instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_1633>?
The molecular formula for <BB_1633> (Cn1cccc1-c1cc(C(=O)O)[nH]n1) is C9H9N3O2.
Describe the ring structures in building block <BB_1633>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_1633>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1633>.
**Token:** <BB_1633> **SMILES:** Cn1cccc1-c1cc(C(=O)O)[nH]n1 **Molecular Formula:** C9H9N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1634>.
CCC(CN)CC(C)C.Cl
What is the building block token for the following molecule?
CCC(CN)CC(C)C.Cl
<BB_1634>
What is the molecular formula for <BB_1634>?
The molecular formula for <BB_1634> (CCC(CN)CC(C)C.Cl) is C8H20ClN.
Describe the ring structures in building block <BB_1634>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1634>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1634>.
**Token:** <BB_1634> **SMILES:** CCC(CN)CC(C)C.Cl **Molecular Formula:** C8H20ClN **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1635>.
Nc1nc(Br)n[nH]1
What is the building block token for the following molecule?
Nc1nc(Br)n[nH]1
<BB_1635>
What is the molecular formula for <BB_1635>?
The molecular formula for <BB_1635> (Nc1nc(Br)n[nH]1) is C2H3BrN4.
Describe the ring structures in building block <BB_1635>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1635>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1635>.
**Token:** <BB_1635> **SMILES:** Nc1nc(Br)n[nH]1 **Molecular Formula:** C2H3BrN4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1636>.
FC(F)(F)COC1CNC1.O=C(O)C(F)(F)F
What is the building block token for the following molecule?
FC(F)(F)COC1CNC1.O=C(O)C(F)(F)F
<BB_1636>
What is the molecular formula for <BB_1636>?
The molecular formula for <BB_1636> (FC(F)(F)COC1CNC1.O=C(O)C(F)(F)F) is C7H9F6NO3.
Describe the ring structures in building block <BB_1636>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1636>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1636>.
**Token:** <BB_1636> **SMILES:** FC(F)(F)COC1CNC1.O=C(O)C(F)(F)F **Molecular Formula:** C7H9F6NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1637>.
CCNCCN1CCCC1
What is the building block token for the following molecule?
CCNCCN1CCCC1
<BB_1637>
What is the molecular formula for <BB_1637>?
The molecular formula for <BB_1637> (CCNCCN1CCCC1) is C8H18N2.
Describe the ring structures in building block <BB_1637>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1637>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_1637>.
**Token:** <BB_1637> **SMILES:** CCNCCN1CCCC1 **Molecular Formula:** C8H18N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_1638>.
CC(C)(O)c1nccnc1Br
What is the building block token for the following molecule?
CC(C)(O)c1nccnc1Br
<BB_1638>
What is the molecular formula for <BB_1638>?
The molecular formula for <BB_1638> (CC(C)(O)c1nccnc1Br) is C7H9BrN2O.
Describe the ring structures in building block <BB_1638>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1638>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1638>.
**Token:** <BB_1638> **SMILES:** CC(C)(O)c1nccnc1Br **Molecular Formula:** C7H9BrN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1639>.
OC(c1ccc(Br)cc1)C1(c2ccccc2)CC1
What is the building block token for the following molecule?
OC(c1ccc(Br)cc1)C1(c2ccccc2)CC1
<BB_1639>
What is the molecular formula for <BB_1639>?
The molecular formula for <BB_1639> (OC(c1ccc(Br)cc1)C1(c2ccccc2)CC1) is C16H15BrO.
Describe the ring structures in building block <BB_1639>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1639>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1639>.
**Token:** <BB_1639> **SMILES:** OC(c1ccc(Br)cc1)C1(c2ccccc2)CC1 **Molecular Formula:** C16H15BrO **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1640>.
O=C(O)CC1(c2ccc(C(F)(F)F)cc2)CCC1
What is the building block token for the following molecule?
O=C(O)CC1(c2ccc(C(F)(F)F)cc2)CCC1
<BB_1640>
What is the molecular formula for <BB_1640>?
The molecular formula for <BB_1640> (O=C(O)CC1(c2ccc(C(F)(F)F)cc2)CCC1) is C13H13F3O2.
Describe the ring structures in building block <BB_1640>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1640>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1640>.
**Token:** <BB_1640> **SMILES:** O=C(O)CC1(c2ccc(C(F)(F)F)cc2)CCC1 **Molecular Formula:** C13H13F3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1641>.
N#Cc1sccc1CC(=O)O
What is the building block token for the following molecule?
N#Cc1sccc1CC(=O)O
<BB_1641>
What is the molecular formula for <BB_1641>?
The molecular formula for <BB_1641> (N#Cc1sccc1CC(=O)O) is C7H5NO2S.
Describe the ring structures in building block <BB_1641>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1641>.
The molecule contains the following groups: Carboxylic Acid, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1641>.
**Token:** <BB_1641> **SMILES:** N#Cc1sccc1CC(=O)O **Molecular Formula:** C7H5NO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Nitrile
Provide the SMILES representation for the building block token <BB_1642>.
CCOC(=O)C(NC(C)=O)C(C)=O
What is the building block token for the following molecule?
CCOC(=O)C(NC(C)=O)C(C)=O
<BB_1642>
What is the molecular formula for <BB_1642>?
The molecular formula for <BB_1642> (CCOC(=O)C(NC(C)=O)C(C)=O) is C8H13NO4.
Describe the ring structures in building block <BB_1642>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1642>.
The molecule contains the following groups: Amide, Ester, Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_1642>.
**Token:** <BB_1642> **SMILES:** CCOC(=O)C(NC(C)=O)C(C)=O **Molecular Formula:** C8H13NO4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Ester, Ketone, Ether
Provide the SMILES representation for the building block token <BB_1643>.
O=C=Nc1cc(Cl)ccc1OC(F)(F)F
What is the building block token for the following molecule?
O=C=Nc1cc(Cl)ccc1OC(F)(F)F
<BB_1643>
What is the molecular formula for <BB_1643>?
The molecular formula for <BB_1643> (O=C=Nc1cc(Cl)ccc1OC(F)(F)F) is C8H3ClF3NO2.
Describe the ring structures in building block <BB_1643>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1643>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1643>.
**Token:** <BB_1643> **SMILES:** O=C=Nc1cc(Cl)ccc1OC(F)(F)F **Molecular Formula:** C8H3ClF3NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1644>.
O=C(O)Cn1nc2n(c(=O)c1=O)CCOC2
What is the building block token for the following molecule?
O=C(O)Cn1nc2n(c(=O)c1=O)CCOC2
<BB_1644>
What is the molecular formula for <BB_1644>?
The molecular formula for <BB_1644> (O=C(O)Cn1nc2n(c(=O)c1=O)CCOC2) is C8H9N3O5.
Describe the ring structures in building block <BB_1644>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1644>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_1644>.
**Token:** <BB_1644> **SMILES:** O=C(O)Cn1nc2n(c(=O)c1=O)CCOC2 **Molecular Formula:** C8H9N3O5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_1645>.
N[C@@H](Cc1ccncc1)C(=O)O
What is the building block token for the following molecule?
N[C@@H](Cc1ccncc1)C(=O)O
<BB_1645>
What is the molecular formula for <BB_1645>?
The molecular formula for <BB_1645> (N[C@@H](Cc1ccncc1)C(=O)O) is C8H10N2O2.
Describe the ring structures in building block <BB_1645>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1645>.
The molecule contains the following groups: Carboxylic Acid, Amine.
Provide a comprehensive chemical profile for the building block <BB_1645>.
**Token:** <BB_1645> **SMILES:** N[C@@H](Cc1ccncc1)C(=O)O **Molecular Formula:** C8H10N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine
Provide the SMILES representation for the building block token <BB_1646>.
Cc1ccc(C(F)(F)C(=O)O)cn1.Cl
What is the building block token for the following molecule?
Cc1ccc(C(F)(F)C(=O)O)cn1.Cl
<BB_1646>
What is the molecular formula for <BB_1646>?
The molecular formula for <BB_1646> (Cc1ccc(C(F)(F)C(=O)O)cn1.Cl) is C8H8ClF2NO2.
Describe the ring structures in building block <BB_1646>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1646>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1646>.
**Token:** <BB_1646> **SMILES:** Cc1ccc(C(F)(F)C(=O)O)cn1.Cl **Molecular Formula:** C8H8ClF2NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1647>.
CCC(=O)Cc1cccs1
What is the building block token for the following molecule?
CCC(=O)Cc1cccs1
<BB_1647>
What is the molecular formula for <BB_1647>?
The molecular formula for <BB_1647> (CCC(=O)Cc1cccs1) is C8H10OS.
Describe the ring structures in building block <BB_1647>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1647>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_1647>.
**Token:** <BB_1647> **SMILES:** CCC(=O)Cc1cccs1 **Molecular Formula:** C8H10OS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_1648>.
CC12COC(CCCl)(OC1)OC2
What is the building block token for the following molecule?
CC12COC(CCCl)(OC1)OC2
<BB_1648>
What is the molecular formula for <BB_1648>?
The molecular formula for <BB_1648> (CC12COC(CCCl)(OC1)OC2) is C8H13ClO3.
Describe the ring structures in building block <BB_1648>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1648>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1648>.
**Token:** <BB_1648> **SMILES:** CC12COC(CCCl)(OC1)OC2 **Molecular Formula:** C8H13ClO3 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1649>.
CON(C)C(=O)CCNC(=O)OC(C)(C)C
What is the building block token for the following molecule?
CON(C)C(=O)CCNC(=O)OC(C)(C)C
<BB_1649>
What is the molecular formula for <BB_1649>?
The molecular formula for <BB_1649> (CON(C)C(=O)CCNC(=O)OC(C)(C)C) is C10H20N2O4.
Describe the ring structures in building block <BB_1649>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1649>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1649>.
**Token:** <BB_1649> **SMILES:** CON(C)C(=O)CCNC(=O)OC(C)(C)C **Molecular Formula:** C10H20N2O4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Ether