instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_1850>.
Nc1cnc(N2CC3CCC(C2)O3)nc1
What is the building block token for the following molecule?
Nc1cnc(N2CC3CCC(C2)O3)nc1
<BB_1850>
What is the molecular formula for <BB_1850>?
The molecular formula for <BB_1850> (Nc1cnc(N2CC3CCC(C2)O3)nc1) is C10H14N4O.
Describe the ring structures in building block <BB_1850>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1850>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1850>.
**Token:** <BB_1850> **SMILES:** Nc1cnc(N2CC3CCC(C2)O3)nc1 **Molecular Formula:** C10H14N4O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_1851>.
Fc1ccccc1-c1nnc(S)o1
What is the building block token for the following molecule?
Fc1ccccc1-c1nnc(S)o1
<BB_1851>
What is the molecular formula for <BB_1851>?
The molecular formula for <BB_1851> (Fc1ccccc1-c1nnc(S)o1) is C8H5FN2OS.
Describe the ring structures in building block <BB_1851>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1851>.
The molecule contains the following groups: Thiol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1851>.
**Token:** <BB_1851> **SMILES:** Fc1ccccc1-c1nnc(S)o1 **Molecular Formula:** C8H5FN2OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Thiol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1852>.
CCSC(C)C(=O)O
What is the building block token for the following molecule?
CCSC(C)C(=O)O
<BB_1852>
What is the molecular formula for <BB_1852>?
The molecular formula for <BB_1852> (CCSC(C)C(=O)O) is C5H10O2S.
Describe the ring structures in building block <BB_1852>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1852>.
The molecule contains the following groups: Carboxylic Acid, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_1852>.
**Token:** <BB_1852> **SMILES:** CCSC(C)C(=O)O **Molecular Formula:** C5H10O2S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Sulfide
Provide the SMILES representation for the building block token <BB_1853>.
Cc1sc2ncnc(NCC(=O)O)c2c1C
What is the building block token for the following molecule?
Cc1sc2ncnc(NCC(=O)O)c2c1C
<BB_1853>
What is the molecular formula for <BB_1853>?
The molecular formula for <BB_1853> (Cc1sc2ncnc(NCC(=O)O)c2c1C) is C10H11N3O2S.
Describe the ring structures in building block <BB_1853>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1853>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_1853>.
**Token:** <BB_1853> **SMILES:** Cc1sc2ncnc(NCC(=O)O)c2c1C **Molecular Formula:** C10H11N3O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine
Provide the SMILES representation for the building block token <BB_1854>.
COC(=O)C(Br)c1ccccc1F
What is the building block token for the following molecule?
COC(=O)C(Br)c1ccccc1F
<BB_1854>
What is the molecular formula for <BB_1854>?
The molecular formula for <BB_1854> (COC(=O)C(Br)c1ccccc1F) is C9H8BrFO2.
Describe the ring structures in building block <BB_1854>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1854>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1854>.
**Token:** <BB_1854> **SMILES:** COC(=O)C(Br)c1ccccc1F **Molecular Formula:** C9H8BrFO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1855>.
O=C(O)[C@H]1CCC(F)(F)C[C@H]1F
What is the building block token for the following molecule?
O=C(O)[C@H]1CCC(F)(F)C[C@H]1F
<BB_1855>
What is the molecular formula for <BB_1855>?
The molecular formula for <BB_1855> (O=C(O)[C@H]1CCC(F)(F)C[C@H]1F) is C7H9F3O2.
Describe the ring structures in building block <BB_1855>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1855>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1855>.
**Token:** <BB_1855> **SMILES:** O=C(O)[C@H]1CCC(F)(F)C[C@H]1F **Molecular Formula:** C7H9F3O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1856>.
COC[C@@H](N)CNC(=O)OC(C)(C)C
What is the building block token for the following molecule?
COC[C@@H](N)CNC(=O)OC(C)(C)C
<BB_1856>
What is the molecular formula for <BB_1856>?
The molecular formula for <BB_1856> (COC[C@@H](N)CNC(=O)OC(C)(C)C) is C9H20N2O3.
Describe the ring structures in building block <BB_1856>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1856>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1856>.
**Token:** <BB_1856> **SMILES:** COC[C@@H](N)CNC(=O)OC(C)(C)C **Molecular Formula:** C9H20N2O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_1857>.
Brc1cc2[nH]ncc2cn1.Cl
What is the building block token for the following molecule?
Brc1cc2[nH]ncc2cn1.Cl
<BB_1857>
What is the molecular formula for <BB_1857>?
The molecular formula for <BB_1857> (Brc1cc2[nH]ncc2cn1.Cl) is C6H5BrClN3.
Describe the ring structures in building block <BB_1857>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1857>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1857>.
**Token:** <BB_1857> **SMILES:** Brc1cc2[nH]ncc2cn1.Cl **Molecular Formula:** C6H5BrClN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1858>.
Cn1cc(-c2cc(C(F)(F)F)nc(NN)n2)cn1
What is the building block token for the following molecule?
Cn1cc(-c2cc(C(F)(F)F)nc(NN)n2)cn1
<BB_1858>
What is the molecular formula for <BB_1858>?
The molecular formula for <BB_1858> (Cn1cc(-c2cc(C(F)(F)F)nc(NN)n2)cn1) is C9H9F3N6.
Describe the ring structures in building block <BB_1858>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1858>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1858>.
**Token:** <BB_1858> **SMILES:** Cn1cc(-c2cc(C(F)(F)F)nc(NN)n2)cn1 **Molecular Formula:** C9H9F3N6 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1859>.
COC(=O)C(Br)Cc1ccc(C)cc1
What is the building block token for the following molecule?
COC(=O)C(Br)Cc1ccc(C)cc1
<BB_1859>
What is the molecular formula for <BB_1859>?
The molecular formula for <BB_1859> (COC(=O)C(Br)Cc1ccc(C)cc1) is C11H13BrO2.
Describe the ring structures in building block <BB_1859>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1859>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1859>.
**Token:** <BB_1859> **SMILES:** COC(=O)C(Br)Cc1ccc(C)cc1 **Molecular Formula:** C11H13BrO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1860>.
COC(=O)CCN(C)C
What is the building block token for the following molecule?
COC(=O)CCN(C)C
<BB_1860>
What is the molecular formula for <BB_1860>?
The molecular formula for <BB_1860> (COC(=O)CCN(C)C) is C6H13NO2.
Describe the ring structures in building block <BB_1860>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1860>.
The molecule contains the following groups: Tertiary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1860>.
**Token:** <BB_1860> **SMILES:** COC(=O)CCN(C)C **Molecular Formula:** C6H13NO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Tertiary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_1861>.
Cc1cn(-c2ccc(Cl)nn2)cn1
What is the building block token for the following molecule?
Cc1cn(-c2ccc(Cl)nn2)cn1
<BB_1861>
What is the molecular formula for <BB_1861>?
The molecular formula for <BB_1861> (Cc1cn(-c2ccc(Cl)nn2)cn1) is C8H7ClN4.
Describe the ring structures in building block <BB_1861>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1861>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1861>.
**Token:** <BB_1861> **SMILES:** Cc1cn(-c2ccc(Cl)nn2)cn1 **Molecular Formula:** C8H7ClN4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1862>.
O=C(O)CCc1c(F)c(F)cc(F)c1F
What is the building block token for the following molecule?
O=C(O)CCc1c(F)c(F)cc(F)c1F
<BB_1862>
What is the molecular formula for <BB_1862>?
The molecular formula for <BB_1862> (O=C(O)CCc1c(F)c(F)cc(F)c1F) is C9H6F4O2.
Describe the ring structures in building block <BB_1862>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1862>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1862>.
**Token:** <BB_1862> **SMILES:** O=C(O)CCc1c(F)c(F)cc(F)c1F **Molecular Formula:** C9H6F4O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1863>.
CC(=O)c1ccc(C(N)=O)cc1
What is the building block token for the following molecule?
CC(=O)c1ccc(C(N)=O)cc1
<BB_1863>
What is the molecular formula for <BB_1863>?
The molecular formula for <BB_1863> (CC(=O)c1ccc(C(N)=O)cc1) is C9H9NO2.
Describe the ring structures in building block <BB_1863>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1863>.
The molecule contains the following groups: Amide, Ketone.
Provide a comprehensive chemical profile for the building block <BB_1863>.
**Token:** <BB_1863> **SMILES:** CC(=O)c1ccc(C(N)=O)cc1 **Molecular Formula:** C9H9NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Ketone
Provide the SMILES representation for the building block token <BB_1864>.
Cc1cc(Cl)nc(C2CC2)n1
What is the building block token for the following molecule?
Cc1cc(Cl)nc(C2CC2)n1
<BB_1864>
What is the molecular formula for <BB_1864>?
The molecular formula for <BB_1864> (Cc1cc(Cl)nc(C2CC2)n1) is C8H9ClN2.
Describe the ring structures in building block <BB_1864>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1864>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1864>.
**Token:** <BB_1864> **SMILES:** Cc1cc(Cl)nc(C2CC2)n1 **Molecular Formula:** C8H9ClN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1865>.
Cc1cc(N2CCCC2)ccc1N
What is the building block token for the following molecule?
Cc1cc(N2CCCC2)ccc1N
<BB_1865>
What is the molecular formula for <BB_1865>?
The molecular formula for <BB_1865> (Cc1cc(N2CCCC2)ccc1N) is C11H16N2.
Describe the ring structures in building block <BB_1865>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1865>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_1865>.
**Token:** <BB_1865> **SMILES:** Cc1cc(N2CCCC2)ccc1N **Molecular Formula:** C11H16N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_1866>.
C=CCn1c(S)nc2cc(C(=O)O)ccc2c1=O
What is the building block token for the following molecule?
C=CCn1c(S)nc2cc(C(=O)O)ccc2c1=O
<BB_1866>
What is the molecular formula for <BB_1866>?
The molecular formula for <BB_1866> (C=CCn1c(S)nc2cc(C(=O)O)ccc2c1=O) is C12H10N2O3S.
Describe the ring structures in building block <BB_1866>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.