instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_1833>?
The molecular formula for <BB_1833> (O=[N+]([O-])c1ccc(O)cc1Cl) is C6H4ClNO3.
Describe the ring structures in building block <BB_1833>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1833>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_1833>.
**Token:** <BB_1833> **SMILES:** O=[N+]([O-])c1ccc(O)cc1Cl **Molecular Formula:** C6H4ClNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_1834>.
O=S1(=O)CC2CCN1C2
What is the building block token for the following molecule?
O=S1(=O)CC2CCN1C2
<BB_1834>
What is the molecular formula for <BB_1834>?
The molecular formula for <BB_1834> (O=S1(=O)CC2CCN1C2) is C5H9NO2S.
Describe the ring structures in building block <BB_1834>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1834>.
The molecule contains the following groups: Tertiary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1834>.
**Token:** <BB_1834> **SMILES:** O=S1(=O)CC2CCN1C2 **Molecular Formula:** C5H9NO2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Tertiary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_1835>.
CNC(=O)C1(C)CCN(Cc2ccccc2)C1
What is the building block token for the following molecule?
CNC(=O)C1(C)CCN(Cc2ccccc2)C1
<BB_1835>
What is the molecular formula for <BB_1835>?
The molecular formula for <BB_1835> (CNC(=O)C1(C)CCN(Cc2ccccc2)C1) is C14H20N2O.
Describe the ring structures in building block <BB_1835>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1835>.
The molecule contains the following groups: Tertiary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_1835>.
**Token:** <BB_1835> **SMILES:** CNC(=O)C1(C)CCN(Cc2ccccc2)C1 **Molecular Formula:** C14H20N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide
Provide the SMILES representation for the building block token <BB_1836>.
CSCCON
What is the building block token for the following molecule?
CSCCON
<BB_1836>
What is the molecular formula for <BB_1836>?
The molecular formula for <BB_1836> (CSCCON) is C3H9NOS.
Describe the ring structures in building block <BB_1836>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1836>.
The molecule contains the following groups: Amine, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_1836>.
**Token:** <BB_1836> **SMILES:** CSCCON **Molecular Formula:** C3H9NOS **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Sulfide
Provide the SMILES representation for the building block token <BB_1837>.
N#Cc1ccccc1S
What is the building block token for the following molecule?
N#Cc1ccccc1S
<BB_1837>
What is the molecular formula for <BB_1837>?
The molecular formula for <BB_1837> (N#Cc1ccccc1S) is C7H5NS.
Describe the ring structures in building block <BB_1837>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1837>.
The molecule contains the following groups: Thiol, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1837>.
**Token:** <BB_1837> **SMILES:** N#Cc1ccccc1S **Molecular Formula:** C7H5NS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Thiol, Nitrile
Provide the SMILES representation for the building block token <BB_1838>.
Cl.O=S(=O)(C1CC1)N1CCNCC1
What is the building block token for the following molecule?
Cl.O=S(=O)(C1CC1)N1CCNCC1
<BB_1838>
What is the molecular formula for <BB_1838>?
The molecular formula for <BB_1838> (Cl.O=S(=O)(C1CC1)N1CCNCC1) is C7H15ClN2O2S.
Describe the ring structures in building block <BB_1838>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1838>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1838>.
**Token:** <BB_1838> **SMILES:** Cl.O=S(=O)(C1CC1)N1CCNCC1 **Molecular Formula:** C7H15ClN2O2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_1839>.
O=C(O)C12CC(c3ccc(O)cc3)(C1)C2
What is the building block token for the following molecule?
O=C(O)C12CC(c3ccc(O)cc3)(C1)C2
<BB_1839>
What is the molecular formula for <BB_1839>?
The molecular formula for <BB_1839> (O=C(O)C12CC(c3ccc(O)cc3)(C1)C2) is C12H12O3.
Describe the ring structures in building block <BB_1839>.
The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1839>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1839>.
**Token:** <BB_1839> **SMILES:** O=C(O)C12CC(c3ccc(O)cc3)(C1)C2 **Molecular Formula:** C12H12O3 **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1840>.
O=c1[nH]cnc2c(Cl)cc(Cl)cc12
What is the building block token for the following molecule?
O=c1[nH]cnc2c(Cl)cc(Cl)cc12
<BB_1840>
What is the molecular formula for <BB_1840>?
The molecular formula for <BB_1840> (O=c1[nH]cnc2c(Cl)cc(Cl)cc12) is C8H4Cl2N2O.
Describe the ring structures in building block <BB_1840>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1840>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1840>.
**Token:** <BB_1840> **SMILES:** O=c1[nH]cnc2c(Cl)cc(Cl)cc12 **Molecular Formula:** C8H4Cl2N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1841>.
NCC1CC=CCC1
What is the building block token for the following molecule?
NCC1CC=CCC1
<BB_1841>
What is the molecular formula for <BB_1841>?
The molecular formula for <BB_1841> (NCC1CC=CCC1) is C7H13N.
Describe the ring structures in building block <BB_1841>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1841>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1841>.
**Token:** <BB_1841> **SMILES:** NCC1CC=CCC1 **Molecular Formula:** C7H13N **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1842>.
CN1C(=O)NC(=O)C1=O
What is the building block token for the following molecule?
CN1C(=O)NC(=O)C1=O
<BB_1842>
What is the molecular formula for <BB_1842>?
The molecular formula for <BB_1842> (CN1C(=O)NC(=O)C1=O) is C4H4N2O3.
Describe the ring structures in building block <BB_1842>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1842>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_1842>.
**Token:** <BB_1842> **SMILES:** CN1C(=O)NC(=O)C1=O **Molecular Formula:** C4H4N2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_1843>.
CCOC(=O)C(=O)C1CCOCC1
What is the building block token for the following molecule?
CCOC(=O)C(=O)C1CCOCC1
<BB_1843>
What is the molecular formula for <BB_1843>?
The molecular formula for <BB_1843> (CCOC(=O)C(=O)C1CCOCC1) is C9H14O4.
Describe the ring structures in building block <BB_1843>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1843>.
The molecule contains the following groups: Ester, Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_1843>.
**Token:** <BB_1843> **SMILES:** CCOC(=O)C(=O)C1CCOCC1 **Molecular Formula:** C9H14O4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Ester, Ketone, Ether
Provide the SMILES representation for the building block token <BB_1844>.
N#Cc1ccccc1COc1ccc(C=O)cc1
What is the building block token for the following molecule?
N#Cc1ccccc1COc1ccc(C=O)cc1
<BB_1844>
What is the molecular formula for <BB_1844>?
The molecular formula for <BB_1844> (N#Cc1ccccc1COc1ccc(C=O)cc1) is C15H11NO2.
Describe the ring structures in building block <BB_1844>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1844>.
The molecule contains the following groups: Aldehyde, Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1844>.
**Token:** <BB_1844> **SMILES:** N#Cc1ccccc1COc1ccc(C=O)cc1 **Molecular Formula:** C15H11NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Aldehyde, Ether, Nitrile
Provide the SMILES representation for the building block token <BB_1845>.
Clc1c(Br)cccc1OCC1CC1
What is the building block token for the following molecule?
Clc1c(Br)cccc1OCC1CC1
<BB_1845>
What is the molecular formula for <BB_1845>?
The molecular formula for <BB_1845> (Clc1c(Br)cccc1OCC1CC1) is C10H10BrClO.
Describe the ring structures in building block <BB_1845>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1845>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1845>.
**Token:** <BB_1845> **SMILES:** Clc1c(Br)cccc1OCC1CC1 **Molecular Formula:** C10H10BrClO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1846>.
CCCS(=O)(=O)NOC
What is the building block token for the following molecule?
CCCS(=O)(=O)NOC
<BB_1846>
What is the molecular formula for <BB_1846>?
The molecular formula for <BB_1846> (CCCS(=O)(=O)NOC) is C4H11NO3S.
Describe the ring structures in building block <BB_1846>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1846>.
The molecule contains the following groups: Secondary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1846>.
**Token:** <BB_1846> **SMILES:** CCCS(=O)(=O)NOC **Molecular Formula:** C4H11NO3S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_1847>.
COCC1(B2OC(C)(C)C(C)(C)O2)CC1
What is the building block token for the following molecule?
COCC1(B2OC(C)(C)C(C)(C)O2)CC1
<BB_1847>
What is the molecular formula for <BB_1847>?
The molecular formula for <BB_1847> (COCC1(B2OC(C)(C)C(C)(C)O2)CC1) is C11H21BO3.
Describe the ring structures in building block <BB_1847>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1847>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_1847>.
**Token:** <BB_1847> **SMILES:** COCC1(B2OC(C)(C)C(C)(C)O2)CC1 **Molecular Formula:** C11H21BO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_1848>.
NCC1(CO)COCCN1
What is the building block token for the following molecule?
NCC1(CO)COCCN1
<BB_1848>
What is the molecular formula for <BB_1848>?
The molecular formula for <BB_1848> (NCC1(CO)COCCN1) is C6H14N2O2.
Describe the ring structures in building block <BB_1848>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1848>.
The molecule contains the following groups: Amine, Secondary Amine, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1848>.
**Token:** <BB_1848> **SMILES:** NCC1(CO)COCCN1 **Molecular Formula:** C6H14N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1849>.
CC1(C(=O)O)CC(CN)C1.Cl
What is the building block token for the following molecule?
CC1(C(=O)O)CC(CN)C1.Cl
<BB_1849>
What is the molecular formula for <BB_1849>?
The molecular formula for <BB_1849> (CC1(C(=O)O)CC(CN)C1.Cl) is C7H14ClNO2.
Describe the ring structures in building block <BB_1849>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1849>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1849>.
**Token:** <BB_1849> **SMILES:** CC1(C(=O)O)CC(CN)C1.Cl **Molecular Formula:** C7H14ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)