instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_1800>.
COC(=O)C(O)C1CCCC1
What is the building block token for the following molecule?
COC(=O)C(O)C1CCCC1
<BB_1800>
What is the molecular formula for <BB_1800>?
The molecular formula for <BB_1800> (COC(=O)C(O)C1CCCC1) is C8H14O3.
Describe the ring structures in building block <BB_1800>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1800>.
The molecule contains the following groups: Ester, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1800>.
**Token:** <BB_1800> **SMILES:** COC(=O)C(O)C1CCCC1 **Molecular Formula:** C8H14O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Ester, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1801>.
COC(=O)c1cc(CCCN)on1.Cl
What is the building block token for the following molecule?
COC(=O)c1cc(CCCN)on1.Cl
<BB_1801>
What is the molecular formula for <BB_1801>?
The molecular formula for <BB_1801> (COC(=O)c1cc(CCCN)on1.Cl) is C8H13ClN2O3.
Describe the ring structures in building block <BB_1801>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1801>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1801>.
**Token:** <BB_1801> **SMILES:** COC(=O)c1cc(CCCN)on1.Cl **Molecular Formula:** C8H13ClN2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1802>.
Cc1nc(-n2cccc2)sc1C(=O)O
What is the building block token for the following molecule?
Cc1nc(-n2cccc2)sc1C(=O)O
<BB_1802>
What is the molecular formula for <BB_1802>?
The molecular formula for <BB_1802> (Cc1nc(-n2cccc2)sc1C(=O)O) is C9H8N2O2S.
Describe the ring structures in building block <BB_1802>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_1802>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1802>.
**Token:** <BB_1802> **SMILES:** Cc1nc(-n2cccc2)sc1C(=O)O **Molecular Formula:** C9H8N2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1803>.
O=[N+]([O-])c1cc[nH]c1Cl
What is the building block token for the following molecule?
O=[N+]([O-])c1cc[nH]c1Cl
<BB_1803>
What is the molecular formula for <BB_1803>?
The molecular formula for <BB_1803> (O=[N+]([O-])c1cc[nH]c1Cl) is C4H3ClN2O2.
Describe the ring structures in building block <BB_1803>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1803>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_1803>.
**Token:** <BB_1803> **SMILES:** O=[N+]([O-])c1cc[nH]c1Cl **Molecular Formula:** C4H3ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_1804>.
O=C(O)c1ccc(OC(F)F)c(Br)c1
What is the building block token for the following molecule?
O=C(O)c1ccc(OC(F)F)c(Br)c1
<BB_1804>
What is the molecular formula for <BB_1804>?
The molecular formula for <BB_1804> (O=C(O)c1ccc(OC(F)F)c(Br)c1) is C8H5BrF2O3.
Describe the ring structures in building block <BB_1804>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1804>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1804>.
**Token:** <BB_1804> **SMILES:** O=C(O)c1ccc(OC(F)F)c(Br)c1 **Molecular Formula:** C8H5BrF2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1805>.
Cn1c(N)c(C(=O)CC#N)c(=O)n(C)c1=O
What is the building block token for the following molecule?
Cn1c(N)c(C(=O)CC#N)c(=O)n(C)c1=O
<BB_1805>
What is the molecular formula for <BB_1805>?
The molecular formula for <BB_1805> (Cn1c(N)c(C(=O)CC#N)c(=O)n(C)c1=O) is C9H10N4O3.
Describe the ring structures in building block <BB_1805>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1805>.
The molecule contains the following groups: Amine, Ketone, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1805>.
**Token:** <BB_1805> **SMILES:** Cn1c(N)c(C(=O)CC#N)c(=O)n(C)c1=O **Molecular Formula:** C9H10N4O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ketone, Nitrile
Provide the SMILES representation for the building block token <BB_1806>.
Cl.Cl.N[C@H](Cc1cn[nH]n1)C(=O)O
What is the building block token for the following molecule?
Cl.Cl.N[C@H](Cc1cn[nH]n1)C(=O)O
<BB_1806>
What is the molecular formula for <BB_1806>?
The molecular formula for <BB_1806> (Cl.Cl.N[C@H](Cc1cn[nH]n1)C(=O)O) is C5H10Cl2N4O2.
Describe the ring structures in building block <BB_1806>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1806>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1806>.
**Token:** <BB_1806> **SMILES:** Cl.Cl.N[C@H](Cc1cn[nH]n1)C(=O)O **Molecular Formula:** C5H10Cl2N4O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1807>.
Cc1ccc(-c2nc(CCl)co2)cc1
What is the building block token for the following molecule?
Cc1ccc(-c2nc(CCl)co2)cc1
<BB_1807>
What is the molecular formula for <BB_1807>?
The molecular formula for <BB_1807> (Cc1ccc(-c2nc(CCl)co2)cc1) is C11H10ClNO.
Describe the ring structures in building block <BB_1807>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1807>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1807>.
**Token:** <BB_1807> **SMILES:** Cc1ccc(-c2nc(CCl)co2)cc1 **Molecular Formula:** C11H10ClNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1808>.
Cc1nsc(N(C)CC(N)=O)c1C#N
What is the building block token for the following molecule?
Cc1nsc(N(C)CC(N)=O)c1C#N
<BB_1808>
What is the molecular formula for <BB_1808>?
The molecular formula for <BB_1808> (Cc1nsc(N(C)CC(N)=O)c1C#N) is C8H10N4OS.
Describe the ring structures in building block <BB_1808>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1808>.
The molecule contains the following groups: Tertiary Amine, Amide, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1808>.
**Token:** <BB_1808> **SMILES:** Cc1nsc(N(C)CC(N)=O)c1C#N **Molecular Formula:** C8H10N4OS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Tertiary Amine, Amide, Nitrile
Provide the SMILES representation for the building block token <BB_1809>.
CSc1ccc(N)cn1
What is the building block token for the following molecule?
CSc1ccc(N)cn1
<BB_1809>
What is the molecular formula for <BB_1809>?
The molecular formula for <BB_1809> (CSc1ccc(N)cn1) is C6H8N2S.
Describe the ring structures in building block <BB_1809>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1809>.
The molecule contains the following groups: Amine, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_1809>.
**Token:** <BB_1809> **SMILES:** CSc1ccc(N)cn1 **Molecular Formula:** C6H8N2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Sulfide
Provide the SMILES representation for the building block token <BB_1810>.
CNC(c1ccccc1)c1ccc(F)cc1
What is the building block token for the following molecule?
CNC(c1ccccc1)c1ccc(F)cc1
<BB_1810>
What is the molecular formula for <BB_1810>?
The molecular formula for <BB_1810> (CNC(c1ccccc1)c1ccc(F)cc1) is C14H14FN.
Describe the ring structures in building block <BB_1810>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1810>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1810>.
**Token:** <BB_1810> **SMILES:** CNC(c1ccccc1)c1ccc(F)cc1 **Molecular Formula:** C14H14FN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1811>.
FC(F)c1ccc(Br)cc1OC(F)(F)F
What is the building block token for the following molecule?
FC(F)c1ccc(Br)cc1OC(F)(F)F
<BB_1811>
What is the molecular formula for <BB_1811>?
The molecular formula for <BB_1811> (FC(F)c1ccc(Br)cc1OC(F)(F)F) is C8H4BrF5O.
Describe the ring structures in building block <BB_1811>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1811>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1811>.
**Token:** <BB_1811> **SMILES:** FC(F)c1ccc(Br)cc1OC(F)(F)F **Molecular Formula:** C8H4BrF5O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1812>.
CC(C)CCOc1ccc(C(=O)O)cc1
What is the building block token for the following molecule?
CC(C)CCOc1ccc(C(=O)O)cc1
<BB_1812>
What is the molecular formula for <BB_1812>?
The molecular formula for <BB_1812> (CC(C)CCOc1ccc(C(=O)O)cc1) is C12H16O3.
Describe the ring structures in building block <BB_1812>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1812>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_1812>.
**Token:** <BB_1812> **SMILES:** CC(C)CCOc1ccc(C(=O)O)cc1 **Molecular Formula:** C12H16O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_1813>.
CCc1nc2ccccn2c1C(=O)O
What is the building block token for the following molecule?
CCc1nc2ccccn2c1C(=O)O
<BB_1813>
What is the molecular formula for <BB_1813>?
The molecular formula for <BB_1813> (CCc1nc2ccccn2c1C(=O)O) is C10H10N2O2.
Describe the ring structures in building block <BB_1813>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1813>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1813>.
**Token:** <BB_1813> **SMILES:** CCc1nc2ccccn2c1C(=O)O **Molecular Formula:** C10H10N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1814>.
O=C1CC(c2cccs2)CC(=O)O1
What is the building block token for the following molecule?
O=C1CC(c2cccs2)CC(=O)O1
<BB_1814>
What is the molecular formula for <BB_1814>?
The molecular formula for <BB_1814> (O=C1CC(c2cccs2)CC(=O)O1) is C9H8O3S.
Describe the ring structures in building block <BB_1814>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1814>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1814>.
**Token:** <BB_1814> **SMILES:** O=C1CC(c2cccs2)CC(=O)O1 **Molecular Formula:** C9H8O3S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_1815>.
COC(=O)CC1(CC(=O)OC)CC1(F)Cl
What is the building block token for the following molecule?
COC(=O)CC1(CC(=O)OC)CC1(F)Cl
<BB_1815>
What is the molecular formula for <BB_1815>?
The molecular formula for <BB_1815> (COC(=O)CC1(CC(=O)OC)CC1(F)Cl) is C9H12ClFO4.
Describe the ring structures in building block <BB_1815>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_1815>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1815>.
**Token:** <BB_1815> **SMILES:** COC(=O)CC1(CC(=O)OC)CC1(F)Cl **Molecular Formula:** C9H12ClFO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1816>.
Cl.O=C(O)[C@H]1COCCCN1
What is the building block token for the following molecule?
Cl.O=C(O)[C@H]1COCCCN1
<BB_1816>
What is the molecular formula for <BB_1816>?
The molecular formula for <BB_1816> (Cl.O=C(O)[C@H]1COCCCN1) is C6H12ClNO3.
Describe the ring structures in building block <BB_1816>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.