instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_1700>.
O=C1OCc2cccc(CO)c21
What is the building block token for the following molecule?
O=C1OCc2cccc(CO)c21
<BB_1700>
What is the molecular formula for <BB_1700>?
The molecular formula for <BB_1700> (O=C1OCc2cccc(CO)c21) is C9H8O3.
Describe the ring structures in building block <BB_1700>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1700>.
The molecule contains the following groups: Ester, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1700>.
**Token:** <BB_1700> **SMILES:** O=C1OCc2cccc(CO)c21 **Molecular Formula:** C9H8O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ester, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1701>.
Cn1nc(-c2cccnc2)cc1C(=O)O
What is the building block token for the following molecule?
Cn1nc(-c2cccnc2)cc1C(=O)O
<BB_1701>
What is the molecular formula for <BB_1701>?
The molecular formula for <BB_1701> (Cn1nc(-c2cccnc2)cc1C(=O)O) is C10H9N3O2.
Describe the ring structures in building block <BB_1701>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1701>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1701>.
**Token:** <BB_1701> **SMILES:** Cn1nc(-c2cccnc2)cc1C(=O)O **Molecular Formula:** C10H9N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1702>.
C=C=Cc1cccc(Br)c1
What is the building block token for the following molecule?
C=C=Cc1cccc(Br)c1
<BB_1702>
What is the molecular formula for <BB_1702>?
The molecular formula for <BB_1702> (C=C=Cc1cccc(Br)c1) is C9H7Br.
Describe the ring structures in building block <BB_1702>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1702>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1702>.
**Token:** <BB_1702> **SMILES:** C=C=Cc1cccc(Br)c1 **Molecular Formula:** C9H7Br **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1703>.
Cl.NCC(F)Cl
What is the building block token for the following molecule?
Cl.NCC(F)Cl
<BB_1703>
What is the molecular formula for <BB_1703>?
The molecular formula for <BB_1703> (Cl.NCC(F)Cl) is C2H6Cl2FN.
Describe the ring structures in building block <BB_1703>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1703>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1703>.
**Token:** <BB_1703> **SMILES:** Cl.NCC(F)Cl **Molecular Formula:** C2H6Cl2FN **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1704>.
Cc1c(Br)c(C(F)(F)F)nn1CCC(=O)O
What is the building block token for the following molecule?
Cc1c(Br)c(C(F)(F)F)nn1CCC(=O)O
<BB_1704>
What is the molecular formula for <BB_1704>?
The molecular formula for <BB_1704> (Cc1c(Br)c(C(F)(F)F)nn1CCC(=O)O) is C8H8BrF3N2O2.
Describe the ring structures in building block <BB_1704>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1704>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1704>.
**Token:** <BB_1704> **SMILES:** Cc1c(Br)c(C(F)(F)F)nn1CCC(=O)O **Molecular Formula:** C8H8BrF3N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1705>.
COc1ccc(C=O)c(O)c1
What is the building block token for the following molecule?
COc1ccc(C=O)c(O)c1
<BB_1705>
What is the molecular formula for <BB_1705>?
The molecular formula for <BB_1705> (COc1ccc(C=O)c(O)c1) is C8H8O3.
Describe the ring structures in building block <BB_1705>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1705>.
The molecule contains the following groups: Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_1705>.
**Token:** <BB_1705> **SMILES:** COc1ccc(C=O)c(O)c1 **Molecular Formula:** C8H8O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_1706>.
C[Si](C)(C)C#CC(=O)CCl
What is the building block token for the following molecule?
C[Si](C)(C)C#CC(=O)CCl
<BB_1706>
What is the molecular formula for <BB_1706>?
The molecular formula for <BB_1706> (C[Si](C)(C)C#CC(=O)CCl) is C7H11ClOSi.
Describe the ring structures in building block <BB_1706>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1706>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1706>.
**Token:** <BB_1706> **SMILES:** C[Si](C)(C)C#CC(=O)CCl **Molecular Formula:** C7H11ClOSi **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1707>.
O=S(=O)(Cl)CC1CC(C2CC2)C1
What is the building block token for the following molecule?
O=S(=O)(Cl)CC1CC(C2CC2)C1
<BB_1707>
What is the molecular formula for <BB_1707>?
The molecular formula for <BB_1707> (O=S(=O)(Cl)CC1CC(C2CC2)C1) is C8H13ClO2S.
Describe the ring structures in building block <BB_1707>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1707>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1707>.
**Token:** <BB_1707> **SMILES:** O=S(=O)(Cl)CC1CC(C2CC2)C1 **Molecular Formula:** C8H13ClO2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 3. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1708>.
O=C(O)CC1CCC(C(F)(F)F)CC1
What is the building block token for the following molecule?
O=C(O)CC1CCC(C(F)(F)F)CC1
<BB_1708>
What is the molecular formula for <BB_1708>?
The molecular formula for <BB_1708> (O=C(O)CC1CCC(C(F)(F)F)CC1) is C9H13F3O2.
Describe the ring structures in building block <BB_1708>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1708>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1708>.
**Token:** <BB_1708> **SMILES:** O=C(O)CC1CCC(C(F)(F)F)CC1 **Molecular Formula:** C9H13F3O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1709>.
CC1CCN(CC2CCNCC2)CC1
What is the building block token for the following molecule?
CC1CCN(CC2CCNCC2)CC1
<BB_1709>
What is the molecular formula for <BB_1709>?
The molecular formula for <BB_1709> (CC1CCN(CC2CCNCC2)CC1) is C12H24N2.
Describe the ring structures in building block <BB_1709>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1709>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_1709>.
**Token:** <BB_1709> **SMILES:** CC1CCN(CC2CCNCC2)CC1 **Molecular Formula:** C12H24N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_1710>.
COC(=O)c1c(O)cccc1O
What is the building block token for the following molecule?
COC(=O)c1c(O)cccc1O
<BB_1710>
What is the molecular formula for <BB_1710>?
The molecular formula for <BB_1710> (COC(=O)c1c(O)cccc1O) is C8H8O4.
Describe the ring structures in building block <BB_1710>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1710>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1710>.
**Token:** <BB_1710> **SMILES:** COC(=O)c1c(O)cccc1O **Molecular Formula:** C8H8O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_1711>.
O=C1CCCC1c1ccccc1
What is the building block token for the following molecule?
O=C1CCCC1c1ccccc1
<BB_1711>
What is the molecular formula for <BB_1711>?
The molecular formula for <BB_1711> (O=C1CCCC1c1ccccc1) is C11H12O.
Describe the ring structures in building block <BB_1711>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1711>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_1711>.
**Token:** <BB_1711> **SMILES:** O=C1CCCC1c1ccccc1 **Molecular Formula:** C11H12O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_1712>.
CC1NCCCO1
What is the building block token for the following molecule?
CC1NCCCO1
<BB_1712>
What is the molecular formula for <BB_1712>?
The molecular formula for <BB_1712> (CC1NCCCO1) is C5H11NO.
Describe the ring structures in building block <BB_1712>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1712>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1712>.
**Token:** <BB_1712> **SMILES:** CC1NCCCO1 **Molecular Formula:** C5H11NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_1713>.
Cl.O=C(O)c1cc(Br)c2c(c1)CCN2
What is the building block token for the following molecule?
Cl.O=C(O)c1cc(Br)c2c(c1)CCN2
<BB_1713>
What is the molecular formula for <BB_1713>?
The molecular formula for <BB_1713> (Cl.O=C(O)c1cc(Br)c2c(c1)CCN2) is C9H9BrClNO2.
Describe the ring structures in building block <BB_1713>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1713>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1713>.
**Token:** <BB_1713> **SMILES:** Cl.O=C(O)c1cc(Br)c2c(c1)CCN2 **Molecular Formula:** C9H9BrClNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1714>.
COCc1ccc(C(C)=O)cc1
What is the building block token for the following molecule?
COCc1ccc(C(C)=O)cc1
<BB_1714>
What is the molecular formula for <BB_1714>?
The molecular formula for <BB_1714> (COCc1ccc(C(C)=O)cc1) is C10H12O2.
Describe the ring structures in building block <BB_1714>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1714>.
The molecule contains the following groups: Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_1714>.
**Token:** <BB_1714> **SMILES:** COCc1ccc(C(C)=O)cc1 **Molecular Formula:** C10H12O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Ether
Provide the SMILES representation for the building block token <BB_1715>.
Cc1c(CC(=O)O)c(Br)nn1C
What is the building block token for the following molecule?
Cc1c(CC(=O)O)c(Br)nn1C
<BB_1715>
What is the molecular formula for <BB_1715>?
The molecular formula for <BB_1715> (Cc1c(CC(=O)O)c(Br)nn1C) is C7H9BrN2O2.
Describe the ring structures in building block <BB_1715>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1715>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1715>.
**Token:** <BB_1715> **SMILES:** Cc1c(CC(=O)O)c(Br)nn1C **Molecular Formula:** C7H9BrN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1716>.
O=C1CC(c2ccccc2Br)NC(=O)N1
What is the building block token for the following molecule?
O=C1CC(c2ccccc2Br)NC(=O)N1
<BB_1716>
What is the molecular formula for <BB_1716>?
The molecular formula for <BB_1716> (O=C1CC(c2ccccc2Br)NC(=O)N1) is C10H9BrN2O2.
Describe the ring structures in building block <BB_1716>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.