instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_183>?
The molecular formula for <BB_183> (CC(C)C(=O)c1ccc(C(F)(F)F)cc1) is C11H11F3O.
Describe the ring structures in building block <BB_183>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_183>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_183>.
**Token:** <BB_183> **SMILES:** CC(C)C(=O)c1ccc(C(F)(F)F)cc1 **Molecular Formula:** C11H11F3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_184>.
CC1=CC(c2ccccc2)N2NC(N)=NC2=N1
What is the building block token for the following molecule?
CC1=CC(c2ccccc2)N2NC(N)=NC2=N1
<BB_184>
What is the molecular formula for <BB_184>?
The molecular formula for <BB_184> (CC1=CC(c2ccccc2)N2NC(N)=NC2=N1) is C12H13N5.
Describe the ring structures in building block <BB_184>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_184>.
The molecule contains the following groups: Amine, Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_184>.
**Token:** <BB_184> **SMILES:** CC1=CC(c2ccccc2)N2NC(N)=NC2=N1 **Molecular Formula:** C12H13N5 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_185>.
CC(C)(C)Oc1ccc(N)cc1C#N
What is the building block token for the following molecule?
CC(C)(C)Oc1ccc(N)cc1C#N
<BB_185>
What is the molecular formula for <BB_185>?
The molecular formula for <BB_185> (CC(C)(C)Oc1ccc(N)cc1C#N) is C11H14N2O.
Describe the ring structures in building block <BB_185>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_185>.
The molecule contains the following groups: Amine, Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_185>.
**Token:** <BB_185> **SMILES:** CC(C)(C)Oc1ccc(N)cc1C#N **Molecular Formula:** C11H14N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Nitrile
Provide the SMILES representation for the building block token <BB_186>.
Cc1cc(F)cc2c1S(=O)(=O)NC2=O
What is the building block token for the following molecule?
Cc1cc(F)cc2c1S(=O)(=O)NC2=O
<BB_186>
What is the molecular formula for <BB_186>?
The molecular formula for <BB_186> (Cc1cc(F)cc2c1S(=O)(=O)NC2=O) is C8H6FNO3S.
Describe the ring structures in building block <BB_186>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_186>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_186>.
**Token:** <BB_186> **SMILES:** Cc1cc(F)cc2c1S(=O)(=O)NC2=O **Molecular Formula:** C8H6FNO3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amide, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_187>.
COC(=O)Cc1cncnc1O
What is the building block token for the following molecule?
COC(=O)Cc1cncnc1O
<BB_187>
What is the molecular formula for <BB_187>?
The molecular formula for <BB_187> (COC(=O)Cc1cncnc1O) is C7H8N2O3.
Describe the ring structures in building block <BB_187>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_187>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_187>.
**Token:** <BB_187> **SMILES:** COC(=O)Cc1cncnc1O **Molecular Formula:** C7H8N2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_188>.
Cn1nc(I)cc1Br
What is the building block token for the following molecule?
Cn1nc(I)cc1Br
<BB_188>
What is the molecular formula for <BB_188>?
The molecular formula for <BB_188> (Cn1nc(I)cc1Br) is C4H4BrIN2.
Describe the ring structures in building block <BB_188>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_188>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_188>.
**Token:** <BB_188> **SMILES:** Cn1nc(I)cc1Br **Molecular Formula:** C4H4BrIN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_189>.
Cl.NC[C@H]1CCC[C@@H]1O
What is the building block token for the following molecule?
Cl.NC[C@H]1CCC[C@@H]1O
<BB_189>
What is the molecular formula for <BB_189>?
The molecular formula for <BB_189> (Cl.NC[C@H]1CCC[C@@H]1O) is C6H14ClNO.
Describe the ring structures in building block <BB_189>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_189>.
The molecule contains the following groups: Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_189>.
**Token:** <BB_189> **SMILES:** Cl.NC[C@H]1CCC[C@@H]1O **Molecular Formula:** C6H14ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_190>.
C#CC1(O)CC2(CCC2)C1
What is the building block token for the following molecule?
C#CC1(O)CC2(CCC2)C1
<BB_190>
What is the molecular formula for <BB_190>?
The molecular formula for <BB_190> (C#CC1(O)CC2(CCC2)C1) is C9H12O.
Describe the ring structures in building block <BB_190>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_190>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_190>.
**Token:** <BB_190> **SMILES:** C#CC1(O)CC2(CCC2)C1 **Molecular Formula:** C9H12O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_191>.
CCC1NCCNC1=O
What is the building block token for the following molecule?
CCC1NCCNC1=O
<BB_191>
What is the molecular formula for <BB_191>?
The molecular formula for <BB_191> (CCC1NCCNC1=O) is C6H12N2O.
Describe the ring structures in building block <BB_191>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_191>.
The molecule contains the following groups: Secondary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_191>.
**Token:** <BB_191> **SMILES:** CCC1NCCNC1=O **Molecular Formula:** C6H12N2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide
Provide the SMILES representation for the building block token <BB_192>.
COC(OC)C(O)C(F)(F)F
What is the building block token for the following molecule?
COC(OC)C(O)C(F)(F)F
<BB_192>
What is the molecular formula for <BB_192>?
The molecular formula for <BB_192> (COC(OC)C(O)C(F)(F)F) is C5H9F3O3.
Describe the ring structures in building block <BB_192>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_192>.
The molecule contains the following groups: Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_192>.
**Token:** <BB_192> **SMILES:** COC(OC)C(O)C(F)(F)F **Molecular Formula:** C5H9F3O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_193>.
NCCSc1cccc(F)c1
What is the building block token for the following molecule?
NCCSc1cccc(F)c1
<BB_193>
What is the molecular formula for <BB_193>?
The molecular formula for <BB_193> (NCCSc1cccc(F)c1) is C8H10FNS.
Describe the ring structures in building block <BB_193>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_193>.
The molecule contains the following groups: Amine, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_193>.
**Token:** <BB_193> **SMILES:** NCCSc1cccc(F)c1 **Molecular Formula:** C8H10FNS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_194>.
CNCCc1ccccc1C(=O)O.Cl
What is the building block token for the following molecule?
CNCCc1ccccc1C(=O)O.Cl
<BB_194>
What is the molecular formula for <BB_194>?
The molecular formula for <BB_194> (CNCCc1ccccc1C(=O)O.Cl) is C10H14ClNO2.
Describe the ring structures in building block <BB_194>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_194>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_194>.
**Token:** <BB_194> **SMILES:** CNCCc1ccccc1C(=O)O.Cl **Molecular Formula:** C10H14ClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_195>.
O=C(O)Cc1cc2ncccn2n1
What is the building block token for the following molecule?
O=C(O)Cc1cc2ncccn2n1
<BB_195>
What is the molecular formula for <BB_195>?
The molecular formula for <BB_195> (O=C(O)Cc1cc2ncccn2n1) is C8H7N3O2.
Describe the ring structures in building block <BB_195>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_195>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_195>.
**Token:** <BB_195> **SMILES:** O=C(O)Cc1cc2ncccn2n1 **Molecular Formula:** C8H7N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_196>.
Cn1nccc1-c1cccc(N)c1
What is the building block token for the following molecule?
Cn1nccc1-c1cccc(N)c1
<BB_196>
What is the molecular formula for <BB_196>?
The molecular formula for <BB_196> (Cn1nccc1-c1cccc(N)c1) is C10H11N3.
Describe the ring structures in building block <BB_196>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_196>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_196>.
**Token:** <BB_196> **SMILES:** Cn1nccc1-c1cccc(N)c1 **Molecular Formula:** C10H11N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_197>.
Cl.O=C(O)[C@@H]1[C@@H]2CNC[C@H]1C2
What is the building block token for the following molecule?
Cl.O=C(O)[C@@H]1[C@@H]2CNC[C@H]1C2
<BB_197>
What is the molecular formula for <BB_197>?
The molecular formula for <BB_197> (Cl.O=C(O)[C@@H]1[C@@H]2CNC[C@H]1C2) is C7H12ClNO2.
Describe the ring structures in building block <BB_197>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_197>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_197>.
**Token:** <BB_197> **SMILES:** Cl.O=C(O)[C@@H]1[C@@H]2CNC[C@H]1C2 **Molecular Formula:** C7H12ClNO2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_198>.
C[C@]1(N)CCC[C@H]1C(=O)O.Cl
What is the building block token for the following molecule?
C[C@]1(N)CCC[C@H]1C(=O)O.Cl
<BB_198>
What is the molecular formula for <BB_198>?
The molecular formula for <BB_198> (C[C@]1(N)CCC[C@H]1C(=O)O.Cl) is C7H14ClNO2.
Describe the ring structures in building block <BB_198>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_198>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_198>.
**Token:** <BB_198> **SMILES:** C[C@]1(N)CCC[C@H]1C(=O)O.Cl **Molecular Formula:** C7H14ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_199>.
O=C(O)C1CC12CCCC2
What is the building block token for the following molecule?
O=C(O)C1CC12CCCC2
<BB_199>
What is the molecular formula for <BB_199>?
The molecular formula for <BB_199> (O=C(O)C1CC12CCCC2) is C8H12O2.
Describe the ring structures in building block <BB_199>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 5.
List the primary functional groups present in <BB_199>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_199>.
**Token:** <BB_199> **SMILES:** O=C(O)C1CC12CCCC2 **Molecular Formula:** C8H12O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid