instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_1683>?
The molecular formula for <BB_1683> (O=C(O)c1ccc(CN2CCCC2=O)cc1) is C12H13NO3.
Describe the ring structures in building block <BB_1683>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1683>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_1683>.
**Token:** <BB_1683> **SMILES:** O=C(O)c1ccc(CN2CCCC2=O)cc1 **Molecular Formula:** C12H13NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_1684>.
Cc1nc(Br)oc1C
What is the building block token for the following molecule?
Cc1nc(Br)oc1C
<BB_1684>
What is the molecular formula for <BB_1684>?
The molecular formula for <BB_1684> (Cc1nc(Br)oc1C) is C5H6BrNO.
Describe the ring structures in building block <BB_1684>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1684>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1684>.
**Token:** <BB_1684> **SMILES:** Cc1nc(Br)oc1C **Molecular Formula:** C5H6BrNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1685>.
Fc1ccc(C(S)c2ccccc2)cc1
What is the building block token for the following molecule?
Fc1ccc(C(S)c2ccccc2)cc1
<BB_1685>
What is the molecular formula for <BB_1685>?
The molecular formula for <BB_1685> (Fc1ccc(C(S)c2ccccc2)cc1) is C13H11FS.
Describe the ring structures in building block <BB_1685>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1685>.
The molecule contains the following groups: Thiol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1685>.
**Token:** <BB_1685> **SMILES:** Fc1ccc(C(S)c2ccccc2)cc1 **Molecular Formula:** C13H11FS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Thiol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1686>.
COC(=O)c1ccccc1C1CCNC1.Cl
What is the building block token for the following molecule?
COC(=O)c1ccccc1C1CCNC1.Cl
<BB_1686>
What is the molecular formula for <BB_1686>?
The molecular formula for <BB_1686> (COC(=O)c1ccccc1C1CCNC1.Cl) is C12H16ClNO2.
Describe the ring structures in building block <BB_1686>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1686>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1686>.
**Token:** <BB_1686> **SMILES:** COC(=O)c1ccccc1C1CCNC1.Cl **Molecular Formula:** C12H16ClNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1687>.
COC(=O)c1cc(N)c(C)cc1F.Cl
What is the building block token for the following molecule?
COC(=O)c1cc(N)c(C)cc1F.Cl
<BB_1687>
What is the molecular formula for <BB_1687>?
The molecular formula for <BB_1687> (COC(=O)c1cc(N)c(C)cc1F.Cl) is C9H11ClFNO2.
Describe the ring structures in building block <BB_1687>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1687>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1687>.
**Token:** <BB_1687> **SMILES:** COC(=O)c1cc(N)c(C)cc1F.Cl **Molecular Formula:** C9H11ClFNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1688>.
COc1ccc(C)cc1/C=C/C(=O)O
What is the building block token for the following molecule?
COc1ccc(C)cc1/C=C/C(=O)O
<BB_1688>
What is the molecular formula for <BB_1688>?
The molecular formula for <BB_1688> (COc1ccc(C)cc1/C=C/C(=O)O) is C11H12O3.
Describe the ring structures in building block <BB_1688>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1688>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_1688>.
**Token:** <BB_1688> **SMILES:** COc1ccc(C)cc1/C=C/C(=O)O **Molecular Formula:** C11H12O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_1689>.
Cn1nccc1[C@@H]1C[C@H]1C=O
What is the building block token for the following molecule?
Cn1nccc1[C@@H]1C[C@H]1C=O
<BB_1689>
What is the molecular formula for <BB_1689>?
The molecular formula for <BB_1689> (Cn1nccc1[C@@H]1C[C@H]1C=O) is C8H10N2O.
Describe the ring structures in building block <BB_1689>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1689>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_1689>.
**Token:** <BB_1689> **SMILES:** Cn1nccc1[C@@H]1C[C@H]1C=O **Molecular Formula:** C8H10N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_1690>.
NC1(c2nn[nH]n2)CCCC1
What is the building block token for the following molecule?
NC1(c2nn[nH]n2)CCCC1
<BB_1690>
What is the molecular formula for <BB_1690>?
The molecular formula for <BB_1690> (NC1(c2nn[nH]n2)CCCC1) is C6H11N5.
Describe the ring structures in building block <BB_1690>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1690>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1690>.
**Token:** <BB_1690> **SMILES:** NC1(c2nn[nH]n2)CCCC1 **Molecular Formula:** C6H11N5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1691>.
CC1CCCn2cc(C(=O)O)nc21.Cl
What is the building block token for the following molecule?
CC1CCCn2cc(C(=O)O)nc21.Cl
<BB_1691>
What is the molecular formula for <BB_1691>?
The molecular formula for <BB_1691> (CC1CCCn2cc(C(=O)O)nc21.Cl) is C9H13ClN2O2.
Describe the ring structures in building block <BB_1691>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1691>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1691>.
**Token:** <BB_1691> **SMILES:** CC1CCCn2cc(C(=O)O)nc21.Cl **Molecular Formula:** C9H13ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1692>.
Cc1ccc(O[Si](C)(C)C(C)(C)C)c(N)c1
What is the building block token for the following molecule?
Cc1ccc(O[Si](C)(C)C(C)(C)C)c(N)c1
<BB_1692>
What is the molecular formula for <BB_1692>?
The molecular formula for <BB_1692> (Cc1ccc(O[Si](C)(C)C(C)(C)C)c(N)c1) is C13H23NOSi.
Describe the ring structures in building block <BB_1692>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1692>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1692>.
**Token:** <BB_1692> **SMILES:** Cc1ccc(O[Si](C)(C)C(C)(C)C)c(N)c1 **Molecular Formula:** C13H23NOSi **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1693>.
C1CNC2CCCC2C1
What is the building block token for the following molecule?
C1CNC2CCCC2C1
<BB_1693>
What is the molecular formula for <BB_1693>?
The molecular formula for <BB_1693> (C1CNC2CCCC2C1) is C8H15N.
Describe the ring structures in building block <BB_1693>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1693>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_1693>.
**Token:** <BB_1693> **SMILES:** C1CNC2CCCC2C1 **Molecular Formula:** C8H15N **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_1694>.
CC(C)(C)OC(=O)NC1CC[C@H](O)[C@H](O)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC1CC[C@H](O)[C@H](O)C1
<BB_1694>
What is the molecular formula for <BB_1694>?
The molecular formula for <BB_1694> (CC(C)(C)OC(=O)NC1CC[C@H](O)[C@H](O)C1) is C11H21NO4.
Describe the ring structures in building block <BB_1694>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1694>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1694>.
**Token:** <BB_1694> **SMILES:** CC(C)(C)OC(=O)NC1CC[C@H](O)[C@H](O)C1 **Molecular Formula:** C11H21NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1695>.
Fc1cccc(-c2nnc(CCl)o2)c1
What is the building block token for the following molecule?
Fc1cccc(-c2nnc(CCl)o2)c1
<BB_1695>
What is the molecular formula for <BB_1695>?
The molecular formula for <BB_1695> (Fc1cccc(-c2nnc(CCl)o2)c1) is C9H6ClFN2O.
Describe the ring structures in building block <BB_1695>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1695>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1695>.
**Token:** <BB_1695> **SMILES:** Fc1cccc(-c2nnc(CCl)o2)c1 **Molecular Formula:** C9H6ClFN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1696>.
Cl.O=S1(=O)CCNC(c2ccccc2)CC1
What is the building block token for the following molecule?
Cl.O=S1(=O)CCNC(c2ccccc2)CC1
<BB_1696>
What is the molecular formula for <BB_1696>?
The molecular formula for <BB_1696> (Cl.O=S1(=O)CCNC(c2ccccc2)CC1) is C11H16ClNO2S.
Describe the ring structures in building block <BB_1696>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6.
List the primary functional groups present in <BB_1696>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1696>.
**Token:** <BB_1696> **SMILES:** Cl.O=S1(=O)CCNC(c2ccccc2)CC1 **Molecular Formula:** C11H16ClNO2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1697>.
CN(C)C1CNC(C)(C)C1
What is the building block token for the following molecule?
CN(C)C1CNC(C)(C)C1
<BB_1697>
What is the molecular formula for <BB_1697>?
The molecular formula for <BB_1697> (CN(C)C1CNC(C)(C)C1) is C8H18N2.
Describe the ring structures in building block <BB_1697>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1697>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_1697>.
**Token:** <BB_1697> **SMILES:** CN(C)C1CNC(C)(C)C1 **Molecular Formula:** C8H18N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_1698>.
Cc1ccccc1COC1CCNCC1
What is the building block token for the following molecule?
Cc1ccccc1COC1CCNCC1
<BB_1698>
What is the molecular formula for <BB_1698>?
The molecular formula for <BB_1698> (Cc1ccccc1COC1CCNCC1) is C13H19NO.
Describe the ring structures in building block <BB_1698>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1698>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1698>.
**Token:** <BB_1698> **SMILES:** Cc1ccccc1COC1CCNCC1 **Molecular Formula:** C13H19NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_1699>.
O=C(O)Cc1cc2ncc(Br)cn2n1
What is the building block token for the following molecule?
O=C(O)Cc1cc2ncc(Br)cn2n1
<BB_1699>
What is the molecular formula for <BB_1699>?
The molecular formula for <BB_1699> (O=C(O)Cc1cc2ncc(Br)cn2n1) is C8H6BrN3O2.
Describe the ring structures in building block <BB_1699>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1699>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1699>.
**Token:** <BB_1699> **SMILES:** O=C(O)Cc1cc2ncc(Br)cn2n1 **Molecular Formula:** C8H6BrN3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)