instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_1666>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1666>.
**Token:** <BB_1666> **SMILES:** CCO/C=C/C(=O)OCC **Molecular Formula:** C7H12O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_1667>.
CCNCC(O)CC
What is the building block token for the following molecule?
CCNCC(O)CC
<BB_1667>
What is the molecular formula for <BB_1667>?
The molecular formula for <BB_1667> (CCNCC(O)CC) is C6H15NO.
Describe the ring structures in building block <BB_1667>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1667>.
The molecule contains the following groups: Secondary Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_1667>.
**Token:** <BB_1667> **SMILES:** CCNCC(O)CC **Molecular Formula:** C6H15NO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Alcohol
Provide the SMILES representation for the building block token <BB_1668>.
CCCNC(=O)CCl
What is the building block token for the following molecule?
CCCNC(=O)CCl
<BB_1668>
What is the molecular formula for <BB_1668>?
The molecular formula for <BB_1668> (CCCNC(=O)CCl) is C5H10ClNO.
Describe the ring structures in building block <BB_1668>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1668>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1668>.
**Token:** <BB_1668> **SMILES:** CCCNC(=O)CCl **Molecular Formula:** C5H10ClNO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1669>.
CCN(CC)S(=O)(=O)c1ccc(NC(=O)CCl)cc1
What is the building block token for the following molecule?
CCN(CC)S(=O)(=O)c1ccc(NC(=O)CCl)cc1
<BB_1669>
What is the molecular formula for <BB_1669>?
The molecular formula for <BB_1669> (CCN(CC)S(=O)(=O)c1ccc(NC(=O)CCl)cc1) is C12H17ClN2O3S.
Describe the ring structures in building block <BB_1669>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1669>.
The molecule contains the following groups: Tertiary Amine, Amide, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1669>.
**Token:** <BB_1669> **SMILES:** CCN(CC)S(=O)(=O)c1ccc(NC(=O)CCl)cc1 **Molecular Formula:** C12H17ClN2O3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_1670>.
COc1ccc(NC(=O)OCC(F)(F)F)cc1Cl
What is the building block token for the following molecule?
COc1ccc(NC(=O)OCC(F)(F)F)cc1Cl
<BB_1670>
What is the molecular formula for <BB_1670>?
The molecular formula for <BB_1670> (COc1ccc(NC(=O)OCC(F)(F)F)cc1Cl) is C10H9ClF3NO3.
Describe the ring structures in building block <BB_1670>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1670>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1670>.
**Token:** <BB_1670> **SMILES:** COc1ccc(NC(=O)OCC(F)(F)F)cc1Cl **Molecular Formula:** C10H9ClF3NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1671>.
O=C(O)c1cc(-c2cccs2)no1
What is the building block token for the following molecule?
O=C(O)c1cc(-c2cccs2)no1
<BB_1671>
What is the molecular formula for <BB_1671>?
The molecular formula for <BB_1671> (O=C(O)c1cc(-c2cccs2)no1) is C8H5NO3S.
Describe the ring structures in building block <BB_1671>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_1671>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1671>.
**Token:** <BB_1671> **SMILES:** O=C(O)c1cc(-c2cccs2)no1 **Molecular Formula:** C8H5NO3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1672>.
O=C1CN(C(=O)OCC(F)(F)F)C1
What is the building block token for the following molecule?
O=C1CN(C(=O)OCC(F)(F)F)C1
<BB_1672>
What is the molecular formula for <BB_1672>?
The molecular formula for <BB_1672> (O=C1CN(C(=O)OCC(F)(F)F)C1) is C6H6F3NO3.
Describe the ring structures in building block <BB_1672>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1672>.
The molecule contains the following groups: Amide, Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1672>.
**Token:** <BB_1672> **SMILES:** O=C1CN(C(=O)OCC(F)(F)F)C1 **Molecular Formula:** C6H6F3NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amide, Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1673>.
COC1(C(F)(F)F)CCNC1.Cl
What is the building block token for the following molecule?
COC1(C(F)(F)F)CCNC1.Cl
<BB_1673>
What is the molecular formula for <BB_1673>?
The molecular formula for <BB_1673> (COC1(C(F)(F)F)CCNC1.Cl) is C6H11ClF3NO.
Describe the ring structures in building block <BB_1673>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1673>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1673>.
**Token:** <BB_1673> **SMILES:** COC1(C(F)(F)F)CCNC1.Cl **Molecular Formula:** C6H11ClF3NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1674>.
Cc1cccc(NCC(C)(C)C)n1
What is the building block token for the following molecule?
Cc1cccc(NCC(C)(C)C)n1
<BB_1674>
What is the molecular formula for <BB_1674>?
The molecular formula for <BB_1674> (Cc1cccc(NCC(C)(C)C)n1) is C11H18N2.
Describe the ring structures in building block <BB_1674>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1674>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_1674>.
**Token:** <BB_1674> **SMILES:** Cc1cccc(NCC(C)(C)C)n1 **Molecular Formula:** C11H18N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_1675>.
Cc1cccc(C(=O)c2ccccn2)c1
What is the building block token for the following molecule?
Cc1cccc(C(=O)c2ccccn2)c1
<BB_1675>
What is the molecular formula for <BB_1675>?
The molecular formula for <BB_1675> (Cc1cccc(C(=O)c2ccccn2)c1) is C13H11NO.
Describe the ring structures in building block <BB_1675>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1675>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_1675>.
**Token:** <BB_1675> **SMILES:** Cc1cccc(C(=O)c2ccccn2)c1 **Molecular Formula:** C13H11NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_1676>.
OCc1c(Cl)nc(C2CC2)nc1Cl
What is the building block token for the following molecule?
OCc1c(Cl)nc(C2CC2)nc1Cl
<BB_1676>
What is the molecular formula for <BB_1676>?
The molecular formula for <BB_1676> (OCc1c(Cl)nc(C2CC2)nc1Cl) is C8H8Cl2N2O.
Describe the ring structures in building block <BB_1676>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1676>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1676>.
**Token:** <BB_1676> **SMILES:** OCc1c(Cl)nc(C2CC2)nc1Cl **Molecular Formula:** C8H8Cl2N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1677>.
CNC(=O)C(C)(C)C(=O)O
What is the building block token for the following molecule?
CNC(=O)C(C)(C)C(=O)O
<BB_1677>
What is the molecular formula for <BB_1677>?
The molecular formula for <BB_1677> (CNC(=O)C(C)(C)C(=O)O) is C6H11NO3.
Describe the ring structures in building block <BB_1677>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1677>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_1677>.
**Token:** <BB_1677> **SMILES:** CNC(=O)C(C)(C)C(=O)O **Molecular Formula:** C6H11NO3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_1678>.
COC(=O)c1cc(C)c(I)s1
What is the building block token for the following molecule?
COC(=O)c1cc(C)c(I)s1
<BB_1678>
What is the molecular formula for <BB_1678>?
The molecular formula for <BB_1678> (COC(=O)c1cc(C)c(I)s1) is C7H7IO2S.
Describe the ring structures in building block <BB_1678>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1678>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1678>.
**Token:** <BB_1678> **SMILES:** COC(=O)c1cc(C)c(I)s1 **Molecular Formula:** C7H7IO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1679>.
Cc1cccc(C)c1NC(=O)CNC(=O)C(C)Cl
What is the building block token for the following molecule?
Cc1cccc(C)c1NC(=O)CNC(=O)C(C)Cl
<BB_1679>
What is the molecular formula for <BB_1679>?
The molecular formula for <BB_1679> (Cc1cccc(C)c1NC(=O)CNC(=O)C(C)Cl) is C13H17ClN2O2.
Describe the ring structures in building block <BB_1679>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1679>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1679>.
**Token:** <BB_1679> **SMILES:** Cc1cccc(C)c1NC(=O)CNC(=O)C(C)Cl **Molecular Formula:** C13H17ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1680>.
ICCCC1CC1
What is the building block token for the following molecule?
ICCCC1CC1
<BB_1680>
What is the molecular formula for <BB_1680>?
The molecular formula for <BB_1680> (ICCCC1CC1) is C6H11I.
Describe the ring structures in building block <BB_1680>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_1680>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1680>.
**Token:** <BB_1680> **SMILES:** ICCCC1CC1 **Molecular Formula:** C6H11I **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1681>.
CCc1ccc(C=O)c(O)c1
What is the building block token for the following molecule?
CCc1ccc(C=O)c(O)c1
<BB_1681>
What is the molecular formula for <BB_1681>?
The molecular formula for <BB_1681> (CCc1ccc(C=O)c(O)c1) is C9H10O2.
Describe the ring structures in building block <BB_1681>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1681>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_1681>.
**Token:** <BB_1681> **SMILES:** CCc1ccc(C=O)c(O)c1 **Molecular Formula:** C9H10O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_1682>.
C=CC(C)(O)CC1CC2CCC1C2
What is the building block token for the following molecule?
C=CC(C)(O)CC1CC2CCC1C2
<BB_1682>
What is the molecular formula for <BB_1682>?
The molecular formula for <BB_1682> (C=CC(C)(O)CC1CC2CCC1C2) is C12H20O.
Describe the ring structures in building block <BB_1682>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1682>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_1682>.
**Token:** <BB_1682> **SMILES:** C=CC(C)(O)CC1CC2CCC1C2 **Molecular Formula:** C12H20O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_1683>.
O=C(O)c1ccc(CN2CCCC2=O)cc1
What is the building block token for the following molecule?
O=C(O)c1ccc(CN2CCCC2=O)cc1
<BB_1683>