instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_1816>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1816>.
**Token:** <BB_1816> **SMILES:** Cl.O=C(O)[C@H]1COCCCN1 **Molecular Formula:** C6H12ClNO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Carboxylic Acid, Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1817>.
Cn1cc(C=O)c2ccnc(Cl)c21
What is the building block token for the following molecule?
Cn1cc(C=O)c2ccnc(Cl)c21
<BB_1817>
What is the molecular formula for <BB_1817>?
The molecular formula for <BB_1817> (Cn1cc(C=O)c2ccnc(Cl)c21) is C9H7ClN2O.
Describe the ring structures in building block <BB_1817>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1817>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1817>.
**Token:** <BB_1817> **SMILES:** Cn1cc(C=O)c2ccnc(Cl)c21 **Molecular Formula:** C9H7ClN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1818>.
CN[C@H]1CC[C@@H](O)CC1.Cl
What is the building block token for the following molecule?
CN[C@H]1CC[C@@H](O)CC1.Cl
<BB_1818>
What is the molecular formula for <BB_1818>?
The molecular formula for <BB_1818> (CN[C@H]1CC[C@@H](O)CC1.Cl) is C7H16ClNO.
Describe the ring structures in building block <BB_1818>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1818>.
The molecule contains the following groups: Secondary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1818>.
**Token:** <BB_1818> **SMILES:** CN[C@H]1CC[C@@H](O)CC1.Cl **Molecular Formula:** C7H16ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1819>.
CC(C)C1(O)COC1
What is the building block token for the following molecule?
CC(C)C1(O)COC1
<BB_1819>
What is the molecular formula for <BB_1819>?
The molecular formula for <BB_1819> (CC(C)C1(O)COC1) is C6H12O2.
Describe the ring structures in building block <BB_1819>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1819>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1819>.
**Token:** <BB_1819> **SMILES:** CC(C)C1(O)COC1 **Molecular Formula:** C6H12O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1820>.
Cl.Cl.NCCNC(=O)c1cnccn1
What is the building block token for the following molecule?
Cl.Cl.NCCNC(=O)c1cnccn1
<BB_1820>
What is the molecular formula for <BB_1820>?
The molecular formula for <BB_1820> (Cl.Cl.NCCNC(=O)c1cnccn1) is C7H12Cl2N4O.
Describe the ring structures in building block <BB_1820>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1820>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1820>.
**Token:** <BB_1820> **SMILES:** Cl.Cl.NCCNC(=O)c1cnccn1 **Molecular Formula:** C7H12Cl2N4O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1821>.
Cc1cccc2c(C=O)n[nH]c12
What is the building block token for the following molecule?
Cc1cccc2c(C=O)n[nH]c12
<BB_1821>
What is the molecular formula for <BB_1821>?
The molecular formula for <BB_1821> (Cc1cccc2c(C=O)n[nH]c12) is C9H8N2O.
Describe the ring structures in building block <BB_1821>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1821>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_1821>.
**Token:** <BB_1821> **SMILES:** Cc1cccc2c(C=O)n[nH]c12 **Molecular Formula:** C9H8N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_1822>.
Cl.Cl.Cn1cncc1[C@@H]1C[C@H]1N
What is the building block token for the following molecule?
Cl.Cl.Cn1cncc1[C@@H]1C[C@H]1N
<BB_1822>
What is the molecular formula for <BB_1822>?
The molecular formula for <BB_1822> (Cl.Cl.Cn1cncc1[C@@H]1C[C@H]1N) is C7H13Cl2N3.
Describe the ring structures in building block <BB_1822>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1822>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1822>.
**Token:** <BB_1822> **SMILES:** Cl.Cl.Cn1cncc1[C@@H]1C[C@H]1N **Molecular Formula:** C7H13Cl2N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1823>.
COc1cccc(I)c1C=O
What is the building block token for the following molecule?
COc1cccc(I)c1C=O
<BB_1823>
What is the molecular formula for <BB_1823>?
The molecular formula for <BB_1823> (COc1cccc(I)c1C=O) is C8H7IO2.
Describe the ring structures in building block <BB_1823>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1823>.
The molecule contains the following groups: Aldehyde, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1823>.
**Token:** <BB_1823> **SMILES:** COc1cccc(I)c1C=O **Molecular Formula:** C8H7IO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1824>.
CC1(C)CCC(=O)NC1
What is the building block token for the following molecule?
CC1(C)CCC(=O)NC1
<BB_1824>
What is the molecular formula for <BB_1824>?
The molecular formula for <BB_1824> (CC1(C)CCC(=O)NC1) is C7H13NO.
Describe the ring structures in building block <BB_1824>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1824>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_1824>.
**Token:** <BB_1824> **SMILES:** CC1(C)CCC(=O)NC1 **Molecular Formula:** C7H13NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_1825>.
O=Cc1cccc(-n2cccn2)c1O
What is the building block token for the following molecule?
O=Cc1cccc(-n2cccn2)c1O
<BB_1825>
What is the molecular formula for <BB_1825>?
The molecular formula for <BB_1825> (O=Cc1cccc(-n2cccn2)c1O) is C10H8N2O2.
Describe the ring structures in building block <BB_1825>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1825>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_1825>.
**Token:** <BB_1825> **SMILES:** O=Cc1cccc(-n2cccn2)c1O **Molecular Formula:** C10H8N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_1826>.
CC(C#N)c1cccs1
What is the building block token for the following molecule?
CC(C#N)c1cccs1
<BB_1826>
What is the molecular formula for <BB_1826>?
The molecular formula for <BB_1826> (CC(C#N)c1cccs1) is C7H7NS.
Describe the ring structures in building block <BB_1826>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1826>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1826>.
**Token:** <BB_1826> **SMILES:** CC(C#N)c1cccs1 **Molecular Formula:** C7H7NS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_1827>.
O=C(O)[C@]1(c2ccc(Cl)cc2)C[C@H](O)C1
What is the building block token for the following molecule?
O=C(O)[C@]1(c2ccc(Cl)cc2)C[C@H](O)C1
<BB_1827>
What is the molecular formula for <BB_1827>?
The molecular formula for <BB_1827> (O=C(O)[C@]1(c2ccc(Cl)cc2)C[C@H](O)C1) is C11H11ClO3.
Describe the ring structures in building block <BB_1827>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1827>.
The molecule contains the following groups: Carboxylic Acid, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1827>.
**Token:** <BB_1827> **SMILES:** O=C(O)[C@]1(c2ccc(Cl)cc2)C[C@H](O)C1 **Molecular Formula:** C11H11ClO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1828>.
C[C@@H]1C[C@]1(N)c1ccc(C(C)(C)C)cc1.Cl
What is the building block token for the following molecule?
C[C@@H]1C[C@]1(N)c1ccc(C(C)(C)C)cc1.Cl
<BB_1828>
What is the molecular formula for <BB_1828>?
The molecular formula for <BB_1828> (C[C@@H]1C[C@]1(N)c1ccc(C(C)(C)C)cc1.Cl) is C14H22ClN.
Describe the ring structures in building block <BB_1828>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6.
List the primary functional groups present in <BB_1828>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1828>.
**Token:** <BB_1828> **SMILES:** C[C@@H]1C[C@]1(N)c1ccc(C(C)(C)C)cc1.Cl **Molecular Formula:** C14H22ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1829>.
Cc1cc(CN)sn1
What is the building block token for the following molecule?
Cc1cc(CN)sn1
<BB_1829>
What is the molecular formula for <BB_1829>?
The molecular formula for <BB_1829> (Cc1cc(CN)sn1) is C5H8N2S.
Describe the ring structures in building block <BB_1829>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1829>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1829>.
**Token:** <BB_1829> **SMILES:** Cc1cc(CN)sn1 **Molecular Formula:** C5H8N2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1830>.
CC(C)(C)OC(=O)N1CCC(CCC=O)CC1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC(CCC=O)CC1
<BB_1830>
What is the molecular formula for <BB_1830>?
The molecular formula for <BB_1830> (CC(C)(C)OC(=O)N1CCC(CCC=O)CC1) is C13H23NO3.
Describe the ring structures in building block <BB_1830>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1830>.
The molecule contains the following groups: Amide, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_1830>.
**Token:** <BB_1830> **SMILES:** CC(C)(C)OC(=O)N1CCC(CCC=O)CC1 **Molecular Formula:** C13H23NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_1831>.
Cl.N=C(N)c1ccncc1
What is the building block token for the following molecule?
Cl.N=C(N)c1ccncc1
<BB_1831>
What is the molecular formula for <BB_1831>?
The molecular formula for <BB_1831> (Cl.N=C(N)c1ccncc1) is C6H8ClN3.
Describe the ring structures in building block <BB_1831>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1831>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1831>.
**Token:** <BB_1831> **SMILES:** Cl.N=C(N)c1ccncc1 **Molecular Formula:** C6H8ClN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1832>.
COC(=O)C1(N=[N+]=[N-])CN(C(=O)OC(C)(C)C)C1
What is the building block token for the following molecule?
COC(=O)C1(N=[N+]=[N-])CN(C(=O)OC(C)(C)C)C1
<BB_1832>
What is the molecular formula for <BB_1832>?
The molecular formula for <BB_1832> (COC(=O)C1(N=[N+]=[N-])CN(C(=O)OC(C)(C)C)C1) is C10H16N4O4.
Describe the ring structures in building block <BB_1832>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1832>.
The molecule contains the following groups: Amide, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1832>.
**Token:** <BB_1832> **SMILES:** COC(=O)C1(N=[N+]=[N-])CN(C(=O)OC(C)(C)C)C1 **Molecular Formula:** C10H16N4O4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amide, Ester, Ether
Provide the SMILES representation for the building block token <BB_1833>.
O=[N+]([O-])c1ccc(O)cc1Cl
What is the building block token for the following molecule?
O=[N+]([O-])c1ccc(O)cc1Cl
<BB_1833>