instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_1750>.
COCc1cc(C)[nH]n1
What is the building block token for the following molecule?
COCc1cc(C)[nH]n1
<BB_1750>
What is the molecular formula for <BB_1750>?
The molecular formula for <BB_1750> (COCc1cc(C)[nH]n1) is C6H10N2O.
Describe the ring structures in building block <BB_1750>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1750>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_1750>.
**Token:** <BB_1750> **SMILES:** COCc1cc(C)[nH]n1 **Molecular Formula:** C6H10N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_1751>.
O=S(=O)(Cl)c1cnc2c(Br)cccn12
What is the building block token for the following molecule?
O=S(=O)(Cl)c1cnc2c(Br)cccn12
<BB_1751>
What is the molecular formula for <BB_1751>?
The molecular formula for <BB_1751> (O=S(=O)(Cl)c1cnc2c(Br)cccn12) is C7H4BrClN2O2S.
Describe the ring structures in building block <BB_1751>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1751>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1751>.
**Token:** <BB_1751> **SMILES:** O=S(=O)(Cl)c1cnc2c(Br)cccn12 **Molecular Formula:** C7H4BrClN2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1752>.
N#CC(F)(F)c1ccccn1
What is the building block token for the following molecule?
N#CC(F)(F)c1ccccn1
<BB_1752>
What is the molecular formula for <BB_1752>?
The molecular formula for <BB_1752> (N#CC(F)(F)c1ccccn1) is C7H4F2N2.
Describe the ring structures in building block <BB_1752>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1752>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1752>.
**Token:** <BB_1752> **SMILES:** N#CC(F)(F)c1ccccn1 **Molecular Formula:** C7H4F2N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1753>.
Cc1ccc2c(c1)CNC2=O
What is the building block token for the following molecule?
Cc1ccc2c(c1)CNC2=O
<BB_1753>
What is the molecular formula for <BB_1753>?
The molecular formula for <BB_1753> (Cc1ccc2c(c1)CNC2=O) is C9H9NO.
Describe the ring structures in building block <BB_1753>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1753>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_1753>.
**Token:** <BB_1753> **SMILES:** Cc1ccc2c(c1)CNC2=O **Molecular Formula:** C9H9NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_1754>.
COCCOC(=O)c1c(N)sc(C(N)=O)c1C
What is the building block token for the following molecule?
COCCOC(=O)c1c(N)sc(C(N)=O)c1C
<BB_1754>
What is the molecular formula for <BB_1754>?
The molecular formula for <BB_1754> (COCCOC(=O)c1c(N)sc(C(N)=O)c1C) is C10H14N2O4S.
Describe the ring structures in building block <BB_1754>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1754>.
The molecule contains the following groups: Amine, Amide, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1754>.
**Token:** <BB_1754> **SMILES:** COCCOC(=O)c1c(N)sc(C(N)=O)c1C **Molecular Formula:** C10H14N2O4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Amide, Ester, Ether
Provide the SMILES representation for the building block token <BB_1755>.
COc1ccc(CC2CCCN2)cc1OC.Cl
What is the building block token for the following molecule?
COc1ccc(CC2CCCN2)cc1OC.Cl
<BB_1755>
What is the molecular formula for <BB_1755>?
The molecular formula for <BB_1755> (COc1ccc(CC2CCCN2)cc1OC.Cl) is C13H20ClNO2.
Describe the ring structures in building block <BB_1755>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1755>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1755>.
**Token:** <BB_1755> **SMILES:** COc1ccc(CC2CCCN2)cc1OC.Cl **Molecular Formula:** C13H20ClNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1756>.
COC(=O)c1ccc2c(CBr)csc2c1
What is the building block token for the following molecule?
COC(=O)c1ccc2c(CBr)csc2c1
<BB_1756>
What is the molecular formula for <BB_1756>?
The molecular formula for <BB_1756> (COC(=O)c1ccc2c(CBr)csc2c1) is C11H9BrO2S.
Describe the ring structures in building block <BB_1756>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1756>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1756>.
**Token:** <BB_1756> **SMILES:** COC(=O)c1ccc2c(CBr)csc2c1 **Molecular Formula:** C11H9BrO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1757>.
CC(C)(C)OC(=O)Nc1ccc(CC(N)=S)cc1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)Nc1ccc(CC(N)=S)cc1
<BB_1757>
What is the molecular formula for <BB_1757>?
The molecular formula for <BB_1757> (CC(C)(C)OC(=O)Nc1ccc(CC(N)=S)cc1) is C13H18N2O2S.
Describe the ring structures in building block <BB_1757>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1757>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1757>.
**Token:** <BB_1757> **SMILES:** CC(C)(C)OC(=O)Nc1ccc(CC(N)=S)cc1 **Molecular Formula:** C13H18N2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_1758>.
CCOC(=O)C(C)N(C)Cc1ccccc1
What is the building block token for the following molecule?
CCOC(=O)C(C)N(C)Cc1ccccc1
<BB_1758>
What is the molecular formula for <BB_1758>?
The molecular formula for <BB_1758> (CCOC(=O)C(C)N(C)Cc1ccccc1) is C13H19NO2.
Describe the ring structures in building block <BB_1758>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1758>.
The molecule contains the following groups: Tertiary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1758>.
**Token:** <BB_1758> **SMILES:** CCOC(=O)C(C)N(C)Cc1ccccc1 **Molecular Formula:** C13H19NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_1759>.
CC1CCC(C)(C)CN1.Cl
What is the building block token for the following molecule?
CC1CCC(C)(C)CN1.Cl
<BB_1759>
What is the molecular formula for <BB_1759>?
The molecular formula for <BB_1759> (CC1CCC(C)(C)CN1.Cl) is C8H18ClN.
Describe the ring structures in building block <BB_1759>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1759>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1759>.
**Token:** <BB_1759> **SMILES:** CC1CCC(C)(C)CN1.Cl **Molecular Formula:** C8H18ClN **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1760>.
O=C=NC1CC(=O)C1
What is the building block token for the following molecule?
O=C=NC1CC(=O)C1
<BB_1760>
What is the molecular formula for <BB_1760>?
The molecular formula for <BB_1760> (O=C=NC1CC(=O)C1) is C5H5NO2.
Describe the ring structures in building block <BB_1760>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1760>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_1760>.
**Token:** <BB_1760> **SMILES:** O=C=NC1CC(=O)C1 **Molecular Formula:** C5H5NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_1761>.
Cc1cc(C2CNCC2(C)C)[nH]n1.Cl
What is the building block token for the following molecule?
Cc1cc(C2CNCC2(C)C)[nH]n1.Cl
<BB_1761>
What is the molecular formula for <BB_1761>?
The molecular formula for <BB_1761> (Cc1cc(C2CNCC2(C)C)[nH]n1.Cl) is C10H18ClN3.
Describe the ring structures in building block <BB_1761>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1761>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1761>.
**Token:** <BB_1761> **SMILES:** Cc1cc(C2CNCC2(C)C)[nH]n1.Cl **Molecular Formula:** C10H18ClN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1762>.
Cn1cnc(CC(=O)[O-])n1.[Na+]
What is the building block token for the following molecule?
Cn1cnc(CC(=O)[O-])n1.[Na+]
<BB_1762>
What is the molecular formula for <BB_1762>?
The molecular formula for <BB_1762> (Cn1cnc(CC(=O)[O-])n1.[Na+]) is C5H6N3NaO2.
Describe the ring structures in building block <BB_1762>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1762>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1762>.
**Token:** <BB_1762> **SMILES:** Cn1cnc(CC(=O)[O-])n1.[Na+] **Molecular Formula:** C5H6N3NaO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1763>.
OCc1nc(-c2cccc(Cl)c2)no1
What is the building block token for the following molecule?
OCc1nc(-c2cccc(Cl)c2)no1
<BB_1763>
What is the molecular formula for <BB_1763>?
The molecular formula for <BB_1763> (OCc1nc(-c2cccc(Cl)c2)no1) is C9H7ClN2O2.
Describe the ring structures in building block <BB_1763>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1763>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1763>.
**Token:** <BB_1763> **SMILES:** OCc1nc(-c2cccc(Cl)c2)no1 **Molecular Formula:** C9H7ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1764>.
Cc1cc(C)n2nc(C(F)(F)F)nc2n1
What is the building block token for the following molecule?
Cc1cc(C)n2nc(C(F)(F)F)nc2n1
<BB_1764>
What is the molecular formula for <BB_1764>?
The molecular formula for <BB_1764> (Cc1cc(C)n2nc(C(F)(F)F)nc2n1) is C8H7F3N4.
Describe the ring structures in building block <BB_1764>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1764>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1764>.
**Token:** <BB_1764> **SMILES:** Cc1cc(C)n2nc(C(F)(F)F)nc2n1 **Molecular Formula:** C8H7F3N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1765>.
Cc1nc2nc(Br)sc2c(C)c1C
What is the building block token for the following molecule?
Cc1nc2nc(Br)sc2c(C)c1C
<BB_1765>
What is the molecular formula for <BB_1765>?
The molecular formula for <BB_1765> (Cc1nc2nc(Br)sc2c(C)c1C) is C9H9BrN2S.
Describe the ring structures in building block <BB_1765>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1765>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1765>.
**Token:** <BB_1765> **SMILES:** Cc1nc2nc(Br)sc2c(C)c1C **Molecular Formula:** C9H9BrN2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1766>.
NC(C(=O)O)c1ccc(C(F)(F)F)cc1
What is the building block token for the following molecule?
NC(C(=O)O)c1ccc(C(F)(F)F)cc1
<BB_1766>
What is the molecular formula for <BB_1766>?
The molecular formula for <BB_1766> (NC(C(=O)O)c1ccc(C(F)(F)F)cc1) is C9H8F3NO2.
Describe the ring structures in building block <BB_1766>.
The molecule contains 1 ring(s): an aromatic ring of size 6.