instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_200>.
CCCC[Sn](Cl)(CCCC)CCCC
What is the building block token for the following molecule?
CCCC[Sn](Cl)(CCCC)CCCC
<BB_200>
What is the molecular formula for <BB_200>?
The molecular formula for <BB_200> (CCCC[Sn](Cl)(CCCC)CCCC) is C12H27ClSn.
Describe the ring structures in building block <BB_200>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_200>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_200>.
**Token:** <BB_200> **SMILES:** CCCC[Sn](Cl)(CCCC)CCCC **Molecular Formula:** C12H27ClSn **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_201>.
CNC(=O)c1ccc(N)c(Cl)c1
What is the building block token for the following molecule?
CNC(=O)c1ccc(N)c(Cl)c1
<BB_201>
What is the molecular formula for <BB_201>?
The molecular formula for <BB_201> (CNC(=O)c1ccc(N)c(Cl)c1) is C8H9ClN2O.
Describe the ring structures in building block <BB_201>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_201>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_201>.
**Token:** <BB_201> **SMILES:** CNC(=O)c1ccc(N)c(Cl)c1 **Molecular Formula:** C8H9ClN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_202>.
Cl.Cl.Fc1ccc(-n2cnc3c2CCNC3)cc1
What is the building block token for the following molecule?
Cl.Cl.Fc1ccc(-n2cnc3c2CCNC3)cc1
<BB_202>
What is the molecular formula for <BB_202>?
The molecular formula for <BB_202> (Cl.Cl.Fc1ccc(-n2cnc3c2CCNC3)cc1) is C12H14Cl2FN3.
Describe the ring structures in building block <BB_202>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_202>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_202>.
**Token:** <BB_202> **SMILES:** Cl.Cl.Fc1ccc(-n2cnc3c2CCNC3)cc1 **Molecular Formula:** C12H14Cl2FN3 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_203>.
Cl.O=C1CCCC[C@]1(NCCO)c1ccccc1
What is the building block token for the following molecule?
Cl.O=C1CCCC[C@]1(NCCO)c1ccccc1
<BB_203>
What is the molecular formula for <BB_203>?
The molecular formula for <BB_203> (Cl.O=C1CCCC[C@]1(NCCO)c1ccccc1) is C14H20ClNO2.
Describe the ring structures in building block <BB_203>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_203>.
The molecule contains the following groups: Secondary Amine, Ketone, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_203>.
**Token:** <BB_203> **SMILES:** Cl.O=C1CCCC[C@]1(NCCO)c1ccccc1 **Molecular Formula:** C14H20ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ketone, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_204>.
COc1cc(CN2CCNCC2)cc(OC)c1
What is the building block token for the following molecule?
COc1cc(CN2CCNCC2)cc(OC)c1
<BB_204>
What is the molecular formula for <BB_204>?
The molecular formula for <BB_204> (COc1cc(CN2CCNCC2)cc(OC)c1) is C13H20N2O2.
Describe the ring structures in building block <BB_204>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_204>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_204>.
**Token:** <BB_204> **SMILES:** COc1cc(CN2CCNCC2)cc(OC)c1 **Molecular Formula:** C13H20N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_205>.
OCc1ccc(C(F)F)cn1
What is the building block token for the following molecule?
OCc1ccc(C(F)F)cn1
<BB_205>
What is the molecular formula for <BB_205>?
The molecular formula for <BB_205> (OCc1ccc(C(F)F)cn1) is C7H7F2NO.
Describe the ring structures in building block <BB_205>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_205>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_205>.
**Token:** <BB_205> **SMILES:** OCc1ccc(C(F)F)cn1 **Molecular Formula:** C7H7F2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_206>.
NCc1cccc(CN2CCOCC2)c1
What is the building block token for the following molecule?
NCc1cccc(CN2CCOCC2)c1
<BB_206>
What is the molecular formula for <BB_206>?
The molecular formula for <BB_206> (NCc1cccc(CN2CCOCC2)c1) is C12H18N2O.
Describe the ring structures in building block <BB_206>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_206>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_206>.
**Token:** <BB_206> **SMILES:** NCc1cccc(CN2CCOCC2)c1 **Molecular Formula:** C12H18N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_207>.
O=CC12CC3CC(CC(C3)C1)C2
What is the building block token for the following molecule?
O=CC12CC3CC(CC(C3)C1)C2
<BB_207>
What is the molecular formula for <BB_207>?
The molecular formula for <BB_207> (O=CC12CC3CC(CC(C3)C1)C2) is C11H16O.
Describe the ring structures in building block <BB_207>.
The molecule contains 4 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_207>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_207>.
**Token:** <BB_207> **SMILES:** O=CC12CC3CC(CC(C3)C1)C2 **Molecular Formula:** C11H16O **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_208>.
O=CC1CCCCO1
What is the building block token for the following molecule?
O=CC1CCCCO1
<BB_208>
What is the molecular formula for <BB_208>?
The molecular formula for <BB_208> (O=CC1CCCCO1) is C6H10O2.
Describe the ring structures in building block <BB_208>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_208>.
The molecule contains the following groups: Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_208>.
**Token:** <BB_208> **SMILES:** O=CC1CCCCO1 **Molecular Formula:** C6H10O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_209>.
CC(C)Oc1ccc(CNC(=O)CCl)cc1
What is the building block token for the following molecule?
CC(C)Oc1ccc(CNC(=O)CCl)cc1
<BB_209>
What is the molecular formula for <BB_209>?
The molecular formula for <BB_209> (CC(C)Oc1ccc(CNC(=O)CCl)cc1) is C12H16ClNO2.
Describe the ring structures in building block <BB_209>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_209>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_209>.
**Token:** <BB_209> **SMILES:** CC(C)Oc1ccc(CNC(=O)CCl)cc1 **Molecular Formula:** C12H16ClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_210>.
CNCc1nc(C(F)(F)F)cs1
What is the building block token for the following molecule?
CNCc1nc(C(F)(F)F)cs1
<BB_210>
What is the molecular formula for <BB_210>?
The molecular formula for <BB_210> (CNCc1nc(C(F)(F)F)cs1) is C6H7F3N2S.
Describe the ring structures in building block <BB_210>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_210>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_210>.
**Token:** <BB_210> **SMILES:** CNCc1nc(C(F)(F)F)cs1 **Molecular Formula:** C6H7F3N2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_211>.
Oc1cccc(Cl)c1O
What is the building block token for the following molecule?
Oc1cccc(Cl)c1O
<BB_211>
What is the molecular formula for <BB_211>?
The molecular formula for <BB_211> (Oc1cccc(Cl)c1O) is C6H5ClO2.
Describe the ring structures in building block <BB_211>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_211>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_211>.
**Token:** <BB_211> **SMILES:** Oc1cccc(Cl)c1O **Molecular Formula:** C6H5ClO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_212>.
Fc1c(I)cccc1OC1CC1
What is the building block token for the following molecule?
Fc1c(I)cccc1OC1CC1
<BB_212>
What is the molecular formula for <BB_212>?
The molecular formula for <BB_212> (Fc1c(I)cccc1OC1CC1) is C9H8FIO.
Describe the ring structures in building block <BB_212>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_212>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_212>.
**Token:** <BB_212> **SMILES:** Fc1c(I)cccc1OC1CC1 **Molecular Formula:** C9H8FIO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_213>.
CSc1cnn(C)c1C(=O)O
What is the building block token for the following molecule?
CSc1cnn(C)c1C(=O)O
<BB_213>
What is the molecular formula for <BB_213>?
The molecular formula for <BB_213> (CSc1cnn(C)c1C(=O)O) is C6H8N2O2S.
Describe the ring structures in building block <BB_213>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_213>.
The molecule contains the following groups: Carboxylic Acid, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_213>.
**Token:** <BB_213> **SMILES:** CSc1cnn(C)c1C(=O)O **Molecular Formula:** C6H8N2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Sulfide
Provide the SMILES representation for the building block token <BB_214>.
OCc1cscc1F
What is the building block token for the following molecule?
OCc1cscc1F
<BB_214>
What is the molecular formula for <BB_214>?
The molecular formula for <BB_214> (OCc1cscc1F) is C5H5FOS.
Describe the ring structures in building block <BB_214>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_214>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_214>.
**Token:** <BB_214> **SMILES:** OCc1cscc1F **Molecular Formula:** C5H5FOS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_215>.
Cc1cc(C(F)(F)F)nc2sc(C#N)c(N)c12
What is the building block token for the following molecule?
Cc1cc(C(F)(F)F)nc2sc(C#N)c(N)c12
<BB_215>
What is the molecular formula for <BB_215>?
The molecular formula for <BB_215> (Cc1cc(C(F)(F)F)nc2sc(C#N)c(N)c12) is C10H6F3N3S.
Describe the ring structures in building block <BB_215>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_215>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_215>.
**Token:** <BB_215> **SMILES:** Cc1cc(C(F)(F)F)nc2sc(C#N)c(N)c12 **Molecular Formula:** C10H6F3N3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_216>.
Nc1nc2cc(Br)cc(Cl)c2o1
What is the building block token for the following molecule?
Nc1nc2cc(Br)cc(Cl)c2o1
<BB_216>
What is the molecular formula for <BB_216>?
The molecular formula for <BB_216> (Nc1nc2cc(Br)cc(Cl)c2o1) is C7H4BrClN2O.
Describe the ring structures in building block <BB_216>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.