instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_1783>?
The molecular formula for <BB_1783> (CC(C)(C)OC(=O)N(CC(=O)O)c1cscn1) is C10H14N2O4S.
Describe the ring structures in building block <BB_1783>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1783>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1783>.
**Token:** <BB_1783> **SMILES:** CC(C)(C)OC(=O)N(CC(=O)O)c1cscn1 **Molecular Formula:** C10H14N2O4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_1784>.
FC(F)(F)C1CCC2(CCN2)CC1
What is the building block token for the following molecule?
FC(F)(F)C1CCC2(CCN2)CC1
<BB_1784>
What is the molecular formula for <BB_1784>?
The molecular formula for <BB_1784> (FC(F)(F)C1CCC2(CCN2)CC1) is C9H14F3N.
Describe the ring structures in building block <BB_1784>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1784>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1784>.
**Token:** <BB_1784> **SMILES:** FC(F)(F)C1CCC2(CCN2)CC1 **Molecular Formula:** C9H14F3N **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1785>.
CCN(CC)CCCNC(=O)C1CCNCC1
What is the building block token for the following molecule?
CCN(CC)CCCNC(=O)C1CCNCC1
<BB_1785>
What is the molecular formula for <BB_1785>?
The molecular formula for <BB_1785> (CCN(CC)CCCNC(=O)C1CCNCC1) is C13H27N3O.
Describe the ring structures in building block <BB_1785>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1785>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_1785>.
**Token:** <BB_1785> **SMILES:** CCN(CC)CCCNC(=O)C1CCNCC1 **Molecular Formula:** C13H27N3O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Amide
Provide the SMILES representation for the building block token <BB_1786>.
COc1c(N)cc(C(C)(C)C)cc1C(C)(C)C
What is the building block token for the following molecule?
COc1c(N)cc(C(C)(C)C)cc1C(C)(C)C
<BB_1786>
What is the molecular formula for <BB_1786>?
The molecular formula for <BB_1786> (COc1c(N)cc(C(C)(C)C)cc1C(C)(C)C) is C15H25NO.
Describe the ring structures in building block <BB_1786>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1786>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1786>.
**Token:** <BB_1786> **SMILES:** COc1c(N)cc(C(C)(C)C)cc1C(C)(C)C **Molecular Formula:** C15H25NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_1787>.
Cc1nn(-c2ccccc2)nc1C(=O)O
What is the building block token for the following molecule?
Cc1nn(-c2ccccc2)nc1C(=O)O
<BB_1787>
What is the molecular formula for <BB_1787>?
The molecular formula for <BB_1787> (Cc1nn(-c2ccccc2)nc1C(=O)O) is C10H9N3O2.
Describe the ring structures in building block <BB_1787>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1787>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1787>.
**Token:** <BB_1787> **SMILES:** Cc1nn(-c2ccccc2)nc1C(=O)O **Molecular Formula:** C10H9N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1788>.
Cl.NCc1cccc(CCC(=O)O)c1
What is the building block token for the following molecule?
Cl.NCc1cccc(CCC(=O)O)c1
<BB_1788>
What is the molecular formula for <BB_1788>?
The molecular formula for <BB_1788> (Cl.NCc1cccc(CCC(=O)O)c1) is C10H14ClNO2.
Describe the ring structures in building block <BB_1788>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1788>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1788>.
**Token:** <BB_1788> **SMILES:** Cl.NCc1cccc(CCC(=O)O)c1 **Molecular Formula:** C10H14ClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1789>.
CCC(C)(C(N)=O)C(=O)O
What is the building block token for the following molecule?
CCC(C)(C(N)=O)C(=O)O
<BB_1789>
What is the molecular formula for <BB_1789>?
The molecular formula for <BB_1789> (CCC(C)(C(N)=O)C(=O)O) is C6H11NO3.
Describe the ring structures in building block <BB_1789>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1789>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_1789>.
**Token:** <BB_1789> **SMILES:** CCC(C)(C(N)=O)C(=O)O **Molecular Formula:** C6H11NO3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_1790>.
Cc1ccc(Cl)cc1
What is the building block token for the following molecule?
Cc1ccc(Cl)cc1
<BB_1790>
What is the molecular formula for <BB_1790>?
The molecular formula for <BB_1790> (Cc1ccc(Cl)cc1) is C7H7Cl.
Describe the ring structures in building block <BB_1790>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1790>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1790>.
**Token:** <BB_1790> **SMILES:** Cc1ccc(Cl)cc1 **Molecular Formula:** C7H7Cl **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1791>.
O=c1cc2c(c[nH]1)CCCC2
What is the building block token for the following molecule?
O=c1cc2c(c[nH]1)CCCC2
<BB_1791>
What is the molecular formula for <BB_1791>?
The molecular formula for <BB_1791> (O=c1cc2c(c[nH]1)CCCC2) is C9H11NO.
Describe the ring structures in building block <BB_1791>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1791>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1791>.
**Token:** <BB_1791> **SMILES:** O=c1cc2c(c[nH]1)CCCC2 **Molecular Formula:** C9H11NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1792>.
Cc1ncc(CN)o1
What is the building block token for the following molecule?
Cc1ncc(CN)o1
<BB_1792>
What is the molecular formula for <BB_1792>?
The molecular formula for <BB_1792> (Cc1ncc(CN)o1) is C5H8N2O.
Describe the ring structures in building block <BB_1792>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1792>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1792>.
**Token:** <BB_1792> **SMILES:** Cc1ncc(CN)o1 **Molecular Formula:** C5H8N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1793>.
C[Si](C)(C)c1ccccc1O
What is the building block token for the following molecule?
C[Si](C)(C)c1ccccc1O
<BB_1793>
What is the molecular formula for <BB_1793>?
The molecular formula for <BB_1793> (C[Si](C)(C)c1ccccc1O) is C9H14OSi.
Describe the ring structures in building block <BB_1793>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1793>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1793>.
**Token:** <BB_1793> **SMILES:** C[Si](C)(C)c1ccccc1O **Molecular Formula:** C9H14OSi **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1794>.
Cl.Cl.Cn1ccnc1C(N)C1CC1
What is the building block token for the following molecule?
Cl.Cl.Cn1ccnc1C(N)C1CC1
<BB_1794>
What is the molecular formula for <BB_1794>?
The molecular formula for <BB_1794> (Cl.Cl.Cn1ccnc1C(N)C1CC1) is C8H15Cl2N3.
Describe the ring structures in building block <BB_1794>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1794>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1794>.
**Token:** <BB_1794> **SMILES:** Cl.Cl.Cn1ccnc1C(N)C1CC1 **Molecular Formula:** C8H15Cl2N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1795>.
C[C@@H](N=C=O)c1ccc(Br)cc1
What is the building block token for the following molecule?
C[C@@H](N=C=O)c1ccc(Br)cc1
<BB_1795>
What is the molecular formula for <BB_1795>?
The molecular formula for <BB_1795> (C[C@@H](N=C=O)c1ccc(Br)cc1) is C9H8BrNO.
Describe the ring structures in building block <BB_1795>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1795>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1795>.
**Token:** <BB_1795> **SMILES:** C[C@@H](N=C=O)c1ccc(Br)cc1 **Molecular Formula:** C9H8BrNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1796>.
N#Cc1cnc2c(F)cc(Cl)cc2c1Cl
What is the building block token for the following molecule?
N#Cc1cnc2c(F)cc(Cl)cc2c1Cl
<BB_1796>
What is the molecular formula for <BB_1796>?
The molecular formula for <BB_1796> (N#Cc1cnc2c(F)cc(Cl)cc2c1Cl) is C10H3Cl2FN2.
Describe the ring structures in building block <BB_1796>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1796>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1796>.
**Token:** <BB_1796> **SMILES:** N#Cc1cnc2c(F)cc(Cl)cc2c1Cl **Molecular Formula:** C10H3Cl2FN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1797>.
Cc1ccc(Cl)c(C(=O)O)c1C(F)F
What is the building block token for the following molecule?
Cc1ccc(Cl)c(C(=O)O)c1C(F)F
<BB_1797>
What is the molecular formula for <BB_1797>?
The molecular formula for <BB_1797> (Cc1ccc(Cl)c(C(=O)O)c1C(F)F) is C9H7ClF2O2.
Describe the ring structures in building block <BB_1797>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1797>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1797>.
**Token:** <BB_1797> **SMILES:** Cc1ccc(Cl)c(C(=O)O)c1C(F)F **Molecular Formula:** C9H7ClF2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1798>.
CC(C)(C#N)/N=N/C(C)(C)C#N
What is the building block token for the following molecule?
CC(C)(C#N)/N=N/C(C)(C)C#N
<BB_1798>
What is the molecular formula for <BB_1798>?
The molecular formula for <BB_1798> (CC(C)(C#N)/N=N/C(C)(C)C#N) is C8H12N4.
Describe the ring structures in building block <BB_1798>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1798>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1798>.
**Token:** <BB_1798> **SMILES:** CC(C)(C#N)/N=N/C(C)(C)C#N **Molecular Formula:** C8H12N4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_1799>.
COC(=O)c1cc(C(=O)O)cc(C(=O)O)c1
What is the building block token for the following molecule?
COC(=O)c1cc(C(=O)O)cc(C(=O)O)c1
<BB_1799>
What is the molecular formula for <BB_1799>?
The molecular formula for <BB_1799> (COC(=O)c1cc(C(=O)O)cc(C(=O)O)c1) is C10H8O6.
Describe the ring structures in building block <BB_1799>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1799>.
The molecule contains the following groups: Carboxylic Acid, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1799>.
**Token:** <BB_1799> **SMILES:** COC(=O)c1cc(C(=O)O)cc(C(=O)O)c1 **Molecular Formula:** C10H8O6 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ester, Ether