instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_1733>?
The molecular formula for <BB_1733> (Cl.NC[C@@H]1CC[C@H]1CO) is C6H14ClNO.
Describe the ring structures in building block <BB_1733>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1733>.
The molecule contains the following groups: Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1733>.
**Token:** <BB_1733> **SMILES:** Cl.NC[C@@H]1CC[C@H]1CO **Molecular Formula:** C6H14ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1734>.
O=Cc1c[nH]c2cc(F)c(F)cc12
What is the building block token for the following molecule?
O=Cc1c[nH]c2cc(F)c(F)cc12
<BB_1734>
What is the molecular formula for <BB_1734>?
The molecular formula for <BB_1734> (O=Cc1c[nH]c2cc(F)c(F)cc12) is C9H5F2NO.
Describe the ring structures in building block <BB_1734>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1734>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1734>.
**Token:** <BB_1734> **SMILES:** O=Cc1c[nH]c2cc(F)c(F)cc12 **Molecular Formula:** C9H5F2NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1735>.
O=C([O-])CCOC(F)F.[Li+]
What is the building block token for the following molecule?
O=C([O-])CCOC(F)F.[Li+]
<BB_1735>
What is the molecular formula for <BB_1735>?
The molecular formula for <BB_1735> (O=C([O-])CCOC(F)F.[Li+]) is C4H5F2LiO3.
Describe the ring structures in building block <BB_1735>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1735>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1735>.
**Token:** <BB_1735> **SMILES:** O=C([O-])CCOC(F)F.[Li+] **Molecular Formula:** C4H5F2LiO3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1736>.
COC(=O)C(C)(C)O
What is the building block token for the following molecule?
COC(=O)C(C)(C)O
<BB_1736>
What is the molecular formula for <BB_1736>?
The molecular formula for <BB_1736> (COC(=O)C(C)(C)O) is C5H10O3.
Describe the ring structures in building block <BB_1736>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1736>.
The molecule contains the following groups: Ester, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1736>.
**Token:** <BB_1736> **SMILES:** COC(=O)C(C)(C)O **Molecular Formula:** C5H10O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1737>.
COC(=O)c1cc2ncnc(N)n2n1
What is the building block token for the following molecule?
COC(=O)c1cc2ncnc(N)n2n1
<BB_1737>
What is the molecular formula for <BB_1737>?
The molecular formula for <BB_1737> (COC(=O)c1cc2ncnc(N)n2n1) is C7H7N5O2.
Describe the ring structures in building block <BB_1737>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1737>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1737>.
**Token:** <BB_1737> **SMILES:** COC(=O)c1cc2ncnc(N)n2n1 **Molecular Formula:** C7H7N5O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_1738>.
N#Cc1cc(C=O)cs1
What is the building block token for the following molecule?
N#Cc1cc(C=O)cs1
<BB_1738>
What is the molecular formula for <BB_1738>?
The molecular formula for <BB_1738> (N#Cc1cc(C=O)cs1) is C6H3NOS.
Describe the ring structures in building block <BB_1738>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1738>.
The molecule contains the following groups: Aldehyde, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1738>.
**Token:** <BB_1738> **SMILES:** N#Cc1cc(C=O)cs1 **Molecular Formula:** C6H3NOS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Aldehyde, Nitrile
Provide the SMILES representation for the building block token <BB_1739>.
OC[C@H]1O[C@@H](n2cnc3c(Cl)ncnc32)[C@H](O)[C@@H]1O
What is the building block token for the following molecule?
OC[C@H]1O[C@@H](n2cnc3c(Cl)ncnc32)[C@H](O)[C@@H]1O
<BB_1739>
What is the molecular formula for <BB_1739>?
The molecular formula for <BB_1739> (OC[C@H]1O[C@@H](n2cnc3c(Cl)ncnc32)[C@H](O)[C@@H]1O) is C10H11ClN4O4.
Describe the ring structures in building block <BB_1739>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1739>.
The molecule contains the following groups: Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1739>.
**Token:** <BB_1739> **SMILES:** OC[C@H]1O[C@@H](n2cnc3c(Cl)ncnc32)[C@H](O)[C@@H]1O **Molecular Formula:** C10H11ClN4O4 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1740>.
COC(=O)c1cc(C)sc1N
What is the building block token for the following molecule?
COC(=O)c1cc(C)sc1N
<BB_1740>
What is the molecular formula for <BB_1740>?
The molecular formula for <BB_1740> (COC(=O)c1cc(C)sc1N) is C7H9NO2S.
Describe the ring structures in building block <BB_1740>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1740>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1740>.
**Token:** <BB_1740> **SMILES:** COC(=O)c1cc(C)sc1N **Molecular Formula:** C7H9NO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_1741>.
Cl.NC[C@H]1CCCC[C@H]1O
What is the building block token for the following molecule?
Cl.NC[C@H]1CCCC[C@H]1O
<BB_1741>
What is the molecular formula for <BB_1741>?
The molecular formula for <BB_1741> (Cl.NC[C@H]1CCCC[C@H]1O) is C7H16ClNO.
Describe the ring structures in building block <BB_1741>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1741>.
The molecule contains the following groups: Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1741>.
**Token:** <BB_1741> **SMILES:** Cl.NC[C@H]1CCCC[C@H]1O **Molecular Formula:** C7H16ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1742>.
COc1ccc(NC(N)=S)cc1Cl
What is the building block token for the following molecule?
COc1ccc(NC(N)=S)cc1Cl
<BB_1742>
What is the molecular formula for <BB_1742>?
The molecular formula for <BB_1742> (COc1ccc(NC(N)=S)cc1Cl) is C8H9ClN2OS.
Describe the ring structures in building block <BB_1742>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1742>.
The molecule contains the following groups: Amine, Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1742>.
**Token:** <BB_1742> **SMILES:** COc1ccc(NC(N)=S)cc1Cl **Molecular Formula:** C8H9ClN2OS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1743>.
NC1CCCCCC1c1ccccc1
What is the building block token for the following molecule?
NC1CCCCCC1c1ccccc1
<BB_1743>
What is the molecular formula for <BB_1743>?
The molecular formula for <BB_1743> (NC1CCCCCC1c1ccccc1) is C13H19N.
Describe the ring structures in building block <BB_1743>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6.
List the primary functional groups present in <BB_1743>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1743>.
**Token:** <BB_1743> **SMILES:** NC1CCCCCC1c1ccccc1 **Molecular Formula:** C13H19N **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1744>.
Cc1cnc(NC(=O)CCC2CCCC2)s1
What is the building block token for the following molecule?
Cc1cnc(NC(=O)CCC2CCCC2)s1
<BB_1744>
What is the molecular formula for <BB_1744>?
The molecular formula for <BB_1744> (Cc1cnc(NC(=O)CCC2CCCC2)s1) is C12H18N2OS.
Describe the ring structures in building block <BB_1744>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1744>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_1744>.
**Token:** <BB_1744> **SMILES:** Cc1cnc(NC(=O)CCC2CCCC2)s1 **Molecular Formula:** C12H18N2OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_1745>.
OC[C@@H]1CCCO1
What is the building block token for the following molecule?
OC[C@@H]1CCCO1
<BB_1745>
What is the molecular formula for <BB_1745>?
The molecular formula for <BB_1745> (OC[C@@H]1CCCO1) is C5H10O2.
Describe the ring structures in building block <BB_1745>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1745>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1745>.
**Token:** <BB_1745> **SMILES:** OC[C@@H]1CCCO1 **Molecular Formula:** C5H10O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1746>.
CSc1ncc(Br)c(Cl)n1
What is the building block token for the following molecule?
CSc1ncc(Br)c(Cl)n1
<BB_1746>
What is the molecular formula for <BB_1746>?
The molecular formula for <BB_1746> (CSc1ncc(Br)c(Cl)n1) is C5H4BrClN2S.
Describe the ring structures in building block <BB_1746>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1746>.
The molecule contains the following groups: Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1746>.
**Token:** <BB_1746> **SMILES:** CSc1ncc(Br)c(Cl)n1 **Molecular Formula:** C5H4BrClN2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1747>.
N[C@@H](C(=O)O)c1ccccc1
What is the building block token for the following molecule?
N[C@@H](C(=O)O)c1ccccc1
<BB_1747>
What is the molecular formula for <BB_1747>?
The molecular formula for <BB_1747> (N[C@@H](C(=O)O)c1ccccc1) is C8H9NO2.
Describe the ring structures in building block <BB_1747>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1747>.
The molecule contains the following groups: Carboxylic Acid, Amine.
Provide a comprehensive chemical profile for the building block <BB_1747>.
**Token:** <BB_1747> **SMILES:** N[C@@H](C(=O)O)c1ccccc1 **Molecular Formula:** C8H9NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine
Provide the SMILES representation for the building block token <BB_1748>.
O=C1C(=O)c2ccc(Br)cc2-c2ccccc21
What is the building block token for the following molecule?
O=C1C(=O)c2ccc(Br)cc2-c2ccccc21
<BB_1748>
What is the molecular formula for <BB_1748>?
The molecular formula for <BB_1748> (O=C1C(=O)c2ccc(Br)cc2-c2ccccc21) is C14H7BrO2.
Describe the ring structures in building block <BB_1748>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1748>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1748>.
**Token:** <BB_1748> **SMILES:** O=C1C(=O)c2ccc(Br)cc2-c2ccccc21 **Molecular Formula:** C14H7BrO2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1749>.
CC1(C#N)CCOc2ccccc21
What is the building block token for the following molecule?
CC1(C#N)CCOc2ccccc21
<BB_1749>
What is the molecular formula for <BB_1749>?
The molecular formula for <BB_1749> (CC1(C#N)CCOc2ccccc21) is C11H11NO.
Describe the ring structures in building block <BB_1749>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1749>.
The molecule contains the following groups: Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1749>.
**Token:** <BB_1749> **SMILES:** CC1(C#N)CCOc2ccccc21 **Molecular Formula:** C11H11NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ether, Nitrile