instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_1650>.
Br.Br.CC(N)c1cnccc1O
What is the building block token for the following molecule?
Br.Br.CC(N)c1cnccc1O
<BB_1650>
What is the molecular formula for <BB_1650>?
The molecular formula for <BB_1650> (Br.Br.CC(N)c1cnccc1O) is C7H12Br2N2O.
Describe the ring structures in building block <BB_1650>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1650>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1650>.
**Token:** <BB_1650> **SMILES:** Br.Br.CC(N)c1cnccc1O **Molecular Formula:** C7H12Br2N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1651>.
c1cc2c(cc1C1CO1)OCCO2
What is the building block token for the following molecule?
c1cc2c(cc1C1CO1)OCCO2
<BB_1651>
What is the molecular formula for <BB_1651>?
The molecular formula for <BB_1651> (c1cc2c(cc1C1CO1)OCCO2) is C10H10O3.
Describe the ring structures in building block <BB_1651>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1651>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_1651>.
**Token:** <BB_1651> **SMILES:** c1cc2c(cc1C1CO1)OCCO2 **Molecular Formula:** C10H10O3 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3, an aliphatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_1652>.
O=C(O)c1ccnc(-n2ccc([N+](=O)[O-])n2)c1
What is the building block token for the following molecule?
O=C(O)c1ccnc(-n2ccc([N+](=O)[O-])n2)c1
<BB_1652>
What is the molecular formula for <BB_1652>?
The molecular formula for <BB_1652> (O=C(O)c1ccnc(-n2ccc([N+](=O)[O-])n2)c1) is C9H6N4O4.
Describe the ring structures in building block <BB_1652>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1652>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Nitro.
Provide a comprehensive chemical profile for the building block <BB_1652>.
**Token:** <BB_1652> **SMILES:** O=C(O)c1ccnc(-n2ccc([N+](=O)[O-])n2)c1 **Molecular Formula:** C9H6N4O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Nitro
Provide the SMILES representation for the building block token <BB_1653>.
CCCCC(NC(=O)OCc1ccccc1)C(=O)O
What is the building block token for the following molecule?
CCCCC(NC(=O)OCc1ccccc1)C(=O)O
<BB_1653>
What is the molecular formula for <BB_1653>?
The molecular formula for <BB_1653> (CCCCC(NC(=O)OCc1ccccc1)C(=O)O) is C14H19NO4.
Describe the ring structures in building block <BB_1653>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1653>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1653>.
**Token:** <BB_1653> **SMILES:** CCCCC(NC(=O)OCc1ccccc1)C(=O)O **Molecular Formula:** C14H19NO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_1654>.
Cc1ccn(C2(C(=O)O)CC2)n1
What is the building block token for the following molecule?
Cc1ccn(C2(C(=O)O)CC2)n1
<BB_1654>
What is the molecular formula for <BB_1654>?
The molecular formula for <BB_1654> (Cc1ccn(C2(C(=O)O)CC2)n1) is C8H10N2O2.
Describe the ring structures in building block <BB_1654>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1654>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1654>.
**Token:** <BB_1654> **SMILES:** Cc1ccn(C2(C(=O)O)CC2)n1 **Molecular Formula:** C8H10N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1655>.
Cl.NC1CCC2CC2C1
What is the building block token for the following molecule?
Cl.NC1CCC2CC2C1
<BB_1655>
What is the molecular formula for <BB_1655>?
The molecular formula for <BB_1655> (Cl.NC1CCC2CC2C1) is C7H14ClN.
Describe the ring structures in building block <BB_1655>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1655>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1655>.
**Token:** <BB_1655> **SMILES:** Cl.NC1CCC2CC2C1 **Molecular Formula:** C7H14ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1656>.
O=S(=O)(Cl)c1cccc(C(F)(F)CC(F)(F)F)c1
What is the building block token for the following molecule?
O=S(=O)(Cl)c1cccc(C(F)(F)CC(F)(F)F)c1
<BB_1656>
What is the molecular formula for <BB_1656>?
The molecular formula for <BB_1656> (O=S(=O)(Cl)c1cccc(C(F)(F)CC(F)(F)F)c1) is C9H6ClF5O2S.
Describe the ring structures in building block <BB_1656>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1656>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1656>.
**Token:** <BB_1656> **SMILES:** O=S(=O)(Cl)c1cccc(C(F)(F)CC(F)(F)F)c1 **Molecular Formula:** C9H6ClF5O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1657>.
CC(C)C(NCc1ccccn1)C(=O)O.Cl.Cl
What is the building block token for the following molecule?
CC(C)C(NCc1ccccn1)C(=O)O.Cl.Cl
<BB_1657>
What is the molecular formula for <BB_1657>?
The molecular formula for <BB_1657> (CC(C)C(NCc1ccccn1)C(=O)O.Cl.Cl) is C11H18Cl2N2O2.
Describe the ring structures in building block <BB_1657>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1657>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1657>.
**Token:** <BB_1657> **SMILES:** CC(C)C(NCc1ccccn1)C(=O)O.Cl.Cl **Molecular Formula:** C11H18Cl2N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1658>.
CC(C)(O)c1ncc(C(=O)[O-])cn1.[Na+]
What is the building block token for the following molecule?
CC(C)(O)c1ncc(C(=O)[O-])cn1.[Na+]
<BB_1658>
What is the molecular formula for <BB_1658>?
The molecular formula for <BB_1658> (CC(C)(O)c1ncc(C(=O)[O-])cn1.[Na+]) is C8H9N2NaO3.
Describe the ring structures in building block <BB_1658>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1658>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_1658>.
**Token:** <BB_1658> **SMILES:** CC(C)(O)c1ncc(C(=O)[O-])cn1.[Na+] **Molecular Formula:** C8H9N2NaO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_1659>.
CC(NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)O
What is the building block token for the following molecule?
CC(NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)O
<BB_1659>
What is the molecular formula for <BB_1659>?
The molecular formula for <BB_1659> (CC(NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)O) is C10H9ClN2O5.
Describe the ring structures in building block <BB_1659>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1659>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Amide, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_1659>.
**Token:** <BB_1659> **SMILES:** CC(NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)O **Molecular Formula:** C10H9ClN2O5 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Amide, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_1660>.
C1CC(N2CCNCC2)CCN1
What is the building block token for the following molecule?
C1CC(N2CCNCC2)CCN1
<BB_1660>
What is the molecular formula for <BB_1660>?
The molecular formula for <BB_1660> (C1CC(N2CCNCC2)CCN1) is C9H19N3.
Describe the ring structures in building block <BB_1660>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1660>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_1660>.
**Token:** <BB_1660> **SMILES:** C1CC(N2CCNCC2)CCN1 **Molecular Formula:** C9H19N3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_1661>.
C[N+](C)(C)CCO.C[N+](C)(C)CCO.O=S(=O)([O-])[O-]
What is the building block token for the following molecule?
C[N+](C)(C)CCO.C[N+](C)(C)CCO.O=S(=O)([O-])[O-]
<BB_1661>
What is the molecular formula for <BB_1661>?
The molecular formula for <BB_1661> (C[N+](C)(C)CCO.C[N+](C)(C)CCO.O=S(=O)([O-])[O-]) is C10H28N2O6S.
Describe the ring structures in building block <BB_1661>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1661>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_1661>.
**Token:** <BB_1661> **SMILES:** C[N+](C)(C)CCO.C[N+](C)(C)CCO.O=S(=O)([O-])[O-] **Molecular Formula:** C10H28N2O6S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_1662>.
COC[B-](F)(F)F.[K+]
What is the building block token for the following molecule?
COC[B-](F)(F)F.[K+]
<BB_1662>
What is the molecular formula for <BB_1662>?
The molecular formula for <BB_1662> (COC[B-](F)(F)F.[K+]) is C2H5BF3KO.
Describe the ring structures in building block <BB_1662>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1662>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1662>.
**Token:** <BB_1662> **SMILES:** COC[B-](F)(F)F.[K+] **Molecular Formula:** C2H5BF3KO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1663>.
CCC1(C)CCC(N)CC1
What is the building block token for the following molecule?
CCC1(C)CCC(N)CC1
<BB_1663>
What is the molecular formula for <BB_1663>?
The molecular formula for <BB_1663> (CCC1(C)CCC(N)CC1) is C9H19N.
Describe the ring structures in building block <BB_1663>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1663>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1663>.
**Token:** <BB_1663> **SMILES:** CCC1(C)CCC(N)CC1 **Molecular Formula:** C9H19N **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1664>.
Nc1ncc(C2(O)CCNCC2)s1
What is the building block token for the following molecule?
Nc1ncc(C2(O)CCNCC2)s1
<BB_1664>
What is the molecular formula for <BB_1664>?
The molecular formula for <BB_1664> (Nc1ncc(C2(O)CCNCC2)s1) is C8H13N3OS.
Describe the ring structures in building block <BB_1664>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1664>.
The molecule contains the following groups: Amine, Secondary Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_1664>.
**Token:** <BB_1664> **SMILES:** Nc1ncc(C2(O)CCNCC2)s1 **Molecular Formula:** C8H13N3OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Alcohol
Provide the SMILES representation for the building block token <BB_1665>.
CC(C)(C)OC(=O)NCCc1nnc2n1CCCC2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NCCc1nnc2n1CCCC2
<BB_1665>
What is the molecular formula for <BB_1665>?
The molecular formula for <BB_1665> (CC(C)(C)OC(=O)NCCc1nnc2n1CCCC2) is C13H22N4O2.
Describe the ring structures in building block <BB_1665>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1665>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1665>.
**Token:** <BB_1665> **SMILES:** CC(C)(C)OC(=O)NCCc1nnc2n1CCCC2 **Molecular Formula:** C13H22N4O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_1666>.
CCO/C=C/C(=O)OCC
What is the building block token for the following molecule?
CCO/C=C/C(=O)OCC
<BB_1666>
What is the molecular formula for <BB_1666>?
The molecular formula for <BB_1666> (CCO/C=C/C(=O)OCC) is C7H12O3.
Describe the ring structures in building block <BB_1666>.
The molecule is acyclic (contains no rings).