instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_166>.
The molecule contains the following groups: Amine, Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_166>.
**Token:** <BB_166> **SMILES:** Cl.Cl.NCCNc1ncnc2ccc([N+](=O)[O-])cc12 **Molecular Formula:** C10H13Cl2N5O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_167>.
CC(=O)O.CCC(C)C(N)C(N)=O
What is the building block token for the following molecule?
CC(=O)O.CCC(C)C(N)C(N)=O
<BB_167>
What is the molecular formula for <BB_167>?
The molecular formula for <BB_167> (CC(=O)O.CCC(C)C(N)C(N)=O) is C8H18N2O3.
Describe the ring structures in building block <BB_167>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_167>.
The molecule contains the following groups: Carboxylic Acid, Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_167>.
**Token:** <BB_167> **SMILES:** CC(=O)O.CCC(C)C(N)C(N)=O **Molecular Formula:** C8H18N2O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amine, Amide
Provide the SMILES representation for the building block token <BB_168>.
Nc1cc(C2CCCCCC2)no1
What is the building block token for the following molecule?
Nc1cc(C2CCCCCC2)no1
<BB_168>
What is the molecular formula for <BB_168>?
The molecular formula for <BB_168> (Nc1cc(C2CCCCCC2)no1) is C10H16N2O.
Describe the ring structures in building block <BB_168>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 7.
List the primary functional groups present in <BB_168>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_168>.
**Token:** <BB_168> **SMILES:** Nc1cc(C2CCCCCC2)no1 **Molecular Formula:** C10H16N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 7. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_169>.
Br.CN1CCCCC1CBr
What is the building block token for the following molecule?
Br.CN1CCCCC1CBr
<BB_169>
What is the molecular formula for <BB_169>?
The molecular formula for <BB_169> (Br.CN1CCCCC1CBr) is C7H15Br2N.
Describe the ring structures in building block <BB_169>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_169>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_169>.
**Token:** <BB_169> **SMILES:** Br.CN1CCCCC1CBr **Molecular Formula:** C7H15Br2N **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_170>.
CC(c1ccc(Cl)cc1Cl)S(N)(=O)=O
What is the building block token for the following molecule?
CC(c1ccc(Cl)cc1Cl)S(N)(=O)=O
<BB_170>
What is the molecular formula for <BB_170>?
The molecular formula for <BB_170> (CC(c1ccc(Cl)cc1Cl)S(N)(=O)=O) is C8H9Cl2NO2S.
Describe the ring structures in building block <BB_170>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_170>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_170>.
**Token:** <BB_170> **SMILES:** CC(c1ccc(Cl)cc1Cl)S(N)(=O)=O **Molecular Formula:** C8H9Cl2NO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_171>.
Nc1cc(Cl)c([N+](=O)[O-])cc1N
What is the building block token for the following molecule?
Nc1cc(Cl)c([N+](=O)[O-])cc1N
<BB_171>
What is the molecular formula for <BB_171>?
The molecular formula for <BB_171> (Nc1cc(Cl)c([N+](=O)[O-])cc1N) is C6H6ClN3O2.
Describe the ring structures in building block <BB_171>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_171>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_171>.
**Token:** <BB_171> **SMILES:** Nc1cc(Cl)c([N+](=O)[O-])cc1N **Molecular Formula:** C6H6ClN3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_172>.
NS(=O)(=O)Cc1ccc(C(F)(F)F)nc1
What is the building block token for the following molecule?
NS(=O)(=O)Cc1ccc(C(F)(F)F)nc1
<BB_172>
What is the molecular formula for <BB_172>?
The molecular formula for <BB_172> (NS(=O)(=O)Cc1ccc(C(F)(F)F)nc1) is C7H7F3N2O2S.
Describe the ring structures in building block <BB_172>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_172>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_172>.
**Token:** <BB_172> **SMILES:** NS(=O)(=O)Cc1ccc(C(F)(F)F)nc1 **Molecular Formula:** C7H7F3N2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_173>.
O=C(O)c1n[nH]c2cc([N+](=O)[O-])ccc12
What is the building block token for the following molecule?
O=C(O)c1n[nH]c2cc([N+](=O)[O-])ccc12
<BB_173>
What is the molecular formula for <BB_173>?
The molecular formula for <BB_173> (O=C(O)c1n[nH]c2cc([N+](=O)[O-])ccc12) is C8H5N3O4.
Describe the ring structures in building block <BB_173>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_173>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Nitro.
Provide a comprehensive chemical profile for the building block <BB_173>.
**Token:** <BB_173> **SMILES:** O=C(O)c1n[nH]c2cc([N+](=O)[O-])ccc12 **Molecular Formula:** C8H5N3O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Nitro
Provide the SMILES representation for the building block token <BB_174>.
COc1cc(OC)c2ncc(C(=O)O)c(O)c2c1
What is the building block token for the following molecule?
COc1cc(OC)c2ncc(C(=O)O)c(O)c2c1
<BB_174>
What is the molecular formula for <BB_174>?
The molecular formula for <BB_174> (COc1cc(OC)c2ncc(C(=O)O)c(O)c2c1) is C12H11NO5.
Describe the ring structures in building block <BB_174>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_174>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_174>.
**Token:** <BB_174> **SMILES:** COc1cc(OC)c2ncc(C(=O)O)c(O)c2c1 **Molecular Formula:** C12H11NO5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_175>.
Cl.Cn1cc(-c2ccccc2)cc1CCN
What is the building block token for the following molecule?
Cl.Cn1cc(-c2ccccc2)cc1CCN
<BB_175>
What is the molecular formula for <BB_175>?
The molecular formula for <BB_175> (Cl.Cn1cc(-c2ccccc2)cc1CCN) is C13H17ClN2.
Describe the ring structures in building block <BB_175>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_175>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_175>.
**Token:** <BB_175> **SMILES:** Cl.Cn1cc(-c2ccccc2)cc1CCN **Molecular Formula:** C13H17ClN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_176>.
Cc1csc(C(=O)O)c1-n1cccc1
What is the building block token for the following molecule?
Cc1csc(C(=O)O)c1-n1cccc1
<BB_176>
What is the molecular formula for <BB_176>?
The molecular formula for <BB_176> (Cc1csc(C(=O)O)c1-n1cccc1) is C10H9NO2S.
Describe the ring structures in building block <BB_176>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_176>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_176>.
**Token:** <BB_176> **SMILES:** Cc1csc(C(=O)O)c1-n1cccc1 **Molecular Formula:** C10H9NO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_177>.
Cl.Cl.NC(=O)c1nnc2n1CCNC2
What is the building block token for the following molecule?
Cl.Cl.NC(=O)c1nnc2n1CCNC2
<BB_177>
What is the molecular formula for <BB_177>?
The molecular formula for <BB_177> (Cl.Cl.NC(=O)c1nnc2n1CCNC2) is C6H11Cl2N5O.
Describe the ring structures in building block <BB_177>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_177>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_177>.
**Token:** <BB_177> **SMILES:** Cl.Cl.NC(=O)c1nnc2n1CCNC2 **Molecular Formula:** C6H11Cl2N5O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_178>.
CN(C)CCN(C)N=O
What is the building block token for the following molecule?
CN(C)CCN(C)N=O
<BB_178>
What is the molecular formula for <BB_178>?
The molecular formula for <BB_178> (CN(C)CCN(C)N=O) is C5H13N3O.
Describe the ring structures in building block <BB_178>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_178>.
The molecule contains the following groups: Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_178>.
**Token:** <BB_178> **SMILES:** CN(C)CCN(C)N=O **Molecular Formula:** C5H13N3O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Tertiary Amine
Provide the SMILES representation for the building block token <BB_179>.
Cc1cc(F)c(C(=O)O)nc1Cl
What is the building block token for the following molecule?
Cc1cc(F)c(C(=O)O)nc1Cl
<BB_179>
What is the molecular formula for <BB_179>?
The molecular formula for <BB_179> (Cc1cc(F)c(C(=O)O)nc1Cl) is C7H5ClFNO2.
Describe the ring structures in building block <BB_179>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_179>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_179>.
**Token:** <BB_179> **SMILES:** Cc1cc(F)c(C(=O)O)nc1Cl **Molecular Formula:** C7H5ClFNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_180>.
NNC(=O)c1ccc(Cn2cc([N+](=O)[O-])cn2)o1
What is the building block token for the following molecule?
NNC(=O)c1ccc(Cn2cc([N+](=O)[O-])cn2)o1
<BB_180>
What is the molecular formula for <BB_180>?
The molecular formula for <BB_180> (NNC(=O)c1ccc(Cn2cc([N+](=O)[O-])cn2)o1) is C9H9N5O4.
Describe the ring structures in building block <BB_180>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_180>.
The molecule contains the following groups: Amine, Tertiary Amine, Amide, Nitro.
Provide a comprehensive chemical profile for the building block <BB_180>.
**Token:** <BB_180> **SMILES:** NNC(=O)c1ccc(Cn2cc([N+](=O)[O-])cn2)o1 **Molecular Formula:** C9H9N5O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine, Amide, Nitro
Provide the SMILES representation for the building block token <BB_181>.
CNC(=O)CN(C)C1CCCCCC1
What is the building block token for the following molecule?
CNC(=O)CN(C)C1CCCCCC1
<BB_181>
What is the molecular formula for <BB_181>?
The molecular formula for <BB_181> (CNC(=O)CN(C)C1CCCCCC1) is C11H22N2O.
Describe the ring structures in building block <BB_181>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.
List the primary functional groups present in <BB_181>.
The molecule contains the following groups: Tertiary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_181>.
**Token:** <BB_181> **SMILES:** CNC(=O)CN(C)C1CCCCCC1 **Molecular Formula:** C11H22N2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Tertiary Amine, Amide
Provide the SMILES representation for the building block token <BB_182>.
COC(=O)[C@@H]1CNC[C@H]1c1ccccc1
What is the building block token for the following molecule?
COC(=O)[C@@H]1CNC[C@H]1c1ccccc1
<BB_182>
What is the molecular formula for <BB_182>?
The molecular formula for <BB_182> (COC(=O)[C@@H]1CNC[C@H]1c1ccccc1) is C12H15NO2.
Describe the ring structures in building block <BB_182>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_182>.
The molecule contains the following groups: Secondary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_182>.
**Token:** <BB_182> **SMILES:** COC(=O)[C@@H]1CNC[C@H]1c1ccccc1 **Molecular Formula:** C12H15NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_183>.
CC(C)C(=O)c1ccc(C(F)(F)F)cc1
What is the building block token for the following molecule?
CC(C)C(=O)c1ccc(C(F)(F)F)cc1
<BB_183>