip_whitespace(text, i + 1) local new_val, new_i = grok_one(self, text, i) VALUE[key] = new_val -- -- Expect now either '}' to end things, or a ',' to allow us to continue. -- i = skip_whitespace(text, new_i) local c = text:sub(i,i) if c == '}' then return VALUE, i + 1 end if text:sub(i, i) ~= ',' then self:onDecodeError("expected comma or '}'", text, i, etc) end i = skip_whitespace(text, i + 1) end self:onDecodeError("unclosed '{'", text, start, etc) end local function grok_array(self, text, start, etc) if text:sub(start,start) ~= '[' then self:onDecodeError("expected '['", text, start, etc) end local i = skip_whitespace(text, start + 1) -- +1 to skip the '[' local VALUE = self.strictTypes and self:newArray { } or { } if text:sub(i,i) == ']' then return VALUE, i + 1 end local VALUE_INDEX = 1 local text_len = text:len() while i <= text_len do local val, new_i = grok_one(self, text, i) -- can't table.insert(VALUE, val) here because it's a no-op if val is nil VALUE[VALUE_INDEX] = val VALUE_INDEX = VALUE_INDEX + 1 i = skip_whitespace(text, new_i) -- -- Expect now either ']' to end things, or a ',' to allow us to continue. -- local c = text:sub(i,i) if c == ']' then return VALUE, i + 1 end if text:sub(i, i) ~= ',' then self:onDecodeError("expected comma or '['", text, i, etc) end i = skip_whitespace(text, i + 1) end self:onDecodeError("unclosed '['", text, start, etc) end grok_one = function(self, text, start, etc) -- Skip any whitespace start = skip_whitespace(text, start) if start > text:len() then self:onDecodeError("unexpected end of string", text, nil, etc) end if text:find('^"', start) then return grok_string(self, text, start, etc) elseif text:find('^[-0123456789 ]', start) then return grok_number(self, text, start, etc) elseif text:find('^%{', start) then return grok_object(self, text, start, etc) elseif text:find('^%[', start) then return grok_array(self, text, start, etc) elseif text:find('^true', start) then return true, start + 4 elseif text:find('^false', start) then return false, start + 5 elseif text:find('^null', start) then return nil, start + 4 else self:onDecodeError("can't parse JSON", text, start, etc) end end function OBJDEF:decode(text, etc) if type(self) ~= 'table' or self.__index ~= OBJDEF then OBJDEF:onDecodeError("JSON:decode must be called in method format", nil, nil, etc) end if text == nil then self:onDecodeOfNilError(string.format("nil passed to JSON:decode()"), nil, nil, etc) elseif type(text) ~= 'string' then self:onDecodeError(string.format("expected string argument to JSON:decode(), got %s", type(text)), nil, nil, etc) end if text:match('^%s*$') then return nil end if text:match('^%s*<') then -- Can't be JSON... we'll assume it's HTML self:onDecodeOfHTMLError(string.format("html passed to JSON:decode()"), text, nil, etc) end -- -- Ensure that it's not UTF-32 or UTF-16. -- Those are perfectly valid encodings for JSON (as per RFC 4627 section 3), -- but this package can't handle them. -- if text:sub(1,1):byte() == 0 or (text:len() >= 2 and text:sub(2,2):byte() == 0) then self:onDecodeError("JSON package groks only UTF-8, sorry", text, nil, etc) end local success, value = pcall(grok_one, self, text, 1, etc) if success then return value else -- if JSON:onDecodeError() didn't abort out of the pcall, we'll have received the error message here as "value", so pass it along as an assert. if self.assert then self.assert(false, value) else assert(false, value) end -- and if we're still here, return a nil and throw the error message on as a second arg return nil, value end end local function backslash_replacement_function(c) if c == "\n" then return "\\n" elseif c == "\r" then return "\\r" elseif c == "\t" then return "\\t" elseif c == "\b" then return "\\b" elseif c == "\f" then return "\\f" elseif c == '"' then return '\\"' elseif c == '\\' then return '\\\\' else return string.format("\\u%04x", c:byte()) end end local chars_to_be_escaped_in_JSON_string = '[' .. '"' -- class sub-pattern to match a double quote .. '%\\' -- class sub-pattern to match a backslash .. '%z' -- class sub-pattern to match a null .. '\001' .. '-' .. '\031' -- class sub-pattern to match control characters .. ']' local function json_string_literal(value) local newval = value:gsub(chars_to_be_escaped_in_JSON_string, backslash_replacement_function) return '"' .. newval .. '"' end local function object_or_array(self, T, etc) -- -- We need to inspect all the keys... if there are any strings, we'll convert to a JSON -- object. If there are only numbers, it's a JSON array. -- -- If we'll be converting to a JSON object, we'll want to sort the keys so that the -- end result is deterministic. -- local string_keys = { } local number_keys = { } local number_keys_must_be_strings = false local maximum_number_key for key in pairs(T) do if type(key) == 'string' then table.insert(string_keys, key) elseif type(key) == 'number' then table.insert(number_keys, key) if key <= 0 or key >= math.huge then number_keys_must_be_strings = true elseif not maximum_number_key or key > maximum_number_key then maximum_number_key = key end else self:onEncodeError("can't encode table with a key of type " .. type(key), etc) end end if #string_keys == 0 and not number_keys_must_be_strings then -- -- An empty table, or a numeric-only array -- if #number_keys > 0 then return nil, maximum_number_key -- an array elseif tostring(T) == "JSON array" then return nil elseif tostring(T) == "JSON object" then return { } else -- have to guess, so we'll pick array, since empty arrays are likely more common than empty objects return nil end end table.sort(string_keys) local map if #number_keys > 0 then -- -- If we're here then we have either mixed string/number keys, or numbers inappropriate for a JSON array -- It's not ideal, but we'll turn the numbers into strings so that we can at least create a JSON object. -- if self.noKeyConversion then self:onEncodeError("a table with both numeric and string keys could be an object or array; aborting", etc) end -- -- Have to make a shallow copy of the source table so we can remap the numeric keys to be strings -- map = { } for key, val in pairs(T) do map[key] = val end table.sort(number_keys) -- -- Throw numeric keys in there as strings -- for _, number_key in ipairs(number_keys) do local string_key = tostring(number_key) if map[string_key] == nil then table.insert(string_keys , string_key) map[string_key] = T[number_key] else self:onEncodeError("conflict converting table with mixed-type keys into a JSON object: key " .. number_key .. " exists both as a string and a number.", etc) end end end return string_keys, nil, map end -- -- Encode -- -- 'options' is nil, or a table with possible keys: -- pretty -- if true, return a pretty-printed version -- indent -- a string (usually of spaces) used to indent each nested level -- align_keys -- if true, align all the keys when formatting a table -- local encode_value -- must predeclare because it calls itself function encode_value(self, value, parents, etc, options, indent) if value == nil then return 'null' elseif type(value) == 'string' then return json_string_literal(value) elseif type(value) == 'number' then if value ~= value then -- -- NaN (Not a Number). -- JSON has no NaN, so we have to fudge the best we can. This should really be a package option. -- return "null" elseif value >= math.huge then -- -- Positive infinity. JSON has no INF, so we have to fudge the best we can. This should -- really be a package option. Note: at least with some implementations, positive infinity -- is both ">= math.huge" and "<= -math.huge", which makes no sense but that's how it is. -- Negative infinity is properly "<= -math.huge". So, we must be sure to check the ">=" -- case first. -- return "1e+9999" elseif value <= -math.huge then -- -- Negative infinity. -- JSON has no INF, so we have to fudge the best we can. This should really be a package option. -- return "-1e+9999" else return tostring(value) end elseif type(value) == 'boolean' then return tostring(value) elseif type(value) ~= 'table' then self:onEncodeError("can't convert " .. type(value) .. " to JSON", etc) else -- -- A table to be converted to either a JSON object or array. -- local T = value if type(options) ~= 'table' then options = {} end if type(indent) ~= 'string' then indent = "" end if parents[T] then self:onEncodeError("table " .. tostring(T) .. " is a child of itself", etc) else parents[T] = true end local result_value local object_keys, maximum_number_key, map = object_or_array(self, T, etc) if maximum_number_key then -- -- An array... -- local ITEMS = { } for i = 1, maximum_number_key do table.insert(ITEMS, encode_value(self, T[i], parents, etc, options, indent)) end if options.pretty then result_value = "[ " .. table.concat(ITEMS, ", ") .. " ]" else result_value = "[" .. table.concat(ITEMS, ",") .. "]" end elseif object_keys then -- -- An object -- local TT = map or T if options.pretty then local KEYS = { } local max_key_length = 0 for _, key in ipairs(object_keys) do local encoded = encode_value(self, tostring(key), parents, etc, options, indent) if options.align_keys then max_key_length = math.max(max_key_length, #encoded) end table.insert(KEYS, encoded) end local key_indent = indent .. tostring(options.indent or "") local subtable_indent = key_indent .. string.rep(" ", max_key_length) .. (options.align_keys and " " or "") local FORMAT = "%s%" .. string.format("%d", max_key_length) .. "s: %s" local COMBINED_PARTS = { } for i, key in ipairs(object_keys) do local encoded_val = encode_value(self, TT[key], parents, etc, options, subtable_indent) table.insert(COMBINED_PARTS, string.format(FORMAT, key_indent, KEYS[i], encoded_val)) end result_value = "{\n" .. table.concat(COMBINED_PARTS, ",\n") .. "\n" .. indent .. "}" else local PARTS = { } for _, key in ipairs(object_keys) do local encoded_val = encode_value(self, TT[key], parents, etc, options, indent) local encoded_key = encode_value(self, tostring(key), parents, etc, options, indent) table.insert(PARTS, string.format("%s:%s", encoded_key, encoded_val)) end result_value = "{" .. table.concat(PARTS, ",") .. "}" end else -- -- An empty array/object... we'll treat it as an array, though it should really be an option -- result_value = "[]" end parents[T] = false return result_value end end function OBJDEF:encode(value, etc, options) if type(self) ~= 'table' or self.__index ~= OBJDEF then OBJDEF:onEncodeError("JSON:encode must be called in method format", etc) end return encode_value(self, value, {}, etc, options or nil) end function OBJDEF:encode_pretty(value, etc, options) if type(self) ~= 'table' or self.__index ~= OBJDEF then OBJDEF:onEncodeError("JSON:encode_pretty must be called in method format", etc) end return encode_value(self, value, {}, etc, options or default_pretty_options) end function OBJDEF.__tostring() return "JSON encode/decode package" end OBJDEF.__index = OBJDEF function OBJDEF:new(args) local new = { } if args then for key, val in pairs(args) do new[key] = val end end return setmetatable(new, OBJDEF) end return OBJDEF:new() -- -- Version history: -- -- 20141223.14 The encode_pretty() routine produced fine results for small datasets, but isn't really -- appropriate for anything large, so with help from Alex Aulbach I've made the encode routines -- more flexible, and changed the default encode_pretty() to be more generally useful. -- -- Added a third 'options' argument to the encode() and encode_pretty() routines, to control -- how the encoding takes place. -- -- Updated docs to add assert() call to the loadfile() line, just as good practice so that -- if there is a problem loading JSON.lua, the appropriate error message will percolate up. -- -- 20140920.13 Put back (in a way that doesn't cause warnings about unused variables) the author string, -- so that the source of the package, and its version number, are visible in compiled copies. -- -- 20140911.12 Minor lua cleanup. -- Fixed internal reference to 'JSON.noKeyConversion' to reference 'self' instead of 'JSON'. -- (Thanks to SmugMug's David Parry for these.) -- -- 20140418.11 JSON nulls embedded within an array were being ignored, such that -- ["1",null,null,null,null,null,"seven"], -- would return -- {1,"seven"} -- It's now fixed to properly return -- {1, nil, nil, nil, nil, nil, "seven"} -- Thanks to "haddock" for catching the error. -- -- 20140116.10 The user's JSON.assert() wasn't always being used. Thanks to "blue" for the heads up. -- -- 20131118.9 Update for Lua 5.3... it seems that tostring(2/1) produces "2.0" instead of "2", -- and this caused some problems. -- -- 20131031.8 Unified the code for encode() and encode_pretty(); they had been stupidly separate, -- and had of course diverged (encode_pretty didn't get the fixes that encode got, so -- sometimes produced incorrect results; thanks to Mattie for the heads up). -- -- Handle encoding tables with non-positive numeric keys (unlikely, but possible). -- -- If a table has both numeric and string keys, or its numeric keys are inappropriate -- (such as being non-positive or infinite), the numeric keys are turned into -- string keys appropriate for a JSON object. So, as before, -- JSON:encode({ "one", "two", "three" }) -- produces the array -- ["one","two","three"] -- but now something with mixed key types like -- JSON:encode({ "one", "two", "three", SOMESTRING = "some string" })) -- instead of throwing an error produces an object: -- {"1":"one","2":"two","3":"three","SOMESTRING":"some string"} -- -- To maintain the prior throw-an-error semantics, set -- JSON.noKeyConversion = true -- -- 20131004.7 Release under a Creative Commons CC-BY license, which I should have done from day one, sorry. -- -- 20130120.6 Comment update: added a link to the specific page on my blog where this code can -- be found, so that folks who come across the code outside of my blog can find updates -- more easily. -- -- 20111207.5 Added support for the 'etc' arguments, for better error reporting. -- -- 20110731.4 More feedback from David Kolf on how to make the tests for Nan/Infinity system independent. -- -- 20110730.3 Incorporated feedback from David Kolf at http://lua-users.org/wiki/JsonModules: -- -- * When encoding lua for JSON, Sparse numeric arrays are now handled by -- spitting out full arrays, such that -- JSON:encode({"one", "two", [10] = "ten"}) -- returns -- ["one","two",null,null,null,null,null,null,null,"ten"] -- -- In 20100810.2 and earlier, only up to the first non-null value would have been retained. -- -- * When encoding lua for JSON, numeric value NaN gets spit out as null, and infinity as "1+e9999". -- Version 20100810.2 and earlier created invalid JSON in both cases. -- -- * Unicode surrogate pairs are now detected when decoding JSON. -- -- 20100810.2 added some checking to ensure that an invalid Unicode character couldn't leak in to the UTF-8 encoding -- -- 20100731.1 initial public release --
gpl-2.0
tiagosr/ld27-train
tiledloader/Grid.lua
6
6367
--------------------------------------------------------------------------------------------------- -- -= Grid =- --------------------------------------------------------------------------------------------------- local Grid = {class = "Grid"} Grid.__index = Grid --------------------------------------------------------------------------------------------------- -- Creates and returns a new grid function Grid:new() local grid = {} grid.cells = {} return setmetatable(grid, Grid) end --------------------------------------------------------------------------------------------------- -- Gets the value of a single cell function Grid:get(x,y) return self.cells[x] and self.cells[x][y] end --------------------------------------------------------------------------------------------------- -- Sets the value of a single cell function Grid:set(x,y,value) if not self.cells[x] then self.cells[x] = {} end self.cells[x][y] = value end --------------------------------------------------------------------------------------------------- -- Iterate over all values local x, y, row, val function Grid:iterate() x, y, row, val = nil, nil, nil, nil return function() repeat if not y then x, row = next(self.cells, x) if not row then return end end y, val = next(row, y) until y return x, y, val end end --------------------------------------------------------------------------------------------------- -- Iterate over a rectangle shape function Grid:rectangle(startX, startY, width, height, includeNil) local x, y = startX, startY return function() while y <= startY + height do while x <= startX + width do x = x+1 if self(x-1,y) ~= nil or includeNil then return x-1, y, self(x-1,y) end end x = startX y = y+1 end return nil end end --------------------------------------------------------------------------------------------------- -- Iterate over a line. Set noDiag to true to keep from traversing diagonally. function Grid:line(startX, startY, endX, endY, noDiag, includeNil) local dx = math.abs(endX - startX) local dy = math.abs(endY - startY) local x = startX local y = startY local incrX = endX > startX and 1 or -1 local incrY = endY > startY and 1 or -1 local err = dx - dy local err2 = err*2 local i = 1+dx+dy local rx,ry,rv local checkX = false return function() while i>0 do rx,ry,rv = x,y,self(x,y) err2 = err*2 while true do checkX = not checkX if checkX == true or not noDiag then if err2 > -dy then err = err - dy x = x + incrX i = i-1 if noDiag then break end end end if checkX == false or not noDiag then if err2 < dx then err = err + dx y = y + incrY i = i-1 if noDiag then break end end end if not noDiag then break end end if rx == endX and ry == endY then i = 0 end if rv ~= nil or includeNil then return rx,ry,rv end end return nil end end --------------------------------------------------------------------------------------------------- -- Iterates over a circle of cells function Grid:circle(cx, cy, r, includeNil) local x,y x = x or cx-r return function() repeat y = y == nil and cy or y <= cy and y-1 or y+1 while ((cx-x)*(cx-x)+(cy-y)*(cy-y)) >= r*r do if x > cx+r then return nil end x = x + (y < cy and 0 or 1) y = cy + (y < cy and 1 or 0) end until self(x,y) ~= nil or includeNil return x,y,self(x,y) end end --------------------------------------------------------------------------------------------------- -- Cleans the grid of empty rows. function Grid:clean() for key,row in pairs(self.cells) do if not next(row) then self.cells[key] = nil end end end --------------------------------------------------------------------------------------------------- -- Clears the grid function Grid:clear() self.cells = {} end --------------------------------------------------------------------------------------------------- -- This makes calling the grid as a function act like Grid.get. Grid.__call = Grid.get --------------------------------------------------------------------------------------------------- -- Returns the grid class return Grid -------------------------------------------------------------------------------------- -- Copyright (c) 2011-2012 Casey Baxter -- Permission is hereby granted, free of charge, to any person obtaining a copy -- of this software and associated documentation files (the "Software"), to deal -- in the Software without restriction, including without limitation the rights -- to use, copy, modify, merge, publish, distribute, sublicense, and/or sell -- copies of the Software, and to permit persons to whom the Software is -- furnished to do so, subject to the following conditions: -- The above copyright notice and this permission notice shall be included in -- all copies or substantial portions of the Software. -- Except as contained in this notice, the name(s) of the above copyright holders -- shall not be used in advertising or otherwise to promote the sale, use or -- other dealings in this Software without prior written authorization. -- THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR -- IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, -- FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE -- AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER -- LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, -- OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN -- THE SOFTWARE.
mit
bnetcc/darkstar
scripts/commands/wallhack.lua
1
1150
--------------------------------------------------------------------------------------------------- -- func: wallhack <optional target> -- desc: Allows the player to walk through walls. --------------------------------------------------------------------------------------------------- cmdprops = { permission = 0, parameters = "s" }; function error(player, msg) player:PrintToPlayer(msg); player:PrintToPlayer("!wallhack {player}"); end; function onTrigger(player, target) -- validate target local targ; if (target == nil) then targ = player; else targ = GetPlayerByName(target); if (targ == nil) then error(player, string.format("Player named '%s' not found!", target)); return; end end -- toggle wallhack for target if (targ:checkNameFlags(0x00000200)) then targ:setFlag(0x00000200); player:PrintToPlayer( string.format("Toggled %s's wallhack flag OFF.", targ:getName()) ); else targ:setFlag(0x00000200); player:PrintToPlayer( string.format("Toggled %s's wallhack flag ON.", targ:getName()) ); end end
gpl-3.0
dmccuskey/dmc-dragdrop
examples/dmc-dragdrop-oop/dmc_corona/lib/dmc_lua/lua_events_mix.lua
32
8316
--====================================================================-- -- dmc_lua/lua_events_mix.lua -- -- Documentation: http://docs.davidmccuskey.com/ --====================================================================-- --[[ The MIT License (MIT) Copyright (C) 2014-2015 David McCuskey. All Rights Reserved. Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. --]] --====================================================================-- --== DMC Lua Library : Lua Events Mixin --====================================================================-- -- Semantic Versioning Specification: http://semver.org/ local VERSION = "0.2.2" --====================================================================-- --== Setup, Constants local Events local Utils = {} -- make copying from Utils easier local assert = assert local sfmt = string.format local type = type --====================================================================-- --== Support Functions --== Start: copy from lua_utils ==-- function Utils.createObjectCallback( object, method ) assert( object ~= nil, "missing object in Utils.createObjectCallback" ) assert( method ~= nil, "missing method in Utils.createObjectCallback" ) --==-- return function( ... ) return method( object, ... ) end end --== End: copy from lua_utils ==-- -- callback is either function or object (table) -- creates listener lookup key given event name and handler -- local function _createEventListenerKey( e_name, handler ) return e_name .. "::" .. tostring( handler ) end -- return event unmodified -- local function _createCoronaEvent( obj, event ) return event end -- obj, -- event type, string -- data, anything -- params, table of params -- params.merge, boolean, if to merge data (table) in with event table -- local function _createDmcEvent( obj, e_type, data, params ) params = params or {} if params.merge==nil then params.merge=false end --==-- local e if params.merge and type( data )=='table' then e = data e.name = obj.EVENT e.type = e_type e.target = obj else e = { name=obj.EVENT, type=e_type, target=obj, data=data } end return e end local function _patch( obj ) obj = obj or {} -- add properties Events.__init__( obj ) if obj.EVENT==nil then obj.EVENT = Events.EVENT -- generic event name end -- add methods obj.dispatchEvent = Events.dispatchEvent obj.dispatchRawEvent = Events.dispatchRawEvent obj.addEventListener = Events.addEventListener obj.removeEventListener = Events.removeEventListener obj.setDebug = Events.setDebug obj.setEventFunc = Events.setEventFunc obj._dispatchEvent = Events._dispatchEvent return obj end --====================================================================-- --== Events Mixin --====================================================================-- Events = {} Events.EVENT = 'event_mix_event' --======================================================-- -- Start: Mixin Setup for Lua Objects function Events.__init__( self, params ) -- print( "Events.__init__" ) params = params or {} --==-- --[[ event listeners key'd by: * <event name>::<function> * <event name>::<object> { <event name> = { 'event::function' = func, 'event::object' = object (table) } } --]] self.__event_listeners = {} -- holds event listeners self.__debug_on = false self.__event_func = params.event_func or _createDmcEvent end function Events.__undoInit__( self ) -- print( "Events.__undoInit__" ) self.__event_listeners = nil self.__debug_on = nil self.__event_func = nil end -- END: Mixin Setup for Lua Objects --======================================================-- --====================================================================-- --== Public Methods function Events.createCallback( self, method ) return Utils.createObjectCallback( self, method ) end function Events.setDebug( self, value ) assert( type( value )=='boolean', "setDebug requires boolean" ) self.__debug_on = value end function Events.setEventFunc( self, func ) assert( func and type(func)=='function', 'setEventFunc requires function' ) self.__event_func = func end function Events.createEvent( self, ... ) return self.__event_func( self, ... ) end function Events.dispatchEvent( self, ... ) -- print( "Events.dispatchEvent" ) local f = self.__event_func self:_dispatchEvent( f( self, ... ) ) end function Events.dispatchRawEvent( self, event ) -- print( "Events.dispatchRawEvent", event ) assert( type( event )=='table', "wrong type for event" ) assert( event.name, "event must have property 'name'") --==-- self:_dispatchEvent( event ) end -- addEventListener() -- function Events.addEventListener( self, e_name, listener ) -- print( "Events.addEventListener", e_name, listener ) assert( type( e_name )=='string', sfmt( "Events.addEventListener event name should be a string, received '%s'", tostring(e_name)) ) assert( type(listener)=='function' or type(listener)=='table', sfmt( "Events.addEventListener callback should be function or object, received '%s'", tostring(listener) )) -- Sanity Check if not e_name or type( e_name )~='string' then error( "ERROR addEventListener: event name must be string", 2 ) end if not listener and not Utils.propertyIn( {'function','table'}, type(listener) ) then error( "ERROR addEventListener: listener must be a function or object", 2 ) end -- Processing local events, listeners, key events = self.__event_listeners if not events[ e_name ] then events[ e_name ] = {} end listeners = events[ e_name ] key = _createEventListenerKey( e_name, listener ) if listeners[ key ] then print("WARNING:: Events:addEventListener, already have listener") else listeners[ key ] = listener end end -- removeEventListener() -- function Events.removeEventListener( self, e_name, listener ) -- print( "Events.removeEventListener" ); local listeners, key listeners = self.__event_listeners[ e_name ] if not listeners or type(listeners)~= 'table' then print( "WARNING:: Events:removeEventListener, no listeners found" ) end key = _createEventListenerKey( e_name, listener ) if not listeners[ key ] then print( "WARNING:: Events:removeEventListener, listener not found" ) else listeners[ key ] = nil end end --====================================================================-- --== Private Methods function Events:_dispatchEvent( event ) -- print( "Events:_dispatchEvent", event.name ); local e_name, listeners e_name = event.name if not e_name or not self.__event_listeners[ e_name ] then return end listeners = self.__event_listeners[ e_name ] if type( listeners )~='table' then return end for k, callback in pairs( listeners ) do if type( callback )=='function' then -- have function callback( event ) elseif type( callback )=='table' and callback[e_name] then -- have object/table local method = callback[e_name] method( callback, event ) else print( "WARNING: Events dispatchEvent", e_name ) end end end --====================================================================-- --== Events Facade --====================================================================-- return { EventsMix=Events, dmcEventFunc=_createDmcEvent, coronaEventFunc=_createCoronaEvent, patch=_patch, }
mit
erwin8086/basiccomputers
api.lua
1
3947
local bc = basiccomputers --[[ Restrice computers dig-abiliti. Computer can only dig if func returns true ]] function bc.register_can_dig(func) local old_can_dig = bc.can_dig function bc.can_dig(pos, player) if not func(pos, player) then return false else return old_can_dig(pos, player) end end end --[[ Restrice access to computers inventory. Access only granted if func returns true. ]] function bc.register_can_inv(func) local old_can_inv = bc.can_inv function bc.can_inv(pos, player) if not func(pos, player) then return false else return old_can_inv(pos, player) end end end --[[ Restrice access to computers buttons. If buttons can only accessed if func returns true. ]] function bc.register_can_click(func) local old_can_click = bc.can_click function bc.can_click(pos, player) if not func(pos, palyer) then return false else return old_can_click(pos, player) end end end --[[ Restrice access to input line of computer. Input only accepted if func returns true ]] function bc.register_can_enter(func) local old_can_enter = bc.can_enter function bc.can_enter(pos, player) if not func(pos, player) then return false else return old_can_enter(pos, player) end end end --[[ Call func on computer punched. ]] function bc.register_on_punch(func) local old_on_punch = bc.on_punch function bc.on_punch(pos, player) func(pos, player) if old_on_punch then old_on_punch(pos, player) end end end --[[ Call func when computer starts. If func returns true normal computers start procedure is skipped. ]] function bc.register_on_start(func) local old_on_start = bc.on_start function bc.on_start(pos, player, start) if func(pos, player, start) then return true elseif old_on_start then return old_on_start(pos, player, start) end end end --[[ Called when computer stops. If returns true computers normal stop procedure is skipped ]] function bc.register_on_stop(func) local old_on_stop = bc.on_stop function bc.on_stop(pos, player) if func(pos, player) then return true elseif old_on_stop then return old_on_stop(pos, player) end end end --[[ Called when computer reboots. If returns true computers normal reboot procedure is skipped. ]] function bc.register_on_reboot(func) local old_on_reboot = bc.on_reboot function bc.on_reboot(pos, player) if func(pos, player) then return true else return old_on_reboot(pos, player) end end end --[[ Called when computer receive fields. If returns true computers normal on receive is skipped. ]] function bc.register_on_receive(func) local old_on_receive = bc.on_receive function bc.on_receive(pos, fields, player) if func(pos, fields, player) then return true else return old_on_receive(pos, fields, player) end end end --[[ Called when computer is calculated. If returns true computers normal on calculated procedure is skipped. ]] function bc.register_on_calc(func) local old_on_calc = bc.on_calc function bc.on_calc(pos) if func(pos) then return true else return old_on_calc(pos) end end end --[[ Register an Upgrade. Registered Upgrade can put in Upgrade slot. ]] function bc.register_upgrade(upgrade) local old_is_upgrade = bc.is_upgrade function bc.is_upgrade(u) if u == upgrade then return true else return old_is_upgrade(u) end end end --[[ Register basic command. Example: basiccomputers.register_command("P", function(basic, args) local arg1 = args[1] if type(arg1) == "string" then basic:print(arg1) end end) ]] function bc.register_command(cmd, func) bc.basic.cmds[cmd] = func end --[[ Register basic function. Example: basiccomputers.register_function("FIVE", function(basic, args) local arg1 = args1 if type(arg1) == "number" then arg1 = arg1 * 5 else arg1 = 5 end return arg1 end) ]] function bc.register_function(f, func) bc.basic.funcs[f] = func end bc.api = 0.01
lgpl-2.1
bnetcc/darkstar
scripts/zones/Bastok_Mines/npcs/Babenn.lua
5
2009
----------------------------------- -- Area: Bastok Mines -- NPC: Babenn -- Finishes Quest: The Eleventh's Hour -- Involved in Quests: Riding on the Clouds -- !pos 73 -1 34 234 ----------------------------------- package.loaded["scripts/zones/Bastok_Mines/TextIDs"] = nil; ----------------------------------- require("scripts/zones/Bastok_Mines/TextIDs"); require("scripts/globals/settings"); require("scripts/globals/keyitems"); require("scripts/globals/quests"); require("scripts/globals/titles"); ----------------------------------- function onTrade(player,npc,trade) if (player:getQuestStatus(JEUNO,RIDING_ON_THE_CLOUDS) == QUEST_ACCEPTED and player:getVar("ridingOnTheClouds_2") == 1) then if (trade:hasItemQty(1127,1) and trade:getItemCount() == 1) then -- Trade Kindred seal player:setVar("ridingOnTheClouds_2",0); player:tradeComplete(); player:addKeyItem(SMILING_STONE); player:messageSpecial(KEYITEM_OBTAINED,SMILING_STONE); end end end; function onTrigger(player,npc) if (player:getQuestStatus(BASTOK,THE_ELEVENTH_S_HOUR) == QUEST_ACCEPTED and player:getVar("EleventhsHour") == 1) then player:startEvent(45); else player:startEvent(40); end end; function onEventUpdate(player,csid,option) -- printf("CSID2: %u",csid); -- printf("RESULT2: %u",option); end; function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); if (csid == 45) then if (player:getFreeSlotsCount() > 1) then player:setVar("EleventhsHour",0); player:delKeyItem(OLD_TOOLBOX); player:addTitle(PURSUER_OF_THE_TRUTH); player:addItem(16629); player:messageSpecial(ITEM_OBTAINED,16629); player:addFame(BASTOK,30); player:completeQuest(BASTOK,THE_ELEVENTH_S_HOUR); else player:messageSpecial(ITEM_CANNOT_BE_OBTAINED, 16629); end end end;
gpl-3.0
Maliv/Secret
plugins/banhammer.lua
1085
11557
local function pre_process(msg) -- SERVICE MESSAGE if msg.action and msg.action.type then local action = msg.action.type -- Check if banned user joins chat by link if action == 'chat_add_user_link' then local user_id = msg.from.id print('Checking invited user '..user_id) local banned = is_banned(user_id, msg.to.id) if banned or is_gbanned(user_id) then -- Check it with redis print('User is banned!') local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] is banned and kicked ! ")-- Save to logs kick_user(user_id, msg.to.id) end end -- Check if banned user joins chat if action == 'chat_add_user' then local user_id = msg.action.user.id print('Checking invited user '..user_id) local banned = is_banned(user_id, msg.to.id) if banned or is_gbanned(user_id) then -- Check it with redis print('User is banned!') local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] added a banned user >"..msg.action.user.id)-- Save to logs kick_user(user_id, msg.to.id) local banhash = 'addedbanuser:'..msg.to.id..':'..msg.from.id redis:incr(banhash) local banhash = 'addedbanuser:'..msg.to.id..':'..msg.from.id local banaddredis = redis:get(banhash) if banaddredis then if tonumber(banaddredis) == 4 and not is_owner(msg) then kick_user(msg.from.id, msg.to.id)-- Kick user who adds ban ppl more than 3 times end if tonumber(banaddredis) == 8 and not is_owner(msg) then ban_user(msg.from.id, msg.to.id)-- Kick user who adds ban ppl more than 7 times local banhash = 'addedbanuser:'..msg.to.id..':'..msg.from.id redis:set(banhash, 0)-- Reset the Counter end end end if data[tostring(msg.to.id)] then if data[tostring(msg.to.id)]['settings'] then if data[tostring(msg.to.id)]['settings']['lock_bots'] then bots_protection = data[tostring(msg.to.id)]['settings']['lock_bots'] end end end if msg.action.user.username ~= nil then if string.sub(msg.action.user.username:lower(), -3) == 'bot' and not is_momod(msg) and bots_protection == "yes" then --- Will kick bots added by normal users local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] added a bot > @".. msg.action.user.username)-- Save to logs kick_user(msg.action.user.id, msg.to.id) end end end -- No further checks return msg end -- banned user is talking ! if msg.to.type == 'chat' then local data = load_data(_config.moderation.data) local group = msg.to.id local texttext = 'groups' --if not data[tostring(texttext)][tostring(msg.to.id)] and not is_realm(msg) then -- Check if this group is one of my groups or not --chat_del_user('chat#id'..msg.to.id,'user#id'..our_id,ok_cb,false) --return --end local user_id = msg.from.id local chat_id = msg.to.id local banned = is_banned(user_id, chat_id) if banned or is_gbanned(user_id) then -- Check it with redis print('Banned user talking!') local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] banned user is talking !")-- Save to logs kick_user(user_id, chat_id) msg.text = '' end end return msg end local function kick_ban_res(extra, success, result) --vardump(result) --vardump(extra) local member_id = result.id local user_id = member_id local member = result.username local chat_id = extra.chat_id local from_id = extra.from_id local get_cmd = extra.get_cmd local receiver = "chat#id"..chat_id if get_cmd == "kick" then if member_id == from_id then return send_large_msg(receiver, "You can't kick yourself") end if is_momod2(member_id, chat_id) and not is_admin2(sender) then return send_large_msg(receiver, "You can't kick mods/owner/admins") end return kick_user(member_id, chat_id) elseif get_cmd == 'ban' then if is_momod2(member_id, chat_id) and not is_admin2(sender) then return send_large_msg(receiver, "You can't ban mods/owner/admins") end send_large_msg(receiver, 'User @'..member..' ['..member_id..'] banned') return ban_user(member_id, chat_id) elseif get_cmd == 'unban' then send_large_msg(receiver, 'User @'..member..' ['..member_id..'] unbanned') local hash = 'banned:'..chat_id redis:srem(hash, member_id) return 'User '..user_id..' unbanned' elseif get_cmd == 'banall' then send_large_msg(receiver, 'User @'..member..' ['..member_id..'] globally banned') return banall_user(member_id, chat_id) elseif get_cmd == 'unbanall' then send_large_msg(receiver, 'User @'..member..' ['..member_id..'] un-globally banned') return unbanall_user(member_id, chat_id) end end local function run(msg, matches) if matches[1]:lower() == 'id' then if msg.to.type == "user" then return "Bot ID: "..msg.to.id.. "\n\nYour ID: "..msg.from.id end if type(msg.reply_id) ~= "nil" then local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] used /id ") id = get_message(msg.reply_id,get_message_callback_id, false) elseif matches[1]:lower() == 'id' then local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] used /id ") return "Group ID for " ..string.gsub(msg.to.print_name, "_", " ").. ":\n\n"..msg.to.id end end if matches[1]:lower() == 'kickme' then-- /kickme local receiver = get_receiver(msg) if msg.to.type == 'chat' then local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] left using kickme ")-- Save to logs chat_del_user("chat#id"..msg.to.id, "user#id"..msg.from.id, ok_cb, false) end end if not is_momod(msg) then -- Ignore normal users return end if matches[1]:lower() == "banlist" then -- Ban list ! local chat_id = msg.to.id if matches[2] and is_admin(msg) then chat_id = matches[2] end return ban_list(chat_id) end if matches[1]:lower() == 'ban' then-- /ban if type(msg.reply_id)~="nil" and is_momod(msg) then if is_admin(msg) then local msgr = get_message(msg.reply_id,ban_by_reply_admins, false) else msgr = get_message(msg.reply_id,ban_by_reply, false) end end local user_id = matches[2] local chat_id = msg.to.id if string.match(matches[2], '^%d+$') then if tonumber(matches[2]) == tonumber(our_id) then return end if not is_admin(msg) and is_momod2(matches[2], msg.to.id) then return "you can't ban mods/owner/admins" end if tonumber(matches[2]) == tonumber(msg.from.id) then return "You can't ban your self !" end local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] baned user ".. matches[2]) ban_user(user_id, chat_id) else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'ban', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') res_user(username, kick_ban_res, cbres_extra) end end if matches[1]:lower() == 'unban' then -- /unban if type(msg.reply_id)~="nil" and is_momod(msg) then local msgr = get_message(msg.reply_id,unban_by_reply, false) end local user_id = matches[2] local chat_id = msg.to.id local targetuser = matches[2] if string.match(targetuser, '^%d+$') then local user_id = targetuser local hash = 'banned:'..chat_id redis:srem(hash, user_id) local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] unbaned user ".. matches[2]) return 'User '..user_id..' unbanned' else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'unban', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') res_user(username, kick_ban_res, cbres_extra) end end if matches[1]:lower() == 'kick' then if type(msg.reply_id)~="nil" and is_momod(msg) then if is_admin(msg) then local msgr = get_message(msg.reply_id,Kick_by_reply_admins, false) else msgr = get_message(msg.reply_id,Kick_by_reply, false) end end if string.match(matches[2], '^%d+$') then if tonumber(matches[2]) == tonumber(our_id) then return end if not is_admin(msg) and is_momod2(matches[2], msg.to.id) then return "you can't kick mods/owner/admins" end if tonumber(matches[2]) == tonumber(msg.from.id) then return "You can't kick your self !" end local user_id = matches[2] local chat_id = msg.to.id name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] kicked user ".. matches[2]) kick_user(user_id, chat_id) else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'kick', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') res_user(username, kick_ban_res, cbres_extra) end end if not is_admin(msg) then return end if matches[1]:lower() == 'banall' then -- Global ban if type(msg.reply_id) ~="nil" and is_admin(msg) then return get_message(msg.reply_id,banall_by_reply, false) end local user_id = matches[2] local chat_id = msg.to.id local targetuser = matches[2] if string.match(targetuser, '^%d+$') then if tonumber(matches[2]) == tonumber(our_id) then return false end banall_user(targetuser) return 'User ['..user_id..' ] globally banned' else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'banall', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') res_user(username, kick_ban_res, cbres_extra) end end if matches[1]:lower() == 'unbanall' then -- Global unban local user_id = matches[2] local chat_id = msg.to.id if string.match(matches[2], '^%d+$') then if tonumber(matches[2]) == tonumber(our_id) then return false end unbanall_user(user_id) return 'User ['..user_id..' ] removed from global ban list' else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'unbanall', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') res_user(username, kick_ban_res, cbres_extra) end end if matches[1]:lower() == "gbanlist" then -- Global ban list return banall_list() end end return { patterns = { "^[!/]([Bb]anall) (.*)$", "^[!/]([Bb]anall)$", "^[!/]([Bb]anlist) (.*)$", "^[!/]([Bb]anlist)$", "^[!/]([Gg]banlist)$", "^[!/]([Bb]an) (.*)$", "^[!/]([Kk]ick)$", "^[!/]([Uu]nban) (.*)$", "^[!/]([Uu]nbanall) (.*)$", "^[!/]([Uu]nbanall)$", "^[!/]([Kk]ick) (.*)$", "^[!/]([Kk]ickme)$", "^[!/]([Bb]an)$", "^[!/]([Uu]nban)$", "^[!/]([Ii]d)$", "^!!tgservice (.+)$" }, run = run, pre_process = pre_process }
gpl-2.0
ioiasff/mbg
plugins/banhammer.lua
1085
11557
local function pre_process(msg) -- SERVICE MESSAGE if msg.action and msg.action.type then local action = msg.action.type -- Check if banned user joins chat by link if action == 'chat_add_user_link' then local user_id = msg.from.id print('Checking invited user '..user_id) local banned = is_banned(user_id, msg.to.id) if banned or is_gbanned(user_id) then -- Check it with redis print('User is banned!') local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] is banned and kicked ! ")-- Save to logs kick_user(user_id, msg.to.id) end end -- Check if banned user joins chat if action == 'chat_add_user' then local user_id = msg.action.user.id print('Checking invited user '..user_id) local banned = is_banned(user_id, msg.to.id) if banned or is_gbanned(user_id) then -- Check it with redis print('User is banned!') local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] added a banned user >"..msg.action.user.id)-- Save to logs kick_user(user_id, msg.to.id) local banhash = 'addedbanuser:'..msg.to.id..':'..msg.from.id redis:incr(banhash) local banhash = 'addedbanuser:'..msg.to.id..':'..msg.from.id local banaddredis = redis:get(banhash) if banaddredis then if tonumber(banaddredis) == 4 and not is_owner(msg) then kick_user(msg.from.id, msg.to.id)-- Kick user who adds ban ppl more than 3 times end if tonumber(banaddredis) == 8 and not is_owner(msg) then ban_user(msg.from.id, msg.to.id)-- Kick user who adds ban ppl more than 7 times local banhash = 'addedbanuser:'..msg.to.id..':'..msg.from.id redis:set(banhash, 0)-- Reset the Counter end end end if data[tostring(msg.to.id)] then if data[tostring(msg.to.id)]['settings'] then if data[tostring(msg.to.id)]['settings']['lock_bots'] then bots_protection = data[tostring(msg.to.id)]['settings']['lock_bots'] end end end if msg.action.user.username ~= nil then if string.sub(msg.action.user.username:lower(), -3) == 'bot' and not is_momod(msg) and bots_protection == "yes" then --- Will kick bots added by normal users local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] added a bot > @".. msg.action.user.username)-- Save to logs kick_user(msg.action.user.id, msg.to.id) end end end -- No further checks return msg end -- banned user is talking ! if msg.to.type == 'chat' then local data = load_data(_config.moderation.data) local group = msg.to.id local texttext = 'groups' --if not data[tostring(texttext)][tostring(msg.to.id)] and not is_realm(msg) then -- Check if this group is one of my groups or not --chat_del_user('chat#id'..msg.to.id,'user#id'..our_id,ok_cb,false) --return --end local user_id = msg.from.id local chat_id = msg.to.id local banned = is_banned(user_id, chat_id) if banned or is_gbanned(user_id) then -- Check it with redis print('Banned user talking!') local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] banned user is talking !")-- Save to logs kick_user(user_id, chat_id) msg.text = '' end end return msg end local function kick_ban_res(extra, success, result) --vardump(result) --vardump(extra) local member_id = result.id local user_id = member_id local member = result.username local chat_id = extra.chat_id local from_id = extra.from_id local get_cmd = extra.get_cmd local receiver = "chat#id"..chat_id if get_cmd == "kick" then if member_id == from_id then return send_large_msg(receiver, "You can't kick yourself") end if is_momod2(member_id, chat_id) and not is_admin2(sender) then return send_large_msg(receiver, "You can't kick mods/owner/admins") end return kick_user(member_id, chat_id) elseif get_cmd == 'ban' then if is_momod2(member_id, chat_id) and not is_admin2(sender) then return send_large_msg(receiver, "You can't ban mods/owner/admins") end send_large_msg(receiver, 'User @'..member..' ['..member_id..'] banned') return ban_user(member_id, chat_id) elseif get_cmd == 'unban' then send_large_msg(receiver, 'User @'..member..' ['..member_id..'] unbanned') local hash = 'banned:'..chat_id redis:srem(hash, member_id) return 'User '..user_id..' unbanned' elseif get_cmd == 'banall' then send_large_msg(receiver, 'User @'..member..' ['..member_id..'] globally banned') return banall_user(member_id, chat_id) elseif get_cmd == 'unbanall' then send_large_msg(receiver, 'User @'..member..' ['..member_id..'] un-globally banned') return unbanall_user(member_id, chat_id) end end local function run(msg, matches) if matches[1]:lower() == 'id' then if msg.to.type == "user" then return "Bot ID: "..msg.to.id.. "\n\nYour ID: "..msg.from.id end if type(msg.reply_id) ~= "nil" then local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] used /id ") id = get_message(msg.reply_id,get_message_callback_id, false) elseif matches[1]:lower() == 'id' then local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] used /id ") return "Group ID for " ..string.gsub(msg.to.print_name, "_", " ").. ":\n\n"..msg.to.id end end if matches[1]:lower() == 'kickme' then-- /kickme local receiver = get_receiver(msg) if msg.to.type == 'chat' then local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] left using kickme ")-- Save to logs chat_del_user("chat#id"..msg.to.id, "user#id"..msg.from.id, ok_cb, false) end end if not is_momod(msg) then -- Ignore normal users return end if matches[1]:lower() == "banlist" then -- Ban list ! local chat_id = msg.to.id if matches[2] and is_admin(msg) then chat_id = matches[2] end return ban_list(chat_id) end if matches[1]:lower() == 'ban' then-- /ban if type(msg.reply_id)~="nil" and is_momod(msg) then if is_admin(msg) then local msgr = get_message(msg.reply_id,ban_by_reply_admins, false) else msgr = get_message(msg.reply_id,ban_by_reply, false) end end local user_id = matches[2] local chat_id = msg.to.id if string.match(matches[2], '^%d+$') then if tonumber(matches[2]) == tonumber(our_id) then return end if not is_admin(msg) and is_momod2(matches[2], msg.to.id) then return "you can't ban mods/owner/admins" end if tonumber(matches[2]) == tonumber(msg.from.id) then return "You can't ban your self !" end local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] baned user ".. matches[2]) ban_user(user_id, chat_id) else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'ban', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') res_user(username, kick_ban_res, cbres_extra) end end if matches[1]:lower() == 'unban' then -- /unban if type(msg.reply_id)~="nil" and is_momod(msg) then local msgr = get_message(msg.reply_id,unban_by_reply, false) end local user_id = matches[2] local chat_id = msg.to.id local targetuser = matches[2] if string.match(targetuser, '^%d+$') then local user_id = targetuser local hash = 'banned:'..chat_id redis:srem(hash, user_id) local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] unbaned user ".. matches[2]) return 'User '..user_id..' unbanned' else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'unban', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') res_user(username, kick_ban_res, cbres_extra) end end if matches[1]:lower() == 'kick' then if type(msg.reply_id)~="nil" and is_momod(msg) then if is_admin(msg) then local msgr = get_message(msg.reply_id,Kick_by_reply_admins, false) else msgr = get_message(msg.reply_id,Kick_by_reply, false) end end if string.match(matches[2], '^%d+$') then if tonumber(matches[2]) == tonumber(our_id) then return end if not is_admin(msg) and is_momod2(matches[2], msg.to.id) then return "you can't kick mods/owner/admins" end if tonumber(matches[2]) == tonumber(msg.from.id) then return "You can't kick your self !" end local user_id = matches[2] local chat_id = msg.to.id name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] kicked user ".. matches[2]) kick_user(user_id, chat_id) else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'kick', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') res_user(username, kick_ban_res, cbres_extra) end end if not is_admin(msg) then return end if matches[1]:lower() == 'banall' then -- Global ban if type(msg.reply_id) ~="nil" and is_admin(msg) then return get_message(msg.reply_id,banall_by_reply, false) end local user_id = matches[2] local chat_id = msg.to.id local targetuser = matches[2] if string.match(targetuser, '^%d+$') then if tonumber(matches[2]) == tonumber(our_id) then return false end banall_user(targetuser) return 'User ['..user_id..' ] globally banned' else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'banall', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') res_user(username, kick_ban_res, cbres_extra) end end if matches[1]:lower() == 'unbanall' then -- Global unban local user_id = matches[2] local chat_id = msg.to.id if string.match(matches[2], '^%d+$') then if tonumber(matches[2]) == tonumber(our_id) then return false end unbanall_user(user_id) return 'User ['..user_id..' ] removed from global ban list' else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'unbanall', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') res_user(username, kick_ban_res, cbres_extra) end end if matches[1]:lower() == "gbanlist" then -- Global ban list return banall_list() end end return { patterns = { "^[!/]([Bb]anall) (.*)$", "^[!/]([Bb]anall)$", "^[!/]([Bb]anlist) (.*)$", "^[!/]([Bb]anlist)$", "^[!/]([Gg]banlist)$", "^[!/]([Bb]an) (.*)$", "^[!/]([Kk]ick)$", "^[!/]([Uu]nban) (.*)$", "^[!/]([Uu]nbanall) (.*)$", "^[!/]([Uu]nbanall)$", "^[!/]([Kk]ick) (.*)$", "^[!/]([Kk]ickme)$", "^[!/]([Bb]an)$", "^[!/]([Uu]nban)$", "^[!/]([Ii]d)$", "^!!tgservice (.+)$" }, run = run, pre_process = pre_process }
gpl-2.0
lcf258/openwrtcn
applications/luci-app-statistics/luasrc/statistics/rrdtool/definitions/nut.lua
24
2233
-- Licensed to the public under the Apache License 2.0. module("luci.statistics.rrdtool.definitions.nut",package.seeall) function rrdargs( graph, plugin, plugin_instance, dtype ) local voltages = { title = "%H: Voltages on UPS \"%pi\"", vlabel = "V", number_format = "%5.1lfV", data = { instances = { voltage = { "battery", "input", "output" } }, options = { voltage_output = { color = "00e000", title = "Output voltage", noarea=true, overlay=true }, voltage_battery = { color = "0000ff", title = "Battery voltage", noarea=true, overlay=true }, voltage_input = { color = "ffb000", title = "Input voltage", noarea=true, overlay=true } } } } local currents = { title = "%H: Current on UPS \"%pi\"", vlabel = "A", number_format = "%5.3lfA", data = { instances = { current = { "battery", "output" } }, options = { current_output = { color = "00e000", title = "Output current", noarea=true, overlay=true }, current_battery = { color = "0000ff", title = "Battery current", noarea=true, overlay=true }, } } } local percentage = { title = "%H: Battery charge on UPS \"%pi\"", vlabel = "Percent", y_min = "0", y_max = "100", number_format = "%5.1lf%%", data = { sources = { percent = { "percent" } }, instances = { percent = "charge" }, options = { percent_charge = { color = "00ff00", title = "Charge level" } } } } -- Note: This is in ISO8859-1 for rrdtool. Welcome to the 20th century. local temperature = { title = "%H: Battery temperature on UPS \"%pi\"", vlabel = "\176C", number_format = "%5.1lf\176C", data = { instances = { temperature = "battery" }, options = { temperature_battery = { color = "ffb000", title = "Battery temperature" } } } } local timeleft = { title = "%H: Time left on UPS \"%pi\"", vlabel = "Minutes", number_format = "%.1lfm", data = { sources = { timeleft = { "timeleft" } }, instances = { timeleft = { "battery" } }, options = { timeleft_battery = { color = "0000ff", title = "Time left", transform_rpn = "60,/" } } } } return { voltages, currents, percentage, temperature, timeleft } end
apache-2.0
JabJabJab/Sledgehammer
lua/SledgehammerLua/media/lua/client/Sledgehammer/Gui/TabPanel.lua
1
16043
-- This file is part of Sledgehammer. -- -- Sledgehammer is free software: you can redistribute it and/or modify -- it under the terms of the GNU Lesser General Public License as published by -- the Free Software Foundation, either version 3 of the License, or -- (at your option) any later version. -- -- Sledgehammer is distributed in the hope that it will be useful, -- but WITHOUT ANY WARRANTY; without even the implied warranty of -- MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the -- GNU Lesser General Public License for more details. -- -- You should have received a copy of the GNU Lesser General Public License -- along with Sledgehammer. If not, see <http://www.gnu.org/licenses/>. -- -- Sledgehammer is free to use and modify, ONLY for non-official third-party servers -- not affiliated with TheIndieStone, or it's immediate affiliates, or contractors. require "Sledgehammer/Gui/Component" require "Util" ---------------------------------------------------------------- -- TabPanel.lua -- UI for generic Tabbed Panels. -- -- @author Jab -- @license LGPL3 ---------------------------------------------------------------- TabPanel = Component:derive("TabPanel"); ---------------------------------------------------------------- -- ---------------------------------------------------------------- function TabPanel:new(x, y, w, h) -- Generic instantiation. local o = Component:new(x, y, w, h); setmetatable(o, self); self.__index = self; -- The active index to each array. o.active_index = 0; -- Panel content for each tab. Requires a 'name' field. o.panels = {}; -- For when a tab is added. o.tabs_dirty = false; -- Beginning x position after the tab space. o.tab_end_x = 0; -- For when panels need to be resized. o.panels_dirty = true; -- Amount of tabs. Used as a placemarker for the next added tab. o.tab_count = 0; -- Dimensions used to calculate tab positions. o.tab_dimension_highlight_factors = {}; -- The font-size of the tabs. o.tab_font_size = UIFont.Small; -- Height in pixels of the Tab's font. o.font_height = sHeight(o.tab_font_size); -- The active panel / Tab. o.active_panel = nil; -- Internal panel dimension data. o.inner_x = 0; o.inner_y = 0; o.inner_width = 0; o.inner_height = 0; return o; end ---------------------------------------------------------------- -- ---------------------------------------------------------------- function TabPanel:initialise() -- Invoke super method. Component.initialise(self); end ---------------------------------------------------------------- -- ---------------------------------------------------------------- function TabPanel:createChildren() -- Invoke super method. Component.createChildren(self); -- Setup colors. self.colorOutline = Color(128, 128, 128, 255); self.colorText = Color(164, 164, 164, 255); self.colorTextSelected = Color(240, 240, 240, 255); end ---------------------------------------------------------------- -- ---------------------------------------------------------------- function TabPanel:update() -- Update the active panel. if self.active_panel ~= nil then self.active_panel:update(); end local mouse = self:getLocalMouse(); if self:containsPoint(mouse.x, mouse.y) then -- print(tostring(mouse.x)..", "..tostring(mouse.y)); mouse = self:getMouse(); local length = 32; for index = 0, length, 1 do local nextPanel = self.panels[index]; if nextDim ~= nil then local nextDim = nextPanel._dim; local factor = self.tab_dimension_highlight_factors[index]; if self:containsPoint(mouse.x, mouse.y, nextDim) then if factor < 2 then self.tab_dimension_highlight_factors[index] = factor + 0.2; end else if factor > 1 then self.tab_dimension_highlight_factors[index] = factor - 0.1; end end end end else -- Drop Highlights for tabs while the mouse is outside the TabPanel. local length = 32; for index = 0, length, 1 do if self.tab_dimension_highlight_factors[index] ~= nil then if self.tab_dimension_highlight_factors[index] > 1 then self.tab_dimension_highlight_factors[index] = self.tab_dimension_highlight_factors[index] - 0.1; end end end end end ---------------------------------------------------------------- -- ---------------------------------------------------------------- function TabPanel:prerender() if self.tabs_dirty then local index = 0; local length = self.tab_count; -- Go through each tab. for index = 0, length, 1 do local panel = self.panels[index]; if panel ~= nil then if not panel._name_length then local name = self.panels[index]._name; -- Set the length of the tab. panel._name_length = sLength(name, self.tab_font_size) + 7; end end end -- Reset the font height variable. self.font_height = sHeight(self.tab_font_size); -- Set the tab data clean. self.tabs_dirty = false; end self:setInnerDimensions(); if self.active_panel ~= nil then self.active_panel:setX(self:getInnerX()); self.active_panel:setY(self:getInnerY()); self.active_panel:setWidth(self:getInnerWidth()); self.active_panel:setHeight(self:getInnerHeight()); end end ---------------------------------------------------------------- -- ---------------------------------------------------------------- function TabPanel:_render() local parent = self:getParent() ; local sx = parent:getX() + 4 ; local y = parent:getY() + self:getY(); local h = self.font_height ; local panels_length = 32 ; local has_panels = panels_length > 0 or false ; if has_panels then for index = 0, panels_length, 1 do local panel = self.panels[index]; if panel ~= nil then local tab_length = panel._name_length; if not tab_length then tab_length = sLength(panel._name, self.tab_font_size) + 7; panel._name_length = tab_length; end local dim = nil; -- Draw the tab. if panel.active == true then dim = self:drawActiveTab(panel._name, sx, y, tab_length, self.font_height, self.colorTextSelected, self.colorOutline, self.font, 2, true); else dim = self:drawTab(panel._name, sx, y, tab_length, self.font_height, self.colorText, self.colorOutline, self.font, self.tab_dimension_highlight_factors[index], true); end -- Update panel's tab dimension. panel._dim = dim; -- Add the tab's length to the next measure. sx = sx + tab_length + 2; end end -- Store the x position of the end of the tab space. self.tab_end_x = sx + 1; -- Draw the line in the remaining space to the right of the tabs. self:drawLineH(sx, y + h + 3, self:getWidth() - sx + parent:getX() + self:getX(), 1, self.colorOutline); else -- No tabs means the entire bar at the top is free to populate. self.tab_end_x = 0; -- Draw the line in the remaining space to the right of the tabs. self:drawLineH(parent:getX() + self:getX(), y + h + 3, self:getWidth(), 1, self.colorOutline); end -- Grab the internal dimensions. local ix = self:getInnerX(); local iy = self:getInnerY(); local iw = self:getInnerWidth(); local ih = self:getInnerHeight(); -- Draw the containing border for the internal panel content. self:drawRectPartial(parent:getX() + ix + 4, parent:getY() + iy + 4, iw, ih, false, true, true, true, self.colorOutline); self:_renderChildren(); end ---------------------------------------------------------------- -- ---------------------------------------------------------------- function TabPanel:click() local mouse = self:getMouse(); local length = 32; for index = 0, length, 1 do local next_panel = self.panels[index]; if next_panel ~= nil then local nextDim = next_panel._dim; local factor = self.tab_dimension_highlight_factors[index]; if self:containsPoint(mouse.x, mouse.y, nextDim) then self:setActiveTab(next_panel._name); break; end end end end ---------------------------------------------------------------- -- ---------------------------------------------------------------- function TabPanel:setActiveTab(identifier) -- Validity check. if identifier == nil then print("TabPanel:setActiveTab() -> Identifier is null."); return; end if type(identifier) == "number" then -- Handle identifier as index. -- Validity check. if identifier < 0 then print("TabPanel:setActiveTab() -> Index must be a valid, non-negative integer."); return; end -- If a panel is currently active, remove it. if self.active_panel ~= nil then self:removeChild(self.active_panel); self.active_panel:setVisible(false); self.active_panel.active = false; end -- Set the new active panel. self.active_panel = self.panels[identifier]; self.active_panel:setVisible(true); self.active_panel.active = true; -- Add the new active panel as a child of the Tabs UIElement. self:addChild(self.active_panel); elseif type(identifier) == "string" then -- Handle identifier as the name. -- Validity check. if identifier == "" then print("TabPanel:setActiveTab() -> Name given is empty."); return; end -- length of the panels array. local length = 32; -- Our found panel object. local found_panel = nil; -- Go through each panel. for index = 0, length, 1 do -- Grab the next panel. local panel = self.panels[index]; -- Verify the panel is a valid LuaObject. if panel ~= nil then -- If the name matches, this is the panel. if panel._name == identifier then -- Set the variable. found_panel = panel; -- Break for optimization. break; end end end -- Validity check. if found_panel == nil then print("TabPanel:setActiveTab() -> No panel found for name: " .. identifier); return; end -- If a panel is currently active, remove it. if self.active_panel ~= nil then self:removeChild(self.active_panel); self.active_panel:setVisible(false); self.active_panel.active = false; end -- Set the new active panel. self.active_panel = found_panel; self.active_panel:setVisible(true); self.active_panel.active = true; -- Add the new active panel as a child of the Tabs UIElement. self:addChild(self.active_panel); end self:onTabFocus(); end ---------------------------------------------------------------- -- ---------------------------------------------------------------- function TabPanel:addTab(name, UIObject) -- Validity check. if UIObject == nil then print("TabPanel:addTab() -> UIObject is nil for name: " .. name); return; end UIObject._dim = {x1 = -9999, x2 = -9999, y1 = -9999, y2 = -9999}; -- Set an internal name field. UIObject._name = name; -- Grab the index before incrementing the length. local toReturn = nil; local index = 0; while toReturn == nil do if self.panels[index] == nil then toReturn = index; break; end index = index + 1; end -- Insert the object into the panel array. self.panels[toReturn] = UIObject; self.tab_dimension_highlight_factors[toReturn] = 1; -- Increment tabs length. self.tab_count = self.tab_count + 1; -- Set dirty flags to recalculate. self.tabs_dirty = true; self.panels_dirty = true; -- Start as not visible. UIObject:setVisible(false); -- Return the index position of the tab. return toReturn; end ---------------------------------------------------------------- -- ---------------------------------------------------------------- function TabPanel:removeTab(name) -- TO lowercase to match. name = string.lower(name); local length = 32; for index = 0, length, 1 do local panel = self.panels[index]; if panel ~= nil then if string.lower(panel._name) == name then -- Set panel to null. self.panels[index] = nil; self.tab_count = self.tab_count - 1; -- If the removed tab is the active tab, set the first tab as active. if self.active_index == index then self.active_index = 0; self.active_panel = self.panels[0]; end break; end end end end ---------------------------------------------------------------- -- ---------------------------------------------------------------- function TabPanel:getTab(identifier) if type(identifier) == "number" then -- Handle identifier as index. -- Validity check. if identifier < 0 then print("Index must be a valid, non-negative integer."); return; end return self.panels[identifier]; elseif type(identifier) == "string" then -- Handle identifier as the name. -- Validity check. if identifier == "" then print("Name given is empty."); return; end identifier = string.lower(identifier); -- length of the panels array. local length = 32; -- Go through each panel. for index = 0, length, 1 do -- Grab the next panel. local panel = self.panels[index]; -- Verify the panel is a valid LuaObject. if panel ~= nil then -- If the name matches, this is the panel. if string.lower(panel._name) == identifier then -- Set the variable. return panel; end end end end end ---------------------------------------------------------------- -- ---------------------------------------------------------------- function TabPanel:setInnerDimensions() -- Grab the parent. local p = self:getParent(); -- Parent coordinates. local px = p:getX(); local py = p:getY(); -- Inner dimensions. local x = self:getX() - 4; local y = self:getY() + 15; local w = self:getWidth() ; local h = self:getHeight(); -- Set inner dimensions. self.inner_x = x; self.inner_y = y; self.inner_width = w; self.inner_height = h; end ---------------------------------------------------------------- -- ---------------------------------------------------------------- function TabPanel:getActiveTab() return self.active_panel; end ---------------------------------------------------------------- -- ---------------------------------------------------------------- function TabPanel:getInnerX() return self.inner_x; end ---------------------------------------------------------------- -- ---------------------------------------------------------------- function TabPanel:getInnerY() return self.inner_y; end ---------------------------------------------------------------- -- ---------------------------------------------------------------- function TabPanel:getInnerWidth() return self.inner_width; end ---------------------------------------------------------------- -- ---------------------------------------------------------------- function TabPanel:getInnerHeight() return self.inner_height; end ---------------------------------------------------------------- -- ---------------------------------------------------------------- function TabPanel:onTabFocus(tab) end ---------------------------------------------------------------- -- ---------------------------------------------------------------- function TabPanel:render() end ---------------------------------------------------------------- ---------------------------------------------------------------- -- ###### ######## ### ######## #### ###### -- -- ## ## ## ## ## ## ## ## ## -- -- ## ## ## ## ## ## ## -- -- ###### ## ## ## ## ## ## -- -- ## ## ######### ## ## ## -- -- ## ## ## ## ## ## ## ## ## -- -- ###### ## ## ## ## #### ###### -- ---------------------------------------------------------------- ---------------------------------------------------------------- -- The static definition for header heights for the TabPanel. TabPanel.header_height = 24; ---------------------------------------------------------------- -- @static -- @return Returns the HeaderHieght defined for the TabPanel. ---------------------------------------------------------------- function TabPanel:getHeaderHeight() return TabPanel.header_height; end
lgpl-3.0
yswifi/APlan
build_dir/target-mipsel_24kec+dsp_uClibc-0.9.33.2/luci/libs/nixio/docsrc/nixio.TLSSocket.lua
173
2926
--- TLS Socket Object. -- TLS Sockets contain the underlying socket and context in the fields -- "socket" and "context". -- @cstyle instance module "nixio.TLSSocket" --- Initiate the TLS handshake as client with the server. -- @class function -- @name TLSSocket.connect -- @usage This function calls SSL_connect(). -- @usage You have to call either connect or accept before transmitting data. -- @see TLSSocket.accept -- @return true --- Wait for a TLS handshake from a client. -- @class function -- @name TLSSocket.accept -- @usage This function calls SSL_accept(). -- @usage You have to call either connect or accept before transmitting data. -- @see TLSSocket.connect -- @return true --- Send a message to the socket. -- @class function -- @name TLSSocket.send -- @usage This function calls SSL_write(). -- @usage <strong>Warning:</strong> It is not guaranteed that all data -- in the buffer is written at once. -- You have to check the return value - the number of bytes actually written - -- or use the safe IO functions in the high-level IO utility module. -- @usage Unlike standard Lua indexing the lowest offset and default is 0. -- @param buffer Buffer holding the data to be written. -- @param offset Offset to start reading the buffer from. (optional) -- @param length Length of chunk to read from the buffer. (optional) -- @return number of bytes written --- Send a message on the socket (This is an alias for send). -- See the send description for a detailed description. -- @class function -- @name TLSSocket.write -- @param buffer Buffer holding the data to be written. -- @param offset Offset to start reading the buffer from. (optional) -- @param length Length of chunk to read from the buffer. (optional) -- @see TLSSocket.send -- @return number of bytes written --- Receive a message on the socket. -- @class function -- @name TLSSocket.recv -- @usage This function calls SSL_read(). -- @usage <strong>Warning:</strong> It is not guaranteed that all requested data -- is read at once. -- You have to check the return value - the length of the buffer actually read - -- or use the safe IO functions in the high-level IO utility module. -- @usage The length of the return buffer is limited by the (compile time) -- nixio buffersize which is <em>nixio.const.buffersize</em> (8192 by default). -- Any read request greater than that will be safely truncated to this value. -- @param length Amount of data to read (in Bytes). -- @return buffer containing data successfully read --- Receive a message on the socket (This is an alias for recv). -- See the recv description for more details. -- @class function -- @name TLSSocket.read -- @param length Amount of data to read (in Bytes). -- @see TLSSocket.recv -- @return buffer containing data successfully read --- Shut down the TLS connection. -- @class function -- @name TLSSocket.shutdown -- @usage This function calls SSL_shutdown(). -- @return true
gpl-2.0
bnetcc/darkstar
scripts/zones/Western_Adoulin/npcs/Jorin.lua
5
1935
----------------------------------- -- Area: Western Adoulin -- NPC: Jorin -- Type: Standard NPC and Quest Giver -- Starts, Involved with, and Finishes Quest: 'The Old Man and the Harpoon' -- @zone 256 -- !pos 92 32 152 256 ----------------------------------- package.loaded["scripts/zones/Western_Adoulin/TextIDs"] = nil; ----------------------------------- require("scripts/globals/quests"); require("scripts/zones/Western_Adoulin/TextIDs"); ----------------------------------- function onTrade(player,npc,trade) end; function onTrigger(player,npc) local TOMATH = player:getQuestStatus(ADOULIN, THE_OLD_MAN_AND_THE_HARPOON); if (TOMATH == QUEST_ACCEPTED) then if (player:hasKeyItem(EXTRAVAGANT_HARPOON)) then -- Finishing Quest: 'The Old Man and the Harpoon' player:startEvent(2542); else -- Dialgoue during Quest: 'The Old Man and the Harpoon' player:startEvent(2541); end elseif (TOMATH == QUEST_AVAILABLE) then -- Starts Quest: 'The Old Man and the Harpoon' player:startEvent(2540); else -- Standard dialogue player:startEvent(560); end end; function onEventUpdate(player,csid,option) end; function onEventFinish(player,csid,option) if (csid == 2540) then -- Starting Quest: 'The Old Man and the Harpoon' player:addQuest(ADOULIN, THE_OLD_MAN_AND_THE_HARPOON); player:addKeyItem(BROKEN_HARPOON); player:messageSpecial(KEYITEM_OBTAINED, BROKEN_HARPOON); elseif (csid == 2542) then -- Finishing Quest: 'The Old Man and the Harpoon' player:completeQuest(ADOULIN, THE_OLD_MAN_AND_THE_HARPOON); player:addExp(500 * EXP_RATE); player:addCurrency('bayld', 300 * BAYLD_RATE); player:messageSpecial(BAYLD_OBTAINED, 300 * BAYLD_RATE); player:delKeyItem(EXTRAVAGANT_HARPOON); player:addFame(ADOULIN); end end;
gpl-3.0
Benjji/wesnoth
data/ai/lua/generic_rush_engine.lua
26
27499
return { init = function(ai) -- Grab a useful separate CA as a starting point local generic_rush = wesnoth.require("ai/lua/move_to_any_target.lua").init(ai) -- More generic grunt rush (and can, in fact, be used with other unit types as well) local H = wesnoth.require "lua/helper.lua" local W = H.set_wml_action_metatable {} local AH = wesnoth.require "ai/lua/ai_helper.lua" local BC = wesnoth.require "ai/lua/battle_calcs.lua" local LS = wesnoth.require "lua/location_set.lua" local HS = wesnoth.require "ai/micro_ais/cas/ca_healer_move.lua" local R = wesnoth.require "ai/lua/retreat.lua" local function print_time(...) if generic_rush.data.turn_start_time then AH.print_ts_delta(generic_rush.data.turn_start_time, ...) else AH.print_ts(...) end end ------ Stats at beginning of turn ----------- -- This will be blacklisted after first execution each turn function generic_rush:stats_eval() local score = 999999 return score end function generic_rush:stats_exec() local tod = wesnoth.get_time_of_day() AH.print_ts(' Beginning of Turn ' .. wesnoth.current.turn .. ' (' .. tod.name ..') stats') generic_rush.data.turn_start_time = wesnoth.get_time_stamp() / 1000. for i,s in ipairs(wesnoth.sides) do local total_hp = 0 local units = AH.get_live_units { side = s.side } for i,u in ipairs(units) do total_hp = total_hp + u.hitpoints end local leader = wesnoth.get_units { side = s.side, canrecruit = 'yes' }[1] if leader then print(' Player ' .. s.side .. ' (' .. leader.type .. '): ' .. #units .. ' Units with total HP: ' .. total_hp) end end end ------- Recruit CA -------------- local params = { score_function = (function() return 300000 end), min_turn_1_recruit = (function() return generic_rush:castle_switch_eval() > 0 end), leader_takes_village = (function() if generic_rush:castle_switch_eval() > 0 then local take_village = #(wesnoth.get_villages { x = generic_rush.data.leader_target[1], y = generic_rush.data.leader_target[2] }) > 0 return take_village end return true end ) } wesnoth.require("ai/lua/generic_recruit_engine.lua").init(ai, generic_rush, params) -------- Castle Switch CA -------------- local function get_reachable_enemy_leaders(unit) local potential_enemy_leaders = AH.get_live_units { canrecruit = 'yes', { "filter_side", { { "enemy_of", {side = wesnoth.current.side} } } } } local enemy_leaders = {} for j,e in ipairs(potential_enemy_leaders) do local path, cost = wesnoth.find_path(unit, e.x, e.y, { ignore_units = true, viewing_side = 0 }) if cost < AH.no_path then table.insert(enemy_leaders, e) end end return enemy_leaders end function generic_rush:castle_switch_eval() local start_time, ca_name = wesnoth.get_time_stamp() / 1000., 'castle_switch' if AH.print_eval() then print_time(' - Evaluating castle_switch CA:') end if ai.get_passive_leader() then -- Turn off this CA if the leader is passive return 0 end local leader = wesnoth.get_units { side = wesnoth.current.side, canrecruit = 'yes', formula = '(movement_left = total_movement) and (hitpoints = max_hitpoints)' }[1] if not leader then -- CA is irrelevant if no leader or the leader may have moved from another CA self.data.leader_target = nil if AH.print_eval() then AH.done_eval_messages(start_time, ca_name) end return 0 end local cheapest_unit_cost = AH.get_cheapest_recruit_cost() if self.data.leader_target and wesnoth.sides[wesnoth.current.side].gold >= cheapest_unit_cost then -- make sure move is still valid local next_hop = AH.next_hop(leader, self.data.leader_target[1], self.data.leader_target[2]) if next_hop and next_hop[1] == self.data.leader_target[1] and next_hop[2] == self.data.leader_target[2] then return self.data.leader_score end end local width,height,border = wesnoth.get_map_size() local keeps = wesnoth.get_locations { terrain = 'K*,K*^*,*^K*', -- Keeps x = '1-'..width, y = '1-'..height, { "not", { {"filter", {}} }}, -- That have no unit { "not", { radius = 6, {"filter", { canrecruit = 'yes', { "filter_side", { { "enemy_of", {side = wesnoth.current.side} } } } }} }}, -- That are not too close to an enemy leader { "not", { x = leader.x, y = leader.y, terrain = 'K*,K*^*,*^K*', radius = 3, { "filter_radius", { terrain = 'C*,K*,C*^*,K*^*,*^K*,*^C*' } } }}, -- That are not close and connected to a keep the leader is on { "filter_adjacent_location", { terrain = 'C*,K*,C*^*,K*^*,*^K*,*^C*' }} -- That are not one-hex keeps } if #keeps < 1 then -- Skip if there aren't extra keeps to evaluate -- In this situation we'd only switch keeps if we were running away if AH.print_eval() then AH.done_eval_messages(start_time, ca_name) end return 0 end local enemy_leaders = get_reachable_enemy_leaders(leader) -- Look for the best keep local best_score, best_loc, best_turns = 0, {}, 3 for i,loc in ipairs(keeps) do -- Only consider keeps within 2 turns movement local path, cost = wesnoth.find_path(leader, loc[1], loc[2]) local score = 0 -- Prefer closer keeps to enemy local turns = math.ceil(cost/leader.max_moves) if turns <= 2 then score = 1/turns for j,e in ipairs(enemy_leaders) do score = score + 1 / H.distance_between(loc[1], loc[2], e.x, e.y) end if score > best_score then best_score = score best_loc = loc best_turns = turns end end end -- If we're on a keep, -- don't move to another keep unless it's much better when uncaptured villages are present if best_score > 0 and wesnoth.get_terrain_info(wesnoth.get_terrain(leader.x, leader.y)).keep then local close_unowned_village = (wesnoth.get_villages { { "and", { x = leader.x, y = leader.y, radius = leader.max_moves }}, owner_side = 0 })[1] if close_unowned_village then local score = 1/best_turns for j,e in ipairs(enemy_leaders) do -- count all distances as three less than they actually are score = score + 1 / (H.distance_between(leader.x, leader.y, e.x, e.y) - 3) end if score > best_score then best_score = 0 end end end if best_score > 0 then local next_hop = AH.next_hop(leader, best_loc[1], best_loc[2]) if next_hop and ((next_hop[1] ~= leader.x) or (next_hop[2] ~= leader.y)) then -- See if there is a nearby village that can be captured without delaying progress local close_villages = wesnoth.get_villages( { { "and", { x = next_hop[1], y = next_hop[2], radius = leader.max_moves }}, owner_side = 0 }) for i,loc in ipairs(close_villages) do local path_village, cost_village = wesnoth.find_path(leader, loc[1], loc[2]) if cost_village <= leader.moves then local dummy_leader = wesnoth.copy_unit(leader) dummy_leader.x = loc[1] dummy_leader.y = loc[2] local path_keep, cost_keep = wesnoth.find_path(dummy_leader, best_loc[1], best_loc[2]) local turns_from_keep = math.ceil(cost_keep/leader.max_moves) if turns_from_keep < best_turns or (turns_from_keep == 1 and wesnoth.sides[wesnoth.current.side].gold < cheapest_unit_cost) then -- There is, go there instead next_hop = loc break end end end end self.data.leader_target = next_hop -- if we're on a keep, wait until there are no movable units on the castle before moving off self.data.leader_score = 290000 if wesnoth.get_terrain_info(wesnoth.get_terrain(leader.x, leader.y)).keep then local castle = wesnoth.get_locations { x = "1-"..width, y = "1-"..height, { "and", { x = leader.x, y = leader.y, radius = 200, { "filter_radius", { terrain = 'C*,K*,C*^*,K*^*,*^K*,*^C*' } } }} } local should_wait = false for i,loc in ipairs(castle) do local unit = wesnoth.get_unit(loc[1], loc[2]) if not unit then should_wait = false break elseif unit.moves > 0 then should_wait = true end end if should_wait then self.data.leader_score = 15000 end end if AH.print_eval() then AH.done_eval_messages(start_time, ca_name) end return self.data.leader_score end if AH.print_eval() then AH.done_eval_messages(start_time, ca_name) end return 0 end function generic_rush:castle_switch_exec() local leader = wesnoth.get_units { side = wesnoth.current.side, canrecruit = 'yes' }[1] if AH.print_exec() then print_time(' Executing castle_switch CA') end if AH.show_messages() then W.message { speaker = leader.id, message = 'Switching castles' } end AH.checked_move(ai, leader, self.data.leader_target[1], self.data.leader_target[2]) self.data.leader_target = nil end ------- Grab Villages CA -------------- function generic_rush:grab_villages_eval() local start_time, ca_name = wesnoth.get_time_stamp() / 1000., 'grab_villages' if AH.print_eval() then print_time(' - Evaluating grab_villages CA:') end -- Check if there are units with moves left local units = wesnoth.get_units { side = wesnoth.current.side, canrecruit = 'no', formula = 'movement_left > 0' } if (not units[1]) then if AH.print_eval() then AH.done_eval_messages(start_time, ca_name) end return 0 end local enemies = AH.get_live_units { { "filter_side", {{"enemy_of", {side = wesnoth.current.side} }} } } local villages = wesnoth.get_villages() -- Just in case: if (not villages[1]) then if AH.print_eval() then AH.done_eval_messages(start_time, ca_name) end return 0 end --print('#units, #enemies', #units, #enemies) -- First check if attacks are possible for any unit local return_value = 200000 -- If one with > 50% chance of kill is possible, set return_value to lower than combat CA local attacks = ai.get_attacks() --print(#attacks) for i,a in ipairs(attacks) do if (#a.movements == 1) and (a.chance_to_kill > 0.5) then return_value = 90000 break end end -- Also find which locations can be attacked by enemies local enemy_attack_map = BC.get_attack_map(enemies).units -- Now we go through the villages and units local max_rating, best_village, best_unit = -9e99, {}, {} local village_ratings = {} for j,v in ipairs(villages) do -- First collect all information that only depends on the village local village_rating = 0 -- This is the unit independent rating local unit_in_way = wesnoth.get_unit(v[1], v[2]) -- If an enemy can get within one move of the village, we want to hold it if enemy_attack_map:get(v[1], v[2]) then --print(' within enemy reach', v[1], v[2]) village_rating = village_rating + 100 end -- Unowned and enemy-owned villages get a large bonus local owner = wesnoth.get_village_owner(v[1], v[2]) if (not owner) then village_rating = village_rating + 10000 else if wesnoth.is_enemy(owner, wesnoth.current.side) then village_rating = village_rating + 20000 end end local enemy_distance_from_village = AH.get_closest_enemy(v) -- Now we go on to the unit-dependent rating local best_unit_rating = -9e99 local reachable = false for i,u in ipairs(units) do -- Skip villages that have units other than 'u' itself on them local village_occupied = false if unit_in_way and ((unit_in_way.x ~= u.x) or (unit_in_way.y ~= u.y)) then village_occupied = true end -- Rate all villages that can be reached and are unoccupied by other units if (not village_occupied) then -- Path finding is expensive, so we do a first cut simply by distance -- There is no way a unit can get to the village if the distance is greater than its moves local dist = H.distance_between(u.x, u.y, v[1], v[2]) if (dist <= u.moves) then local path, cost = wesnoth.find_path(u, v[1], v[2]) if (cost <= u.moves) then village_rating = village_rating - 1 reachable = true --print('Can reach:', u.id, v[1], v[2], cost) local rating = 0 -- Prefer strong units if enemies can reach the village, injured units otherwise if enemy_attack_map:get(v[1], v[2]) then rating = rating + u.hitpoints else rating = rating + u.max_hitpoints - u.hitpoints end -- Prefer not backtracking and moving more distant units to capture villages local enemy_distance_from_unit = AH.get_closest_enemy({u.x, u.y}) rating = rating - (enemy_distance_from_village + enemy_distance_from_unit)/5 if (rating > best_unit_rating) then best_unit_rating, best_unit = rating, u end --print(' rating:', rating) end end end end village_ratings[v] = {village_rating, best_unit, reachable} end for j,v in ipairs(villages) do local rating = village_ratings[v][1] if village_ratings[v][3] and rating > max_rating then max_rating, best_village, best_unit = rating, v, village_ratings[v][2] end end --print('max_rating', max_rating) if (max_rating > -9e99) then self.data.unit, self.data.village = best_unit, best_village if (max_rating >= 1000) then if AH.print_eval() then AH.done_eval_messages(start_time, ca_name) end return return_value else if AH.print_eval() then AH.done_eval_messages(start_time, ca_name) end return 0 end end if AH.print_eval() then AH.done_eval_messages(start_time, ca_name) end return 0 end function generic_rush:grab_villages_exec() if AH.print_exec() then print_time(' Executing grab_villages CA') end if AH.show_messages() then W.message { speaker = self.data.unit.id, message = 'Grab villages' } end AH.movefull_stopunit(ai, self.data.unit, self.data.village) self.data.unit, self.data.village = nil, nil end ------- Spread Poison CA -------------- function generic_rush:spread_poison_eval() local start_time, ca_name = wesnoth.get_time_stamp() / 1000., 'spread_poison' if AH.print_eval() then print_time(' - Evaluating spread_poison CA:') end -- If a unit with a poisoned weapon can make an attack, we'll do that preferentially -- (with some exceptions) local poisoners = AH.get_live_units { side = wesnoth.current.side, formula = 'attacks_left > 0', { "filter_wml", { { "attack", { { "specials", { { "poison", { } } } } } } } }, canrecruit = 'no' } --print('#poisoners', #poisoners) if (not poisoners[1]) then if AH.print_eval() then AH.done_eval_messages(start_time, ca_name) end return 0 end local attacks = AH.get_attacks(poisoners) --print('#attacks', #attacks) if (not attacks[1]) then if AH.print_eval() then AH.done_eval_messages(start_time, ca_name) end return 0 end -- Go through all possible attacks with poisoners local max_rating, best_attack = -9e99, {} for i,a in ipairs(attacks) do local attacker = wesnoth.get_unit(a.src.x, a.src.y) local defender = wesnoth.get_unit(a.target.x, a.target.y) -- Don't try to poison a unit that cannot be poisoned local cant_poison = defender.status.poisoned or defender.status.unpoisonable -- For now, we also simply don't poison units on villages (unless standard combat CA does it) local on_village = wesnoth.get_terrain_info(wesnoth.get_terrain(defender.x, defender.y)).village -- Also, poisoning units that would level up through the attack or could level on their turn as a result is very bad local about_to_level = defender.max_experience - defender.experience <= (wesnoth.unit_types[attacker.type].level * 2) if (not cant_poison) and (not on_village) and (not about_to_level) then -- Strongest enemy gets poisoned first local rating = defender.hitpoints -- Always attack enemy leader, if possible if defender.canrecruit then rating = rating + 1000 end -- Enemies that can regenerate are not good targets if wesnoth.unit_ability(defender, 'regenerate') then rating = rating - 1000 end -- More priority to enemies on strong terrain local defender_defense = 100 - wesnoth.unit_defense(defender, wesnoth.get_terrain(defender.x, defender.y)) rating = rating + defender_defense / 4. -- For the same attacker/defender pair, go to strongest terrain local attack_defense = 100 - wesnoth.unit_defense(attacker, wesnoth.get_terrain(a.dst.x, a.dst.y)) rating = rating + attack_defense / 2. --print('rating', rating) -- And from village everything else being equal local is_village = wesnoth.get_terrain_info(wesnoth.get_terrain(a.dst.x, a.dst.y)).village if is_village then rating = rating + 0.5 end if rating > max_rating then max_rating, best_attack = rating, a end end end if (max_rating > -9e99) then self.data.attack = best_attack if AH.print_eval() then AH.done_eval_messages(start_time, ca_name) end return 190000 end if AH.print_eval() then AH.done_eval_messages(start_time, ca_name) end return 0 end function generic_rush:spread_poison_exec() local attacker = wesnoth.get_unit(self.data.attack.src.x, self.data.attack.src.y) if AH.print_exec() then print_time(' Executing spread_poison CA') end if AH.show_messages() then W.message { speaker = attacker.id, message = 'Poison attack' } end local defender = wesnoth.get_unit(self.data.attack.target.x, self.data.attack.target.y) AH.movefull_stopunit(ai, attacker, self.data.attack.dst.x, self.data.attack.dst.y) if (not attacker) or (not attacker.valid) then return end if (not defender) or (not defender.valid) then return end -- Find the poison weapon -- If several attacks have poison, this will always find the last one local is_poisoner, poison_weapon = AH.has_weapon_special(attacker, "poison") AH.checked_attack(ai, attacker, defender, poison_weapon) self.data.attack = nil end ------- Place Healers CA -------------- function generic_rush:place_healers_eval() if HS:evaluation(ai, {}, self) > 0 then return 95000 end return 0 end function generic_rush:place_healers_exec() HS:execution(ai, nil, self) end ------- Retreat CA -------------- function generic_rush:retreat_injured_units_eval() local units = wesnoth.get_units { side = wesnoth.current.side, formula = 'movement_left > 0' } local unit, loc = R.retreat_injured_units(units) if unit then self.data.retreat_unit = unit self.data.retreat_loc = loc -- First check if attacks are possible for any unit -- If one with > 50% chance of kill is possible, set return_value to lower than combat CA local attacks = ai.get_attacks() for i,a in ipairs(attacks) do if (#a.movements == 1) and (a.chance_to_kill > 0.5) then return 95000 end end return 205000 end return 0 end function generic_rush:retreat_injured_units_exec() AH.movefull_outofway_stopunit(ai, self.data.retreat_unit, self.data.retreat_loc) self.data.retreat_unit = nil self.data.retreat_loc = nil end ------- Village Hunt CA -------------- -- Give extra priority to seeking villages if we have less than our share -- our share is defined as being slightly more than the total/the number of sides function generic_rush:village_hunt_eval() local villages = wesnoth.get_villages() if not villages[1] then return 0 end local my_villages = wesnoth.get_villages { owner_side = wesnoth.current.side } if #my_villages > #villages / #wesnoth.sides then return 0 end local allied_villages = wesnoth.get_villages { {"filter_owner", { {"ally_of", { side = wesnoth.current.side }} }} } if #allied_villages == #villages then return 0 end local units = wesnoth.get_units { side = wesnoth.current.side, canrecruit = false, formula = 'movement_left > 0' } if not units[1] then return 0 end return 30000 end function generic_rush:village_hunt_exec() local unit = wesnoth.get_units({ side = wesnoth.current.side, canrecruit = false, formula = 'movement_left > 0' })[1] local villages = wesnoth.get_villages() local target, best_cost = nil, AH.no_path for i,v in ipairs(villages) do if not wesnoth.match_location(v[1], v[2], { {"filter_owner", { {"ally_of", { side = wesnoth.current.side }} }} }) then local path, cost = wesnoth.find_path(unit, v[1], v[2], { ignore_units = true, max_cost = best_cost }) if cost < best_cost then target = v best_cost = cost end end end if target then local x, y = wesnoth.find_vacant_tile(target[1], target[2], unit) local dest = AH.next_hop(unit, x, y) AH.checked_move(ai, unit, dest[1], dest[2]) end end return generic_rush end }
gpl-2.0
Atebite/NutScript
plugins/wepselect.lua
3
4526
PLUGIN.name = "Weapon Select" PLUGIN.author = "Chessnut" PLUGIN.desc = "A replacement for the default weapon selection." if (SERVER) then concommand.Add("nut_selectweapon", function(client, command, arguments) local index = tonumber(arguments[1]) or 1 local weapon = client:GetWeapons()[index] if (IsValid(weapon)) then client:SelectWeapon(weapon:GetClass()) end end) else PLUGIN.index = PLUGIN.index or 1 PLUGIN.deltaIndex = PLUGIN.deltaIndex or PLUGIN.index PLUGIN.infoAlpha = PLUGIN.infoAlpha or 0 PLUGIN.alpha = PLUGIN.alpha or 0 PLUGIN.alphaDelta = PLUGIN.alphaDelta or PLUGIN.alpha PLUGIN.fadeTime = PLUGIN.fadeTime or 0 function PLUGIN:HUDPaint() local frameTime = FrameTime() self.alphaDelta = Lerp(frameTime * 10, self.alphaDelta, self.alpha) local fraction = self.alphaDelta if (fraction > 0) then local weapons = LocalPlayer():GetWeapons() local total = #weapons local x, y = ScrW() * 0.5, ScrH() * 0.5 local spacing = math.pi * 0.85 local radius = 240 * self.alphaDelta self.deltaIndex = Lerp(frameTime * 12, self.deltaIndex, self.index) --math.Approach(self.deltaIndex, self.index, fTime() * 12) local index = self.deltaIndex for k, v in ipairs(weapons) do if (!weapons[self.index]) then self.index = total end local theta = (k - index) * 0.1 local color = ColorAlpha(k == self.index and nut.config.get("color") or color_white, (255 - math.abs(theta * 3) * 255) * fraction) local lastY = 0 local shiftX = ScrW()*.02 if (self.markup and k < self.index) then local w, h = self.markup:Size() lastY = (h * fraction) if (k == self.index - 1) then self.infoAlpha = Lerp(frameTime * 3, self.infoAlpha, 255) self.markup:Draw(x + 5 + shiftX, y + 30, 0, 0, self.infoAlpha * fraction) end end surface.SetFont("nutSubTitleFont") local tx, ty = surface.GetTextSize(v:GetPrintName():upper()) local scale = (1 - math.abs(theta*2)) local matrix = Matrix() matrix:Translate(Vector( shiftX + x + math.cos(theta * spacing + math.pi) * radius + radius, y + lastY + math.sin(theta * spacing + math.pi) * radius - ty/2 , 1)) matrix:Rotate(angle or Angle(0, 0, 0)) matrix:Scale(Vector(1, 1, 0) * scale) cam.PushModelMatrix(matrix) nut.util.drawText(v:GetPrintName():upper(), 2, ty/2, color, 0, 1, "nutSubTitleFont") cam.PopModelMatrix() end if (self.fadeTime < CurTime() and self.alpha > 0) then self.alpha = 0 end end end local weaponInfo = { "Author", "Contact", "Purpose", "Instructions" } function PLUGIN:onIndexChanged() self.alpha = 1 self.fadeTime = CurTime() + 5 local weapon = LocalPlayer():GetWeapons()[self.index] self.markup = nil if (IsValid(weapon)) then local text = "" for k, v in ipairs(weaponInfo) do if (weapon[v] and weapon[v]:find("%S")) then local color = nut.config.get("color") text = text.."<font=nutSmallBoldFont><color="..color.r..","..color.g..","..color.b..">"..L(v).."</font></color>\n"..weapon[v].."\n" end end if (text != "") then self.markup = markup.Parse("<font=nutSmallFont>"..text, ScrW() * 0.3) self.infoAlpha = 0 end local source, pitch = hook.Run("WeaponCycleSound") or "common/talk.wav" LocalPlayer():EmitSound(source or "common/talk.wav", 50, pitch or 180) end end function PLUGIN:PlayerBindPress(client, bind, pressed) local weapon = client:GetActiveWeapon() if (!client:InVehicle() and (!IsValid(weapon) or weapon:GetClass() != "weapon_physgun" or !client:KeyDown(IN_ATTACK))) then bind = bind:lower() if (bind:find("invprev") and pressed) then self.index = self.index - 1 if (self.index < 1) then self.index = #client:GetWeapons() end self:onIndexChanged() return true elseif (bind:find("invnext") and pressed) then self.index = self.index + 1 if (self.index > #client:GetWeapons()) then self.index = 1 end self:onIndexChanged() return true elseif (bind:find("slot")) then self.index = math.Clamp(tonumber(bind:match("slot(%d)")) or 1, 1, #LocalPlayer():GetWeapons()) self:onIndexChanged() return true elseif (bind:find("attack") and pressed and self.alpha > 0) then LocalPlayer():EmitSound(hook.Run("WeaponSelectSound", LocalPlayer():GetWeapons()[self.index]) or "buttons/button16.wav") RunConsoleCommand("nut_selectweapon", self.index) self.alpha = 0 return true end end end end
mit
bnetcc/darkstar
scripts/zones/Abyssea-Konschtat/npcs/Conflux_Surveyor.lua
3
3234
----------------------------------- -- Zone: Abyssea - Konschtat -- NPC: Conflux Surveyor -- Type: -- !pos 133.000 -72.738 -824.000 15 ----------------------------------- package.loaded["scripts/zones/Abyssea-Konschtat/TextIDs"] = nil; ----------------------------------- require("scripts/globals/settings"); require("scripts/globals/abyssea"); require("scripts/zones/Abyssea-Konschtat/TextIDs"); ----------------------------------- function onTrade(player,npc,trade) end; function onTrigger(player,npc) local visitant = 0; local prevtime = player:getVar("Abyssea_Time"); local STONES = getTravStonesTotal(player); local SOJOURN = getAbyssiteTotal(player,SOJOURN); if (player:hasStatusEffect(EFFECT_VISITANT)) then visitant = 60; end player:startEvent(2001,0,visitant,prevtime,STONES,SOJOURN,0,0,0); end; function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); local SOJOURN = getAbyssiteTotal(player,"SOJOURN"); local duration = 0; local prevtime = player:getVar("Abyssea_Time"); -- Gets reduced by Visitants "on tic". if (prevtime > 7200) then prevtime = 7200; duration = prevtime; else duration = prevtime; end duration = duration+(SOJOURN *180); if (csid == 2001) then if (option == 2) then -- Use no stones, use previous remaining time player:addStatusEffect(EFFECT_VISITANT,0,3,duration,0,0); player:setVar("Abyssea_Time",duration); elseif (option == 65538) then -- Use 1 stone duration = ((duration + 1800) * VISITANT_BONUS); player:addStatusEffect(EFFECT_VISITANT,0,3,duration,0,0); player:setVar("Abyssea_Time",duration); spendTravStones(player,1); elseif (option == 65539) then -- Use 1 stone player:PrintToPlayer( "Not implemented yet, sorry!" ); -- Todo: extend time elseif (option == 131074) then -- Use 2 stone duration = ((duration + 3600) * VISITANT_BONUS); player:addStatusEffect(EFFECT_VISITANT,0,3,duration,0,0); player:setVar("Abyssea_Time",duration); spendTravStones(player,2); elseif (option == 131075) then -- Use 2 stone player:PrintToPlayer( "Not implemented yet, sorry!" ); -- Todo: extend time elseif (option == 196610) then -- Use 3 stone duration = ((duration + 5400) * VISITANT_BONUS); player:addStatusEffect(EFFECT_VISITANT,0,3,duration,0,0); player:setVar("Abyssea_Time",duration); spendTravStones(player,3); elseif (option == 196611) then -- Use 3 stone player:PrintToPlayer( "Not implemented yet, sorry!" ); -- Todo: extend time elseif (option == 262146) then -- Use 4 stone duration = ((duration + 7200) * VISITANT_BONUS); player:addStatusEffect(EFFECT_VISITANT,0,3,duration,0,0); player:setVar("Abyssea_Time",duration); spendTravStones(player,4); end end end;
gpl-3.0
hooksta4/darkstar
scripts/zones/The_Boyahda_Tree/npcs/Grounds_Tome.lua
2
1103
----------------------------------- -- Area: The Boyahda Tree -- NPC: Grounds Tome ----------------------------------- require("scripts/globals/settings"); require("scripts/globals/groundsofvalor"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) startGov(GOV_EVENT_BOYAHDA_TREE,player); end; ----------------------------------- -- onEventSelection ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); updateGov(player,csid,option,719,720,721,722,723,724,725,726,726,726); end; ----------------------------------- -- onEventFinish Action ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); finishGov(player,csid,option,719,720,721,722,723,724,725,726,726,726,GOV_MSG_BOYAHDA_TREE); end;
gpl-3.0
hooksta4/darkstar
scripts/zones/Aht_Urhgan_Whitegate/npcs/Mhasbaf.lua
37
1030
----------------------------------- -- Area: Aht Urhgan Whitegate -- NPC: Mhasbaf -- Type: Standard NPC -- @pos 54.701 -6.999 11.387 50 ----------------------------------- package.loaded["scripts/zones/Aht_Urhgan_Whitegate/TextIDs"] = nil; ----------------------------------- require("scripts/zones/Aht_Urhgan_Whitegate/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) player:startEvent(0x021e); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end;
gpl-3.0
hooksta4/darkstar
scripts/zones/zones/Port_Bastok/npcs/Sawyer.lua
17
1551
----------------------------------- -- Area: Port Bastok -- NPC: Sawyer -- Standard Merchant NPC -- Confirmed shop stock, August 2013 ----------------------------------- require("scripts/globals/shop"); package.loaded["scripts/zones/Port_Bastok/TextIDs"] = nil; require("scripts/zones/Port_Bastok/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) player:showText(npc,SAWYER_SHOP_DIALOG); stock = { 0x11EF, 147,1, --Pumpernickel 0x1141, 3036,1, --Egg Soup 0x115A, 368,1, --Pineapple Juice 0x1127, 22,2, --Bretzel 0x11E2, 143,2, --Sausage 0x1148, 1012,2, --Melon Juice 0x1155, 662,2, --Roast Mutton 0x1193, 92,3, --Iron Bread 0x1154, 294,3, --Baked Popoto 0x1167, 184,3, --Pebble Soup 0x119D, 10,3 --Distilled Water } showNationShop(player, BASTOK, stock); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end;
gpl-3.0
gedadsbranch/Darkstar-Mission
scripts/zones/Windurst_Walls/npcs/Juvillie.lua
38
1041
----------------------------------- -- Area: Windurst Walls -- NPC: Juvillie -- Type: Event Replayer -- @zone: 239 -- @pos -180.731 -3.451 143.138 -- -- Auto-Script: Requires Verification (Verfied by Brawndo) ----------------------------------- package.loaded["scripts/zones/Windurst_Walls/TextIDs"] = nil; ----------------------------------- ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) player:startEvent(0x0196); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end;
gpl-3.0
hooksta4/darkstar
scripts/zones/Abyssea-Altepa/Zone.lua
33
1470
----------------------------------- -- -- Zone: Abyssea - Altepa -- ----------------------------------- package.loaded["scripts/zones/Abyssea-Altepa/TextIDs"] = nil; ----------------------------------- require("scripts/globals/settings"); require("scripts/globals/quests"); require("scripts/zones/Abyssea-Altepa/TextIDs"); ----------------------------------- -- onInitialize ----------------------------------- function onInitialize(zone) end; ----------------------------------- -- onZoneIn ----------------------------------- function onZoneIn(player,prevZone) local cs = -1; if (player:getXPos() == 0 and player:getYPos() == 0 and player:getZPos() == 0) then player:setPos(435 ,0 ,320 ,136) end if (player:getQuestStatus(ABYSSEA, THE_TRUTH_BECKONS) == QUEST_ACCEPTED and player:getVar("1stTimeAyssea") == 0) then player:setVar("1stTimeAyssea",1); end return cs; end; ----------------------------------- -- onRegionEnter ----------------------------------- function onRegionEnter(player,region) end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end;
gpl-3.0
hooksta4/darkstar
scripts/zones/zones/Sacrarium/mobs/Old_Professor_Mariselle.lua
2
2159
----------------------------------- -- Area: Sacrarium -- NPC: Old Professor Mariselle ----------------------------------- require("scripts/globals/keyitems"); require("scripts/globals/missions"); ----------------------------------- -- onMobSpawn ----------------------------------- function onMobSpawn(mob) end; ----------------------------------- -- onMobFight ----------------------------------- function onMobFight(mob,target) local OP_Mariselle = mob:getID(); -- Summons a pupil every 30 seconds. -- TODO: Casting animation for summons. When he spawns them isn't retail accurate. -- TODO: Make him and the clones teleport around the room every 30s if (mob:getBattleTime() % 30 < 3 and mob:getBattleTime() > 3) then for i = OP_Mariselle+1, OP_Mariselle+2 do if (GetMobAction(i) == 0) then SpawnMob(i):updateEnmity(target); GetMobByID(i):setPos(GetMobByID(OP_Mariselle):getXPos()+1, GetMobByID(OP_Mariselle):getYPos(), GetMobByID(OP_Mariselle):getZPos()+1); -- Set pupil x and z position +1 from Mariselle return; end end end end; ----------------------------------- -- onMobDeath ----------------------------------- function onMobDeath(mob, killer) local OP_Mariselle = mob:getID(); for i = OP_Mariselle+1, OP_Mariselle+2 do if (GetMobAction(i) ~= 0) then DespawnMob(i); end end if (killer:getCurrentMission(COP) == THE_SECRETS_OF_WORSHIP and killer:getVar("PromathiaStatus") == 3 and killer:hasKeyItem(RELIQUIARIUM_KEY)==false) then killer:setVar("PromathiaStatus",4); end -- Set random variable for determining Old Prof. Mariselle's next spawn location local rand = math.random((2),(7)); SetServerVariable("Old_Prof_Spawn_Location", rand); end; ----------------------------------- -- OnMobDespawn ----------------------------------- function onMobDespawn( mob ) local OP_Mariselle = mob:getID(); for i = OP_Mariselle+1, OP_Mariselle+2 do if (GetMobAction(i) ~= 0) then DespawnMob(i); end end -- Set random variable for determining Old Prof. Mariselle's next spawn location local rand = math.random((2),(7)); SetServerVariable("Old_Prof_Spawn_Location", rand); end;
gpl-3.0
hooksta4/darkstar
scripts/zones/zones/Lower_Jeuno/npcs/Morefie.lua
6
1119
----------------------------------- -- Area: Lower Jeuno -- NPC: Morefie -- Standard Merchant NPC ----------------------------------- require("scripts/globals/shop"); package.loaded["scripts/zones/Lower_Jeuno/TextIDs"] = nil; require("scripts/zones/Lower_Jeuno/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) player:showText(npc,MOREFIE_SHOP_DIALOG); stock = {0x340F,1250, -- Silver Earring 0x3490,1250, -- Silver Ring 0x3410,4140} -- Mythril Earring showShop(player, STATIC, stock); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end;
gpl-3.0
snabbco/snabb
lib/ljndpi/ndpi/protocol_ids_2_3.lua
6
13824
-- Generated by ljdnpi's tools/update-protocol-ids script local T = { [0] = "PROTOCOL_UNKNOWN", [0] = "PROTOCOL_UNKNOWN", [1] = "PROTOCOL_FTP_CONTROL", [2] = "PROTOCOL_SIZE", [2] = "PROTOCOL_MAIL_POP", [3] = "PROTOCOL_MAIL_SMTP", [4] = "PROTOCOL_MAIL_IMAP", [5] = "PROTOCOL_DNS", [6] = "PROTOCOL_IPP", [7] = "PROTOCOL_HTTP", [8] = "PROTOCOL_MDNS", [9] = "PROTOCOL_NTP", [10] = "PROTOCOL_NETBIOS", [11] = "PROTOCOL_NFS", [12] = "PROTOCOL_SSDP", [13] = "PROTOCOL_BGP", [14] = "PROTOCOL_SNMP", [15] = "PROTOCOL_XDMCP", [16] = "PROTOCOL_SMB", [17] = "PROTOCOL_SYSLOG", [18] = "PROTOCOL_DHCP", [19] = "PROTOCOL_POSTGRES", [20] = "PROTOCOL_MYSQL", [21] = "PROTOCOL_HOTMAIL", [22] = "PROTOCOL_DIRECT_DOWNLOAD_LINK", [23] = "PROTOCOL_MAIL_POPS", [24] = "PROTOCOL_APPLEJUICE", [25] = "PROTOCOL_DIRECTCONNECT", [26] = "PROTOCOL_NTOP", [27] = "PROTOCOL_COAP", [28] = "PROTOCOL_VMWARE", [29] = "PROTOCOL_MAIL_SMTPS", [30] = "PROTOCOL_FBZERO", [31] = "PROTOCOL_UBNTAC2", [32] = "PROTOCOL_KONTIKI", [33] = "PROTOCOL_OPENFT", [34] = "PROTOCOL_FASTTRACK", [35] = "PROTOCOL_GNUTELLA", [36] = "PROTOCOL_EDONKEY", [37] = "PROTOCOL_BITTORRENT", [38] = "PROTOCOL_SKYPE_CALL_OUT", [39] = "PROTOCOL_MUSICALLY", [40] = "PROTOCOL_FREE_40", [41] = "PROTOCOL_FREE_41", [42] = "PROTOCOL_FREE_42", [43] = "PROTOCOL_FREE_43", [44] = "PROTOCOL_FREE_44", [45] = "PROTOCOL_FREE_45", [46] = "PROTOCOL_FREE_46", [47] = "PROTOCOL_XBOX", [48] = "PROTOCOL_QQ", [49] = "PROTOCOL_SKYPE_CALL_IN", [50] = "PROTOCOL_RTSP", [51] = "PROTOCOL_MAIL_IMAPS", [52] = "PROTOCOL_ICECAST", [53] = "PROTOCOL_PPLIVE", [54] = "PROTOCOL_PPSTREAM", [55] = "PROTOCOL_ZATTOO", [56] = "PROTOCOL_SHOUTCAST", [57] = "PROTOCOL_SOPCAST", [58] = "PROTOCOL_TVANTS", [59] = "PROTOCOL_TVUPLAYER", [60] = "PROTOCOL_HTTP_DOWNLOAD", [61] = "PROTOCOL_QQLIVE", [62] = "PROTOCOL_THUNDER", [63] = "PROTOCOL_SOULSEEK", [64] = "PROTOCOL_SSL_NO_CERT", [65] = "PROTOCOL_IRC", [66] = "PROTOCOL_AYIYA", [67] = "PROTOCOL_UNENCRYPTED_JABBER", [68] = "PROTOCOL_MSN", [69] = "PROTOCOL_OSCAR", [70] = "PROTOCOL_YAHOO", [71] = "PROTOCOL_BATTLEFIELD", [72] = "PROTOCOL_GOOGLE_PLUS", [73] = "PROTOCOL_IP_VRRP", [74] = "PROTOCOL_STEAM", [75] = "PROTOCOL_HALFLIFE2", [76] = "PROTOCOL_WORLDOFWARCRAFT", [77] = "PROTOCOL_TELNET", [78] = "PROTOCOL_STUN", [79] = "PROTOCOL_IP_IPSEC", [80] = "PROTOCOL_IP_GRE", [81] = "PROTOCOL_IP_ICMP", [82] = "PROTOCOL_IP_IGMP", [83] = "PROTOCOL_IP_EGP", [84] = "PROTOCOL_IP_SCTP", [85] = "PROTOCOL_IP_OSPF", [86] = "PROTOCOL_IP_IP_IN_IP", [87] = "PROTOCOL_RTP", [88] = "PROTOCOL_RDP", [89] = "PROTOCOL_VNC", [90] = "PROTOCOL_PCANYWHERE", [91] = "PROTOCOL_SSL", [92] = "PROTOCOL_SSH", [93] = "PROTOCOL_USENET", [94] = "PROTOCOL_MGCP", [95] = "PROTOCOL_IAX", [96] = "PROTOCOL_TFTP", [97] = "PROTOCOL_AFP", [98] = "PROTOCOL_STEALTHNET", [99] = "PROTOCOL_AIMINI", [100] = "PROTOCOL_SIP", [101] = "PROTOCOL_TRUPHONE", [102] = "PROTOCOL_IP_ICMPV6", [103] = "PROTOCOL_DHCPV6", [104] = "PROTOCOL_ARMAGETRON", [105] = "PROTOCOL_CROSSFIRE", [106] = "PROTOCOL_DOFUS", [107] = "PROTOCOL_FIESTA", [108] = "PROTOCOL_FLORENSIA", [109] = "PROTOCOL_GUILDWARS", [110] = "PROTOCOL_HTTP_APPLICATION_ACTIVESYNC", [111] = "PROTOCOL_KERBEROS", [112] = "PROTOCOL_LDAP", [113] = "PROTOCOL_MAPLESTORY", [114] = "PROTOCOL_MSSQL_TDS", [115] = "PROTOCOL_PPTP", [116] = "PROTOCOL_WARCRAFT3", [117] = "PROTOCOL_WORLD_OF_KUNG_FU", [118] = "PROTOCOL_SLACK", [119] = "PROTOCOL_FACEBOOK", [120] = "PROTOCOL_TWITTER", [121] = "PROTOCOL_DROPBOX", [122] = "PROTOCOL_GMAIL", [123] = "PROTOCOL_GOOGLE_MAPS", [124] = "PROTOCOL_YOUTUBE", [125] = "PROTOCOL_SKYPE", [126] = "PROTOCOL_GOOGLE", [127] = "PROTOCOL_DCERPC", [128] = "PROTOCOL_NETFLOW", [129] = "PROTOCOL_SFLOW", [130] = "PROTOCOL_HTTP_CONNECT", [131] = "PROTOCOL_HTTP_PROXY", [132] = "PROTOCOL_CITRIX", [133] = "PROTOCOL_NETFLIX", [134] = "PROTOCOL_LASTFM", [135] = "PROTOCOL_WAZE", [136] = "PROTOCOL_YOUTUBE_UPLOAD", [137] = "PROTOCOL_ICQ", [138] = "PROTOCOL_CHECKMK", [139] = "PROTOCOL_AJP", [140] = "PROTOCOL_APPLE", [141] = "PROTOCOL_WEBEX", [142] = "PROTOCOL_WHATSAPP", [143] = "PROTOCOL_APPLE_ICLOUD", [144] = "PROTOCOL_VIBER", [145] = "PROTOCOL_APPLE_ITUNES", [146] = "PROTOCOL_RADIUS", [147] = "PROTOCOL_WINDOWS_UPDATE", [148] = "PROTOCOL_TEAMVIEWER", [149] = "PROTOCOL_TUENTI", [150] = "PROTOCOL_LOTUS_NOTES", [151] = "PROTOCOL_SAP", [152] = "PROTOCOL_GTP", [153] = "PROTOCOL_UPNP", [154] = "PROTOCOL_LLMNR", [155] = "PROTOCOL_REMOTE_SCAN", [156] = "PROTOCOL_SPOTIFY", [157] = "PROTOCOL_MESSENGER", [158] = "PROTOCOL_H323", [159] = "PROTOCOL_OPENVPN", [160] = "PROTOCOL_NOE", [161] = "PROTOCOL_CISCOVPN", [162] = "PROTOCOL_TEAMSPEAK", [163] = "PROTOCOL_TOR", [164] = "PROTOCOL_SKINNY", [165] = "PROTOCOL_RTCP", [166] = "PROTOCOL_RSYNC", [167] = "PROTOCOL_ORACLE", [168] = "PROTOCOL_CORBA", [169] = "PROTOCOL_UBUNTUONE", [170] = "PROTOCOL_WHOIS_DAS", [171] = "PROTOCOL_COLLECTD", [172] = "PROTOCOL_SOCKS", [173] = "PROTOCOL_NINTENDO", [174] = "PROTOCOL_RTMP", [175] = "PROTOCOL_FTP_DATA", [176] = "PROTOCOL_WIKIPEDIA", [177] = "PROTOCOL_ZMQ", [178] = "PROTOCOL_AMAZON", [179] = "PROTOCOL_EBAY", [180] = "PROTOCOL_CNN", [181] = "PROTOCOL_MEGACO", [182] = "PROTOCOL_REDIS", [183] = "PROTOCOL_PANDO", [184] = "PROTOCOL_VHUA", [185] = "PROTOCOL_TELEGRAM", [186] = "PROTOCOL_VEVO", [187] = "PROTOCOL_PANDORA", [188] = "PROTOCOL_QUIC", [189] = "PROTOCOL_WHATSAPP_VOICE", [190] = "PROTOCOL_EAQ", [191] = "PROTOCOL_OOKLA", [192] = "PROTOCOL_AMQP", [193] = "PROTOCOL_KAKAOTALK", [194] = "PROTOCOL_KAKAOTALK_VOICE", [195] = "PROTOCOL_TWITCH", [196] = "PROTOCOL_QUICKPLAY", [197] = "PROTOCOL_WECHAT", [198] = "PROTOCOL_MPEGTS", [199] = "PROTOCOL_SNAPCHAT", [200] = "PROTOCOL_SINA", [201] = "PROTOCOL_HANGOUT", [202] = "PROTOCOL_IFLIX", [203] = "PROTOCOL_GITHUB", [204] = "PROTOCOL_BJNP", [205] = "PROTOCOL_1KXUN", [206] = "PROTOCOL_IQIYI", [207] = "PROTOCOL_SMPP", [208] = "PROTOCOL_DNSCRYPT", [209] = "PROTOCOL_TINC", [210] = "PROTOCOL_DEEZER", [211] = "PROTOCOL_INSTAGRAM", [212] = "PROTOCOL_MICROSOFT", [213] = "PROTOCOL_STARCRAFT", [214] = "PROTOCOL_TEREDO", [215] = "PROTOCOL_HOTSPOT_SHIELD", [216] = "PROTOCOL_HEP", [217] = "PROTOCOL_GOOGLE_DRIVE", [218] = "PROTOCOL_OCS", [219] = "PROTOCOL_OFFICE_365", [220] = "PROTOCOL_CLOUDFLARE", [221] = "PROTOCOL_MS_ONE_DRIVE", [222] = "PROTOCOL_MQTT", [223] = "PROTOCOL_RX", [224] = "PROTOCOL_APPLESTORE", [225] = "PROTOCOL_OPENDNS", [226] = "PROTOCOL_GIT", [227] = "PROTOCOL_DRDA", [228] = "PROTOCOL_PLAYSTORE", [229] = "PROTOCOL_SOMEIP", [230] = "PROTOCOL_FIX", [231] = "PROTOCOL_PLAYSTATION", [232] = "PROTOCOL_PASTEBIN", [233] = "PROTOCOL_LINKEDIN", [234] = "PROTOCOL_SOUNDCLOUD", [235] = "PROTOCOL_CSGO", [236] = "PROTOCOL_LISP", [237] = "PROTOCOL_DIAMETER", [238] = "PROTOCOL_APPLE_PUSH", [239] = "PROTOCOL_GOOGLE_SERVICES", [240] = "PROTOCOL_AMAZON_VIDEO", [241] = "PROTOCOL_GOOGLE_DOCS", [242] = "PROTOCOL_WHATSAPP_FILES", [243] = "PROTOCOL_VIDTO", [244] = "PROTOCOL_RAPIDVIDEO", [245] = "PROTOCOL_SHOWMAX", PROTOCOL_UNKNOWN = 0, PROTOCOL_UNKNOWN = 0, PROTOCOL_FTP_CONTROL = 1, PROTOCOL_SIZE = 2, PROTOCOL_MAIL_POP = 2, PROTOCOL_MAIL_SMTP = 3, PROTOCOL_MAIL_IMAP = 4, PROTOCOL_DNS = 5, PROTOCOL_IPP = 6, PROTOCOL_HTTP = 7, PROTOCOL_MDNS = 8, PROTOCOL_NTP = 9, PROTOCOL_NETBIOS = 10, PROTOCOL_NFS = 11, PROTOCOL_SSDP = 12, PROTOCOL_BGP = 13, PROTOCOL_SNMP = 14, PROTOCOL_XDMCP = 15, PROTOCOL_SMB = 16, PROTOCOL_SYSLOG = 17, PROTOCOL_DHCP = 18, PROTOCOL_POSTGRES = 19, PROTOCOL_MYSQL = 20, PROTOCOL_HOTMAIL = 21, PROTOCOL_DIRECT_DOWNLOAD_LINK = 22, PROTOCOL_MAIL_POPS = 23, PROTOCOL_APPLEJUICE = 24, PROTOCOL_DIRECTCONNECT = 25, PROTOCOL_NTOP = 26, PROTOCOL_COAP = 27, PROTOCOL_VMWARE = 28, PROTOCOL_MAIL_SMTPS = 29, PROTOCOL_FBZERO = 30, PROTOCOL_UBNTAC2 = 31, PROTOCOL_KONTIKI = 32, PROTOCOL_OPENFT = 33, PROTOCOL_FASTTRACK = 34, PROTOCOL_GNUTELLA = 35, PROTOCOL_EDONKEY = 36, PROTOCOL_BITTORRENT = 37, PROTOCOL_SKYPE_CALL_OUT = 38, PROTOCOL_MUSICALLY = 39, PROTOCOL_FREE_40 = 40, PROTOCOL_FREE_41 = 41, PROTOCOL_FREE_42 = 42, PROTOCOL_FREE_43 = 43, PROTOCOL_FREE_44 = 44, PROTOCOL_FREE_45 = 45, PROTOCOL_FREE_46 = 46, PROTOCOL_XBOX = 47, PROTOCOL_QQ = 48, PROTOCOL_SKYPE_CALL_IN = 49, PROTOCOL_RTSP = 50, PROTOCOL_MAIL_IMAPS = 51, PROTOCOL_ICECAST = 52, PROTOCOL_PPLIVE = 53, PROTOCOL_PPSTREAM = 54, PROTOCOL_ZATTOO = 55, PROTOCOL_SHOUTCAST = 56, PROTOCOL_SOPCAST = 57, PROTOCOL_TVANTS = 58, PROTOCOL_TVUPLAYER = 59, PROTOCOL_HTTP_DOWNLOAD = 60, PROTOCOL_QQLIVE = 61, PROTOCOL_THUNDER = 62, PROTOCOL_SOULSEEK = 63, PROTOCOL_SSL_NO_CERT = 64, PROTOCOL_IRC = 65, PROTOCOL_AYIYA = 66, PROTOCOL_UNENCRYPTED_JABBER = 67, PROTOCOL_MSN = 68, PROTOCOL_OSCAR = 69, PROTOCOL_YAHOO = 70, PROTOCOL_BATTLEFIELD = 71, PROTOCOL_GOOGLE_PLUS = 72, PROTOCOL_IP_VRRP = 73, PROTOCOL_STEAM = 74, PROTOCOL_HALFLIFE2 = 75, PROTOCOL_WORLDOFWARCRAFT = 76, PROTOCOL_TELNET = 77, PROTOCOL_STUN = 78, PROTOCOL_IP_IPSEC = 79, PROTOCOL_IP_GRE = 80, PROTOCOL_IP_ICMP = 81, PROTOCOL_IP_IGMP = 82, PROTOCOL_IP_EGP = 83, PROTOCOL_IP_SCTP = 84, PROTOCOL_IP_OSPF = 85, PROTOCOL_IP_IP_IN_IP = 86, PROTOCOL_RTP = 87, PROTOCOL_RDP = 88, PROTOCOL_VNC = 89, PROTOCOL_PCANYWHERE = 90, PROTOCOL_SSL = 91, PROTOCOL_SSH = 92, PROTOCOL_USENET = 93, PROTOCOL_MGCP = 94, PROTOCOL_IAX = 95, PROTOCOL_TFTP = 96, PROTOCOL_AFP = 97, PROTOCOL_STEALTHNET = 98, PROTOCOL_AIMINI = 99, PROTOCOL_SIP = 100, PROTOCOL_TRUPHONE = 101, PROTOCOL_IP_ICMPV6 = 102, PROTOCOL_DHCPV6 = 103, PROTOCOL_ARMAGETRON = 104, PROTOCOL_CROSSFIRE = 105, PROTOCOL_DOFUS = 106, PROTOCOL_FIESTA = 107, PROTOCOL_FLORENSIA = 108, PROTOCOL_GUILDWARS = 109, PROTOCOL_HTTP_APPLICATION_ACTIVESYNC = 110, PROTOCOL_KERBEROS = 111, PROTOCOL_LDAP = 112, PROTOCOL_MAPLESTORY = 113, PROTOCOL_MSSQL_TDS = 114, PROTOCOL_PPTP = 115, PROTOCOL_WARCRAFT3 = 116, PROTOCOL_WORLD_OF_KUNG_FU = 117, PROTOCOL_SLACK = 118, PROTOCOL_FACEBOOK = 119, PROTOCOL_TWITTER = 120, PROTOCOL_DROPBOX = 121, PROTOCOL_GMAIL = 122, PROTOCOL_GOOGLE_MAPS = 123, PROTOCOL_YOUTUBE = 124, PROTOCOL_SKYPE = 125, PROTOCOL_GOOGLE = 126, PROTOCOL_DCERPC = 127, PROTOCOL_NETFLOW = 128, PROTOCOL_SFLOW = 129, PROTOCOL_HTTP_CONNECT = 130, PROTOCOL_HTTP_PROXY = 131, PROTOCOL_CITRIX = 132, PROTOCOL_NETFLIX = 133, PROTOCOL_LASTFM = 134, PROTOCOL_WAZE = 135, PROTOCOL_YOUTUBE_UPLOAD = 136, PROTOCOL_ICQ = 137, PROTOCOL_CHECKMK = 138, PROTOCOL_AJP = 139, PROTOCOL_APPLE = 140, PROTOCOL_WEBEX = 141, PROTOCOL_WHATSAPP = 142, PROTOCOL_APPLE_ICLOUD = 143, PROTOCOL_VIBER = 144, PROTOCOL_APPLE_ITUNES = 145, PROTOCOL_RADIUS = 146, PROTOCOL_WINDOWS_UPDATE = 147, PROTOCOL_TEAMVIEWER = 148, PROTOCOL_TUENTI = 149, PROTOCOL_LOTUS_NOTES = 150, PROTOCOL_SAP = 151, PROTOCOL_GTP = 152, PROTOCOL_UPNP = 153, PROTOCOL_LLMNR = 154, PROTOCOL_REMOTE_SCAN = 155, PROTOCOL_SPOTIFY = 156, PROTOCOL_MESSENGER = 157, PROTOCOL_H323 = 158, PROTOCOL_OPENVPN = 159, PROTOCOL_NOE = 160, PROTOCOL_CISCOVPN = 161, PROTOCOL_TEAMSPEAK = 162, PROTOCOL_TOR = 163, PROTOCOL_SKINNY = 164, PROTOCOL_RTCP = 165, PROTOCOL_RSYNC = 166, PROTOCOL_ORACLE = 167, PROTOCOL_CORBA = 168, PROTOCOL_UBUNTUONE = 169, PROTOCOL_WHOIS_DAS = 170, PROTOCOL_COLLECTD = 171, PROTOCOL_SOCKS = 172, PROTOCOL_NINTENDO = 173, PROTOCOL_RTMP = 174, PROTOCOL_FTP_DATA = 175, PROTOCOL_WIKIPEDIA = 176, PROTOCOL_ZMQ = 177, PROTOCOL_AMAZON = 178, PROTOCOL_EBAY = 179, PROTOCOL_CNN = 180, PROTOCOL_MEGACO = 181, PROTOCOL_REDIS = 182, PROTOCOL_PANDO = 183, PROTOCOL_VHUA = 184, PROTOCOL_TELEGRAM = 185, PROTOCOL_VEVO = 186, PROTOCOL_PANDORA = 187, PROTOCOL_QUIC = 188, PROTOCOL_WHATSAPP_VOICE = 189, PROTOCOL_EAQ = 190, PROTOCOL_OOKLA = 191, PROTOCOL_AMQP = 192, PROTOCOL_KAKAOTALK = 193, PROTOCOL_KAKAOTALK_VOICE = 194, PROTOCOL_TWITCH = 195, PROTOCOL_QUICKPLAY = 196, PROTOCOL_WECHAT = 197, PROTOCOL_MPEGTS = 198, PROTOCOL_SNAPCHAT = 199, PROTOCOL_SINA = 200, PROTOCOL_HANGOUT = 201, PROTOCOL_IFLIX = 202, PROTOCOL_GITHUB = 203, PROTOCOL_BJNP = 204, PROTOCOL_1KXUN = 205, PROTOCOL_IQIYI = 206, PROTOCOL_SMPP = 207, PROTOCOL_DNSCRYPT = 208, PROTOCOL_TINC = 209, PROTOCOL_DEEZER = 210, PROTOCOL_INSTAGRAM = 211, PROTOCOL_MICROSOFT = 212, PROTOCOL_STARCRAFT = 213, PROTOCOL_TEREDO = 214, PROTOCOL_HOTSPOT_SHIELD = 215, PROTOCOL_HEP = 216, PROTOCOL_GOOGLE_DRIVE = 217, PROTOCOL_OCS = 218, PROTOCOL_OFFICE_365 = 219, PROTOCOL_CLOUDFLARE = 220, PROTOCOL_MS_ONE_DRIVE = 221, PROTOCOL_MQTT = 222, PROTOCOL_RX = 223, PROTOCOL_APPLESTORE = 224, PROTOCOL_OPENDNS = 225, PROTOCOL_GIT = 226, PROTOCOL_DRDA = 227, PROTOCOL_PLAYSTORE = 228, PROTOCOL_SOMEIP = 229, PROTOCOL_FIX = 230, PROTOCOL_PLAYSTATION = 231, PROTOCOL_PASTEBIN = 232, PROTOCOL_LINKEDIN = 233, PROTOCOL_SOUNDCLOUD = 234, PROTOCOL_CSGO = 235, PROTOCOL_LISP = 236, PROTOCOL_DIAMETER = 237, PROTOCOL_APPLE_PUSH = 238, PROTOCOL_GOOGLE_SERVICES = 239, PROTOCOL_AMAZON_VIDEO = 240, PROTOCOL_GOOGLE_DOCS = 241, PROTOCOL_WHATSAPP_FILES = 242, PROTOCOL_VIDTO = 243, PROTOCOL_RAPIDVIDEO = 244, PROTOCOL_SHOWMAX = 245, } T.PROTOCOL_NO_MASTER_PROTO = T.PROTOCOL_UNKNOWN return T
apache-2.0
hooksta4/darkstar
scripts/zones/Port_San_dOria/npcs/Prietta.lua
13
1435
----------------------------------- -- Area: Port San d'Oria -- NPC: Prietta -- Standard Info NPC ----------------------------------- package.loaded["scripts/zones/Port_San_dOria/TextIDs"] = nil; require("scripts/zones/Port_San_dOria/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) if (player:getQuestStatus(SANDORIA,FLYERS_FOR_REGINE) ==QUEST_ACCEPTED) then if (trade:hasItemQty(532,1) and trade:getItemCount() == 1 and player:getVar("tradePrietta") == 0) then player:messageSpecial(7121); player:setVar("FFR",player:getVar("FFR") - 1); player:setVar("tradePrietta",1); player:messageSpecial(7122,17 - player:getVar("FFR")); trade:complete(); elseif (player:getVar("tradePrietta") ==1) then player:messageSpecial(7120); end end end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) player:startEvent(0x254); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end;
gpl-3.0
Null22/senator
plugins/id.lua
355
2795
local function user_print_name(user) if user.print_name then return user.print_name end local text = '' if user.first_name then text = user.last_name..' ' end if user.lastname then text = text..user.last_name end return text end local function returnids(cb_extra, success, result) local receiver = cb_extra.receiver --local chat_id = "chat#id"..result.id local chat_id = result.id local chatname = result.print_name local text = 'IDs for chat '..chatname ..' ('..chat_id..')\n' ..'There are '..result.members_num..' members' ..'\n---------\n' i = 0 for k,v in pairs(result.members) do i = i+1 text = text .. i .. ". " .. string.gsub(v.print_name, "_", " ") .. " (" .. v.id .. ")\n" end send_large_msg(receiver, text) end local function username_id(cb_extra, success, result) local receiver = cb_extra.receiver local qusername = cb_extra.qusername local text = 'User '..qusername..' not found in this group!' for k,v in pairs(result.members) do vusername = v.username if vusername == qusername then text = 'ID for username\n'..vusername..' : '..v.id end end send_large_msg(receiver, text) end local function run(msg, matches) local receiver = get_receiver(msg) if matches[1] == "!id" then local text = 'Name : '.. string.gsub(user_print_name(msg.from),'_', ' ') .. '\nID : ' .. msg.from.id if is_chat_msg(msg) then text = text .. "\n\nYou are in group " .. string.gsub(user_print_name(msg.to), '_', ' ') .. " (ID: " .. msg.to.id .. ")" end return text elseif matches[1] == "chat" then -- !ids? (chat) (%d+) if matches[2] and is_sudo(msg) then local chat = 'chat#id'..matches[2] chat_info(chat, returnids, {receiver=receiver}) else if not is_chat_msg(msg) then return "You are not in a group." end local chat = get_receiver(msg) chat_info(chat, returnids, {receiver=receiver}) end else if not is_chat_msg(msg) then return "Only works in group" end local qusername = string.gsub(matches[1], "@", "") local chat = get_receiver(msg) chat_info(chat, username_id, {receiver=receiver, qusername=qusername}) end end return { description = "Know your id or the id of a chat members.", usage = { "!id: Return your ID and the chat id if you are in one.", "!ids chat: Return the IDs of the current chat members.", "!ids chat <chat_id>: Return the IDs of the <chat_id> members.", "!id <username> : Return the id from username given." }, patterns = { "^!id$", "^!ids? (chat) (%d+)$", "^!ids? (chat)$", "^!id (.*)$" }, run = run }
gpl-2.0
hooksta4/darkstar
scripts/zones/Bastok_Mines/npcs/Pavvke.lua
6
2088
----------------------------------- -- Area: Bastok Mines -- NPC: Pavvke -- Starts Quests: Fallen Comrades (100%) ----------------------------------- package.loaded["scripts/zones/Bastok_Mines/TextIDs"] = nil; ----------------------------------- require("scripts/globals/quests"); require("scripts/globals/settings"); require("scripts/zones/Bastok_Mines/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) count = trade:getItemCount(); SilverTag = trade:hasItemQty(13116,1); Fallen = player:getQuestStatus(BASTOK,FALLEN_COMRADES); if (Fallen == 1 and SilverTag == true and count == 1) then player:tradeComplete(); player:startEvent(0x005b); elseif (Fallen == 2 and SilverTag == true and count == 1) then player:tradeComplete(); player:startEvent(0x005c); end end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) Fallen = player:getQuestStatus(BASTOK,FALLEN_COMRADES); pLevel = player:getMainLvl(player); pFame = player:getFameLevel(BASTOK); if (Fallen == 0 and pLevel >= 12 and pFame >= 2) then player:startEvent(0x005a); else player:startEvent(0x004b); end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) --printf("CSID2: %u",csid); --printf("RESULT2: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); if (csid == 0x005a) then player:addQuest(BASTOK,FALLEN_COMRADES); elseif (csid == 0x005b) then player:completeQuest(BASTOK,FALLEN_COMRADES); player:addFame(BASTOK,BAS_FAME*120); player:addGil(GIL_RATE*550); player:messageSpecial(GIL_OBTAINED,GIL_RATE*550); elseif (csid == 0x005c) then player:addFame(BASTOK,BAS_FAME*8); player:addGil(GIL_RATE*550); player:messageSpecial(GIL_OBTAINED,GIL_RATE*550); end end;
gpl-3.0
gedadsbranch/Darkstar-Mission
scripts/zones/Riverne-Site_A01/npcs/_0u3.lua
19
1339
----------------------------------- -- Area: Riverne Site #A01 -- NPC: Unstable Displacement ----------------------------------- package.loaded["scripts/zones/Riverne-Site_A01/TextIDs"] = nil; ----------------------------------- require("scripts/globals/settings"); require("scripts/zones/Riverne-Site_A01/TextIDs"); ----------------------------------- -- onTrade ----------------------------------- function onTrade(player,npc,trade) if(trade:hasItemQty(1691,1) and trade:getItemCount() == 1) then -- Trade Giant Scale player:tradeComplete(); npc:openDoor(RIVERNE_PORTERS); player:messageSpecial(SD_HAS_GROWN); end end; ----------------------------------- -- onTrigger ----------------------------------- function onTrigger(player,npc) if(npc:getAnimation() == 8) then player:startEvent(0x13); else player:messageSpecial(SD_VERY_SMALL); end; return 1; end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end;
gpl-3.0
FishFilletsNG/fillets-data
script/barrel/code.lua
1
33741
file_include('script/share/prog_border.lua') -- ----------------------------------------------------------------- -- Init -- ----------------------------------------------------------------- local function prog_init() initModels() sound_playMusic("music/rybky05.ogg") local pokus = getRestartCount() --NOTE: a final level small:setGoal("goal_alive") big:setGoal("goal_alive") barel:setGoal("goal_out") -- ------------------------------------------------------------- local function prog_init_room() local pom1, pom2, pomb1, pomb2 = 0, 0, false, false room.uvod = 0 room.celakrajni = 0 room.ozviratkach = {} room.hl1 = random(400) + 400 room.hl2 = room.hl1 + random(800) + 800 room.hl3 = room.hl2 + random(1600) + 1600 room.hl4 = room.hl3 + random(3200) + 3200 room.onoze = 0 room.opldech = 0 room.okukajde = 0 room.okrabovi = 0 room.okachne = 0 return function() if stdBorderReport() then addm(6, "bar-m-barel") if random(100) < 30 or room.celakrajni == 0 then addv(random(10) + 5, "bar-v-genofond") end room.celakrajni = 1 end if no_dialog() and isReady(small) and isReady(big) then if room.hl1 > 0 then room.hl1 = room.hl1 - 1 end if room.hl2 > 0 then room.hl2 = room.hl2 - 1 end if room.hl3 > 0 then room.hl3 = room.hl3 - 1 end if room.hl4 > 0 then room.hl4 = room.hl4 - 1 end if room.uvod == 0 then room.uvod = 1 switch(pokus){ [1] = function() pom1 = 5 end, [2] = function() pom1 = randint(2, 4) end, default = function() pom1 = random(6) end, } adddel(10 + random(20)) if pom1 >= 4 then switch(random(2)){ [0] = function() addv(0, "bar-v-videt0") end, [1] = function() addm(0, "bar-m-videt1") end, } end if pom1 >= 5 then addv(5, "bar-v-co") end if pom1 >= 2 then addm(10, "bar-m-pobit") planDialogSet(2, "bar-x-suckne", 201, pldik, "cinnost") addv(10, "bar-v-priciny") planDialogSet(2, "bar-x-suckano", 202, pldik, "cinnost") end if pom1 >= 4 then addm(random(30) + 10, "bar-m-no") end if pom1 >= 2 then addv(5, "bar-v-sud") end if pom1 >= 3 then addm(5, "bar-m-panb") end elseif room.hl1 == 0 or room.hl2 == 0 or room.hl3 == 0 or room.hl4 == 0 then if room.hl1 == 0 then room.hl1 = -1 end if room.hl2 == 0 then room.hl2 = -1 end if room.hl3 == 0 then room.hl3 = -1 end if room.hl4 == 0 then room.hl4 = -1 end if countPairs(room.ozviratkach) == 0 then pom1 = random(2) elseif countPairs(room.ozviratkach) == 4 then room.ozviratkach = {} pom1 = random(4) else repeat pom1 = random(4) until not room.ozviratkach[pom1] end room.ozviratkach[pom1] = true adddel(50 + random(100)) switch(pom1){ [0] = function() addm(0, "bar-m-rada") addv(7, "bar-v-kdyby" ..random(2)) end, [1] = function() addm(0, "bar-m-mutanti") if random(100) < 50 then addv(10, "bar-v-ufouni") end addm(random(50) + 10, "bar-m-zmeni") end, [2] = function() addv(0, "bar-v-lih") addm(8, "bar-m-fdto") pldotec:planDialog(3, "bar-x-vypr") addm(10, "bar-m-promin") end, [3] = function() addv(0, "bar-v-sbirka") addm(10, "bar-m-dost" ..random(2)) end, } elseif room.onoze == 0 and nozka.cinnost < 20 and dist(small, nozka) < 5 and random(1000) < 2 then room.onoze = 1 addm(3, "bar-m-noha") elseif room.opldech == 0 and dist(big, pldotec) <= 5 and random(100) < 1 then room.opldech = 1 addv(10, "bar-v-pld") addm(6, "bar-m-pudy") addv(2, "bar-v-traverza") planDialogSet(2, "bar-x-suckne", 201, pldik, "cinnost") elseif room.okukajde == 0 and kukajda.dir ~= dir_no and random(100) < 2 and small.dir ~= dir_no then room.okukajde = 1 addm(10, "bar-m-rybka") if random(100) < 70 then addv(random(30) + 5, "bar-v-fotka") end elseif room.okrabovi == 0 and look_at(big, krabik) and dist(big, krabik) <= 3 and random(100) < 1 then room.okrabovi = 1 addv(10, "bar-v-krab") elseif room.okachne == 0 and kachnicka.dir ~= dir_no and small.dir ~= dir_no and random(100) < 10 then room.okachne = 1 addm(5, "bar-m-kachna") end end end end -- ------------------------------------------------------------- local function prog_init_barel() local pom1, pom2, pomb1, pomb2 = 0, 0, false, false setanim(barel, "a0d8a1a2a3a4d3a3a2a1R") return function() goanim(barel) barel:updateAnim() end end -- ------------------------------------------------------------- local function prog_init_kachnicka() local pom1, pom2, pomb1, pomb2 = 0, 0, false, false kachnicka.cinnost = random(100) + 10 return function() if kachnicka.cinnost > 0 then if kachnicka:isTalking() then kachnicka:killSound() end if odd(game_getCycles()) and random(100) < 10 then kachnicka.afaze = random(5) end kachnicka.cinnost = kachnicka.cinnost - 1 if kachnicka.cinnost == 0 then kachnicka.afaze = 5 kachnicka.cinnost = -30 - random(60) end else if not kachnicka:isTalking() then kachnicka:talk("bar-x-kchkch", VOLUME_LOW, -1) end kachnicka.afaze = math.mod(kachnicka.afaze - 5 + 1, 4) + 5 kachnicka.cinnost = kachnicka.cinnost + 1 if kachnicka.cinnost == 0 then kachnicka.afaze = 0 kachnicka.cinnost = 30 + random(100) end end kachnicka:updateAnim() end end -- ------------------------------------------------------------- local function prog_init_had() local pom1, pom2, pomb1, pomb2 = 0, 0, false, false had.streva = random(4) had.huba = random(3) return function() if math.mod(game_getCycles(), 3) == 0 then if (had.huba == 0) then if random(1000) < 15 then had.huba = random(2) + 1 end else if random(1000) < 15 then had.huba = 0 elseif random(100) < 50 then had.huba = 3 - had.huba end end end had.streva = math.mod(had.streva + 1, 4) had.afaze = 4 * had.huba + had.streva had:updateAnim() end end -- ------------------------------------------------------------- local function prog_init_ocicko() local pom1, pom2, pomb1, pomb2 = 0, 0, false, false ocicko.cinnost = 0 return function() if (ocicko.cinnost == 0) then local rnd = random(8) if random(100) < 10 then if (rnd >= 0) and (rnd <= 2) then ocicko.citac = random(5) + 5 ocicko.cinnost = 1 ocicko.faze = random(2) * 2 elseif (rnd == 3) then ocicko.citac = random(3) + 2 ocicko.cinnost = 2 ocicko.faze = random(2) * 2 elseif (rnd >= 4) and (rnd <= 6) then ocicko.citac = random(12) + 12 ocicko.cinnost = 3 + random(2) elseif (rnd == 7) then ocicko.citac = random(10) + 2 ocicko.cinnost = 5 end end elseif (ocicko.cinnost == 1) or (ocicko.cinnost == 2) then switch(ocicko.faze){ [0] = function() if ocicko.cinnost == 1 then ocicko.afaze = 1 else ocicko.afaze = 3 end if random(100) < 20 then ocicko.faze = ocicko.faze + 1 end end, [1] = function() ocicko.afaze = 0 ocicko.faze = ocicko.faze + 1 end, [2] = function() if ocicko.cinnost == 1 then ocicko.afaze = 2 else ocicko.afaze = 4 end if random(100) < 20 then ocicko.faze = ocicko.faze + 1 end end, [3] = function() ocicko.afaze = 0 ocicko.citac = ocicko.citac - 1 if ocicko.citac == 0 then ocicko.cinnost = 0 else ocicko.faze = 0 end end, } elseif (ocicko.cinnost >= 3) or (ocicko.cinnost <= 5) then switch(ocicko.cinnost){ [3] = function() switch(ocicko.afaze){ [0] = function() ocicko.afaze = random(4) + 1 end, [1] = function() ocicko.afaze = 3 end, [2] = function() ocicko.afaze = 4 end, [3] = function() ocicko.afaze = 2 end, [4] = function() ocicko.afaze = 1 end, } end, [4] = function() switch(ocicko.afaze){ [0] = function() ocicko.afaze = random(4) + 1 end, [1] = function() ocicko.afaze = 4 end, [2] = function() ocicko.afaze = 3 end, [3] = function() ocicko.afaze = 1 end, [4] = function() ocicko.afaze = 2 end, } end, [5] = function() if random(100) < 40 then ocicko.afaze = random(5) end end, } ocicko.citac = ocicko.citac - 1 if ocicko.citac == 0 then ocicko.cinnost = 0 ocicko.afaze = 0 end end ocicko:updateAnim() end end -- ------------------------------------------------------------- local function prog_init_kukajda() local pom1, pom2, pomb1, pomb2 = 0, 0, false, false kukajda.ploutvicka = 0 kukajda.oci = 0 kukajda.mrknuti = 0 return function() kukajda.ploutvicka = math.mod(kukajda.ploutvicka + 1, 6) if (kukajda.ploutvicka == 0) or (kukajda.ploutvicka == 1) then kukajda.afaze = 0 elseif (kukajda.ploutvicka == 2) or (kukajda.ploutvicka == 5) then kukajda.afaze = 1 elseif (kukajda.ploutvicka == 3) or (kukajda.ploutvicka == 4) then kukajda.afaze = 2 end if random(100) < 3 then kukajda.oci = random(5) end if kukajda.mrknuti > 0 then kukajda.mrknuti = kukajda.mrknuti - 1 kukajda.afaze = kukajda.afaze + 15 else kukajda.afaze = kukajda.afaze + kukajda.oci * 3 if random(100) < 4 then kukajda.mrknuti = random(3) + 2 end end kukajda:updateAnim() end end -- ------------------------------------------------------------- local function prog_init_killer() local pom1, pom2, pomb1, pomb2 = 0, 0, false, false killer.ocas = 0 killer.usmev = 0 return function() if odd(game_getCycles()) then killer.ocas = 1 - killer.ocas end if killer.usmev > 0 then killer.usmev = killer.usmev - 1 killer.afaze = killer.ocas else if random(100) < 2 then killer.usmev = random(30) + 10 killer:talk("bar-x-gr" ..random(3), VOLUME_LOW) end killer.afaze = 2 * killer.ocas + 2 if random(100) < 7 then killer.afaze = killer.afaze + 1 end end killer:updateAnim() end end -- ------------------------------------------------------------- local function prog_init_hlubinna() local pom1, pom2, pomb1, pomb2 = 0, 0, false, false hlubinna.ploutvicka = 0 hlubinna.zzzeni = 0 return function() hlubinna.ploutvicka = math.mod(hlubinna.ploutvicka + 1, 5) if (hlubinna.ploutvicka == 3) then hlubinna.afaze = 1 elseif (hlubinna.ploutvicka == 4) then hlubinna.afaze = 0 else hlubinna.afaze = hlubinna.ploutvicka end if hlubinna.zzzeni > 0 then hlubinna.afaze=hlubinna.afaze + 6 hlubinna.zzzeni = hlubinna.zzzeni - 1 elseif random(100) < 5 then hlubinna.afaze = hlubinna.afaze + 3 elseif random(1000) < 15 then hlubinna.afaze=hlubinna.afaze + 6 hlubinna.zzzeni = 5 hlubinna:talk("bar-x-zzz", VOLUME_LOW) end hlubinna:updateAnim() end end -- ------------------------------------------------------------- local function prog_init_krabik() local pom1, pom2, pomb1, pomb2 = 0, 0, false, false krabik.oci = 0 return function() if odd(game_getCycles()) and random(100) < 10 then krabik.oci = random(5) end if random(100) < 10 then krabik.afaze = 5 else krabik.afaze = krabik.oci end krabik:updateAnim() end end -- ------------------------------------------------------------- local function prog_init_baget() return function() if random(100) < 6 then baget.afaze = 1 else baget.afaze = 0 end baget:updateAnim() end end -- ------------------------------------------------------------- local function prog_init_nozka() local pom1, pom2, pomb1, pomb2 = 0, 0, false, false nozka.cinnost = random(100) + 20 nozka.dup = 0 nozka.oci = 0 return function() if odd(game_getCycles()) and random(100) < 10 then nozka.oci = random(5) end if nozka.cinnost > 0 then nozka.cinnost = nozka.cinnost - 1 nozka.dup = 0 if nozka.cinnost == 0 then nozka.cinnost = -20 - random(60) end else if math.mod(game_getCycles(), 3) == 0 then nozka.dup = 1 - nozka.dup if nozka.dup == 0 then nozka:talk("bar-x-tup", VOLUME_LOW) end end if nozka.cinnost < -1 or nozka.dup == 0 then nozka.cinnost = nozka.cinnost + 1 end if nozka.cinnost == 0 then nozka.cinnost = 10 + random(150) end end if random(100) < 4 then nozka.afaze = 5 else nozka.afaze = nozka.oci end nozka.afaze = nozka.afaze + nozka.dup * 6 nozka:updateAnim() end end -- ------------------------------------------------------------- local function prog_init_pldik() local pom1, pom2, pomb1, pomb2 = 0, 0, false, false pldik.cinnost = 0 pldik.oci = 0 pldik.suckani = 0 return function() switch(pldik.cinnost){ [0] = function() if random(1000) < 5 then pldik.cinnost = 1 end if random(100) < 5 then pldik.oci = random(5) if pldik.oci > 0 then pldik.oci = pldik.oci + 1 end end if pldik.suckani == 0 and random(100) < 4 then pldik.suckani = random(5) + 1 pldik.suckfaze = 0 end end, [1] = function() if random(1000) < 10 then pldik.cinnost = 0 end pldik.oci = 6 if pldik.suckani == 0 and random(100) < 4 then pldik.suckani = random(4) + 1 pldik.suckfaze = 0 end end, [201] = function() if not pldik:isTalking() then pldik.cinnost = 0 end pldik.oci = 1 if pldik.suckani == 0 then pldik.suckani = 1000 pldik.suckfaze = 0 end end, [202] = function() if not pldik:isTalking() then pldik.cinnost = 0 end pldik.oci = 0 if pldik.suckani == 0 then pldik.suckani = 1000 pldik.suckfaze = 0 end end, } pldik.afaze = pldik.oci * 2 if random(100) < 5 then pldik.afaze = 12 end if pldik.suckani > 0 then if (pldik.suckfaze == 0) then if pldik.cinnost < 200 then pldik:talk("bar-x-suck" ..random(4), VOLUME_LOW) end elseif isRange(pldik.suckfaze, 1, 3) then pldik.afaze = pldik.afaze + 1 elseif (pldik.suckfaze == 5) then pldik.suckani = pldik.suckani - 1 end pldik.suckfaze = math.mod(pldik.suckfaze + 1, 6) end pldik:updateAnim() end end -- ------------------------------------------------------------- local function prog_init_shark() local pom1, pom2, pomb1, pomb2 = 0, 0, false, false shark.oci = random(2) shark.pusa = random(2) return function() if random(1000) < 5 then shark.oci = 1 - shark.oci end if random(1000) < 5 then shark.pusa = 1 - shark.pusa end shark.afaze = shark.oci + shark.pusa * 2 if shark.oci == 0 and random(100) < 3 then shark.afaze = shark.afaze + 1 end shark:updateAnim() end end -- ------------------------------------------------------------- local function prog_init_pldotec() local pom1, pom2, pomb1, pomb2 = 0, 0, false, false pldotec.vlnit = 0 pldotec.del = 0 pldotec.ocko = 0 pldotec.smer = 0 pldotec.faze = 0 pldotec.smutny = 0 return function() switch(pldotec.dir){ [dir_no] = function() if pldotec.vlnit == -1 then pldotec.vlnit = 8 end end, [dir_down] = function() pldotec.vlnit = -1 end, default = function() pldotec.vlnit = 8 end, } if pldotec.vlnit > 0 then pldotec.smutny = 0 end if pldotec.vlnit > 0 then if pldotec.del == 0 then if (pldotec.vlnit >= 6) and (pldotec.vlnit <= 8) then pldotec.del = 1 elseif (pldotec.vlnit >= 3) and (pldotec.vlnit <= 5) then pldotec.del = 2 else pldotec.del = 3 end if random(2) == 0 then pldotec.afaze = math.mod(pldotec.afaze + 1, 4) else pldotec.afaze = math.mod(pldotec.afaze + 3, 4) end pldotec.vlnit = pldotec.vlnit - 1 if pldotec.vlnit == 0 then pldotec.del = 0 end if pldotec.vlnit == 0 then pldotec.afaze = 0 elseif pldotec.vlnit == 1 then pldotec.afaze = 3 end else pldotec.del = pldotec.del - 1 end elseif pldotec.smutny > 0 then if pldotec.ocko == 0 then if random(100) < 10 then pldotec.ocko = 3 end end if pldotec.ocko > 0 then pldotec.ocko = pldotec.ocko - 1 end if pldotec.ocko > 0 then pldotec.afaze = 15 else pldotec.afaze = 14 end pldotec.smutny = pldotec.smutny - 1 else if random(100) < 10 then pldotec.smer = 1 - pldotec.smer end if (pldotec.faze == 0) then pldotec.afaze = 0 if random(100) < 10 then pldotec.faze = 1 end elseif (pldotec.faze == 1) or (pldotec.faze == 4) then pldotec.faze = pldotec.faze + 1 pldotec.afaze = 4 elseif (pldotec.faze == 5) then pldotec.afaze = 0 pldotec.faze = 0 else pldotec.faze = pldotec.faze + 1 pldotec.afaze = 5 end switch(pldotec.afaze){ [0] = function() if pldotec.smer == 1 then pldotec.afaze = 6 end end, [4] = function() if pldotec.smer == 1 then pldotec.afaze = 7 end end, } if pldotec.ocko == 0 then if random(100) < 10 then pldotec.ocko = 3 end end if pldotec.ocko > 0 then pldotec.ocko = pldotec.ocko - 1 end if pldotec.ocko > 0 then if pldotec.afaze == 0 then pldotec.afaze = 9 else pldotec.afaze = pldotec.afaze + 6 end end end pldotec:updateAnim() end end -- ------------------------------------------------------------- local function prog_init_levahlava() local pom1, pom2, pomb1, pomb2 = 0, 0, false, false levahlava.kouka = random(3) levahlava.makoukat = levahlava.kouka levahlava.cinnost = 0 return function() if levahlava.kouka == 0 and pravahlava.kouka == 0 and levahlava.cinnost == 0 and levahlava.cinnost == 0 and levahlava.makoukat == 0 and pravahlava.makoukat == 0 and random(100) < 5 then levahlava.cinnost = 2 pravahlava.cinnost = 2 end if levahlava.kouka ~= levahlava.makoukat then if levahlava.kouka == 1 or levahlava.makoukat == 1 then levahlava.kouka = levahlava.makoukat else levahlava.kouka = 1 end end switch(levahlava.cinnost){ [0] = function() if random(1000) < 5 then levahlava.cinnost = 1 elseif random(100) < 5 then levahlava.makoukat = random(3) end levahlava.afaze = levahlava.kouka * 2 if levahlava.afaze > 0 then levahlava.afaze = levahlava.afaze + 1 end if random(100) < 95 then levahlava.afaze = levahlava.afaze + 1 end end, [1] = function() levahlava.afaze = levahlava.kouka * 2 if levahlava.afaze > 0 then levahlava.afaze = levahlava.afaze + 1 end if random(1000) < 5 then levahlava.cinnost = 0 end end, [2] = function() levahlava.afaze = 2 if random(100) < 3 then levahlava.cinnost = 0 pravahlava.cinnost = 0 end end, } levahlava:updateAnim() end end -- ------------------------------------------------------------- local function prog_init_pravahlava() local pom1, pom2, pomb1, pomb2 = 0, 0, false, false pravahlava.kouka = random(3) pravahlava.makoukat = pravahlava.kouka pravahlava.cinnost = 0 return function() if pravahlava.kouka ~= pravahlava.makoukat then if pravahlava.kouka == 1 or pravahlava.makoukat == 1 then pravahlava.kouka = pravahlava.makoukat else pravahlava.kouka = 1 end end switch(pravahlava.cinnost){ [0] = function() if random(1000) < 5 then pravahlava.cinnost = 1 elseif random(100) < 5 then pravahlava.makoukat = random(3) end pravahlava.afaze = pravahlava.kouka * 2 if pravahlava.afaze > 0 then pravahlava.afaze = pravahlava.afaze + 1 end if random(100) < 95 then pravahlava.afaze = pravahlava.afaze + 1 end end, [1] = function() pravahlava.afaze = pravahlava.kouka * 2 if pravahlava.afaze > 0 then pravahlava.afaze = pravahlava.afaze + 1 end if random(1000) < 5 then pravahlava.cinnost = 0 end end, [2] = function() pravahlava.afaze = 2 end, } pravahlava:updateAnim() end end -- -------------------- local update_table = {} local subinit subinit = prog_init_room() if subinit then table.insert(update_table, subinit) end subinit = prog_init_barel() if subinit then table.insert(update_table, subinit) end subinit = prog_init_kachnicka() if subinit then table.insert(update_table, subinit) end subinit = prog_init_had() if subinit then table.insert(update_table, subinit) end subinit = prog_init_ocicko() if subinit then table.insert(update_table, subinit) end subinit = prog_init_kukajda() if subinit then table.insert(update_table, subinit) end subinit = prog_init_killer() if subinit then table.insert(update_table, subinit) end subinit = prog_init_hlubinna() if subinit then table.insert(update_table, subinit) end subinit = prog_init_krabik() if subinit then table.insert(update_table, subinit) end subinit = prog_init_baget() if subinit then table.insert(update_table, subinit) end subinit = prog_init_nozka() if subinit then table.insert(update_table, subinit) end subinit = prog_init_pldik() if subinit then table.insert(update_table, subinit) end subinit = prog_init_shark() if subinit then table.insert(update_table, subinit) end subinit = prog_init_pldotec() if subinit then table.insert(update_table, subinit) end subinit = prog_init_levahlava() if subinit then table.insert(update_table, subinit) end subinit = prog_init_pravahlava() if subinit then table.insert(update_table, subinit) end return update_table end local update_table = prog_init() -- ----------------------------------------------------------------- -- Update -- ----------------------------------------------------------------- function prog_update() for key, subupdate in pairs(update_table) do subupdate() end end
gpl-2.0
gorkinovich/DefendersOfMankind
dependencies/CEGUI/cegui/src/ScriptingModules/LuaScriptModule/support/tolua++bin/lua/define.lua
7
1317
-- tolua: define class -- Written by Waldemar Celes -- TeCGraf/PUC-Rio -- Jul 1998 -- $Id: define.lua 1004 2006-02-27 13:03:20Z lindquist $ -- This code is free software; you can redistribute it and/or modify it. -- The software provided hereunder is on an "as is" basis, and -- the author has no obligation to provide maintenance, support, updates, -- enhancements, or modifications. -- Define class -- Represents a numeric const definition -- The following filds are stored: -- name = constant name classDefine = { name = '', } classDefine.__index = classDefine setmetatable(classDefine,classFeature) -- register define function classDefine:register (pre) if not self:check_public_access() then return end pre = pre or '' output(pre..'tolua_constant(tolua_S,"'..self.lname..'",'..self.name..');') end -- Print method function classDefine:print (ident,close) print(ident.."Define{") print(ident.." name = '"..self.name.."',") print(ident.." lname = '"..self.lname.."',") print(ident.."}"..close) end -- Internal constructor function _Define (t) setmetatable(t,classDefine) t:buildnames() if t.name == '' then error("#invalid define") end append(t) return t end -- Constructor -- Expects a string representing the constant name function Define (n) return _Define{ name = n } end
gpl-3.0
snabbco/snabb
lib/luajit/testsuite/test/lang/compare.lua
6
5758
local function lt(x, y) if x < y then return true else return false end end local function le(x, y) if x <= y then return true else return false end end local function gt(x, y) if x > y then return true else return false end end local function ge(x, y) if x >= y then return true else return false end end local function eq(x, y) if x == y then return true else return false end end local function ne(x, y) if x ~= y then return true else return false end end local function ltx1(x) if x < 1 then return true else return false end end local function lex1(x) if x <= 1 then return true else return false end end local function gtx1(x) if x > 1 then return true else return false end end local function gex1(x) if x >= 1 then return true else return false end end local function eqx1(x) if x == 1 then return true else return false end end local function nex1(x) if x ~= 1 then return true else return false end end local function lt1x(x) if 1 < x then return true else return false end end local function le1x(x) if 1 <= x then return true else return false end end local function gt1x(x) if 1 > x then return true else return false end end local function ge1x(x) if 1 >= x then return true else return false end end local function eq1x(x) if 1 == x then return true else return false end end local function ne1x(x) if 1 ~= x then return true else return false end end local function check(a, b) if a ~= b then error("check failed with "..tostring(a).." ~= "..tostring(b), 2) end end do --- 1,2 local x,y = 1,2 check(x<y, true) check(x<=y, true) check(x>y, false) check(x>=y, false) check(x==y, false) check(x~=y, true) check(1<y, true) check(1<=y, true) check(1>y, false) check(1>=y, false) check(1==y, false) check(1~=y, true) check(x<2, true) check(x<=2, true) check(x>2, false) check(x>=2, false) check(x==2, false) check(x~=2, true) check(lt(x,y), true) check(le(x,y), true) check(gt(x,y), false) check(ge(x,y), false) check(eq(y,x), false) check(ne(y,x), true) end do --- 2,1 local x,y = 2,1 check(x<y, false) check(x<=y, false) check(x>y, true) check(x>=y, true) check(x==y, false) check(x~=y, true) check(2<y, false) check(2<=y, false) check(2>y, true) check(2>=y, true) check(2==y, false) check(2~=y, true) check(x<1, false) check(x<=1, false) check(x>1, true) check(x>=1, true) check(x==1, false) check(x~=1, true) check(lt(x,y), false) check(le(x,y), false) check(gt(x,y), true) check(ge(x,y), true) check(eq(y,x), false) check(ne(y,x), true) end do --- 1,1 local x,y = 1,1 check(x<y, false) check(x<=y, true) check(x>y, false) check(x>=y, true) check(x==y, true) check(x~=y, false) check(1<y, false) check(1<=y, true) check(1>y, false) check(1>=y, true) check(1==y, true) check(1~=y, false) check(x<1, false) check(x<=1, true) check(x>1, false) check(x>=1, true) check(x==1, true) check(x~=1, false) check(lt(x,y), false) check(le(x,y), true) check(gt(x,y), false) check(ge(x,y), true) check(eq(y,x), true) check(ne(y,x), false) end do --- 2 check(lt1x(2), true) check(le1x(2), true) check(gt1x(2), false) check(ge1x(2), false) check(eq1x(2), false) check(ne1x(2), true) check(ltx1(2), false) check(lex1(2), false) check(gtx1(2), true) check(gex1(2), true) check(eqx1(2), false) check(nex1(2), true) end do --- 1 check(lt1x(1), false) check(le1x(1), true) check(gt1x(1), false) check(ge1x(1), true) check(eq1x(1), true) check(ne1x(1), false) check(ltx1(1), false) check(lex1(1), true) check(gtx1(1), false) check(gex1(1), true) check(eqx1(1), true) check(nex1(1), false) end do --- 0 check(lt1x(0), false) check(le1x(0), false) check(gt1x(0), true) check(ge1x(0), true) check(eq1x(0), false) check(ne1x(0), true) check(ltx1(0), true) check(lex1(0), true) check(gtx1(0), false) check(gex1(0), false) check(eqx1(0), false) check(nex1(0), true) end do --- pcall assert(not pcall(function() local a, b = 10.5, nil return a < b end)) end do --- bit +bit for i=1,100 do assert(bit.tobit(i+0x7fffffff) < 0) end for i=1,100 do assert(bit.tobit(i+0x7fffffff) <= 0) end end do --- string 1 255 local a = "\255\255\255\255" local b = "\1\1\1\1" assert(a > b) assert(a > b) assert(a >= b) assert(b <= a) end do --- String comparisons: local function str_cmp(a, b, lt, gt, le, ge) assert(a<b == lt) assert(a>b == gt) assert(a<=b == le) assert(a>=b == ge) assert((not (a<b)) == (not lt)) assert((not (a>b)) == (not gt)) assert((not (a<=b)) == (not le)) assert((not (a>=b)) == (not ge)) end local function str_lo(a, b) str_cmp(a, b, true, false, true, false) end local function str_eq(a, b) str_cmp(a, b, false, false, true, true) end local function str_hi(a, b) str_cmp(a, b, false, true, false, true) end str_lo("a", "b") str_eq("a", "a") str_hi("b", "a") str_lo("a", "aa") str_hi("aa", "a") str_lo("a", "a\0") str_hi("a\0", "a") end do --- obj_eq/ne local function obj_eq(a, b) assert(a==b == true) assert(a~=b == false) end local function obj_ne(a, b) assert(a==b == false) assert(a~=b == true) end obj_eq(nil, nil) obj_ne(nil, false) obj_ne(nil, true) obj_ne(false, nil) obj_eq(false, false) obj_ne(false, true) obj_ne(true, nil) obj_ne(true, false) obj_eq(true, true) obj_eq(1, 1) obj_ne(1, 2) obj_ne(2, 1) obj_eq("a", "a") obj_ne("a", "b") obj_ne("a", 1) obj_ne(1, "a") local t, t2 = {}, {} obj_eq(t, t) obj_ne(t, t2) obj_ne(t, 1) obj_ne(t, "") end
apache-2.0
gedadsbranch/Darkstar-Mission
scripts/zones/Metalworks/npcs/Hungry_Wolf.lua
19
2040
----------------------------------- -- Area: Metalworks -- NPC: Hungry Wolf -- Type: Quest Giver -- @pos -25.861 -11 -30.172 237 -- -- Auto-Script: Requires Verification (Verified by Brawndo) -- Updated for "Smoke on the Mountain" by EccentricAnata 03.22.13 ----------------------------------- package.loaded["scripts/zones/Metalworks/TextIDs"] = nil; require("scripts/zones/Metalworks/TextIDs"); require("scripts/globals/quests"); require("scripts/globals/settings"); require("scripts/globals/titles"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) if(player:getQuestStatus(BASTOK,SMOKE_ON_THE_MOUNTAIN) ~= QUEST_AVAILABLE and trade:hasItemQty(4395,1) and trade:getItemCount() == 1) then player:startEvent(0x01ad); end --]] end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) local SmokeOnTheMountain = player:getQuestStatus(BASTOK,SMOKE_ON_THE_MOUNTAIN); if (SmokeOnTheMountain == QUEST_AVAILABLE) then player:startEvent(0x01ac); else player:startEvent(0x01a5); end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); if(csid == 0x01ac) then player:addQuest(BASTOK,SMOKE_ON_THE_MOUNTAIN); elseif(csid == 0x01ad) then player:tradeComplete(); player:addGil(GIL_RATE*300) player:messageSpecial(GIL_OBTAINED,GIL_RATE*300); player:addTitle(HOT_DOG); if(player:getQuestStatus(BASTOK,SMOKE_ON_THE_MOUNTAIN) == QUEST_ACCEPTED) then player:addFame(BASTOK,BAS_FAME*30); player:completeQuest(BASTOK,SMOKE_ON_THE_MOUNTAIN); else player:addFame(BASTOK,BAS_FAME*5); end end end;
gpl-3.0
hooksta4/darkstar
scripts/zones/Abyssea-Tahrongi/npcs/qm18.lua
17
1550
----------------------------------- -- Zone: Abyssea-Tahrongi -- NPC: ??? -- Spawns: Lacovie ----------------------------------- require("scripts/globals/status"); require("scripts/globals/keyitems"); ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) --[[ if (GetMobAction(16961931) == ACTION_NONE) then -- NM not already spawned from this if (player:hasKeyItem(OVERGROWN_MANDRAGORA_FLOWER) and player:hasKeyItem(CHIPPED_SANDWORM_TOOTH)) then player:startEvent(1020, OVERGROWN_MANDRAGORA_FLOWER, CHIPPED_SANDWORM_TOOTH); -- Ask if player wants to use KIs else player:startEvent(1021, OVERGROWN_MANDRAGORA_FLOWER, CHIPPED_SANDWORM_TOOTH); -- Do not ask, because player is missing at least 1. end end ]] end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID2: %u",csid); -- printf("RESULT2: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); if (csid == 1020 and option == 1) then SpawnMob(16961931):updateClaim(player); -- Spawn NM, Despawn after inactive for 5 minutes (pt has to reclaim within 5 of a wipe) player:delKeyItem(OVERGROWN_MANDRAGORA_FLOWER); player:delKeyItem(CHIPPED_SANDWORM_TOOTH); end end;
gpl-3.0
gedadsbranch/Darkstar-Mission
scripts/zones/Oldton_Movalpolos/Zone.lua
13
2426
----------------------------------- -- -- Zone: Oldton_Movalpolos (11) -- ----------------------------------- package.loaded["scripts/zones/Oldton_Movalpolos/TextIDs"] = nil; ----------------------------------- require("scripts/globals/settings"); require("scripts/globals/conquest"); require("scripts/zones/Oldton_Movalpolos/TextIDs"); require("scripts/globals/missions"); ----------------------------------- -- onInitialize ----------------------------------- function onInitialize(zone) UpdateTreasureSpawnPoint(16822527); SetRegionalConquestOverseers(zone:getRegionID()) end; ----------------------------------- -- onConquestUpdate ----------------------------------- function onConquestUpdate(zone, updatetype) local players = zone:getPlayers(); for name, player in pairs(players) do conquestUpdate(zone, player, updatetype, CONQUEST_BASE); end end; ----------------------------------- -- onZoneIn ----------------------------------- function onZoneIn(player,prevZone) local currentday = tonumber(os.date("%j")); local LouverancePath=player:getVar("COP_Louverance_s_Path"); local cs = -1; if ((player:getXPos() == 0) and (player:getYPos() == 0) and (player:getZPos() == 0)) then player:setPos(70.956,5.99,139.843,134); end if(player:getCurrentMission(COP) == THREE_PATHS and (LouverancePath == 3 or LouverancePath == 4))then cs=0x0001; elseif(player:getCurrentMission(COP) == DAWN and player:getVar("PromathiaStatus")==3 and player:getVar("Promathia_kill_day")~=currentday and player:getVar("COP_jabbos_story")== 0 )then cs=0x0039; end return cs; end; ----------------------------------- -- onRegionEnter ----------------------------------- function onRegionEnter(player,region) end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); if(csid==0x0001)then player:setVar("COP_Louverance_s_Path",5); elseif(csid == 0x0039)then player:setVar("COP_jabbos_story",1); end end;
gpl-3.0
gedadsbranch/Darkstar-Mission
scripts/zones/Temenos/npcs/Matter_Diffusion_Module.lua
19
6043
----------------------------------- -- Area: temenos -- NPC: Matter diffusion module -- @pos ----------------------------------- package.loaded["scripts/zones/Temenos/TextIDs"] = nil; ----------------------------------- require("scripts/globals/limbus"); require("scripts/globals/keyitems"); require("scripts/zones/Temenos/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) local count = trade:getItemCount(); local InstanceTrade=0; if(player:hasKeyItem(COSMOCLEANSE) and player:hasKeyItem(WHITE_CARD) )then if(count==1 and trade:hasItemQty(2127,1))then -- Central Temenos - Basement 1 InstanceTrade=128; elseif(count==1 and trade:hasItemQty(1906,1))then -- Central Temenos - 1st Floor InstanceTrade=64; elseif(count==1 and trade:hasItemQty(1905,1))then -- Central Temenos - 2st Floor InstanceTrade=32; elseif(count==1 and trade:hasItemQty(1904,1))then -- Central Temenos - 3st Floor InstanceTrade=16; elseif(count==3 and trade:hasItemQty(1986,1) and trade:hasItemQty(1908,1) and trade:hasItemQty(1907,1))then --proto-ultima InstanceTrade=8; end else player:messageSpecial(CONDITION_FOR_LIMBUS_T); print("error player don't have cosmo clean"); end if(InstanceTrade~=0)then player:setVar("Limbus_Trade_Item-T",InstanceTrade); player:tradeComplete(); player:messageSpecial(CHIP_TRADE_T); player:startEvent(0x7d00,0,0,0,InstanceTrade,0,0,0,0); player:setVar("limbusbitmap",InstanceTrade); end end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) local instancelist ={}; local limbusbitmap = 0 ; local AllowLimbusToPlayer = true ; local currentlimbus= TryTobackOnCurrentLimbus(player); instancelist = TEMENOS_LIST; printf("currentlimbus: %u",currentlimbus); if(player:hasKeyItem(COSMOCLEANSE))then if(player:hasStatusEffect(EFFECT_BATTLEFIELD) == false) then local LimbusTradeItem = player:getVar("Limbus_Trade_Item-T"); for nt = 1,table.getn (instancelist),2 do -- printf("list d'instance: %u",instancelist[nt]); if(instancelist[nt+1][1]==true and player:hasKeyItem(WHITE_CARD))then -- print("player_have_white_card"); limbusbitmap = limbusbitmap + instancelist[nt+1][4]; -- printf("bitmapadd: %u",instancelist[nt+1][4]); end if(instancelist[nt+1][2]==true and player:hasKeyItem(RED_CARD))then -- print("player_have_red_card"); limbusbitmap = limbusbitmap + instancelist[nt+1][4]; -- printf("bitmapadd: %u",instancelist[nt+1][4]); end if(instancelist[nt+1][3]==true and player:hasKeyItem(BLACK_CARD))then -- print("player_have_black_card"); limbusbitmap = limbusbitmap + instancelist[nt+1][4]; -- printf("bitmapadd: %u",instancelist[nt+1][4]); end end limbusbitmap= limbusbitmap + LimbusTradeItem; ----- /////////////////////////////////////////////on doit ajouter le mipmap pour l'item trade ici else local status = player:getStatusEffect(EFFECT_BATTLEFIELD); local playerbcnmid = status:getPower(); -- check if the player has the key item for the current battlefield for nt = 1,table.getn (instancelist),2 do -- printf("list d'instance: %u",instancelist[nt]); if(instancelist[nt] == playerbcnmid)then if(instancelist[nt+1][1]== true and player:hasKeyItem(WHITE_CARD) == false)then AllowLimbusToPlayer = false; end if(instancelist[nt+1][2]== true and player:hasKeyItem(RED_CARD) == false )then AllowLimbusToPlayer = false; end if(instancelist[nt+1][3]== true and player:hasKeyItem(BLACK_CARD) == false )then AllowLimbusToPlayer = false; end if(AllowLimbusToPlayer == true)then --player have the correct key item for the current battflield limbusbitmap = instancelist[nt+1][4]; end end end end if(limbusbitmap~= 0 )then player:startEvent(0x7d00,0,0,0,limbusbitmap,0,0,0,0); player:setVar("limbusbitmap",limbusbitmap); else player:messageSpecial(CONDITION_FOR_LIMBUS_T); print("player need a card for basic limbus"); end elseif(currentlimbus~=0)then for nt = 1,table.getn (instancelist),2 do -- printf("list d'instance: %u",instancelist[nt]); if(instancelist[nt] == currentlimbus)then limbusbitmap = instancelist[nt+1][4]; end end player:startEvent(0x7d00,0,0,0,limbusbitmap,0,0,0,0); player:setVar("limbusbitmap",limbusbitmap); else player:messageSpecial(CONDITION_FOR_LIMBUS_T); print("error player don't have cosmo clean"); end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) if(csid == 0x7d00)then if(player:hasStatusEffect(EFFECT_BATTLEFIELD) == false) then ResetPlayerLimbusVariable(player); player:setVar("characterLimbusKey",0); else local status = player:getStatusEffect(EFFECT_BATTLEFIELD); player:setVar("LimbusID",status:getPower()); player:setVar("characterLimbusKey",GetLimbusKeyFromInstance(status:getPower())); end player:updateEvent(2,player:getVar("limbusbitmap"),0,1,1,0); player:setVar("limbusbitmap",0); end end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); if(csid == 0x7d00)then end end;
gpl-3.0
gedadsbranch/Darkstar-Mission
scripts/zones/Southern_San_dOria_[S]/npcs/Dilgeur.lua
36
1106
----------------------------------- -- Area: Southern SandOria [S] -- NPC: Dilgeur -- Misnamed NPC, name is Crochepallade when it should be Dilgeur, swap pos with the NPC at -46 2 -8 -- @zone 80 -- @pos 22 2 3 ----------------------------------- package.loaded["scripts/zones/Southern_San_dOria_[S]/TextIDs"] = nil; require("scripts/zones/Southern_San_dOria_[S]/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) player:startEvent(0x014A); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end;
gpl-3.0
hooksta4/darkstar
scripts/globals/items/crayfish.lua
18
1409
----------------------------------------- -- ID: 4472 -- Item: crayfish -- Food Effect: 5Min, Mithra only ----------------------------------------- -- Dexterity -3 -- Vitality 1 -- defense 10 ----------------------------------------- require("scripts/globals/status"); ----------------------------------------- -- OnItemCheck ----------------------------------------- function onItemCheck(target) local result = 0; if (target:getRace() ~= 7) then result = 247; end if (target:getMod(MOD_EAT_RAW_FISH) == 1) then result = 0; end if (target:hasStatusEffect(EFFECT_FOOD) == true or target:hasStatusEffect(EFFECT_FIELD_SUPPORT_FOOD) == true) then result = 246; end return result; end; ----------------------------------------- -- OnItemUse ----------------------------------------- function onItemUse(target) target:addStatusEffect(EFFECT_FOOD,0,0,300,4472); end; ----------------------------------------- -- onEffectGain Action ----------------------------------------- function onEffectGain(target,effect) target:addMod(MOD_DEX, -3); target:addMod(MOD_VIT, 1); target:addMod(MOD_DEF, 10); end; ----------------------------------------- -- onEffectLose Action ----------------------------------------- function onEffectLose(target,effect) target:delMod(MOD_DEX, -3); target:delMod(MOD_VIT, 1); target:delMod(MOD_DEF, 10); end;
gpl-3.0
hooksta4/darkstar
scripts/zones/zones/Windurst_Woods/npcs/Etsa_Rhuyuli.lua
38
1415
----------------------------------- -- Area: Windurst Woods -- NPC: Etsa Rhuyuli -- Type: Standard NPC -- @pos 62.482 -8.499 -139.836 241 ----------------------------------- package.loaded["scripts/zones/Windurst_Woods/TextIDs"] = nil; ----------------------------------- require("scripts/globals/quests"); require("scripts/zones/Windurst_Woods/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) local WildcatWindurst = player:getVar("WildcatWindurst"); if (player:getQuestStatus(WINDURST,LURE_OF_THE_WILDCAT_WINDURST) == QUEST_ACCEPTED and player:getMaskBit(WildcatWindurst,1) == false) then player:startEvent(0x02de); else player:startEvent(0x01a6); end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); if (csid == 0x02de) then player:setMaskBit(player:getVar("WildcatWindurst"),"WildcatWindurst",1,true); end end;
gpl-3.0
prosody-modules/import2
mod_telnet_tlsinfo/mod_telnet_tlsinfo.lua
32
1220
-- mod_telnet_tlsinfo.lua module:set_global(); module:depends("admin_telnet"); local console_env = module:shared("/*/admin_telnet/env"); local c2s_sessions = module:shared("/*/c2s/sessions"); local s2s_sessions = module:shared("/*/s2s/sessions"); local function print_tlsinfo(print, session) if session.secure then local sock = session.conn:socket() for k,v in pairs(sock:info()) do print(("%20s: %s"):format(k, tostring(v))) end else print(("%20s: %s"):format("protocol", "TCP")) end end function console_env.c2s:showtls(pat) local print = self.session.print; for _, session in pairs(c2s_sessions) do if not pat or session.full_jid and session.full_jid:find(pat, nil, true) then print(session.full_jid or "unauthenticated") print_tlsinfo(print, session); print"" end end end function console_env.s2s:showtls(pat) local print = self.session.print; for _, session in pairs(s2s_sessions) do if not pat or session.from_host == pat or session.to_host == pat then if session.direction == "outgoing" then print(session.from_host, "->", session.to_host) else print(session.to_host, "<-", session.from_host) end print_tlsinfo(print, session); print"" end end end
mit
hooksta4/darkstar
scripts/globals/abilities/pets/ecliptic_howl.lua
20
1294
--------------------------------------------------- -- Aerial Armor --------------------------------------------------- require("scripts/globals/settings"); require("scripts/globals/status"); require("scripts/globals/monstertpmoves"); require("scripts/globals/utils"); --------------------------------------------------- function onAbilityCheck(player, target, ability) return 0,0; end; function onPetAbility(target, pet, skill, summoner) local bonusTime = utils.clamp(summoner:getSkillLevel(SKILL_SUM) - 300, 0, 200); local duration = 180 + bonusTime; local moon = VanadielMoonPhase(); local buffvalue = 0; if moon > 90 then buffvalue = 25; elseif moon > 75 then buffvalue = 21; elseif moon > 60 then buffvalue = 17; elseif moon > 40 then buffvalue = 13; elseif moon > 25 then buffvalue = 9; elseif moon > 10 then buffvalue = 5; else buffvalue = 1; end target:delStatusEffect(EFFECT_ACCURACY_BOOST); target:delStatusEffect(EFFECT_EVASION_BOOST); target:addStatusEffect(EFFECT_ACCURACY_BOOST,buffvalue,0,duration); target:addStatusEffect(EFFECT_EVASION_BOOST,25-buffvalue,0,duration); skill:setMsg(0); return 0; end
gpl-3.0
ak48disk/wowaddons
Quartz/modules/Timer.lua
1
5850
--[[ Copyright (C) 2006-2007 Nymbia Copyright (C) 2010 Hendrik "Nevcairiel" Leppkes < h.leppkes@gmail.com > This program is free software; you can redistribute it and/or modify it under the terms of the GNU General Public License as published by the Free Software Foundation; either version 2 of the License, or (at your option) any later version. This program is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details. You should have received a copy of the GNU General Public License along with this program; if not, write to the Free Software Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. ]] local Quartz3 = LibStub("AceAddon-3.0"):GetAddon("Quartz3") local L = LibStub("AceLocale-3.0"):GetLocale("Quartz3") local MODNAME = "Timer" local Timer = Quartz3:NewModule(MODNAME, "AceEvent-3.0") local Mirror = Quartz3:GetModule("Mirror") ---------------------------- -- Upvalues local GetTime = GetTime local unpack, pairs, ipairs, tonumber = unpack, pairs, ipairs, tonumber local table_remove = table.remove local external = Mirror.ExternalTimers local thistimers = {} local getOptions function Timer:ChatHandler(msg) if self:IsEnabled() then if msg:match("^kill") then local name = msg:match("^kill (.+)$") if name then external[name] = nil for k, v in ipairs(thistimers) do if v == name then table_remove(thistimers, k) break end end self:SendMessage("Quartz3Mirror_UpdateCustom") else return Quartz3:Print(L["Usage: /quartztimer timername 60 or /quartztimer kill timername"]) end else local duration = tonumber(msg:match("^(%d+)")) local name if duration then name = msg:match("^%d+ (.+)$") else duration = tonumber(msg:match("(%d+)$")) if not duration then return Quartz3:Print(L["Usage: /quartztimer timername 60 or /quartztimer 60 timername"]) end name = msg:match("^(.+) %d+$") end if not name then return Quartz3:Print(L["Usage: /quartztimer timername 60 or /quartztimer kill timername"]) end local currentTime = GetTime() external[name].startTime = currentTime external[name].endTime = currentTime + duration for k, v in ipairs(thistimers) do if v == name then table_remove(thistimers, k) break end end thistimers[#thistimers+1] = name self:SendMessage("Quartz3Mirror_UpdateCustom") end end end function Timer:OnDisable() for k, v in pairs(thistimers) do external[v] = nil thistimers[k] = nil end self:SendMessage("Quartz3Mirror_UpdateCustom") end local function chatHandler(message) Timer:ChatHandler(message) end function Timer:OnInitialize() self:SetEnabledState(Quartz3:GetModuleEnabled(MODNAME)) Quartz3:RegisterModuleOptions(MODNAME, getOptions, L["Timer"]) Quartz3:RegisterChatCommand("qt", chatHandler) Quartz3:RegisterChatCommand("quartzt", chatHandler) Quartz3:RegisterChatCommand("quartztimer", chatHandler) end do local newname, newlength local options function getOptions() if not options then options = { type = "group", name = L["Timer"], order = 600, args = { toggle = { type = "toggle", name = L["Enable"], desc = L["Enable"], get = function() return Quartz3:GetModuleEnabled(MODNAME) end, set = function(info, v) Quartz3:SetModuleEnabled(MODNAME, v) end, order = 99, width = "full", }, newtimername = { type = "input", name = L["New Timer Name"], desc = L["Set a name for the new timer"], get = function() return newname or "" end, set = function(info, v) newname = v end, order = 100, }, newtimerlength = { type = "input", name = L["New Timer Length"], desc = L["Length of the new timer, in seconds"], get = function() return newlength or 0 end, set = function(info, v) newlength = tonumber(v) end, usage = L["<Time in seconds>"], order = 101, }, makenewtimer = { type = "execute", name = L["Make Timer"], desc = L["Make a new timer using the above settings. NOTE: it may be easier for you to simply use the command line to make timers, /qt"], func = function() local currentTime = GetTime() external[newname].startTime = currentTime external[newname].endTime = currentTime + newlength for k, v in ipairs(thistimers) do if v == newname then table_remove(thistimers, k) break end end thistimers[#thistimers+1] = newname Timer:SendMessage("Quartz3Mirror_UpdateCustom") newname = nil newlength = nil end, disabled = function() return not (newname and newlength) end, order = -3, }, nl = { type = "description", name = "", order = -2, }, killtimer = { type = "select", name = L["Stop Timer"], desc = L["Select a timer to stop"], get = function() return "" end, set = function(info, name) if name then external[name] = nil for k, v in ipairs(thistimers) do if v == name then table_remove(thistimers, k) break end end Timer:SendMessage("Quartz3Mirror_UpdateCustom") end end, values = thistimers, order = -1, }, }, } end return options end end
mit
hooksta4/darkstar
scripts/zones/Mhaura/npcs/Kamilah.lua
2
1127
----------------------------------- -- Area: Mhaura -- NPC: Kamilah -- Guild Merchant NPC: Blacksmithing Guild -- @pos -64.302 -16.000 35.261 249 ----------------------------------- package.loaded["scripts/zones/Mhaura/TextIDs"] = nil; ----------------------------------- require("scripts/globals/settings"); require("scripts/globals/shop"); require("scripts/zones/Mhaura/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) if (player:sendGuild(532,8,23,2)) then player:showText(npc,SMITHING_GUILD); end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end;
gpl-3.0
hooksta4/darkstar
scripts/zones/Temenos/Zone.lua
35
4896
----------------------------------- -- -- Zone: Temenos (37) -- ----------------------------------- package.loaded["scripts/zones/Temenos/TextIDs"] = nil; ----------------------------------- require("scripts/globals/settings"); require("scripts/zones/Temenos/TextIDs"); require("scripts/globals/limbus"); ----------------------------------- -- onInitialize ----------------------------------- function onInitialize(zone) SetServerVariable("[Temenos_W_Tower]UniqueID",0); SetServerVariable("[Temenos_N_Tower]UniqueID",0); SetServerVariable("[Temenos_E_Tower]UniqueID",0); SetServerVariable("[C_Temenos_Base]UniqueID",0); SetServerVariable("[C_Temenos_Base_II]UniqueID",0); SetServerVariable("[C_Temenos_1st]UniqueID",0); SetServerVariable("[C_Temenos_2nd]UniqueID",0); SetServerVariable("[C_Temenos_3rd]UniqueID",0); SetServerVariable("[C_Temenos_4th]UniqueID",0); SetServerVariable("[C_Temenos_4th_II]UniqueID",0); zone:registerRegion(1, 378,70,-186 ,382,72,-182); -- 'Temenos_Western_Tower' 380 71 -184 zone:registerRegion(2, 378,70,373 ,382,72,377); -- 'Temenos_Northern_Tower' 380 71 375 zone:registerRegion(3, 378,-4,93 ,382,4,98); -- 'Temenos_Eastern_Tower' 380 -2 96 zone:registerRegion(4, 578,-4,-546 ,582,4,-542); -- 'Central_Temenos_Basement' 580 -2 -544 zone:registerRegion(5, 258,-164,-506 ,262,-160,-502); -- 'Central_Temenos_1st_Floor' 260 -162 -504 zone:registerRegion(6, 18,-4,-546 ,22,4,-542); -- 'Central_Temenos_2nd_Floor' 20 -2 -544 zone:registerRegion(7, -298,-164,-502 ,-294,-160,-498); -- 'Central_Temenos_3rd_Floor' -296 -162 -500 zone:registerRegion(8, -542,-4,-586 ,-538,4,-582); -- 'Central_Temenos_4th_Floor' -540 -2 -584 end; ----------------------------------- -- onConquestUpdate ----------------------------------- function onConquestUpdate(zone, updatetype) local players = zone:getPlayers(); for name, player in pairs(players) do conquestUpdate(zone, player, updatetype, CONQUEST_BASE); end end; ----------------------------------- -- onZoneIn ----------------------------------- function onZoneIn(player,prevZone) local cs = -1; player:setPos(580,-1.5,4.452,192); return cs; end; ----------------------------------- -- onRegionEnter ----------------------------------- function onRegionEnter(player,region) local regionID = region:GetRegionID(); switch (regionID): caseof { [1] = function (x) if (player:hasStatusEffect(EFFECT_BATTLEFIELD) == false) then -- create instance Temenos_Western_Tower RegisterLimbusInstance(player,1298); end end, [2] = function (x) if (player:hasStatusEffect(EFFECT_BATTLEFIELD) == false) then -- create instance Temenos_Northern_Tower RegisterLimbusInstance(player,1299); end end, [3] = function (x) if (player:hasStatusEffect(EFFECT_BATTLEFIELD) == false) then -- create instance Temenos_Eastern_Tower RegisterLimbusInstance(player,1300); end end, [4] = function (x) if (player:hasStatusEffect(EFFECT_BATTLEFIELD) == false) then -- create instance Central_Temenos_Basement RegisterLimbusInstance(player,1301); end end, [5] = function (x) if (player:hasStatusEffect(EFFECT_BATTLEFIELD) == false) then -- create instance Central_Temenos_1st_Floor RegisterLimbusInstance(player,1303); end end, [6] = function (x) if (player:hasStatusEffect(EFFECT_BATTLEFIELD) == false) then -- create instance Central_Temenos_2nd_Floor RegisterLimbusInstance(player,1304); end end, [7] = function (x) if (player:hasStatusEffect(EFFECT_BATTLEFIELD) == false) then -- create instance Central_Temenos_3rd_Floor RegisterLimbusInstance(player,1305); end end, [8] = function (x) if (player:hasStatusEffect(EFFECT_BATTLEFIELD) == false) then -- create instance Central_Temenos_4th_Floor RegisterLimbusInstance(player,1306); end end, } end; function onRegionLeave(player,region) end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end;
gpl-3.0
gedadsbranch/Darkstar-Mission
scripts/zones/Southern_San_dOria/npcs/Ominous_Cloud.lua
19
5169
----------------------------------- -- Area: Southern Sandoria -- NPC: Ominous Cloud -- Type: Traveling Merchant NPC -- @zone: 230 -- @pos -41.550 1.999 -2.845 -- ----------------------------------- package.loaded["scripts/zones/Southern_San_dOria/TextIDs"] = nil; ----------------------------------- ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) local wijinruit = trade:getItemQty(951) local uchitake = (trade:getItemQty(1161) / 99) local tsurara = (trade:getItemQty(1164) / 99) local kawahori = (trade:getItemQty(1167) / 99) local makibishi = (trade:getItemQty(1170) / 99) local hiraishin = (trade:getItemQty(1173) / 99) local mizu = (trade:getItemQty(1176) / 99) local shihei = (trade:getItemQty(1179) / 99) local jusatsu = (trade:getItemQty(1182) / 99) local kaginawa = (trade:getItemQty(1185) / 99) local sairui = (trade:getItemQty(1188) / 99) local kodoku = (trade:getItemQty(1191) / 99) local shinobi = (trade:getItemQty(1194) / 99) local sanjaku = (trade:getItemQty(2553) / 99) local soushi = (trade:getItemQty(2555) / 99) local kabenro = (trade:getItemQty(2642) / 99) local jinko = (trade:getItemQty(2643) / 99) local mokujin = (trade:getItemQty(2970) / 99) local inoshi = (trade:getItemQty(2971) / 99) local shikan = (trade:getItemQty(2972) / 99) local chono = (trade:getItemQty(2973) / 99) local tools = (uchitake + tsurara + kawahori + makibishi + hiraishin + mizu + shihei + jusatsu + kaginawa + sairui + kodoku + shinobi + sanjaku + soushi + kabenro + jinko + mokujin + inoshi + shikan + chono) if(((tools * 99) + wijinruit) == trade:getItemCount()) then if((tools == math.floor(tools)) and (tools == wijinruit) and (player:getFreeSlotsCount() >= wijinruit)) then player:tradeComplete(); if(uchitake > 0) then player:addItem(5308,uchitake); player:messageSpecial(ITEM_OBTAINED,5308); end if(tsurara > 0) then player:addItem(5309,tsurara); player:messageSpecial(ITEM_OBTAINED,5309); end if(kawahori > 0) then player:addItem(5310,kawahori); player:messageSpecial(ITEM_OBTAINED,5310); end if(makibishi > 0) then player:addItem(5311,makibishi); player:messageSpecial(ITEM_OBTAINED,5311); end if(hiraishin > 0) then player:addItem(5312,hiraishin); player:messageSpecial(ITEM_OBTAINED,5312); end if(mizu > 0) then player:addItem(5313,mizu); player:messageSpecial(ITEM_OBTAINED,5313); end if(shihei > 0) then player:addItem(5314,shihei); player:messageSpecial(ITEM_OBTAINED,5314); end if(jusatsu > 0) then player:addItem(5315,jusatsu); player:messageSpecial(ITEM_OBTAINED,5315); end if(kaginawa > 0) then player:addItem(5316,kaginawa); player:messageSpecial(ITEM_OBTAINED,5316); end if(sairui > 0) then player:addItem(5317,sairui); player:messageSpecial(ITEM_OBTAINED,5317); end if(kodoku > 0) then player:addItem(5318,kodoku); player:messageSpecial(ITEM_OBTAINED,5318); end if(shinobi > 0) then player:addItem(5319,shinobi); player:messageSpecial(ITEM_OBTAINED,5319); end if(sanjaku > 0) then player:addItem(5417,sanjaku); player:messageSpecial(ITEM_OBTAINED,5417); end if(soushi > 0) then player:addItem(5734,soushi); player:messageSpecial(ITEM_OBTAINED,5734); end if(kabenro > 0) then player:addItem(5863,kabenro); player:messageSpecial(ITEM_OBTAINED,5863); end if(jinko > 0) then player:addItem(5864,jinko); player:messageSpecial(ITEM_OBTAINED,5864); end if(mokujin > 0) then player:addItem(5866,mokujin); player:messageSpecial(ITEM_OBTAINED,5866); end if(inoshi > 0) then player:addItem(5867,inoshi); player:messageSpecial(ITEM_OBTAINED,5867); end if(shikan > 0) then player:addItem(5868,shikan); player:messageSpecial(ITEM_OBTAINED,5868); end if(chono > 0) then player:addItem(5869,chono); player:messageSpecial(ITEM_OBTAINED,5869); end end end -- 951 Wijinruit -- 1161 Uchitake 5308 -- 1164 Tsurara 5309 -- 1167 Kawahori-ogi 5310 -- 1170 Makibishi 5311 -- 1173 Hiraishin 5312 -- 1176 Mizu-deppo 5313 -- 1179 Shihei 5314 -- 1182 Jusatsu 5315 -- 1185 Kaginawa 5316 -- 1188 Sairui-ran 5317 -- 1191 Kodoku 5318 -- 1194 Shinobi-tabi 5319 -- 2553 Sanjaku-tengui 5417 -- 2555 Soshi 5734 -- 2642 Kabenro 5863 -- 2643 Jinko 5864 -- 2970 Mokujin 5866 -- 2971 Inoshishinofuda 5867 -- 2972 Shikanofuda 5868 -- 2973 Chonofuda 5869 end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) player:startEvent(0x02f7); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end;
gpl-3.0
mynameiscraziu/godvare
plugins/minecraft.lua
624
2605
local usage = { "!mine [ip]: Searches Minecraft server on specified ip and sends info. Default port: 25565", "!mine [ip] [port]: Searches Minecraft server on specified ip and port and sends info.", } local ltn12 = require "ltn12" local function mineSearch(ip, port, receiver) --25565 local responseText = "" local api = "https://api.syfaro.net/server/status" local parameters = "?ip="..(URL.escape(ip) or "").."&port="..(URL.escape(port) or "").."&players=true&favicon=true" local http = require("socket.http") local respbody = {} local body, code, headers, status = http.request{ url = api..parameters, method = "GET", redirect = true, sink = ltn12.sink.table(respbody) } local body = table.concat(respbody) if (status == nil) then return "ERROR: status = nil" end if code ~=200 then return "ERROR: "..code..". Status: "..status end local jsonData = json:decode(body) responseText = responseText..ip..":"..port.." ->\n" if (jsonData.motd ~= nil) then local tempMotd = "" tempMotd = jsonData.motd:gsub('%§.', '') if (jsonData.motd ~= nil) then responseText = responseText.." Motd: "..tempMotd.."\n" end end if (jsonData.online ~= nil) then responseText = responseText.." Online: "..tostring(jsonData.online).."\n" end if (jsonData.players ~= nil) then if (jsonData.players.max ~= nil) then responseText = responseText.." Max Players: "..jsonData.players.max.."\n" end if (jsonData.players.now ~= nil) then responseText = responseText.." Players online: "..jsonData.players.now.."\n" end if (jsonData.players.sample ~= nil and jsonData.players.sample ~= false) then responseText = responseText.." Players: "..table.concat(jsonData.players.sample, ", ").."\n" end end if (jsonData.favicon ~= nil and false) then --send_photo(receiver, jsonData.favicon) --(decode base64 and send) end return responseText end local function parseText(chat, text) if (text == nil or text == "!mine") then return usage end ip, port = string.match(text, "^!mine (.-) (.*)$") if (ip ~= nil and port ~= nil) then return mineSearch(ip, port, chat) end local ip = string.match(text, "^!mine (.*)$") if (ip ~= nil) then return mineSearch(ip, "25565", chat) end return "ERROR: no input ip?" end local function run(msg, matches) local chat_id = tostring(msg.to.id) local result = parseText(chat_id, msg.text) return result end return { description = "Searches Minecraft server and sends info", usage = usage, patterns = { "^!mine (.*)$" }, run = run }
gpl-2.0
moto-timo/vlc
share/lua/playlist/canalplus.lua
113
3501
--[[ $Id: $ Copyright (c) 2007 the VideoLAN team This program is free software; you can redistribute it and/or modify it under the terms of the GNU General Public License as published by the Free Software Foundation; either version 2 of the License, or (at your option) any later version. This program is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details. You should have received a copy of the GNU General Public License along with this program; if not, write to the Free Software Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston MA 02110-1301, USA. --]] -- Probe function. function probe() return vlc.access == "http" and string.match( vlc.path, "www.canalplus.fr" ) end -- Parse function. function parse() p = {} --vlc.msg.dbg( vlc.path ) if string.match( vlc.path, "www.canalplus.fr/.*%?pid=.*" ) then -- This is the HTML page's URL local _,_,pid = string.find( vlc.path, "pid(%d-)%-" ) local id, name, description, arturl while true do -- Try to find the video's title local line = vlc.readline() if not line then break end -- vlc.msg.dbg( line ) if string.match( line, "aVideos" ) then if string.match( line, "CONTENT_ID.*=" ) then _,_,id = string.find( line, "\"(.-)\"" ) elseif string.match( line, "CONTENT_VNC_TITRE" ) then _,_,arturl = string.find( line, "src=\"(.-)\"" ) _,_,name = string.find( line, "title=\"(.-)\"" ) elseif string.match( line, "CONTENT_VNC_DESCRIPTION" ) then _,_,description = string.find( line, "\"(.-)\"" ) end if id and string.match( line, "new Array" ) then add_item( p, id, name, description, arturl ) id = nil name = nil arturl = nil description = nil end end end if id then add_item( p, id, name, description, arturl ) end return p elseif string.match( vlc.path, "embed%-video%-player" ) then while true do local line = vlc.readline() if not line then break end --vlc.msg.dbg( line ) if string.match( line, "<hi" ) then local _,_,path = string.find( line, "%[(http.-)%]" ) return { { path = path } } end end end end function get_url_param( url, name ) local _,_,ret = string.find( url, "[&?]"..name.."=([^&]*)" ) return ret end function add_item( p, id, name, description, arturl ) --[[vlc.msg.dbg( "id: " .. tostring(id) ) vlc.msg.dbg( "name: " .. tostring(name) ) vlc.msg.dbg( "arturl: " .. tostring(arturl) ) vlc.msg.dbg( "description: " .. tostring(description) ) --]] --local path = "http://www.canalplus.fr/flash/xml/configuration/configuration-embed-video-player.php?xmlParam="..id.."-"..get_url_param(vlc.path,"pid") local path = "http://www.canalplus.fr/flash/xml/module/embed-video-player/embed-video-player.php?video_id="..id.."&pid="..get_url_param(vlc.path,"pid") table.insert( p, { path = path; name = name; description = description; arturl = arturl } ) end
gpl-2.0
hooksta4/darkstar
scripts/zones/zones/Boneyard_Gully/mobs/Race_Runner.lua
2
1425
----------------------------------- -- Area: Boneyard_Gully -- Name: Race Runner ----------------------------------- require("scripts/globals/titles"); require("scripts/globals/status"); local path = { -539, 0, -481, -556, 0, -478, -581, 0, -475, -579, -3, -460, -572, 2, -433, -545, 1, -440, -532, 0, -466 }; ----------------------------------- -- onMobInitialize Action ----------------------------------- function onMobInitialize(mob) end; ----------------------------------- -- onMobSpawn Action ----------------------------------- function onMobSpawn(mob) onMobRoam(mob); end; ----------------------------------- -- onMobRoamAction Action ----------------------------------- function onMobRoamAction(mob) pathfind.patrol(mob, path, PATHFLAG_REVERSE); end; ----------------------------------- -- onMobRoam Action ----------------------------------- function onMobRoam(mob) -- move to start position if not moving if (mob:isFollowingPath() == false) then mob:pathThrough(pathfind.first(path)); end end; ----------------------------------- -- onMobEngaged Action ----------------------------------- function onMobEngaged(mob,target) end; ----------------------------------- -- onMobFight Action ----------------------------------- function onMobFight(mob,target) end; ----------------------------------- -- onMobDeath ----------------------------------- function onMobDeath(mob, killer) end;
gpl-3.0
gedadsbranch/Darkstar-Mission
scripts/zones/Gusgen_Mines/npcs/_5g2.lua
34
1100
----------------------------------- -- Area: Gusgen Mines -- NPC: _5g2 (Door A) -- @pos -4.001 -42.4 -25.5 196 ----------------------------------- package.loaded["scripts/zones/Gusgen_Mines/TextIDs"] = nil; ----------------------------------- require("scripts/zones/Gusgen_Mines/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) if (npc:getAnimation() == 9) then player:messageSpecial(LOCK_OTHER_DEVICE) else return 0; end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end;
gpl-3.0
hooksta4/darkstar
scripts/zones/Windurst_Waters/TextIDs.lua
9
5524
-- Variable TextID Description text -- General Texts ITEM_CANNOT_BE_OBTAINED = 6538; -- Come back after sorting your inventory. ITEM_OBTAINED = 6543; -- Obtained: <<<Unknown Parameter (Type: 80) 1>>><<<Possible Special Code: 01>>><<<Possible Special Code: 05>>> GIL_OBTAINED = 6544; -- Obtained <<<Numeric Parameter 0>>> gil. KEYITEM_OBTAINED = 6546; -- Obtained key item: <<<Unknown Parameter (Type: 80) 1>>> HOMEPOINT_SET = 6632; -- Home point set! FISHING_MESSAGE_OFFSET = 7029; -- You can't fish here. COOKING_SUPPORT = 7128; -- Your ?Multiple Choice (Parameter 1)?[fishing/woodworking/smithing/goldsmithing/clothcraft/leatherworking/bonecraft/alchemy/cooking] skills went up ... GUILD_TERMINATE_CONTRACT = 7142; -- You have terminated your trading contract with the ?Multiple Choice (Parameter 1)?[Fishermen's/Carpenters'/Blacksmiths'/Goldsmiths'/Weavers'/Tanners'/Boneworkers'/Alchemists'/Culinarians'] Guild and formed a new one with the ?Multiple Choice (Parameter 0)?[Fishermen's/Carpenters'/Blacksmiths'/Goldsmiths'/Weavers'/Tanners'/Boneworkers'/Alchemists'/Culinarians'] Guild.?Prompt? GUILD_NEW_CONTRACT = 7150; -- You have formed a new trading contract with the ?Multiple Choice (Parameter 0)?[Fishermen's/Carpenters'/Blacksmiths'/Goldsmiths'/Weavers'/Tanners'/Boneworkers'/Alchemists'/Culinarians'] Guild.?Prompt? NO_MORE_GP_ELIGIBLE = 7157; -- You are not eligible to receive guild points at this time. GP_OBTAINED = 7146; -- Obtained <<<Numeric Parameter 0>>> guild points. NOT_HAVE_ENOUGH_GP = 7163; -- You do not have enough guild points. -- Other NOTHING_OUT_OF_ORDINARY = 6557; -- There is nothing out of the ordinary here. DIABOLOS_UNLOCKED = 11863; -- You are now able to summon Diabolos! -- Conquest System CONQUEST = 9187; -- You've earned conquest points! -- Mission Dialogs YOU_ACCEPT_THE_MISSION = 6717; -- You have accepted the mission. -- Shop Texts KOPOPO_SHOP_DIALOG = 7816; -- Cooking is as much an art as music and painting are. Can your taste buds appreciate the full value of our works of art? CHOMOJINJAHL_SHOP_DIALOG = 7821; -- The qualities needed to be a good cook are strong arms, a sense of taste, and devotion. ENSASA_SHOP_DIALOG = 8888; -- Welcome to my little catalyst shop, where you'll find a range of general and unusual goods! UPIHKHACHLA_SHOP_DIALOG = 8889; -- For adventurerrrs on the go, Ensasa's Catalyst Shop is the place for all you need in generrral goods! SHOHRUNTUHRUN_SHOP_DIALOG = 8891; -- Oh, hidey-widey! This is the Federal Magic Reservey-wervey. What can I do for you today-oway? HIKOMUMAKIMU_SHOP_DIALOG = 8892; -- Welcome to the Federal Magic Reserve, the only place in the Federation where high-level magic is allowed to be sold. OREZEBREZ_SHOP_DIALOG = 8893; -- Welcome to Baren-Moren's, makers of the finest headwear. Our slogan is: he smarter the hat, the smarter the head. TAAJIJI_SHOP_DIALOG = 8895; -- May I take your order, please... NESSRUGETOMALL_SHOP_DIALOG = 11434; -- Welcome to the Rarab Tail Hostelry. MAQUMOLPIH_OPEN_DIALOG = 8896; -- Psst... Check out these things my suppliers in Aragoneu dug up. MAQUMOLPIH_CLOSED_DIALOG = 8897; -- Sorrrry, but I'm waiting on my next shipment from Aragoneu, so I'm all out of things to sell you at the moment. BAEHUFAEHU_OPEN_DIALOG = 8898; -- Can I interest you in some of Sarutabaruta's wares? Come on, have a look, and see how I fares! BAEHUFAEHU_CLOSED_DIALOG = 8899; -- Sorry-dorry, but I'm taking a breaky-wakey! (Or, as you'll be knowing, since control of Sarutabaruta was lost, I'm out of stock, so go on, get going!) AHYEEKIH_OPEN_DIALOG = 8900; -- Psst... Wanna buy somethin' cheap from Kolshushu? AHYEEKIH_CLOSED_DIALOG = 8901; -- Hee-hee-hee... Can you hang on a while? I can start selling you good stuff from Kolshushu once I'm ready. FOMINA_OPEN_DIALOG = 8902; -- Hello, adventurer! Can I interest you in something a little different--something from Elshimo? FOMINA_CLOSED_DIALOG = 8903; -- Well, um, let me see... This should be a good spot to open shop. There are some wealthy-looking Tarutaru houses nearby. It's quiet and yet there're plenty of passers-by... OTETE_OPEN_DIALOG = 8904; -- He-he-he... Hey! How's about... Items from Li'Telor that you can't do without? Reckon you could do, with one of these or two? OTETE_CLOSED_DIALOG = 8905; -- Oh... Phew... My heart is so blue... Bluer than these flowers... Leave me be for a couple hours... JOURILLE_OPEN_DIALOG = 8906; -- Greetings. Can I interest you in some of these goods from Ronfaure...? JOURILLE_CLOSED_DIALOG = 8907; -- Greetings! I am Jourille, your friendly neighborhood traveling merchant. I would most like to sell you something from Ronfaure right now, but I regret that I am waiting on my next shipment. PRESTAPIQ_CLOSED_DIALOG = 10629; -- Goodebyongo! Wingdorsht tooo fhar awayz fhrum mai hormtowne! Dropt arll goodhys whylle ahn trripp! PRESTAPIQ_OPEN_DIALOG = 10630; -- Helgohelgo! Me's bhrink goodhys arll ja wayz fhrum hormtowne ovf Morvalporlis! -- Harvest Festival TRICK_OR_TREAT = 10136; -- Trick or treat... THANK_YOU_TREAT = 10137; -- And now for your treat... HERE_TAKE_THIS = 10138; -- Here, take this... IF_YOU_WEAR_THIS = 10139; -- If you put this on and walk around, something...unexpected might happen... THANK_YOU = 10137; -- Thank you... -- conquest Base CONQUEST_BASE = 0;
gpl-3.0
hooksta4/darkstar
scripts/zones/RuAun_Gardens/npcs/qm1.lua
16
1435
----------------------------------- -- Area: Ru'Aun Gardens -- NPC: ??? (Genbu's Spawn) -- Allows players to spawn the HNM Genbu with a Gem of the North and a Winterstone. -- @pos 257 -70 517 130 ----------------------------------- package.loaded["scripts/zones/RuAun_Gardens/TextIDs"] = nil; ----------------------------------- require("scripts/zones/RuAun_Gardens/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) -- Trade Gem of the North and Winterstone if (GetMobAction(17309980) == 0 and trade:hasItemQty(1424,1) and trade:hasItemQty(1425,1) and trade:getItemCount() == 2) then player:tradeComplete(); SpawnMob(17309980,300):updateClaim(player); -- Spawn Genbu player:showText(npc,SKY_GOD_OFFSET + 5); end end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) player:messageSpecial(SKY_GOD_OFFSET); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end;
gpl-3.0
gedadsbranch/Darkstar-Mission
scripts/zones/Windurst_Waters_[S]/npcs/Rakih_Lyhall.lua
38
1050
----------------------------------- -- Area: Windurst Waters (S) -- NPC: Rakih Lyhall -- Type: Standard NPC -- @zone: 94 -- @pos -48.111 -4.5 69.712 -- -- Auto-Script: Requires Verification (Verified by Brawndo) ----------------------------------- package.loaded["scripts/zones/Windurst_Waters_[S]/TextIDs"] = nil; ----------------------------------- ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) player:startEvent(0x01ad); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end;
gpl-3.0
AnySDK/Sample_Lua
frameworks/cocos2d-x/cocos/scripting/lua-bindings/auto/api/SkeletonAnimation.lua
10
1885
-------------------------------- -- @module SkeletonAnimation -- @extend SkeletonRenderer -- @parent_module sp -------------------------------- -- -- @function [parent=#SkeletonAnimation] setStartListener -- @param self -- @param #function listener -------------------------------- -- -- @function [parent=#SkeletonAnimation] setTrackEventListener -- @param self -- @param #spTrackEntry entry -- @param #function listener -------------------------------- -- -- @function [parent=#SkeletonAnimation] setTrackCompleteListener -- @param self -- @param #spTrackEntry entry -- @param #function listener -------------------------------- -- -- @function [parent=#SkeletonAnimation] setTrackStartListener -- @param self -- @param #spTrackEntry entry -- @param #function listener -------------------------------- -- -- @function [parent=#SkeletonAnimation] setCompleteListener -- @param self -- @param #function listener -------------------------------- -- -- @function [parent=#SkeletonAnimation] setTrackEndListener -- @param self -- @param #spTrackEntry entry -- @param #function listener -------------------------------- -- -- @function [parent=#SkeletonAnimation] setEventListener -- @param self -- @param #function listener -------------------------------- -- -- @function [parent=#SkeletonAnimation] setMix -- @param self -- @param #string fromAnimation -- @param #string toAnimation -- @param #float duration -------------------------------- -- -- @function [parent=#SkeletonAnimation] setEndListener -- @param self -- @param #function listener -------------------------------- -- -- @function [parent=#SkeletonAnimation] clearTracks -- @param self -------------------------------- -- -- @function [parent=#SkeletonAnimation] clearTrack -- @param self return nil
mit
hooksta4/darkstar
scripts/zones/Southern_San_dOria/npcs/Paouala.lua
2
2102
----------------------------------- -- Area: Southern San d'Oria -- NPC: Paouala -- Starts and Finishes Quest: Sleepless Nights -- @zone 230 -- @pos 158 -6 17 ------------------------------------- package.loaded["scripts/zones/Southern_San_dOria/TextIDs"] = nil; ----------------------------------- require("scripts/globals/settings"); require("scripts/globals/titles"); require("scripts/globals/shop"); require("scripts/globals/quests"); require("scripts/zones/Southern_San_dOria/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) if (player:getQuestStatus(SANDORIA,SLEEPLESS_NIGHTS) == QUEST_ACCEPTED) then if (trade:hasItemQty(4527,1) and trade:getItemCount() == 1) then player:startEvent(0x0054); end end end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) sleeplessNights = player:getQuestStatus(SANDORIA,SLEEPLESS_NIGHTS); if (player:getFameLevel(SANDORIA) >= 2 and sleeplessNights == QUEST_AVAILABLE) then player:startEvent(0x0055); elseif (sleeplessNights == QUEST_ACCEPTED) then player:startEvent(0x0053); elseif (sleeplessNights == QUEST_COMPLETED) then player:startEvent(0x0051); else player:startEvent(0x0052); end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); if (csid == 0x0055 and option == 1) then player:addQuest(SANDORIA,SLEEPLESS_NIGHTS); elseif (csid == 0x0054) then player:tradeComplete(); player:addTitle(SHEEPS_MILK_DELIVERER); player:addGil(GIL_RATE*5000); player:messageSpecial(GIL_OBTAINED,GIL_RATE*5000); player:addFame(SANDORIA,SAN_FAME*30); player:completeQuest(SANDORIA,SLEEPLESS_NIGHTS); end end;
gpl-3.0
jpuigcerver/Laia
laia/util/io.lua
1
4153
require 'laia.util.types' tds = require 'tds' -- read symbols_table file. this file contains -- two columns: "symbol id" function laia.read_symbols_table(filename, sym2int, int2sym, subtract) local num_symbols = 0 sym2int = sym2int or {} -- If sym2int table is given, update it int2sym = int2sym or {} -- If int2sym table is given, update it subtract = subtract or true local f = io.open(filename, 'r') assert(f ~= nil, ('Unable to read symbols table: %q'):format(filename)) local ln = 0 -- Line number while true do local line = f:read('*line') if line == nil then break end ln = ln + 1 local sym, id = string.match(line, '^(%S+)%s+(%d+)$') assert(sym ~= nil and id ~= nil, ('Expected a string and an integer separated by a space at ' .. 'line %d in file %q'):format(ln, filename)) int = tonumber(id) num_symbols = int > num_symbols and int or num_symbols if subtract then int = int - 1 end sym2int[sym] = int table.insert(int2sym, int, sym) end f:close() return num_symbols, sym2int, int2sym end function laia.check_contiguous_int2sym(int2sym) local ei = 0 -- Expected integer ID for i,_ in ipairs(int2sym) do ei = ei + 1 if i ~= ei then return false end end return true end function laia.read_transcripts_table(filename, sym2int, transcripts, sym_count) local num_transcripts = 0 transcripts = transcripts or {} -- If transcripts table is given, update it --transcripts = transcripts or tds.Hash() -- If transcripts table is given, update it sym_count = sym_count or {} -- If counts table is given, update it for key,val in pairs(sym2int) do if sym_count[val] == nil then sym_count[val] = 0 end end local f = io.open(filename, 'r') assert(f ~= nil, ('Unable to read transcripts table: %q'):format(filename)) local ln = 0 while true do local line = f:read('*line') if line == nil then break end ln = ln + 1 local id, txt = string.match(line, '^(%S+)%s+(%S.*)$') assert(id ~= nil and txt ~= nil, ('Wrong transcript format at line %d in file %q') :format(ln, filename)) transcripts[id] = {} --transcripts[id] = tds.Vec() num_transcripts = num_transcripts + 1 for sym in txt:gmatch('%S+') do if sym2int ~= nil then assert(sym2int[sym] ~= nil, ('Symbol %q is not in the symbols table'):format(sym)) table.insert(transcripts[id], sym2int[sym]) --transcripts[id]:insert(sym2int[sym]) local isym = sym2int[sym] sym_count[isym] = sym_count[isym] + 1 else assert(laia.isint(sym), ('Token %q is not an integer and no symbols table was given.') :format(sym)) table.insert(transcripts[id], sym) --transcripts[id]:insert(sym) end end end f:close() return num_transcripts, transcripts, sym_count end -- Load sample files and IDs from list. The IDs are the basenames of the files, -- i.e., removing directory and extension. function laia.read_files_list(filename, transcripts, file_list, sample_list) local num_samples = 0 --file_list = file_list or {} -- If file_list table is given, update it --sample_list = sample_list or {} -- If sample_list table is given, update it file_list = file_list or tds.Vec() -- If file_list table is given, update it sample_list = sample_list or tds.Vec() -- If sample_list table is given, update it local f = io.open(filename, 'r') assert(f ~= nil, ('Unable to read image list file: %q'):format(filename)) local ln = 0 while true do local line = f:read('*line') if line == nil then break end ln = ln + 1 local id = string.match(string.gsub(line, ".*/", ""), '^(.+)[.][^./]+$') assert(id ~= nil, ('Unable to determine sample ID at line %d in file %q') :format(ln, filename)) assert(transcripts == nil or transcripts[id] ~= nil, ('No transcription was found for sample ID %q'):format(id)) --table.insert(file_list, line) --table.insert(sample_list, id) file_list:insert(line) sample_list:insert(id) num_samples = num_samples + 1 end f:close() return num_samples, file_list, sample_list end
mit
hooksta4/darkstar
scripts/zones/zones/Windurst_Waters/npcs/Kerutoto.lua
2
11336
----------------------------------- -- Area: Windurst Waters -- NPC: Kerutoto -- Starts Quest Food For Thought -- Involved in Quest: Riding on the Clouds -- @zone 238 -- @pos 13 -5 -157 ----------------------------------- package.loaded["scripts/zones/Windurst_Waters/TextIDs"] = nil; package.loaded["scripts/globals/settings"] = nil; ----------------------------------- require("scripts/globals/missions"); require("scripts/globals/settings"); require("scripts/globals/titles"); require("scripts/globals/keyitems"); require("scripts/globals/quests"); require("scripts/zones/Windurst_Waters/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) local count = trade:getItemCount(); if (player:getQuestStatus(WINDURST,BLUE_RIBBON_BLUES) == QUEST_ACCEPTED) then if (trade:hasItemQty(12521,1) and count == 1) then player:startEvent(0x016a); elseif (trade:hasItemQty(13569,1) and count == 1) then if (player:getVar("BlueRibbonBluesProg") == 4) then player:startEvent(0x016d); -- Lost, ribbon but it came back else player:startEvent(0x0166,3600); end end end if (player:getQuestStatus(WINDURST,FOOD_FOR_THOUGHT) == QUEST_ACCEPTED and trade:hasItemQty(4371,1) and count == 1) then player:startEvent(0x014c,440); player:setVar("Kerutoto_Food_var",2); end if (player:getQuestStatus(JEUNO,RIDING_ON_THE_CLOUDS) == QUEST_ACCEPTED and player:getVar("ridingOnTheClouds_4") == 3) then if (trade:hasItemQty(1127,1) and count == 1) then -- Trade Kindred seal player:setVar("ridingOnTheClouds_4",0); player:tradeComplete(); player:addKeyItem(SPIRITED_STONE); player:messageSpecial(KEYITEM_OBTAINED,SPIRITED_STONE); end end end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) local KerutotoFood = player:getVar("Kerutoto_Food_var"); -- Variable to track progress of Kerutoto in Food for Thought local FoodForThought = player:getQuestStatus(WINDURST,FOOD_FOR_THOUGHT); local OhbiruFood = player:getVar("Ohbiru_Food_var"); -- Variable to track progress of Ohbiru-Dohbiru in Food for Thought local BlueRibbonBlues = player:getQuestStatus(WINDURST,BLUE_RIBBON_BLUES); local needZone = player:needToZone(); local realday = tonumber(os.date("%j")); -- %M for next minute, %j for next day local waking_dreams = player:getQuestStatus(WINDURST,WAKING_DREAMS) -- Awakening of the Gods -- if (player:getCurrentMission(WINDURST) == AWAKENING_OF_THE_GODS and player:getVar("MissionStatus") == 0) then player:startEvent(0x02E1); elseif (player:getCurrentMission(WINDURST) == AWAKENING_OF_THE_GODS and player:getVar("MissionStatus") == 1) then player:startEvent(0x02E0); elseif (player:getCurrentMission(WINDURST) == AWAKENING_OF_THE_GODS and player:getVar("MissionStatus") == 2) then player:startEvent(0x02E2); -- Three Paths -- elseif (player:getCurrentMission(COP) == THREE_PATHS and player:getVar("COP_Ulmia_s_Path") == 3) then player:startEvent(0x036c); -- Waking Dreams -- elseif (player:hasKeyItem(VIAL_OF_DREAM_INCENSE)==false and ((player:hasCompletedMission(COP,DARKNESS_NAMED) and waking_dreams == QUEST_AVAILABLE ) or(waking_dreams == QUEST_COMPLETED and realday ~= player:getVar("Darkness_Named_date")))) then player:addQuest(WINDURST,WAKING_DREAMS); player:startEvent(0x0396);--918 elseif (player:hasKeyItem(WHISPER_OF_DREAMS)==true) then local availRewards = 0 if (player:hasItem(17599)) then availRewards = availRewards + 1; end -- Diabolos's Pole if (player:hasItem(14814)) then availRewards = availRewards + 2; end -- Diabolos's Earring if (player:hasItem(15557)) then availRewards = availRewards + 4; end -- Diabolos's Ring if (player:hasItem(15516)) then availRewards = availRewards + 8; end -- Diabolos's Torque if (player:hasSpell(304)) then availRewards = availRewards + 32; -- Pact else availRewards = availRewards + 16 -- Gil end player:startEvent(0x0398,17599,14814,15557,15516,0,0,0,availRewards); -- Blue Ribbon Blues -- elseif (BlueRibbonBlues == QUEST_COMPLETED and needZone) then player:startEvent(0x016b);--363 elseif (BlueRibbonBlues == QUEST_ACCEPTED) then local blueRibbonProg = player:getVar("BlueRibbonBluesProg"); if (player:hasItem(12521)) then player:startEvent(0x016a);--362 elseif (blueRibbonProg == 2 and needZone == false) then local timerDay = player:getVar("BlueRibbonBluesTimer_Day"); local currentDay = VanadielDayOfTheYear(); if (player:getVar("BlueRibbonBluesTimer_Year") < VanadielYear()) then player:startEvent(0x0168); -- go to the grave 360 elseif (timerDay + 1 == VanadielDayOfTheYear() and player:getVar("BlueRibbonBluesTimer_Hour") <= VanadielHour()) then player:startEvent(0x0168); -- go to the grave 360 elseif (timerDay + 2 <= VanadielDayOfTheYear()) then player:startEvent(0x0168); -- go to the grave 360 else player:startEvent(0x0167); -- Thanks for the ribbon 359 end elseif (blueRibbonProg == 3) then if (player:hasItem(13569)) then player:startEvent(0x0169,0,13569); -- remidner, go to the grave else player:startEvent(0x016e,0,13569); -- lost the ribbon end elseif (blueRibbonProg == 4) then player:startEvent(0x016e,0,13569); else player:startEvent(0x0132); -- Standard Conversation end elseif (BlueRibbonBlues == QUEST_AVAILABLE and player:getQuestStatus(WINDURST,WATER_WAY_TO_GO) == QUEST_COMPLETED and player:getFameLevel(WINDURST) >= 5) then player:startEvent(0x0165); -- Food for Thought -- elseif (FoodForThought == QUEST_AVAILABLE) then if (OhbiruFood == 1 and KerutotoFood ~= 256) then -- Player knows the researchers are hungry and quest not refused player:startEvent(0x0139,0,4371); -- Offered Quest 1 (Including Order ifYES) elseif (OhbiruFood == 1 and KerutotoFood == 256) then -- Player knows the researchers are hungry and quest refused previously player:startEvent(0x013a,0,4371); -- Offered Quest 2 (Including Order ifYES) else player:startEvent(0x0138); -- Before Quest: Asks you to check on others. end elseif (FoodForThought == QUEST_ACCEPTED) then if (KerutotoFood == 1) then player:startEvent(0x013b,0,4371); -- Repeats Order elseif (KerutotoFood == 3) then player:startEvent(0x014d); -- Reminder to check with the others if this NPC has already been fed end elseif (FoodForThought == QUEST_COMPLETED and needZone) then player:startEvent(0x0130); -- NPC is sleeping but feels full (post Food for Thought) else player:startEvent(0x0132); -- Standard Conversation end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); if (csid == 0x036c) then player:setVar("COP_Ulmia_s_Path",4); elseif ((csid == 0x0139 and option == 0) or (csid == 0x013a and option == 0)) then player:addQuest(WINDURST,FOOD_FOR_THOUGHT); player:setVar("Kerutoto_Food_var",1); elseif (csid == 0x0139 and option == 1) then player:setVar("Kerutoto_Food_var",256); elseif (csid == 0x014c) then if (player:getVar("Kerutoto_Food_var") == 2 and player:getVar("Kenapa_Food_var") == 4 and player:getVar("Ohbiru_Food_var") == 3) then -- If this is the last NPC to be fed player:addGil(GIL_RATE*440); player:tradeComplete(); player:addTitle(FAST_FOOD_DELIVERER); player:addFame(WINDURST,WIN_FAME*100); player:needToZone(true); player:completeQuest(WINDURST,FOOD_FOR_THOUGHT); player:setVar("Kerutoto_Food_var",0); -- ------------------------------------------ player:setVar("Kenapa_Food_var",0); -- Erase all the variables used in this quest player:setVar("Ohbiru_Food_var",0); -- ------------------------------------------ else player:tradeComplete(); player:addGil(GIL_RATE*440); player:setVar("Kerutoto_Food_var",3); -- If this is NOT the last NPC given food, flag this NPC as completed. end elseif (csid == 0x0165) then player:addQuest(WINDURST,BLUE_RIBBON_BLUES); elseif (csid == 0x0166 or csid == 0x016d) then player:tradeComplete(); player:setVar("BlueRibbonBluesProg",2); player:setVar("BlueRibbonBluesTimer_Hour",VanadielHour()); player:setVar("BlueRibbonBluesTimer_Year",VanadielYear()); player:setVar("BlueRibbonBluesTimer_Day",VanadielDayOfTheYear()); player:needToZone(true); if (csid == 0x0166) then player:addGil(GIL_RATE*3600); end elseif (csid == 0x0168) then if (player:getFreeSlotsCount() >= 1) then player:setVar("BlueRibbonBluesProg",3); player:setVar("BlueRibbonBluesTimer_Hour",0); player:setVar("BlueRibbonBluesTimer_Year",0); player:setVar("BlueRibbonBluesTimer_Day",0); player:addItem(13569); player:messageSpecial(ITEM_OBTAINED,13569); else player:messageSpecial(ITEM_CANNOT_BE_OBTAINED,13569); end elseif (csid == 0x016a) then player:completeQuest(WINDURST,BLUE_RIBBON_BLUES); player:setVar("BlueRibbonBluesProg",0); player:addFame(WINDURST,WIN_FAME*140); player:addTitle(GHOSTIE_BUSTER); player:needToZone(true); elseif (csid == 0x0396) then --diablos start player:addKeyItem(VIAL_OF_DREAM_INCENSE); player:messageSpecial(KEYITEM_OBTAINED,VIAL_OF_DREAM_INCENSE); elseif (csid == 0x0398) then --diablos reward local item = 0; local addspell = 0; if (option == 1 and player:hasItem(17599)==false) then item = 17599;--diaboloss-pole elseif (option == 2 and player:hasItem(14814)==false) then item = 14814;--diaboloss-earring elseif (option == 3 and player:hasItem(15557)==false) then item = 15557;--diaboloss-ring elseif (option == 4 and player:hasItem(15516)==false) then item = 15516;--diaboloss-torque elseif (option == 5) then player:addGil(GIL_RATE*15000); player:messageSpecial(GIL_OBTAINED,GIL_RATE*15000); -- Gil player:delKeyItem(WHISPER_OF_DREAMS); player:setVar("Darkness_Named_date", os.date("%j")); -- %M for next minute, %j for next day player:completeQuest(WINDURST,WAKING_DREAMS); elseif (option == 6 and player:hasSpell(304)==false) then player:addSpell(304); -- diabolos Spell player:messageSpecial(DIABOLOS_UNLOCKED,0,0,0); addspell=1; end if (addspell==1) then player:delKeyItem(WHISPER_OF_DREAMS); player:setVar("Darkness_Named_date", os.date("%j")); -- %M for next minute, %j for next day player:completeQuest(WINDURST,WAKING_DREAMS); elseif (item > 0 and player:getFreeSlotsCount()~=0) then player:delKeyItem(WHISPER_OF_DREAMS); player:setVar("Darkness_Named_date", os.date("%j")); -- %M for next minute, %j for next day player:completeQuest(WINDURST,WAKING_DREAMS); player:addItem(item); player:messageSpecial(ITEM_OBTAINED,item); -- Item elseif ( option ~= 5 and (( item == 0 and addspell==0 ) or (item > 0 and player:getFreeSlotsCount()==0) ) ) then player:messageSpecial(ITEM_CANNOT_BE_OBTAINED,item); end elseif (csid == 0x02E0) then player:setVar("MissionStatus",2); end end;
gpl-3.0
ASTPP/trunk
freeswitch/scripts/astpp/astpp.lua
1
2518
------------------------------------------------------------------------------------- -- ASTPP - Open Source VoIP Billing Solution -- -- Copyright (C) 2016 iNextrix Technologies Pvt. Ltd. -- Samir Doshi <samir.doshi@inextrix.com> -- ASTPP Version 3.0 and above -- License https://www.gnu.org/licenses/agpl-3.0.html -- -- This program is free software: you can redistribute it and/or modify -- it under the terms of the GNU Affero General Public License as -- published by the Free Software Foundation, either version 3 of the -- License, or (at your option) any later version. -- -- This program is distributed in the hope that it will be useful, -- but WITHOUT ANY WARRANTY; without even the implied warranty of -- MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the -- GNU Affero General Public License for more details. -- -- You should have received a copy of the GNU Affero General Public License -- along with this program. If not, see <http://www.gnu.org/licenses/>. -------------------------------------------------------------------------------------- -- Define script path local script_path = "/usr/local/freeswitch/scripts/astpp/"; -- Load config file dofile("/var/lib/astpp/astpp.lua"); -- Load CONSTANT file dofile("/usr/local/freeswitch/scripts/astpp/constant.lua"); -- Load json file to decode json string JSON = (loadfile (script_path .."lib/JSON.lua"))(); -- Load utility file dofile(script_path.."lib/astpp.utility.lua"); -- Include Logger file to print messages dofile(script_path.."lib/astpp.logger.lua"); -- Include database connection file to connect database dofile(script_path.."lib/astpp.db.lua"); -- Call database connection db_connect() -- Include common functions file dofile(script_path.."lib/astpp.functions.lua"); config = load_conf() -- Include file to build xml for fs dofile(script_path.."scripts/astpp.xml.lua"); -- Include custom file to load custom function dofile(script_path.."lib/astpp.custom.lua"); if (not params) then params = {} function params:getHeader(name) self.name = name; end function params:serialize(name) self.name = name; end end if (config['debug']==2) then -- print all params if (params:serialize() ~= nil) then Logger.notice ("[xml_handler] Params:\n" .. params:serialize()) end for param_key,param_value in pairs(XML_REQUEST) do --pseudocode Logger.info ("[xml_REQUEST] "..param_key..": " .. param_value) end end dofile(script_path.."scripts/astpp."..XML_REQUEST["section"]..".lua")
gpl-2.0
moto-timo/vlc
share/lua/playlist/metachannels.lua
92
2096
--[[ $Id$ Copyright © 2010 VideoLAN and AUTHORS Authors: Rémi Duraffort <ivoire at videolan dot org> This program is free software; you can redistribute it and/or modify it under the terms of the GNU General Public License as published by the Free Software Foundation; either version 2 of the License, or (at your option) any later version. This program is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details. You should have received a copy of the GNU General Public License along with this program; if not, write to the Free Software Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston MA 02110-1301, USA. --]] require "simplexml" function probe() return vlc.access == 'http' and string.match( vlc.path, 'metachannels.com' ) end function parse() local webpage = '' while true do local line = vlc.readline() if line == nil then break end webpage = webpage .. line end local feed = simplexml.parse_string( webpage ) local channel = feed.children[1] -- list all children that are items local tracks = {} for _,item in ipairs( channel.children ) do if( item.name == 'item' ) then simplexml.add_name_maps( item ) local url = vlc.strings.resolve_xml_special_chars( item.children_map['link'][1].children[1] ) local title = vlc.strings.resolve_xml_special_chars( item.children_map['title'][1].children[1] ) local arturl = nil if item.children_map['media:thumbnail'] then arturl = vlc.strings.resolve_xml_special_chars( item.children_map['media:thumbnail'][1].attributes['url'] ) end table.insert( tracks, { path = url, title = title, arturl = arturl, options = {':play-and-pause'} } ) end end return tracks end
gpl-2.0
PrashntS/dotfiles
etc/hammerspoon/Spoons/RoundedCorners.spoon/init.lua
1
4129
--- === RoundedCorners === --- --- Give your screens rounded corners --- --- Download: [https://github.com/Hammerspoon/Spoons/raw/master/Spoons/RoundedCorners.spoon.zip](https://github.com/Hammerspoon/Spoons/raw/master/Spoons/RoundedCorners.spoon.zip) local obj = {} obj.__index = obj -- Metadata obj.name = "RoundedCorners" obj.version = "1.0" obj.author = "Chris Jones <cmsj@tenshu.net>" obj.homepage = "https://github.com/Hammerspoon/Spoons" obj.license = "MIT - https://opensource.org/licenses/MIT" obj.corners = {} obj.screenWatcher = nil --- RoundedCorners.allScreens --- Variable --- Controls whether corners are drawn on all screens or just the primary screen. Defaults to true obj.allScreens = true --- RoundedCorners.radius --- Variable --- Controls the radius of the rounded corners, in points. Defaults to 6 obj.radius = 6 --- RoundedCorners.level --- Variable --- Controls which level of the screens the corners are drawn at. See `hs.canvas.windowLevels` for more information. Defaults to `screenSaver + 1` obj.level = hs.canvas.windowLevels["cursor"] -- Internal function used to find our location, so we know where to load files from local function script_path() local str = debug.getinfo(2, "S").source:sub(2) return str:match("(.*/)") end obj.spoonPath = script_path() function obj:init() self.screenWatcher = hs.screen.watcher.new(function() self:screensChanged() end) self.spaceWatcher = hs.spaces.watcher.new(function() self:screensChanged() end) end --- RoundedCorners:start() --- Method --- Starts RoundedCorners --- --- Parameters: --- * None --- --- Returns: --- * The RoundedCorners object --- --- Notes: --- * This will draw the rounded screen corners and start watching for changes in screen sizes/layouts, reacting accordingly function obj:start() self.screenWatcher:start() self.spaceWatcher:start() self:render() return self end --- RoundedCorners:stop() --- Method --- Stops RoundedCorners --- --- Parameters: --- * None --- --- Returns: --- * The RoundedCorners object --- --- Notes: --- * This will remove all rounded screen corners and stop watching for changes in screen sizes/layouts function obj:stop() self.screenWatcher:stop() self.spaceWatcher:stop() self:deleteAllCorners() return self end -- Delete all the corners function obj:deleteAllCorners() hs.fnutils.each(self.corners, function(corner) corner:delete(0.4) end) self.corners = {} end -- React to the screens having changed function obj:screensChanged() self:deleteAllCorners() self:render() end -- Get the screens to draw on, given the user's settings function obj:getScreens() if self.allScreens then return hs.screen.allScreens() else return {hs.screen.primaryScreen()} end end -- Draw the corners function obj:render() local screens = self:getScreens() local radius = self.radius hs.fnutils.each(screens, function(screen) local screenFrame = screen:fullFrame() local cornerData = { { frame={x=screenFrame.x, y=screenFrame.y}, center={x=radius,y=radius} }, { frame={x=screenFrame.x + screenFrame.w - radius, y=screenFrame.y}, center={x=0,y=radius} }, { frame={x=screenFrame.x, y=screenFrame.y + screenFrame.h - radius}, center={x=radius,y=0} }, { frame={x=screenFrame.x + screenFrame.w - radius, y=screenFrame.y + screenFrame.h - radius}, center={x=0,y=0} }, } for _,data in pairs(cornerData) do self.corners[#self.corners+1] = hs.canvas.new({x=data.frame.x, y=data.frame.y, w=radius, h=radius}) :appendElements( { action="build", type="rectangle", }, { action="clip", type="circle", center=data.center, radius=radius, reversePath=true, }, { action="fill", type="rectangle", frame={x=0, y=0, w=radius, h=radius, }, fillColor={ alpha=1, }}, { type="resetClip", }) :behavior(hs.canvas.windowBehaviors.stationary) :level(self.level) :show(0.4) end end) end return obj
mit
hooksta4/darkstar
scripts/globals/abilities/chakra.lua
18
1872
----------------------------------- -- Ability: Chakra -- Cures certain status effects and restores a small amount of HP to user. -- Obtained: Monk Level 35 -- Recast Time: 5:00 -- Duration: Instant ----------------------------------- require("scripts/globals/status"); ----------------------------------- -- onAbilityCheck ----------------------------------- function onAbilityCheck(player,target,ability) return 0,0; end; ----------------------------------- -- onUseAbility ----------------------------------- function onUseAbility(player,target,ability) local hp = player:getHP(); local vit = player:getStat(MOD_VIT); local multi = 2; local merits = player:getMerit(MERIT_INVIGORATE); local body = player:getEquipID(SLOT_BODY); local hand = player:getEquipID(SLOT_HANDS); if (player:hasStatusEffect(EFFECT_POISON)) then player:delStatusEffect(EFFECT_POISON); end if (player:hasStatusEffect(EFFECT_BLINDNESS)) then player:delStatusEffect(EFFECT_BLINDNESS); end if ((body == 12639) or (body == 14474)) then -- Temple Cyclas (+1) equipped if (player:hasStatusEffect(EFFECT_PARALYSIS)) then player:delStatusEffect(EFFECT_PARALYSIS); end multi = multi + 1; end if ((hand == 15103) or (hand == 14910)) then -- Melee Gloves (+1) equipped if (player:hasStatusEffect(EFFECT_DISEASE)) then player:delStatusEffect(EFFECT_DISEASE); end multi = multi + 0.6; end local recover = (multi * vit); player:setHP((hp + recover)); if (merits >= 1) then if (player:hasStatusEffect(EFFECT_REGEN)) then player:delStatusEffect(EFFECT_REGEN); end player:addStatusEffect(EFFECT_REGEN,10,0,merits,0,0,1); end return recover; end;
gpl-3.0
FishFilletsNG/fillets-data
script/ending/demo_dialogs_nl.lua
1
1358
dialogId("dlg-x-poster1", "font_poster", "Good morning, fish!") dialogStr("Goede morgen, vissen!") dialogId("dlg-x-poster2", "font_poster", "Again, you didn’t disappoint us. General Committee decided to decorate you with the highest orders. They are made of milk chocolate. Due to confidentiality, eat them immediately.") dialogStr("Jullie hebben ons weer niet teleurgesteld. De Commissie heeft besloten jullie met de hoogste eer te bekleden. Die bestaat uit melkchocolade. Gezien de noodzaak voor geheimhouding moeten jullie het gelijk opeten.") dialogId("dlg-x-boss", "font_poster", "BOSS") dialogStr("BAAS") dialogId("dlg-x-poster3", "font_poster", "PS: I understand this little pld issue, but next time please tell me in advance, so that we can provide an adoption permission.") dialogStr("PS: Ik heb begrip voor het gedoe met het kleine roze monstertje, maar vertel het volgende keer wat eerder, zodat we de adoptiepapieren op tijd klaar hebben.") dialogId("dlg-x-poster4", "font_poster", "PPS: Tell me, where did you find such a good player that he managed it all? I wish he won the computer or at least some of the other prizes.") dialogStr("PPS: Vertel eens, waar heb je zo'n goeie speler vandaan gehaald die alles heeft weten op te lossen? Ik wou dat hij of zij de computer had gewonnen, of in ieder geval één van de andere prijzen.")
gpl-2.0
hooksta4/darkstar
scripts/globals/spells/dia_ii.lua
18
2295
----------------------------------------- -- Spell: Dia II -- Lowers an enemy's defense and gradually deals light elemental damage. ----------------------------------------- require("scripts/globals/settings"); require("scripts/globals/status"); require("scripts/globals/magic"); ----------------------------------------- -- OnSpellCast ----------------------------------------- function onMagicCastingCheck(caster,target,spell) return 0; end; function onSpellCast(caster,target,spell) --calculate raw damage local basedmg = caster:getSkillLevel(ENFEEBLING_MAGIC_SKILL) / 4; local dmg = calculateMagicDamage(basedmg,3,caster,spell,target,ENFEEBLING_MAGIC_SKILL,MOD_INT,false); -- Softcaps at 8, should always do at least 1 dmg = utils.clamp(dmg, 1, 8); --get resist multiplier (1x if no resist) local resist = applyResistance(caster,spell,target,caster:getStat(MOD_INT)-target:getStat(MOD_INT),ENFEEBLING_MAGIC_SKILL,1.0); --get the resisted damage dmg = dmg*resist; --add on bonuses (staff/day/weather/jas/mab/etc all go in this function) dmg = addBonuses(caster,spell,target,dmg); --add in target adjustment dmg = adjustForTarget(target,dmg,spell:getElement()); --add in final adjustments including the actual damage dealt local final = finalMagicAdjustments(caster,target,spell,dmg); -- Calculate duration. local duration = 120; local dotBonus = 0; if (caster:hasStatusEffect(EFFECT_SABOTEUR)) then duration = duration * 2; end caster:delStatusEffect(EFFECT_SABOTEUR); dotBonus = dotBonus+caster:getMod(MOD_DIA_DOT); -- Dia Wand -- Check for Bio. local bio = target:getStatusEffect(EFFECT_BIO); -- Do it! if (bio == nil or (DIA_OVERWRITE == 0 and bio:getPower() <= 2) or (DIA_OVERWRITE == 1 and bio:getPower() < 2)) then target:addStatusEffect(EFFECT_DIA,2+dotBonus,3,duration,FLAG_ERASABLE, 10); spell:setMsg(2); else spell:setMsg(75); end -- Try to kill same tier Bio if (BIO_OVERWRITE == 1 and bio ~= nil) then if (bio:getPower() <= 2) then target:delStatusEffect(EFFECT_BIO); end end return final; end;
gpl-3.0
effil/effil
tests/lua/gc.lua
2
2263
require "bootstrap-tests" local gc = effil.gc test.gc.tear_down = default_tear_down test.gc.cleanup = function () collectgarbage() gc.collect() test.equal(gc.count(), 1) for i = 0, 10000 do local tmp = effil.table() end collectgarbage() gc.collect() test.equal(gc.count(), 1) end test.gc.disable = function () local nobjects = 10000 collectgarbage() gc.collect() test.equal(gc.count(), 1) gc.pause() test.is_false(gc.enabled()) for i = 1, nobjects do local tmp = effil.table() end test.equal(gc.count(), nobjects + 1) collectgarbage() gc.collect() test.equal(gc.count(), 1) gc.resume() end test.gc.store_same_value = function() local fill = function (c) local a = effil.table {} c:push(a) c:push(a) end local c = effil.channel() fill(c) c:pop() collectgarbage() effil.gc.collect() c:pop()[1] = 0 end local function create_fabric() local f = { data = {} } function f:create(num) for i = 1, num do table.insert(self.data, effil.table()) end end function f:remove(num) for i = 1, num do table.remove(self.data, 1) end end return f end test.gc.check_iterative = function() test.equal(gc.count(), 1) local fabric = create_fabric() test.equal(2, effil.gc.step()) fabric:create(199) test.equal(gc.count(), 200) fabric:remove(50) collectgarbage() test.equal(gc.count(), 200) fabric:create(1) -- trigger GC test.equal(gc.count(), 151) fabric:remove(150) fabric:create(149) test.equal(gc.count(), 300) collectgarbage() fabric:create(1) -- trigger GC test.equal(gc.count(), 151) end test.gc.check_step = function() local fabric = create_fabric() effil.gc.step(3) fabric:create(299) fabric:remove(100) test.equal(gc.count(), 300) collectgarbage() fabric:create(1) -- trigger GC test.equal(gc.count(), 201) test.equal(3, effil.gc.step(2.5)) fabric:create(299) fabric:remove(250) test.equal(gc.count(), 500) collectgarbage() fabric:create(1) -- trigger GC test.equal(gc.count(), 251) end
mit