instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_150>.
O=C(O)c1cnc(-c2nnc[nH]2)s1
What is the building block token for the following molecule?
O=C(O)c1cnc(-c2nnc[nH]2)s1
<BB_150>
What is the molecular formula for <BB_150>?
The molecular formula for <BB_150> (O=C(O)c1cnc(-c2nnc[nH]2)s1) is C6H4N4O2S.
Describe the ring structures in building block <BB_150>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_150>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_150>.
**Token:** <BB_150> **SMILES:** O=C(O)c1cnc(-c2nnc[nH]2)s1 **Molecular Formula:** C6H4N4O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_151>.
Nc1nc2[nH]c(-c3ccc(Br)cc3)nc2c(=O)[nH]1
What is the building block token for the following molecule?
Nc1nc2[nH]c(-c3ccc(Br)cc3)nc2c(=O)[nH]1
<BB_151>
What is the molecular formula for <BB_151>?
The molecular formula for <BB_151> (Nc1nc2[nH]c(-c3ccc(Br)cc3)nc2c(=O)[nH]1) is C11H8BrN5O.
Describe the ring structures in building block <BB_151>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_151>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_151>.
**Token:** <BB_151> **SMILES:** Nc1nc2[nH]c(-c3ccc(Br)cc3)nc2c(=O)[nH]1 **Molecular Formula:** C11H8BrN5O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_152>.
O=Cc1nccn1C1CC1
What is the building block token for the following molecule?
O=Cc1nccn1C1CC1
<BB_152>
What is the molecular formula for <BB_152>?
The molecular formula for <BB_152> (O=Cc1nccn1C1CC1) is C7H8N2O.
Describe the ring structures in building block <BB_152>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_152>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_152>.
**Token:** <BB_152> **SMILES:** O=Cc1nccn1C1CC1 **Molecular Formula:** C7H8N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_153>.
Cl.NC(=O)C[C@H](N)c1ccccc1Cl
What is the building block token for the following molecule?
Cl.NC(=O)C[C@H](N)c1ccccc1Cl
<BB_153>
What is the molecular formula for <BB_153>?
The molecular formula for <BB_153> (Cl.NC(=O)C[C@H](N)c1ccccc1Cl) is C9H12Cl2N2O.
Describe the ring structures in building block <BB_153>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_153>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_153>.
**Token:** <BB_153> **SMILES:** Cl.NC(=O)C[C@H](N)c1ccccc1Cl **Molecular Formula:** C9H12Cl2N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_154>.
NS(=O)(=O)c1cc(C(F)(F)F)cnn1
What is the building block token for the following molecule?
NS(=O)(=O)c1cc(C(F)(F)F)cnn1
<BB_154>
What is the molecular formula for <BB_154>?
The molecular formula for <BB_154> (NS(=O)(=O)c1cc(C(F)(F)F)cnn1) is C5H4F3N3O2S.
Describe the ring structures in building block <BB_154>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_154>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_154>.
**Token:** <BB_154> **SMILES:** NS(=O)(=O)c1cc(C(F)(F)F)cnn1 **Molecular Formula:** C5H4F3N3O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_155>.
NCc1cccc(COc2ccccc2)c1
What is the building block token for the following molecule?
NCc1cccc(COc2ccccc2)c1
<BB_155>
What is the molecular formula for <BB_155>?
The molecular formula for <BB_155> (NCc1cccc(COc2ccccc2)c1) is C14H15NO.
Describe the ring structures in building block <BB_155>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_155>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_155>.
**Token:** <BB_155> **SMILES:** NCc1cccc(COc2ccccc2)c1 **Molecular Formula:** C14H15NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_156>.
C#CCC(=O)O
What is the building block token for the following molecule?
C#CCC(=O)O
<BB_156>
What is the molecular formula for <BB_156>?
The molecular formula for <BB_156> (C#CCC(=O)O) is C4H4O2.
Describe the ring structures in building block <BB_156>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_156>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_156>.
**Token:** <BB_156> **SMILES:** C#CCC(=O)O **Molecular Formula:** C4H4O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_157>.
C#CCOc1c(Br)cc(Cl)cc1C=O
What is the building block token for the following molecule?
C#CCOc1c(Br)cc(Cl)cc1C=O
<BB_157>
What is the molecular formula for <BB_157>?
The molecular formula for <BB_157> (C#CCOc1c(Br)cc(Cl)cc1C=O) is C10H6BrClO2.
Describe the ring structures in building block <BB_157>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_157>.
The molecule contains the following groups: Aldehyde, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_157>.
**Token:** <BB_157> **SMILES:** C#CCOc1c(Br)cc(Cl)cc1C=O **Molecular Formula:** C10H6BrClO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_158>.
O=C(O)c1cc(Cl)nc(Cl)c1F
What is the building block token for the following molecule?
O=C(O)c1cc(Cl)nc(Cl)c1F
<BB_158>
What is the molecular formula for <BB_158>?
The molecular formula for <BB_158> (O=C(O)c1cc(Cl)nc(Cl)c1F) is C6H2Cl2FNO2.
Describe the ring structures in building block <BB_158>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_158>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_158>.
**Token:** <BB_158> **SMILES:** O=C(O)c1cc(Cl)nc(Cl)c1F **Molecular Formula:** C6H2Cl2FNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_159>.
CC(C)CCOCCC#N
What is the building block token for the following molecule?
CC(C)CCOCCC#N
<BB_159>
What is the molecular formula for <BB_159>?
The molecular formula for <BB_159> (CC(C)CCOCCC#N) is C8H15NO.
Describe the ring structures in building block <BB_159>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_159>.
The molecule contains the following groups: Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_159>.
**Token:** <BB_159> **SMILES:** CC(C)CCOCCC#N **Molecular Formula:** C8H15NO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ether, Nitrile
Provide the SMILES representation for the building block token <BB_160>.
[N-]=[N+]=Nc1cc(Br)ccc1O
What is the building block token for the following molecule?
[N-]=[N+]=Nc1cc(Br)ccc1O
<BB_160>
What is the molecular formula for <BB_160>?
The molecular formula for <BB_160> ([N-]=[N+]=Nc1cc(Br)ccc1O) is C6H4BrN3O.
Describe the ring structures in building block <BB_160>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_160>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_160>.
**Token:** <BB_160> **SMILES:** [N-]=[N+]=Nc1cc(Br)ccc1O **Molecular Formula:** C6H4BrN3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_161>.
CC(C)C(Br)C(=O)N1CCC(C(N)=O)CC1
What is the building block token for the following molecule?
CC(C)C(Br)C(=O)N1CCC(C(N)=O)CC1
<BB_161>
What is the molecular formula for <BB_161>?
The molecular formula for <BB_161> (CC(C)C(Br)C(=O)N1CCC(C(N)=O)CC1) is C11H19BrN2O2.
Describe the ring structures in building block <BB_161>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_161>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_161>.
**Token:** <BB_161> **SMILES:** CC(C)C(Br)C(=O)N1CCC(C(N)=O)CC1 **Molecular Formula:** C11H19BrN2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_162>.
Cl.N[C@H](CO)C(F)F
What is the building block token for the following molecule?
Cl.N[C@H](CO)C(F)F
<BB_162>
What is the molecular formula for <BB_162>?
The molecular formula for <BB_162> (Cl.N[C@H](CO)C(F)F) is C3H8ClF2NO.
Describe the ring structures in building block <BB_162>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_162>.
The molecule contains the following groups: Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_162>.
**Token:** <BB_162> **SMILES:** Cl.N[C@H](CO)C(F)F **Molecular Formula:** C3H8ClF2NO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_163>.
Cl.Nc1ccc(F)c(-c2ccccc2)c1
What is the building block token for the following molecule?
Cl.Nc1ccc(F)c(-c2ccccc2)c1
<BB_163>
What is the molecular formula for <BB_163>?
The molecular formula for <BB_163> (Cl.Nc1ccc(F)c(-c2ccccc2)c1) is C12H11ClFN.
Describe the ring structures in building block <BB_163>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_163>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_163>.
**Token:** <BB_163> **SMILES:** Cl.Nc1ccc(F)c(-c2ccccc2)c1 **Molecular Formula:** C12H11ClFN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_164>.
CC(Oc1nc(N)ncc1Br)C1CC1
What is the building block token for the following molecule?
CC(Oc1nc(N)ncc1Br)C1CC1
<BB_164>
What is the molecular formula for <BB_164>?
The molecular formula for <BB_164> (CC(Oc1nc(N)ncc1Br)C1CC1) is C9H12BrN3O.
Describe the ring structures in building block <BB_164>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_164>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_164>.
**Token:** <BB_164> **SMILES:** CC(Oc1nc(N)ncc1Br)C1CC1 **Molecular Formula:** C9H12BrN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_165>.
OB(O)c1cccc(-n2cccn2)c1
What is the building block token for the following molecule?
OB(O)c1cccc(-n2cccn2)c1
<BB_165>
What is the molecular formula for <BB_165>?
The molecular formula for <BB_165> (OB(O)c1cccc(-n2cccn2)c1) is C9H9BN2O2.
Describe the ring structures in building block <BB_165>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_165>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_165>.
**Token:** <BB_165> **SMILES:** OB(O)c1cccc(-n2cccn2)c1 **Molecular Formula:** C9H9BN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_166>.
Cl.Cl.NCCNc1ncnc2ccc([N+](=O)[O-])cc12
What is the building block token for the following molecule?
Cl.Cl.NCCNc1ncnc2ccc([N+](=O)[O-])cc12
<BB_166>
What is the molecular formula for <BB_166>?
The molecular formula for <BB_166> (Cl.Cl.NCCNc1ncnc2ccc([N+](=O)[O-])cc12) is C10H13Cl2N5O2.
Describe the ring structures in building block <BB_166>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.