instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_1716>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1716>.
**Token:** <BB_1716> **SMILES:** O=C1CC(c2ccccc2Br)NC(=O)N1 **Molecular Formula:** C10H9BrN2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1717>.
CC(C)c1nn(C)c(Cl)c1C=O
What is the building block token for the following molecule?
CC(C)c1nn(C)c(Cl)c1C=O
<BB_1717>
What is the molecular formula for <BB_1717>?
The molecular formula for <BB_1717> (CC(C)c1nn(C)c(Cl)c1C=O) is C8H11ClN2O.
Describe the ring structures in building block <BB_1717>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1717>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1717>.
**Token:** <BB_1717> **SMILES:** CC(C)c1nn(C)c(Cl)c1C=O **Molecular Formula:** C8H11ClN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1718>.
C=CCN1CCN(C(=O)OC(C)(C)C)C(C)C1=O
What is the building block token for the following molecule?
C=CCN1CCN(C(=O)OC(C)(C)C)C(C)C1=O
<BB_1718>
What is the molecular formula for <BB_1718>?
The molecular formula for <BB_1718> (C=CCN1CCN(C(=O)OC(C)(C)C)C(C)C1=O) is C13H22N2O3.
Describe the ring structures in building block <BB_1718>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1718>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1718>.
**Token:** <BB_1718> **SMILES:** C=CCN1CCN(C(=O)OC(C)(C)C)C(C)C1=O **Molecular Formula:** C13H22N2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_1719>.
Cc1nc(-c2ccc(C(=O)O)cc2)cs1
What is the building block token for the following molecule?
Cc1nc(-c2ccc(C(=O)O)cc2)cs1
<BB_1719>
What is the molecular formula for <BB_1719>?
The molecular formula for <BB_1719> (Cc1nc(-c2ccc(C(=O)O)cc2)cs1) is C11H9NO2S.
Describe the ring structures in building block <BB_1719>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1719>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1719>.
**Token:** <BB_1719> **SMILES:** Cc1nc(-c2ccc(C(=O)O)cc2)cs1 **Molecular Formula:** C11H9NO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1720>.
FC1(F)CCC2(CC1)CC(Br)C2
What is the building block token for the following molecule?
FC1(F)CCC2(CC1)CC(Br)C2
<BB_1720>
What is the molecular formula for <BB_1720>?
The molecular formula for <BB_1720> (FC1(F)CCC2(CC1)CC(Br)C2) is C9H13BrF2.
Describe the ring structures in building block <BB_1720>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1720>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1720>.
**Token:** <BB_1720> **SMILES:** FC1(F)CCC2(CC1)CC(Br)C2 **Molecular Formula:** C9H13BrF2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1721>.
Brc1ccccc1-c1noc(C2CCCN2)n1
What is the building block token for the following molecule?
Brc1ccccc1-c1noc(C2CCCN2)n1
<BB_1721>
What is the molecular formula for <BB_1721>?
The molecular formula for <BB_1721> (Brc1ccccc1-c1noc(C2CCCN2)n1) is C12H12BrN3O.
Describe the ring structures in building block <BB_1721>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1721>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1721>.
**Token:** <BB_1721> **SMILES:** Brc1ccccc1-c1noc(C2CCCN2)n1 **Molecular Formula:** C12H12BrN3O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1722>.
O=S([O-])c1cnc(Cl)nc1Cl.[Li+]
What is the building block token for the following molecule?
O=S([O-])c1cnc(Cl)nc1Cl.[Li+]
<BB_1722>
What is the molecular formula for <BB_1722>?
The molecular formula for <BB_1722> (O=S([O-])c1cnc(Cl)nc1Cl.[Li+]) is C4HCl2LiN2O2S.
Describe the ring structures in building block <BB_1722>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1722>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1722>.
**Token:** <BB_1722> **SMILES:** O=S([O-])c1cnc(Cl)nc1Cl.[Li+] **Molecular Formula:** C4HCl2LiN2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1723>.
Cl.Cl.Fc1ccc(C2CCNCC2)nc1
What is the building block token for the following molecule?
Cl.Cl.Fc1ccc(C2CCNCC2)nc1
<BB_1723>
What is the molecular formula for <BB_1723>?
The molecular formula for <BB_1723> (Cl.Cl.Fc1ccc(C2CCNCC2)nc1) is C10H15Cl2FN2.
Describe the ring structures in building block <BB_1723>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1723>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1723>.
**Token:** <BB_1723> **SMILES:** Cl.Cl.Fc1ccc(C2CCNCC2)nc1 **Molecular Formula:** C10H15Cl2FN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1724>.
CCn1ccc(CCl)n1
What is the building block token for the following molecule?
CCn1ccc(CCl)n1
<BB_1724>
What is the molecular formula for <BB_1724>?
The molecular formula for <BB_1724> (CCn1ccc(CCl)n1) is C6H9ClN2.
Describe the ring structures in building block <BB_1724>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1724>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1724>.
**Token:** <BB_1724> **SMILES:** CCn1ccc(CCl)n1 **Molecular Formula:** C6H9ClN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1725>.
Cl.NNc1ccc(F)cc1F
What is the building block token for the following molecule?
Cl.NNc1ccc(F)cc1F
<BB_1725>
What is the molecular formula for <BB_1725>?
The molecular formula for <BB_1725> (Cl.NNc1ccc(F)cc1F) is C6H7ClF2N2.
Describe the ring structures in building block <BB_1725>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1725>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1725>.
**Token:** <BB_1725> **SMILES:** Cl.NNc1ccc(F)cc1F **Molecular Formula:** C6H7ClF2N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1726>.
COc1ccc(C(=O)O)c(C#N)c1
What is the building block token for the following molecule?
COc1ccc(C(=O)O)c(C#N)c1
<BB_1726>
What is the molecular formula for <BB_1726>?
The molecular formula for <BB_1726> (COc1ccc(C(=O)O)c(C#N)c1) is C9H7NO3.
Describe the ring structures in building block <BB_1726>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1726>.
The molecule contains the following groups: Carboxylic Acid, Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1726>.
**Token:** <BB_1726> **SMILES:** COc1ccc(C(=O)O)c(C#N)c1 **Molecular Formula:** C9H7NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Nitrile
Provide the SMILES representation for the building block token <BB_1727>.
Cl.O=C(O)c1ccc2cnccc2c1
What is the building block token for the following molecule?
Cl.O=C(O)c1ccc2cnccc2c1
<BB_1727>
What is the molecular formula for <BB_1727>?
The molecular formula for <BB_1727> (Cl.O=C(O)c1ccc2cnccc2c1) is C10H8ClNO2.
Describe the ring structures in building block <BB_1727>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1727>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1727>.
**Token:** <BB_1727> **SMILES:** Cl.O=C(O)c1ccc2cnccc2c1 **Molecular Formula:** C10H8ClNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1728>.
Oc1ccc(C=Cc2ccncc2)cc1
What is the building block token for the following molecule?
Oc1ccc(C=Cc2ccncc2)cc1
<BB_1728>
What is the molecular formula for <BB_1728>?
The molecular formula for <BB_1728> (Oc1ccc(C=Cc2ccncc2)cc1) is C13H11NO.
Describe the ring structures in building block <BB_1728>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1728>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1728>.
**Token:** <BB_1728> **SMILES:** Oc1ccc(C=Cc2ccncc2)cc1 **Molecular Formula:** C13H11NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1729>.
C#CCn1c(SC)nc(C)cc1=O
What is the building block token for the following molecule?
C#CCn1c(SC)nc(C)cc1=O
<BB_1729>
What is the molecular formula for <BB_1729>?
The molecular formula for <BB_1729> (C#CCn1c(SC)nc(C)cc1=O) is C9H10N2OS.
Describe the ring structures in building block <BB_1729>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1729>.
The molecule contains the following groups: Sulfide.
Provide a comprehensive chemical profile for the building block <BB_1729>.
**Token:** <BB_1729> **SMILES:** C#CCn1c(SC)nc(C)cc1=O **Molecular Formula:** C9H10N2OS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Sulfide
Provide the SMILES representation for the building block token <BB_1730>.
CC(C)(C)OC(=O)Nc1cnc(F)nc1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)Nc1cnc(F)nc1
<BB_1730>
What is the molecular formula for <BB_1730>?
The molecular formula for <BB_1730> (CC(C)(C)OC(=O)Nc1cnc(F)nc1) is C9H12FN3O2.
Describe the ring structures in building block <BB_1730>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1730>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1730>.
**Token:** <BB_1730> **SMILES:** CC(C)(C)OC(=O)Nc1cnc(F)nc1 **Molecular Formula:** C9H12FN3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1731>.
CN(C)/C=C1\CCC1=O
What is the building block token for the following molecule?
CN(C)/C=C1\CCC1=O
<BB_1731>
What is the molecular formula for <BB_1731>?
The molecular formula for <BB_1731> (CN(C)/C=C1\CCC1=O) is C7H11NO.
Describe the ring structures in building block <BB_1731>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1731>.
The molecule contains the following groups: Tertiary Amine, Ketone.
Provide a comprehensive chemical profile for the building block <BB_1731>.
**Token:** <BB_1731> **SMILES:** CN(C)/C=C1\CCC1=O **Molecular Formula:** C7H11NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Tertiary Amine, Ketone
Provide the SMILES representation for the building block token <BB_1732>.
CN(C)S(=O)(=N[Si](C)(C)C(C)(C)C)n1ccnc1
What is the building block token for the following molecule?
CN(C)S(=O)(=N[Si](C)(C)C(C)(C)C)n1ccnc1
<BB_1732>
What is the molecular formula for <BB_1732>?
The molecular formula for <BB_1732> (CN(C)S(=O)(=N[Si](C)(C)C(C)(C)C)n1ccnc1) is C11H24N4OSSi.
Describe the ring structures in building block <BB_1732>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1732>.
The molecule contains the following groups: Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_1732>.
**Token:** <BB_1732> **SMILES:** CN(C)S(=O)(=N[Si](C)(C)C(C)(C)C)n1ccnc1 **Molecular Formula:** C11H24N4OSSi **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Tertiary Amine
Provide the SMILES representation for the building block token <BB_1733>.
Cl.NC[C@@H]1CC[C@H]1CO
What is the building block token for the following molecule?
Cl.NC[C@@H]1CC[C@H]1CO
<BB_1733>