instruction
stringlengths 41
142
| input
stringlengths 0
478
| output
stringlengths 4
382
|
|---|---|---|
Provide the SMILES representation for the building block token <BB_200>.
|
CCCC[Sn](Cl)(CCCC)CCCC
|
|
What is the building block token for the following molecule?
|
CCCC[Sn](Cl)(CCCC)CCCC
|
<BB_200>
|
What is the molecular formula for <BB_200>?
|
The molecular formula for <BB_200> (CCCC[Sn](Cl)(CCCC)CCCC) is C12H27ClSn.
|
|
Describe the ring structures in building block <BB_200>.
|
The molecule is acyclic (contains no rings).
|
|
List the primary functional groups present in <BB_200>.
|
The molecule contains the following groups: Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_200>.
|
**Token:** <BB_200>
**SMILES:** CCCC[Sn](Cl)(CCCC)CCCC
**Molecular Formula:** C12H27ClSn
**Ring System:** The molecule is acyclic (contains no rings).
**Functional Groups:** Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_201>.
|
CNC(=O)c1ccc(N)c(Cl)c1
|
|
What is the building block token for the following molecule?
|
CNC(=O)c1ccc(N)c(Cl)c1
|
<BB_201>
|
What is the molecular formula for <BB_201>?
|
The molecular formula for <BB_201> (CNC(=O)c1ccc(N)c(Cl)c1) is C8H9ClN2O.
|
|
Describe the ring structures in building block <BB_201>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_201>.
|
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_201>.
|
**Token:** <BB_201>
**SMILES:** CNC(=O)c1ccc(N)c(Cl)c1
**Molecular Formula:** C8H9ClN2O
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_202>.
|
Cl.Cl.Fc1ccc(-n2cnc3c2CCNC3)cc1
|
|
What is the building block token for the following molecule?
|
Cl.Cl.Fc1ccc(-n2cnc3c2CCNC3)cc1
|
<BB_202>
|
What is the molecular formula for <BB_202>?
|
The molecular formula for <BB_202> (Cl.Cl.Fc1ccc(-n2cnc3c2CCNC3)cc1) is C12H14Cl2FN3.
|
|
Describe the ring structures in building block <BB_202>.
|
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 6.
|
|
List the primary functional groups present in <BB_202>.
|
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_202>.
|
**Token:** <BB_202>
**SMILES:** Cl.Cl.Fc1ccc(-n2cnc3c2CCNC3)cc1
**Molecular Formula:** C12H14Cl2FN3
**Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 6.
**Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_203>.
|
Cl.O=C1CCCC[C@]1(NCCO)c1ccccc1
|
|
What is the building block token for the following molecule?
|
Cl.O=C1CCCC[C@]1(NCCO)c1ccccc1
|
<BB_203>
|
What is the molecular formula for <BB_203>?
|
The molecular formula for <BB_203> (Cl.O=C1CCCC[C@]1(NCCO)c1ccccc1) is C14H20ClNO2.
|
|
Describe the ring structures in building block <BB_203>.
|
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_203>.
|
The molecule contains the following groups: Secondary Amine, Ketone, Alcohol, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_203>.
|
**Token:** <BB_203>
**SMILES:** Cl.O=C1CCCC[C@]1(NCCO)c1ccccc1
**Molecular Formula:** C14H20ClNO2
**Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
**Functional Groups:** Secondary Amine, Ketone, Alcohol, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_204>.
|
COc1cc(CN2CCNCC2)cc(OC)c1
|
|
What is the building block token for the following molecule?
|
COc1cc(CN2CCNCC2)cc(OC)c1
|
<BB_204>
|
What is the molecular formula for <BB_204>?
|
The molecular formula for <BB_204> (COc1cc(CN2CCNCC2)cc(OC)c1) is C13H20N2O2.
|
|
Describe the ring structures in building block <BB_204>.
|
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
|
|
List the primary functional groups present in <BB_204>.
|
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Ether.
|
|
Provide a comprehensive chemical profile for the building block <BB_204>.
|
**Token:** <BB_204>
**SMILES:** COc1cc(CN2CCNCC2)cc(OC)c1
**Molecular Formula:** C13H20N2O2
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
**Functional Groups:** Secondary Amine, Tertiary Amine, Ether
|
|
Provide the SMILES representation for the building block token <BB_205>.
|
OCc1ccc(C(F)F)cn1
|
|
What is the building block token for the following molecule?
|
OCc1ccc(C(F)F)cn1
|
<BB_205>
|
What is the molecular formula for <BB_205>?
|
The molecular formula for <BB_205> (OCc1ccc(C(F)F)cn1) is C7H7F2NO.
|
|
Describe the ring structures in building block <BB_205>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_205>.
|
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_205>.
|
**Token:** <BB_205>
**SMILES:** OCc1ccc(C(F)F)cn1
**Molecular Formula:** C7H7F2NO
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_206>.
|
NCc1cccc(CN2CCOCC2)c1
|
|
What is the building block token for the following molecule?
|
NCc1cccc(CN2CCOCC2)c1
|
<BB_206>
|
What is the molecular formula for <BB_206>?
|
The molecular formula for <BB_206> (NCc1cccc(CN2CCOCC2)c1) is C12H18N2O.
|
|
Describe the ring structures in building block <BB_206>.
|
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
|
|
List the primary functional groups present in <BB_206>.
|
The molecule contains the following groups: Amine, Tertiary Amine, Ether.
|
|
Provide a comprehensive chemical profile for the building block <BB_206>.
|
**Token:** <BB_206>
**SMILES:** NCc1cccc(CN2CCOCC2)c1
**Molecular Formula:** C12H18N2O
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
**Functional Groups:** Amine, Tertiary Amine, Ether
|
|
Provide the SMILES representation for the building block token <BB_207>.
|
O=CC12CC3CC(CC(C3)C1)C2
|
|
What is the building block token for the following molecule?
|
O=CC12CC3CC(CC(C3)C1)C2
|
<BB_207>
|
What is the molecular formula for <BB_207>?
|
The molecular formula for <BB_207> (O=CC12CC3CC(CC(C3)C1)C2) is C11H16O.
|
|
Describe the ring structures in building block <BB_207>.
|
The molecule contains 4 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.
|
|
List the primary functional groups present in <BB_207>.
|
The molecule contains the following groups: Aldehyde.
|
|
Provide a comprehensive chemical profile for the building block <BB_207>.
|
**Token:** <BB_207>
**SMILES:** O=CC12CC3CC(CC(C3)C1)C2
**Molecular Formula:** C11H16O
**Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.
**Functional Groups:** Aldehyde
|
|
Provide the SMILES representation for the building block token <BB_208>.
|
O=CC1CCCCO1
|
|
What is the building block token for the following molecule?
|
O=CC1CCCCO1
|
<BB_208>
|
What is the molecular formula for <BB_208>?
|
The molecular formula for <BB_208> (O=CC1CCCCO1) is C6H10O2.
|
|
Describe the ring structures in building block <BB_208>.
|
The molecule contains 1 ring(s): an aliphatic ring of size 6.
|
|
List the primary functional groups present in <BB_208>.
|
The molecule contains the following groups: Aldehyde, Ether.
|
|
Provide a comprehensive chemical profile for the building block <BB_208>.
|
**Token:** <BB_208>
**SMILES:** O=CC1CCCCO1
**Molecular Formula:** C6H10O2
**Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6.
**Functional Groups:** Aldehyde, Ether
|
|
Provide the SMILES representation for the building block token <BB_209>.
|
CC(C)Oc1ccc(CNC(=O)CCl)cc1
|
|
What is the building block token for the following molecule?
|
CC(C)Oc1ccc(CNC(=O)CCl)cc1
|
<BB_209>
|
What is the molecular formula for <BB_209>?
|
The molecular formula for <BB_209> (CC(C)Oc1ccc(CNC(=O)CCl)cc1) is C12H16ClNO2.
|
|
Describe the ring structures in building block <BB_209>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_209>.
|
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_209>.
|
**Token:** <BB_209>
**SMILES:** CC(C)Oc1ccc(CNC(=O)CCl)cc1
**Molecular Formula:** C12H16ClNO2
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_210>.
|
CNCc1nc(C(F)(F)F)cs1
|
|
What is the building block token for the following molecule?
|
CNCc1nc(C(F)(F)F)cs1
|
<BB_210>
|
What is the molecular formula for <BB_210>?
|
The molecular formula for <BB_210> (CNCc1nc(C(F)(F)F)cs1) is C6H7F3N2S.
|
|
Describe the ring structures in building block <BB_210>.
|
The molecule contains 1 ring(s): an aromatic ring of size 5.
|
|
List the primary functional groups present in <BB_210>.
|
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_210>.
|
**Token:** <BB_210>
**SMILES:** CNCc1nc(C(F)(F)F)cs1
**Molecular Formula:** C6H7F3N2S
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5.
**Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_211>.
|
Oc1cccc(Cl)c1O
|
|
What is the building block token for the following molecule?
|
Oc1cccc(Cl)c1O
|
<BB_211>
|
What is the molecular formula for <BB_211>?
|
The molecular formula for <BB_211> (Oc1cccc(Cl)c1O) is C6H5ClO2.
|
|
Describe the ring structures in building block <BB_211>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_211>.
|
The molecule contains the following groups: Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_211>.
|
**Token:** <BB_211>
**SMILES:** Oc1cccc(Cl)c1O
**Molecular Formula:** C6H5ClO2
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_212>.
|
Fc1c(I)cccc1OC1CC1
|
|
What is the building block token for the following molecule?
|
Fc1c(I)cccc1OC1CC1
|
<BB_212>
|
What is the molecular formula for <BB_212>?
|
The molecular formula for <BB_212> (Fc1c(I)cccc1OC1CC1) is C9H8FIO.
|
|
Describe the ring structures in building block <BB_212>.
|
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
|
|
List the primary functional groups present in <BB_212>.
|
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_212>.
|
**Token:** <BB_212>
**SMILES:** Fc1c(I)cccc1OC1CC1
**Molecular Formula:** C9H8FIO
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
**Functional Groups:** Ether, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_213>.
|
CSc1cnn(C)c1C(=O)O
|
|
What is the building block token for the following molecule?
|
CSc1cnn(C)c1C(=O)O
|
<BB_213>
|
What is the molecular formula for <BB_213>?
|
The molecular formula for <BB_213> (CSc1cnn(C)c1C(=O)O) is C6H8N2O2S.
|
|
Describe the ring structures in building block <BB_213>.
|
The molecule contains 1 ring(s): an aromatic ring of size 5.
|
|
List the primary functional groups present in <BB_213>.
|
The molecule contains the following groups: Carboxylic Acid, Sulfide.
|
|
Provide a comprehensive chemical profile for the building block <BB_213>.
|
**Token:** <BB_213>
**SMILES:** CSc1cnn(C)c1C(=O)O
**Molecular Formula:** C6H8N2O2S
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5.
**Functional Groups:** Carboxylic Acid, Sulfide
|
|
Provide the SMILES representation for the building block token <BB_214>.
|
OCc1cscc1F
|
|
What is the building block token for the following molecule?
|
OCc1cscc1F
|
<BB_214>
|
What is the molecular formula for <BB_214>?
|
The molecular formula for <BB_214> (OCc1cscc1F) is C5H5FOS.
|
|
Describe the ring structures in building block <BB_214>.
|
The molecule contains 1 ring(s): an aromatic ring of size 5.
|
|
List the primary functional groups present in <BB_214>.
|
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_214>.
|
**Token:** <BB_214>
**SMILES:** OCc1cscc1F
**Molecular Formula:** C5H5FOS
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5.
**Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_215>.
|
Cc1cc(C(F)(F)F)nc2sc(C#N)c(N)c12
|
|
What is the building block token for the following molecule?
|
Cc1cc(C(F)(F)F)nc2sc(C#N)c(N)c12
|
<BB_215>
|
What is the molecular formula for <BB_215>?
|
The molecular formula for <BB_215> (Cc1cc(C(F)(F)F)nc2sc(C#N)c(N)c12) is C10H6F3N3S.
|
|
Describe the ring structures in building block <BB_215>.
|
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
|
|
List the primary functional groups present in <BB_215>.
|
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Nitrile.
|
|
Provide a comprehensive chemical profile for the building block <BB_215>.
|
**Token:** <BB_215>
**SMILES:** Cc1cc(C(F)(F)F)nc2sc(C#N)c(N)c12
**Molecular Formula:** C10H6F3N3S
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
**Functional Groups:** Amine, Halogen (F,Cl,Br,I), Nitrile
|
|
Provide the SMILES representation for the building block token <BB_216>.
|
Nc1nc2cc(Br)cc(Cl)c2o1
|
|
What is the building block token for the following molecule?
|
Nc1nc2cc(Br)cc(Cl)c2o1
|
<BB_216>
|
What is the molecular formula for <BB_216>?
|
The molecular formula for <BB_216> (Nc1nc2cc(Br)cc(Cl)c2o1) is C7H4BrClN2O.
|
|
Describe the ring structures in building block <BB_216>.
|
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
|
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.