instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_133>?
The molecular formula for <BB_133> (O=C(O)COc1ccc(CO)cc1) is C9H10O4.
Describe the ring structures in building block <BB_133>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_133>.
The molecule contains the following groups: Carboxylic Acid, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_133>.
**Token:** <BB_133> **SMILES:** O=C(O)COc1ccc(CO)cc1 **Molecular Formula:** C9H10O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_134>.
C=CCn1c(S)nnc1COc1ccccc1
What is the building block token for the following molecule?
C=CCn1c(S)nnc1COc1ccccc1
<BB_134>
What is the molecular formula for <BB_134>?
The molecular formula for <BB_134> (C=CCn1c(S)nnc1COc1ccccc1) is C12H13N3OS.
Describe the ring structures in building block <BB_134>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_134>.
The molecule contains the following groups: Ether, Thiol.
Provide a comprehensive chemical profile for the building block <BB_134>.
**Token:** <BB_134> **SMILES:** C=CCn1c(S)nnc1COc1ccccc1 **Molecular Formula:** C12H13N3OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ether, Thiol
Provide the SMILES representation for the building block token <BB_135>.
O=Cc1cc(F)ccc1Cl
What is the building block token for the following molecule?
O=Cc1cc(F)ccc1Cl
<BB_135>
What is the molecular formula for <BB_135>?
The molecular formula for <BB_135> (O=Cc1cc(F)ccc1Cl) is C7H4ClFO.
Describe the ring structures in building block <BB_135>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_135>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_135>.
**Token:** <BB_135> **SMILES:** O=Cc1cc(F)ccc1Cl **Molecular Formula:** C7H4ClFO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_136>.
CCCC1(C(=O)O)CCCCN1C(=O)OC(C)(C)C
What is the building block token for the following molecule?
CCCC1(C(=O)O)CCCCN1C(=O)OC(C)(C)C
<BB_136>
What is the molecular formula for <BB_136>?
The molecular formula for <BB_136> (CCCC1(C(=O)O)CCCCN1C(=O)OC(C)(C)C) is C14H25NO4.
Describe the ring structures in building block <BB_136>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_136>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_136>.
**Token:** <BB_136> **SMILES:** CCCC1(C(=O)O)CCCCN1C(=O)OC(C)(C)C **Molecular Formula:** C14H25NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_137>.
COC(=O)[C@@H]1C=C[C@H](NC(=O)OC(C)(C)C)C1
What is the building block token for the following molecule?
COC(=O)[C@@H]1C=C[C@H](NC(=O)OC(C)(C)C)C1
<BB_137>
What is the molecular formula for <BB_137>?
The molecular formula for <BB_137> (COC(=O)[C@@H]1C=C[C@H](NC(=O)OC(C)(C)C)C1) is C12H19NO4.
Describe the ring structures in building block <BB_137>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_137>.
The molecule contains the following groups: Amide, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_137>.
**Token:** <BB_137> **SMILES:** COC(=O)[C@@H]1C=C[C@H](NC(=O)OC(C)(C)C)C1 **Molecular Formula:** C12H19NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Ester, Ether
Provide the SMILES representation for the building block token <BB_138>.
O=C1CCC(CO)CN1
What is the building block token for the following molecule?
O=C1CCC(CO)CN1
<BB_138>
What is the molecular formula for <BB_138>?
The molecular formula for <BB_138> (O=C1CCC(CO)CN1) is C6H11NO2.
Describe the ring structures in building block <BB_138>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_138>.
The molecule contains the following groups: Amide, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_138>.
**Token:** <BB_138> **SMILES:** O=C1CCC(CO)CN1 **Molecular Formula:** C6H11NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Alcohol
Provide the SMILES representation for the building block token <BB_139>.
O=S(=O)(Cl)Cc1cccc(Br)c1
What is the building block token for the following molecule?
O=S(=O)(Cl)Cc1cccc(Br)c1
<BB_139>
What is the molecular formula for <BB_139>?
The molecular formula for <BB_139> (O=S(=O)(Cl)Cc1cccc(Br)c1) is C7H6BrClO2S.
Describe the ring structures in building block <BB_139>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_139>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_139>.
**Token:** <BB_139> **SMILES:** O=S(=O)(Cl)Cc1cccc(Br)c1 **Molecular Formula:** C7H6BrClO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_140>.
O=C(O)COc1ccc(S(=O)(=O)F)cc1
What is the building block token for the following molecule?
O=C(O)COc1ccc(S(=O)(=O)F)cc1
<BB_140>
What is the molecular formula for <BB_140>?
The molecular formula for <BB_140> (O=C(O)COc1ccc(S(=O)(=O)F)cc1) is C8H7FO5S.
Describe the ring structures in building block <BB_140>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_140>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_140>.
**Token:** <BB_140> **SMILES:** O=C(O)COc1ccc(S(=O)(=O)F)cc1 **Molecular Formula:** C8H7FO5S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_141>.
Cc1nnc([C@]23CCC[C@H]2CNC3)o1
What is the building block token for the following molecule?
Cc1nnc([C@]23CCC[C@H]2CNC3)o1
<BB_141>
What is the molecular formula for <BB_141>?
The molecular formula for <BB_141> (Cc1nnc([C@]23CCC[C@H]2CNC3)o1) is C10H15N3O.
Describe the ring structures in building block <BB_141>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_141>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_141>.
**Token:** <BB_141> **SMILES:** Cc1nnc([C@]23CCC[C@H]2CNC3)o1 **Molecular Formula:** C10H15N3O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_142>.
CC(C)(C)OC(=O)N1CC2CNC(C2)C1.Cl
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC2CNC(C2)C1.Cl
<BB_142>
What is the molecular formula for <BB_142>?
The molecular formula for <BB_142> (CC(C)(C)OC(=O)N1CC2CNC(C2)C1.Cl) is C11H21ClN2O2.
Describe the ring structures in building block <BB_142>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_142>.
The molecule contains the following groups: Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_142>.
**Token:** <BB_142> **SMILES:** CC(C)(C)OC(=O)N1CC2CNC(C2)C1.Cl **Molecular Formula:** C11H21ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_143>.
Cl.NCCCC1N=N1
What is the building block token for the following molecule?
Cl.NCCCC1N=N1
<BB_143>
What is the molecular formula for <BB_143>?
The molecular formula for <BB_143> (Cl.NCCCC1N=N1) is C4H10ClN3.
Describe the ring structures in building block <BB_143>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_143>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_143>.
**Token:** <BB_143> **SMILES:** Cl.NCCCC1N=N1 **Molecular Formula:** C4H10ClN3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_144>.
COC(=O)c1c(N)sc2c1CCCC2
What is the building block token for the following molecule?
COC(=O)c1c(N)sc2c1CCCC2
<BB_144>
What is the molecular formula for <BB_144>?
The molecular formula for <BB_144> (COC(=O)c1c(N)sc2c1CCCC2) is C10H13NO2S.
Describe the ring structures in building block <BB_144>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_144>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_144>.
**Token:** <BB_144> **SMILES:** COC(=O)c1c(N)sc2c1CCCC2 **Molecular Formula:** C10H13NO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_145>.
CCCCCc1cc(O)cc(=O)o1
What is the building block token for the following molecule?
CCCCCc1cc(O)cc(=O)o1
<BB_145>
What is the molecular formula for <BB_145>?
The molecular formula for <BB_145> (CCCCCc1cc(O)cc(=O)o1) is C10H14O3.
Describe the ring structures in building block <BB_145>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_145>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_145>.
**Token:** <BB_145> **SMILES:** CCCCCc1cc(O)cc(=O)o1 **Molecular Formula:** C10H14O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_146>.
CC(C)(C)OC(=O)N1CCCC(C2CC2C(=O)O)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCCC(C2CC2C(=O)O)C1
<BB_146>
What is the molecular formula for <BB_146>?
The molecular formula for <BB_146> (CC(C)(C)OC(=O)N1CCCC(C2CC2C(=O)O)C1) is C14H23NO4.
Describe the ring structures in building block <BB_146>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_146>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_146>.
**Token:** <BB_146> **SMILES:** CC(C)(C)OC(=O)N1CCCC(C2CC2C(=O)O)C1 **Molecular Formula:** C14H23NO4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_147>.
COC(=O)CC1(N)CCCC1.Cl
What is the building block token for the following molecule?
COC(=O)CC1(N)CCCC1.Cl
<BB_147>
What is the molecular formula for <BB_147>?
The molecular formula for <BB_147> (COC(=O)CC1(N)CCCC1.Cl) is C8H16ClNO2.
Describe the ring structures in building block <BB_147>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_147>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_147>.
**Token:** <BB_147> **SMILES:** COC(=O)CC1(N)CCCC1.Cl **Molecular Formula:** C8H16ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_148>.
O=C(O)CSc1ccc2ccccc2c1
What is the building block token for the following molecule?
O=C(O)CSc1ccc2ccccc2c1
<BB_148>
What is the molecular formula for <BB_148>?
The molecular formula for <BB_148> (O=C(O)CSc1ccc2ccccc2c1) is C12H10O2S.
Describe the ring structures in building block <BB_148>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_148>.
The molecule contains the following groups: Carboxylic Acid, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_148>.
**Token:** <BB_148> **SMILES:** O=C(O)CSc1ccc2ccccc2c1 **Molecular Formula:** C12H10O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Sulfide
Provide the SMILES representation for the building block token <BB_149>.
NC(N)=NS(=O)(=O)c1ccc(N)cc1
What is the building block token for the following molecule?
NC(N)=NS(=O)(=O)c1ccc(N)cc1
<BB_149>
What is the molecular formula for <BB_149>?
The molecular formula for <BB_149> (NC(N)=NS(=O)(=O)c1ccc(N)cc1) is C7H10N4O2S.
Describe the ring structures in building block <BB_149>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_149>.
The molecule contains the following groups: Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_149>.
**Token:** <BB_149> **SMILES:** NC(N)=NS(=O)(=O)c1ccc(N)cc1 **Molecular Formula:** C7H10N4O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Sulfonamide