instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_1766>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1766>.
**Token:** <BB_1766> **SMILES:** NC(C(=O)O)c1ccc(C(F)(F)F)cc1 **Molecular Formula:** C9H8F3NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1767>.
O=C(Cc1ccc(F)cc1)NO
What is the building block token for the following molecule?
O=C(Cc1ccc(F)cc1)NO
<BB_1767>
What is the molecular formula for <BB_1767>?
The molecular formula for <BB_1767> (O=C(Cc1ccc(F)cc1)NO) is C8H8FNO2.
Describe the ring structures in building block <BB_1767>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1767>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1767>.
**Token:** <BB_1767> **SMILES:** O=C(Cc1ccc(F)cc1)NO **Molecular Formula:** C8H8FNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1768>.
O=[N+]([O-])c1cnc2ccc(C3CCC3)cc2c1Cl
What is the building block token for the following molecule?
O=[N+]([O-])c1cnc2ccc(C3CCC3)cc2c1Cl
<BB_1768>
What is the molecular formula for <BB_1768>?
The molecular formula for <BB_1768> (O=[N+]([O-])c1cnc2ccc(C3CCC3)cc2c1Cl) is C13H11ClN2O2.
Describe the ring structures in building block <BB_1768>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1768>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_1768>.
**Token:** <BB_1768> **SMILES:** O=[N+]([O-])c1cnc2ccc(C3CCC3)cc2c1Cl **Molecular Formula:** C13H11ClN2O2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_1769>.
CC(NC(=O)OC(C)(C)C)c1nc(C(=O)O)c(N)s1
What is the building block token for the following molecule?
CC(NC(=O)OC(C)(C)C)c1nc(C(=O)O)c(N)s1
<BB_1769>
What is the molecular formula for <BB_1769>?
The molecular formula for <BB_1769> (CC(NC(=O)OC(C)(C)C)c1nc(C(=O)O)c(N)s1) is C11H17N3O4S.
Describe the ring structures in building block <BB_1769>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1769>.
The molecule contains the following groups: Carboxylic Acid, Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1769>.
**Token:** <BB_1769> **SMILES:** CC(NC(=O)OC(C)(C)C)c1nc(C(=O)O)c(N)s1 **Molecular Formula:** C11H17N3O4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_1770>.
CC=CC(=O)C1COCCN1.O=C(O)C(F)(F)F
What is the building block token for the following molecule?
CC=CC(=O)C1COCCN1.O=C(O)C(F)(F)F
<BB_1770>
What is the molecular formula for <BB_1770>?
The molecular formula for <BB_1770> (CC=CC(=O)C1COCCN1.O=C(O)C(F)(F)F) is C10H14F3NO4.
Describe the ring structures in building block <BB_1770>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1770>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1770>.
**Token:** <BB_1770> **SMILES:** CC=CC(=O)C1COCCN1.O=C(O)C(F)(F)F **Molecular Formula:** C10H14F3NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1771>.
FC(F)(F)Sc1ncc(Br)cn1
What is the building block token for the following molecule?
FC(F)(F)Sc1ncc(Br)cn1
<BB_1771>
What is the molecular formula for <BB_1771>?
The molecular formula for <BB_1771> (FC(F)(F)Sc1ncc(Br)cn1) is C5H2BrF3N2S.
Describe the ring structures in building block <BB_1771>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1771>.
The molecule contains the following groups: Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1771>.
**Token:** <BB_1771> **SMILES:** FC(F)(F)Sc1ncc(Br)cn1 **Molecular Formula:** C5H2BrF3N2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1772>.
c1ccc2oc(-c3ncc[nH]3)cc2c1
What is the building block token for the following molecule?
c1ccc2oc(-c3ncc[nH]3)cc2c1
<BB_1772>
What is the molecular formula for <BB_1772>?
The molecular formula for <BB_1772> (c1ccc2oc(-c3ncc[nH]3)cc2c1) is C11H8N2O.
Describe the ring structures in building block <BB_1772>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_1772>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1772>.
**Token:** <BB_1772> **SMILES:** c1ccc2oc(-c3ncc[nH]3)cc2c1 **Molecular Formula:** C11H8N2O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1773>.
CC1(C)OB(CCC#N)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(CCC#N)OC1(C)C
<BB_1773>
What is the molecular formula for <BB_1773>?
The molecular formula for <BB_1773> (CC1(C)OB(CCC#N)OC1(C)C) is C9H16BNO2.
Describe the ring structures in building block <BB_1773>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1773>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1773>.
**Token:** <BB_1773> **SMILES:** CC1(C)OB(CCC#N)OC1(C)C **Molecular Formula:** C9H16BNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_1774>.
C#CCOC(C)C(=O)O
What is the building block token for the following molecule?
C#CCOC(C)C(=O)O
<BB_1774>
What is the molecular formula for <BB_1774>?
The molecular formula for <BB_1774> (C#CCOC(C)C(=O)O) is C6H8O3.
Describe the ring structures in building block <BB_1774>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1774>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_1774>.
**Token:** <BB_1774> **SMILES:** C#CCOC(C)C(=O)O **Molecular Formula:** C6H8O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_1775>.
Nc1c(F)cccc1[N+](=O)[O-]
What is the building block token for the following molecule?
Nc1c(F)cccc1[N+](=O)[O-]
<BB_1775>
What is the molecular formula for <BB_1775>?
The molecular formula for <BB_1775> (Nc1c(F)cccc1[N+](=O)[O-]) is C6H5FN2O2.
Describe the ring structures in building block <BB_1775>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1775>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_1775>.
**Token:** <BB_1775> **SMILES:** Nc1c(F)cccc1[N+](=O)[O-] **Molecular Formula:** C6H5FN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_1776>.
O=C1CC2(CC2)CN1
What is the building block token for the following molecule?
O=C1CC2(CC2)CN1
<BB_1776>
What is the molecular formula for <BB_1776>?
The molecular formula for <BB_1776> (O=C1CC2(CC2)CN1) is C6H9NO.
Describe the ring structures in building block <BB_1776>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1776>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_1776>.
**Token:** <BB_1776> **SMILES:** O=C1CC2(CC2)CN1 **Molecular Formula:** C6H9NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_1777>.
CCc1noc(-c2ccc(C)c(N)c2)n1
What is the building block token for the following molecule?
CCc1noc(-c2ccc(C)c(N)c2)n1
<BB_1777>
What is the molecular formula for <BB_1777>?
The molecular formula for <BB_1777> (CCc1noc(-c2ccc(C)c(N)c2)n1) is C11H13N3O.
Describe the ring structures in building block <BB_1777>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1777>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1777>.
**Token:** <BB_1777> **SMILES:** CCc1noc(-c2ccc(C)c(N)c2)n1 **Molecular Formula:** C11H13N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1778>.
Cc1ccc(NC2CCC2)cc1
What is the building block token for the following molecule?
Cc1ccc(NC2CCC2)cc1
<BB_1778>
What is the molecular formula for <BB_1778>?
The molecular formula for <BB_1778> (Cc1ccc(NC2CCC2)cc1) is C11H15N.
Describe the ring structures in building block <BB_1778>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1778>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_1778>.
**Token:** <BB_1778> **SMILES:** Cc1ccc(NC2CCC2)cc1 **Molecular Formula:** C11H15N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_1779>.
O=S(=O)(F)c1nccs1
What is the building block token for the following molecule?
O=S(=O)(F)c1nccs1
<BB_1779>
What is the molecular formula for <BB_1779>?
The molecular formula for <BB_1779> (O=S(=O)(F)c1nccs1) is C3H2FNO2S2.
Describe the ring structures in building block <BB_1779>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1779>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1779>.
**Token:** <BB_1779> **SMILES:** O=S(=O)(F)c1nccs1 **Molecular Formula:** C3H2FNO2S2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1780>.
Fc1cc(Cl)cc(F)c1CBr
What is the building block token for the following molecule?
Fc1cc(Cl)cc(F)c1CBr
<BB_1780>
What is the molecular formula for <BB_1780>?
The molecular formula for <BB_1780> (Fc1cc(Cl)cc(F)c1CBr) is C7H4BrClF2.
Describe the ring structures in building block <BB_1780>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1780>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1780>.
**Token:** <BB_1780> **SMILES:** Fc1cc(Cl)cc(F)c1CBr **Molecular Formula:** C7H4BrClF2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1781>.
O=C(Nc1ccccc1)Nc1cncnc1
What is the building block token for the following molecule?
O=C(Nc1ccccc1)Nc1cncnc1
<BB_1781>
What is the molecular formula for <BB_1781>?
The molecular formula for <BB_1781> (O=C(Nc1ccccc1)Nc1cncnc1) is C11H10N4O.
Describe the ring structures in building block <BB_1781>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1781>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_1781>.
**Token:** <BB_1781> **SMILES:** O=C(Nc1ccccc1)Nc1cncnc1 **Molecular Formula:** C11H10N4O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_1782>.
CC(=O)C(C)Oc1ccc2ccc(=O)oc2c1
What is the building block token for the following molecule?
CC(=O)C(C)Oc1ccc2ccc(=O)oc2c1
<BB_1782>
What is the molecular formula for <BB_1782>?
The molecular formula for <BB_1782> (CC(=O)C(C)Oc1ccc2ccc(=O)oc2c1) is C13H12O4.
Describe the ring structures in building block <BB_1782>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1782>.
The molecule contains the following groups: Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_1782>.
**Token:** <BB_1782> **SMILES:** CC(=O)C(C)Oc1ccc2ccc(=O)oc2c1 **Molecular Formula:** C13H12O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ketone, Ether
Provide the SMILES representation for the building block token <BB_1783>.
CC(C)(C)OC(=O)N(CC(=O)O)c1cscn1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N(CC(=O)O)c1cscn1
<BB_1783>