instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_216>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_216>.
**Token:** <BB_216> **SMILES:** Nc1nc2cc(Br)cc(Cl)c2o1 **Molecular Formula:** C7H4BrClN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_217>.
COc1ccc(C2(O)CCC3(CC2)OCCO3)cc1
What is the building block token for the following molecule?
COc1ccc(C2(O)CCC3(CC2)OCCO3)cc1
<BB_217>
What is the molecular formula for <BB_217>?
The molecular formula for <BB_217> (COc1ccc(C2(O)CCC3(CC2)OCCO3)cc1) is C15H20O4.
Describe the ring structures in building block <BB_217>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_217>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_217>.
**Token:** <BB_217> **SMILES:** COc1ccc(C2(O)CCC3(CC2)OCCO3)cc1 **Molecular Formula:** C15H20O4 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_218>.
N#Cc1ccc(I)cc1Br
What is the building block token for the following molecule?
N#Cc1ccc(I)cc1Br
<BB_218>
What is the molecular formula for <BB_218>?
The molecular formula for <BB_218> (N#Cc1ccc(I)cc1Br) is C7H3BrIN.
Describe the ring structures in building block <BB_218>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_218>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_218>.
**Token:** <BB_218> **SMILES:** N#Cc1ccc(I)cc1Br **Molecular Formula:** C7H3BrIN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_219>.
O=C(O)CC1CCC2COCCC2C1
What is the building block token for the following molecule?
O=C(O)CC1CCC2COCCC2C1
<BB_219>
What is the molecular formula for <BB_219>?
The molecular formula for <BB_219> (O=C(O)CC1CCC2COCCC2C1) is C11H18O3.
Describe the ring structures in building block <BB_219>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_219>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_219>.
**Token:** <BB_219> **SMILES:** O=C(O)CC1CCC2COCCC2C1 **Molecular Formula:** C11H18O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_220>.
CSc1nccnc1C(=O)O
What is the building block token for the following molecule?
CSc1nccnc1C(=O)O
<BB_220>
What is the molecular formula for <BB_220>?
The molecular formula for <BB_220> (CSc1nccnc1C(=O)O) is C6H6N2O2S.
Describe the ring structures in building block <BB_220>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_220>.
The molecule contains the following groups: Carboxylic Acid, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_220>.
**Token:** <BB_220> **SMILES:** CSc1nccnc1C(=O)O **Molecular Formula:** C6H6N2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Sulfide
Provide the SMILES representation for the building block token <BB_221>.
Cl.N#Cc1ccc(C2CC(N)C2)cc1
What is the building block token for the following molecule?
Cl.N#Cc1ccc(C2CC(N)C2)cc1
<BB_221>
What is the molecular formula for <BB_221>?
The molecular formula for <BB_221> (Cl.N#Cc1ccc(C2CC(N)C2)cc1) is C11H13ClN2.
Describe the ring structures in building block <BB_221>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_221>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_221>.
**Token:** <BB_221> **SMILES:** Cl.N#Cc1ccc(C2CC(N)C2)cc1 **Molecular Formula:** C11H13ClN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_222>.
COCCOc1ccc(C(C)=O)cc1
What is the building block token for the following molecule?
COCCOc1ccc(C(C)=O)cc1
<BB_222>
What is the molecular formula for <BB_222>?
The molecular formula for <BB_222> (COCCOc1ccc(C(C)=O)cc1) is C11H14O3.
Describe the ring structures in building block <BB_222>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_222>.
The molecule contains the following groups: Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_222>.
**Token:** <BB_222> **SMILES:** COCCOc1ccc(C(C)=O)cc1 **Molecular Formula:** C11H14O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Ether
Provide the SMILES representation for the building block token <BB_223>.
CC(C)(C)OC(=O)c1csc(S(=O)(=O)Cl)c1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)c1csc(S(=O)(=O)Cl)c1
<BB_223>
What is the molecular formula for <BB_223>?
The molecular formula for <BB_223> (CC(C)(C)OC(=O)c1csc(S(=O)(=O)Cl)c1) is C9H11ClO4S2.
Describe the ring structures in building block <BB_223>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_223>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_223>.
**Token:** <BB_223> **SMILES:** CC(C)(C)OC(=O)c1csc(S(=O)(=O)Cl)c1 **Molecular Formula:** C9H11ClO4S2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_224>.
Cc1ccc(F)c(CBr)c1
What is the building block token for the following molecule?
Cc1ccc(F)c(CBr)c1
<BB_224>
What is the molecular formula for <BB_224>?
The molecular formula for <BB_224> (Cc1ccc(F)c(CBr)c1) is C8H8BrF.
Describe the ring structures in building block <BB_224>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_224>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_224>.
**Token:** <BB_224> **SMILES:** Cc1ccc(F)c(CBr)c1 **Molecular Formula:** C8H8BrF **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_225>.
CNC(=O)c1nc2ccccc2c(=O)[nH]1
What is the building block token for the following molecule?
CNC(=O)c1nc2ccccc2c(=O)[nH]1
<BB_225>
What is the molecular formula for <BB_225>?
The molecular formula for <BB_225> (CNC(=O)c1nc2ccccc2c(=O)[nH]1) is C10H9N3O2.
Describe the ring structures in building block <BB_225>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_225>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_225>.
**Token:** <BB_225> **SMILES:** CNC(=O)c1nc2ccccc2c(=O)[nH]1 **Molecular Formula:** C10H9N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_226>.
Cc1cc(OCc2ccccn2)ccc1N
What is the building block token for the following molecule?
Cc1cc(OCc2ccccn2)ccc1N
<BB_226>
What is the molecular formula for <BB_226>?
The molecular formula for <BB_226> (Cc1cc(OCc2ccccn2)ccc1N) is C13H14N2O.
Describe the ring structures in building block <BB_226>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_226>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_226>.
**Token:** <BB_226> **SMILES:** Cc1cc(OCc2ccccn2)ccc1N **Molecular Formula:** C13H14N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_227>.
COC(=O)C12CC(C(=O)O)(C1)OC2(C)C
What is the building block token for the following molecule?
COC(=O)C12CC(C(=O)O)(C1)OC2(C)C
<BB_227>
What is the molecular formula for <BB_227>?
The molecular formula for <BB_227> (COC(=O)C12CC(C(=O)O)(C1)OC2(C)C) is C10H14O5.
Describe the ring structures in building block <BB_227>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_227>.
The molecule contains the following groups: Carboxylic Acid, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_227>.
**Token:** <BB_227> **SMILES:** COC(=O)C12CC(C(=O)O)(C1)OC2(C)C **Molecular Formula:** C10H14O5 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Ester, Ether
Provide the SMILES representation for the building block token <BB_228>.
CC1(C(=O)O)Cc2ccc(C(F)(F)F)cc21
What is the building block token for the following molecule?
CC1(C(=O)O)Cc2ccc(C(F)(F)F)cc21
<BB_228>
What is the molecular formula for <BB_228>?
The molecular formula for <BB_228> (CC1(C(=O)O)Cc2ccc(C(F)(F)F)cc21) is C11H9F3O2.
Describe the ring structures in building block <BB_228>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6.
List the primary functional groups present in <BB_228>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_228>.
**Token:** <BB_228> **SMILES:** CC1(C(=O)O)Cc2ccc(C(F)(F)F)cc21 **Molecular Formula:** C11H9F3O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_229>.
CC(C)(C=O)N1CCOCC1
What is the building block token for the following molecule?
CC(C)(C=O)N1CCOCC1
<BB_229>
What is the molecular formula for <BB_229>?
The molecular formula for <BB_229> (CC(C)(C=O)N1CCOCC1) is C8H15NO2.
Describe the ring structures in building block <BB_229>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_229>.
The molecule contains the following groups: Tertiary Amine, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_229>.
**Token:** <BB_229> **SMILES:** CC(C)(C=O)N1CCOCC1 **Molecular Formula:** C8H15NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_230>.
COc1ccc(N)c(I)c1F.Cl
What is the building block token for the following molecule?
COc1ccc(N)c(I)c1F.Cl
<BB_230>
What is the molecular formula for <BB_230>?
The molecular formula for <BB_230> (COc1ccc(N)c(I)c1F.Cl) is C7H8ClFINO.
Describe the ring structures in building block <BB_230>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_230>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_230>.
**Token:** <BB_230> **SMILES:** COc1ccc(N)c(I)c1F.Cl **Molecular Formula:** C7H8ClFINO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_231>.
Cc1cc(F)ncc1C1CC1
What is the building block token for the following molecule?
Cc1cc(F)ncc1C1CC1
<BB_231>
What is the molecular formula for <BB_231>?
The molecular formula for <BB_231> (Cc1cc(F)ncc1C1CC1) is C9H10FN.
Describe the ring structures in building block <BB_231>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_231>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_231>.
**Token:** <BB_231> **SMILES:** Cc1cc(F)ncc1C1CC1 **Molecular Formula:** C9H10FN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_232>.
O=C(Nc1cccc(CO)c1)c1ccco1
What is the building block token for the following molecule?
O=C(Nc1cccc(CO)c1)c1ccco1
<BB_232>
What is the molecular formula for <BB_232>?
The molecular formula for <BB_232> (O=C(Nc1cccc(CO)c1)c1ccco1) is C12H11NO3.
Describe the ring structures in building block <BB_232>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_232>.
The molecule contains the following groups: Amide, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_232>.
**Token:** <BB_232> **SMILES:** O=C(Nc1cccc(CO)c1)c1ccco1 **Molecular Formula:** C12H11NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amide, Alcohol
Provide the SMILES representation for the building block token <BB_233>.
Cl.NCC[C@H]1CCC(=O)N1
What is the building block token for the following molecule?
Cl.NCC[C@H]1CCC(=O)N1
<BB_233>