instruction
stringlengths 41
142
| input
stringlengths 0
478
| output
stringlengths 4
382
|
|---|---|---|
What is the molecular formula for <BB_183>?
|
The molecular formula for <BB_183> (CC(C)C(=O)c1ccc(C(F)(F)F)cc1) is C11H11F3O.
|
|
Describe the ring structures in building block <BB_183>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_183>.
|
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_183>.
|
**Token:** <BB_183>
**SMILES:** CC(C)C(=O)c1ccc(C(F)(F)F)cc1
**Molecular Formula:** C11H11F3O
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_184>.
|
CC1=CC(c2ccccc2)N2NC(N)=NC2=N1
|
|
What is the building block token for the following molecule?
|
CC1=CC(c2ccccc2)N2NC(N)=NC2=N1
|
<BB_184>
|
What is the molecular formula for <BB_184>?
|
The molecular formula for <BB_184> (CC1=CC(c2ccccc2)N2NC(N)=NC2=N1) is C12H13N5.
|
|
Describe the ring structures in building block <BB_184>.
|
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 5.
|
|
List the primary functional groups present in <BB_184>.
|
The molecule contains the following groups: Amine, Secondary Amine, Tertiary Amine.
|
|
Provide a comprehensive chemical profile for the building block <BB_184>.
|
**Token:** <BB_184>
**SMILES:** CC1=CC(c2ccccc2)N2NC(N)=NC2=N1
**Molecular Formula:** C12H13N5
**Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 5.
**Functional Groups:** Amine, Secondary Amine, Tertiary Amine
|
|
Provide the SMILES representation for the building block token <BB_185>.
|
CC(C)(C)Oc1ccc(N)cc1C#N
|
|
What is the building block token for the following molecule?
|
CC(C)(C)Oc1ccc(N)cc1C#N
|
<BB_185>
|
What is the molecular formula for <BB_185>?
|
The molecular formula for <BB_185> (CC(C)(C)Oc1ccc(N)cc1C#N) is C11H14N2O.
|
|
Describe the ring structures in building block <BB_185>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_185>.
|
The molecule contains the following groups: Amine, Ether, Nitrile.
|
|
Provide a comprehensive chemical profile for the building block <BB_185>.
|
**Token:** <BB_185>
**SMILES:** CC(C)(C)Oc1ccc(N)cc1C#N
**Molecular Formula:** C11H14N2O
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Amine, Ether, Nitrile
|
|
Provide the SMILES representation for the building block token <BB_186>.
|
Cc1cc(F)cc2c1S(=O)(=O)NC2=O
|
|
What is the building block token for the following molecule?
|
Cc1cc(F)cc2c1S(=O)(=O)NC2=O
|
<BB_186>
|
What is the molecular formula for <BB_186>?
|
The molecular formula for <BB_186> (Cc1cc(F)cc2c1S(=O)(=O)NC2=O) is C8H6FNO3S.
|
|
Describe the ring structures in building block <BB_186>.
|
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
|
|
List the primary functional groups present in <BB_186>.
|
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I), Sulfonamide.
|
|
Provide a comprehensive chemical profile for the building block <BB_186>.
|
**Token:** <BB_186>
**SMILES:** Cc1cc(F)cc2c1S(=O)(=O)NC2=O
**Molecular Formula:** C8H6FNO3S
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
**Functional Groups:** Amide, Halogen (F,Cl,Br,I), Sulfonamide
|
|
Provide the SMILES representation for the building block token <BB_187>.
|
COC(=O)Cc1cncnc1O
|
|
What is the building block token for the following molecule?
|
COC(=O)Cc1cncnc1O
|
<BB_187>
|
What is the molecular formula for <BB_187>?
|
The molecular formula for <BB_187> (COC(=O)Cc1cncnc1O) is C7H8N2O3.
|
|
Describe the ring structures in building block <BB_187>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_187>.
|
The molecule contains the following groups: Ester, Ether.
|
|
Provide a comprehensive chemical profile for the building block <BB_187>.
|
**Token:** <BB_187>
**SMILES:** COC(=O)Cc1cncnc1O
**Molecular Formula:** C7H8N2O3
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Ester, Ether
|
|
Provide the SMILES representation for the building block token <BB_188>.
|
Cn1nc(I)cc1Br
|
|
What is the building block token for the following molecule?
|
Cn1nc(I)cc1Br
|
<BB_188>
|
What is the molecular formula for <BB_188>?
|
The molecular formula for <BB_188> (Cn1nc(I)cc1Br) is C4H4BrIN2.
|
|
Describe the ring structures in building block <BB_188>.
|
The molecule contains 1 ring(s): an aromatic ring of size 5.
|
|
List the primary functional groups present in <BB_188>.
|
The molecule contains the following groups: Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_188>.
|
**Token:** <BB_188>
**SMILES:** Cn1nc(I)cc1Br
**Molecular Formula:** C4H4BrIN2
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5.
**Functional Groups:** Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_189>.
|
Cl.NC[C@H]1CCC[C@@H]1O
|
|
What is the building block token for the following molecule?
|
Cl.NC[C@H]1CCC[C@@H]1O
|
<BB_189>
|
What is the molecular formula for <BB_189>?
|
The molecular formula for <BB_189> (Cl.NC[C@H]1CCC[C@@H]1O) is C6H14ClNO.
|
|
Describe the ring structures in building block <BB_189>.
|
The molecule contains 1 ring(s): an aliphatic ring of size 5.
|
|
List the primary functional groups present in <BB_189>.
|
The molecule contains the following groups: Amine, Alcohol, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_189>.
|
**Token:** <BB_189>
**SMILES:** Cl.NC[C@H]1CCC[C@@H]1O
**Molecular Formula:** C6H14ClNO
**Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5.
**Functional Groups:** Amine, Alcohol, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_190>.
|
C#CC1(O)CC2(CCC2)C1
|
|
What is the building block token for the following molecule?
|
C#CC1(O)CC2(CCC2)C1
|
<BB_190>
|
What is the molecular formula for <BB_190>?
|
The molecular formula for <BB_190> (C#CC1(O)CC2(CCC2)C1) is C9H12O.
|
|
Describe the ring structures in building block <BB_190>.
|
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
|
|
List the primary functional groups present in <BB_190>.
|
The molecule contains the following groups: Alcohol.
|
|
Provide a comprehensive chemical profile for the building block <BB_190>.
|
**Token:** <BB_190>
**SMILES:** C#CC1(O)CC2(CCC2)C1
**Molecular Formula:** C9H12O
**Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
**Functional Groups:** Alcohol
|
|
Provide the SMILES representation for the building block token <BB_191>.
|
CCC1NCCNC1=O
|
|
What is the building block token for the following molecule?
|
CCC1NCCNC1=O
|
<BB_191>
|
What is the molecular formula for <BB_191>?
|
The molecular formula for <BB_191> (CCC1NCCNC1=O) is C6H12N2O.
|
|
Describe the ring structures in building block <BB_191>.
|
The molecule contains 1 ring(s): an aliphatic ring of size 6.
|
|
List the primary functional groups present in <BB_191>.
|
The molecule contains the following groups: Secondary Amine, Amide.
|
|
Provide a comprehensive chemical profile for the building block <BB_191>.
|
**Token:** <BB_191>
**SMILES:** CCC1NCCNC1=O
**Molecular Formula:** C6H12N2O
**Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6.
**Functional Groups:** Secondary Amine, Amide
|
|
Provide the SMILES representation for the building block token <BB_192>.
|
COC(OC)C(O)C(F)(F)F
|
|
What is the building block token for the following molecule?
|
COC(OC)C(O)C(F)(F)F
|
<BB_192>
|
What is the molecular formula for <BB_192>?
|
The molecular formula for <BB_192> (COC(OC)C(O)C(F)(F)F) is C5H9F3O3.
|
|
Describe the ring structures in building block <BB_192>.
|
The molecule is acyclic (contains no rings).
|
|
List the primary functional groups present in <BB_192>.
|
The molecule contains the following groups: Alcohol, Ether, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_192>.
|
**Token:** <BB_192>
**SMILES:** COC(OC)C(O)C(F)(F)F
**Molecular Formula:** C5H9F3O3
**Ring System:** The molecule is acyclic (contains no rings).
**Functional Groups:** Alcohol, Ether, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_193>.
|
NCCSc1cccc(F)c1
|
|
What is the building block token for the following molecule?
|
NCCSc1cccc(F)c1
|
<BB_193>
|
What is the molecular formula for <BB_193>?
|
The molecular formula for <BB_193> (NCCSc1cccc(F)c1) is C8H10FNS.
|
|
Describe the ring structures in building block <BB_193>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_193>.
|
The molecule contains the following groups: Amine, Sulfide, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_193>.
|
**Token:** <BB_193>
**SMILES:** NCCSc1cccc(F)c1
**Molecular Formula:** C8H10FNS
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Amine, Sulfide, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_194>.
|
CNCCc1ccccc1C(=O)O.Cl
|
|
What is the building block token for the following molecule?
|
CNCCc1ccccc1C(=O)O.Cl
|
<BB_194>
|
What is the molecular formula for <BB_194>?
|
The molecular formula for <BB_194> (CNCCc1ccccc1C(=O)O.Cl) is C10H14ClNO2.
|
|
Describe the ring structures in building block <BB_194>.
|
The molecule contains 1 ring(s): an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_194>.
|
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_194>.
|
**Token:** <BB_194>
**SMILES:** CNCCc1ccccc1C(=O)O.Cl
**Molecular Formula:** C10H14ClNO2
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_195>.
|
O=C(O)Cc1cc2ncccn2n1
|
|
What is the building block token for the following molecule?
|
O=C(O)Cc1cc2ncccn2n1
|
<BB_195>
|
What is the molecular formula for <BB_195>?
|
The molecular formula for <BB_195> (O=C(O)Cc1cc2ncccn2n1) is C8H7N3O2.
|
|
Describe the ring structures in building block <BB_195>.
|
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_195>.
|
The molecule contains the following groups: Carboxylic Acid.
|
|
Provide a comprehensive chemical profile for the building block <BB_195>.
|
**Token:** <BB_195>
**SMILES:** O=C(O)Cc1cc2ncccn2n1
**Molecular Formula:** C8H7N3O2
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
**Functional Groups:** Carboxylic Acid
|
|
Provide the SMILES representation for the building block token <BB_196>.
|
Cn1nccc1-c1cccc(N)c1
|
|
What is the building block token for the following molecule?
|
Cn1nccc1-c1cccc(N)c1
|
<BB_196>
|
What is the molecular formula for <BB_196>?
|
The molecular formula for <BB_196> (Cn1nccc1-c1cccc(N)c1) is C10H11N3.
|
|
Describe the ring structures in building block <BB_196>.
|
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
|
|
List the primary functional groups present in <BB_196>.
|
The molecule contains the following groups: Amine.
|
|
Provide a comprehensive chemical profile for the building block <BB_196>.
|
**Token:** <BB_196>
**SMILES:** Cn1nccc1-c1cccc(N)c1
**Molecular Formula:** C10H11N3
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
**Functional Groups:** Amine
|
|
Provide the SMILES representation for the building block token <BB_197>.
|
Cl.O=C(O)[C@@H]1[C@@H]2CNC[C@H]1C2
|
|
What is the building block token for the following molecule?
|
Cl.O=C(O)[C@@H]1[C@@H]2CNC[C@H]1C2
|
<BB_197>
|
What is the molecular formula for <BB_197>?
|
The molecular formula for <BB_197> (Cl.O=C(O)[C@@H]1[C@@H]2CNC[C@H]1C2) is C7H12ClNO2.
|
|
Describe the ring structures in building block <BB_197>.
|
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aliphatic ring of size 6.
|
|
List the primary functional groups present in <BB_197>.
|
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_197>.
|
**Token:** <BB_197>
**SMILES:** Cl.O=C(O)[C@@H]1[C@@H]2CNC[C@H]1C2
**Molecular Formula:** C7H12ClNO2
**Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aliphatic ring of size 6.
**Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_198>.
|
C[C@]1(N)CCC[C@H]1C(=O)O.Cl
|
|
What is the building block token for the following molecule?
|
C[C@]1(N)CCC[C@H]1C(=O)O.Cl
|
<BB_198>
|
What is the molecular formula for <BB_198>?
|
The molecular formula for <BB_198> (C[C@]1(N)CCC[C@H]1C(=O)O.Cl) is C7H14ClNO2.
|
|
Describe the ring structures in building block <BB_198>.
|
The molecule contains 1 ring(s): an aliphatic ring of size 5.
|
|
List the primary functional groups present in <BB_198>.
|
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
|
|
Provide a comprehensive chemical profile for the building block <BB_198>.
|
**Token:** <BB_198>
**SMILES:** C[C@]1(N)CCC[C@H]1C(=O)O.Cl
**Molecular Formula:** C7H14ClNO2
**Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5.
**Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
|
|
Provide the SMILES representation for the building block token <BB_199>.
|
O=C(O)C1CC12CCCC2
|
|
What is the building block token for the following molecule?
|
O=C(O)C1CC12CCCC2
|
<BB_199>
|
What is the molecular formula for <BB_199>?
|
The molecular formula for <BB_199> (O=C(O)C1CC12CCCC2) is C8H12O2.
|
|
Describe the ring structures in building block <BB_199>.
|
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 5.
|
|
List the primary functional groups present in <BB_199>.
|
The molecule contains the following groups: Carboxylic Acid.
|
|
Provide a comprehensive chemical profile for the building block <BB_199>.
|
**Token:** <BB_199>
**SMILES:** O=C(O)C1CC12CCCC2
**Molecular Formula:** C8H12O2
**Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 5.
**Functional Groups:** Carboxylic Acid
|
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.