instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_1866>.
The molecule contains the following groups: Carboxylic Acid, Thiol.
Provide a comprehensive chemical profile for the building block <BB_1866>.
**Token:** <BB_1866> **SMILES:** C=CCn1c(S)nc2cc(C(=O)O)ccc2c1=O **Molecular Formula:** C12H10N2O3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Thiol
Provide the SMILES representation for the building block token <BB_1867>.
CSc1cnc(N)c(C)c1
What is the building block token for the following molecule?
CSc1cnc(N)c(C)c1
<BB_1867>
What is the molecular formula for <BB_1867>?
The molecular formula for <BB_1867> (CSc1cnc(N)c(C)c1) is C7H10N2S.
Describe the ring structures in building block <BB_1867>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1867>.
The molecule contains the following groups: Amine, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_1867>.
**Token:** <BB_1867> **SMILES:** CSc1cnc(N)c(C)c1 **Molecular Formula:** C7H10N2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Sulfide
Provide the SMILES representation for the building block token <BB_1868>.
NCc1ccc(C2CCCCC2)cc1
What is the building block token for the following molecule?
NCc1ccc(C2CCCCC2)cc1
<BB_1868>
What is the molecular formula for <BB_1868>?
The molecular formula for <BB_1868> (NCc1ccc(C2CCCCC2)cc1) is C13H19N.
Describe the ring structures in building block <BB_1868>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1868>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1868>.
**Token:** <BB_1868> **SMILES:** NCc1ccc(C2CCCCC2)cc1 **Molecular Formula:** C13H19N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1869>.
COC1CN(C)C(C)(C(=O)O)C1.Cl
What is the building block token for the following molecule?
COC1CN(C)C(C)(C(=O)O)C1.Cl
<BB_1869>
What is the molecular formula for <BB_1869>?
The molecular formula for <BB_1869> (COC1CN(C)C(C)(C(=O)O)C1.Cl) is C8H16ClNO3.
Describe the ring structures in building block <BB_1869>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1869>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1869>.
**Token:** <BB_1869> **SMILES:** COC1CN(C)C(C)(C(=O)O)C1.Cl **Molecular Formula:** C8H16ClNO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1870>.
Brc1cc(-c2ccccc2)n[nH]1.Cl
What is the building block token for the following molecule?
Brc1cc(-c2ccccc2)n[nH]1.Cl
<BB_1870>
What is the molecular formula for <BB_1870>?
The molecular formula for <BB_1870> (Brc1cc(-c2ccccc2)n[nH]1.Cl) is C9H8BrClN2.
Describe the ring structures in building block <BB_1870>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1870>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1870>.
**Token:** <BB_1870> **SMILES:** Brc1cc(-c2ccccc2)n[nH]1.Cl **Molecular Formula:** C9H8BrClN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1871>.
O=C(O)c1cnc(C2CCOCC2)s1
What is the building block token for the following molecule?
O=C(O)c1cnc(C2CCOCC2)s1
<BB_1871>
What is the molecular formula for <BB_1871>?
The molecular formula for <BB_1871> (O=C(O)c1cnc(C2CCOCC2)s1) is C9H11NO3S.
Describe the ring structures in building block <BB_1871>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1871>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_1871>.
**Token:** <BB_1871> **SMILES:** O=C(O)c1cnc(C2CCOCC2)s1 **Molecular Formula:** C9H11NO3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_1872>.
CC(=O)NC1(c2nc(C)no2)CCNC1.Cl
What is the building block token for the following molecule?
CC(=O)NC1(c2nc(C)no2)CCNC1.Cl
<BB_1872>
What is the molecular formula for <BB_1872>?
The molecular formula for <BB_1872> (CC(=O)NC1(c2nc(C)no2)CCNC1.Cl) is C9H15ClN4O2.
Describe the ring structures in building block <BB_1872>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1872>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1872>.
**Token:** <BB_1872> **SMILES:** CC(=O)NC1(c2nc(C)no2)CCNC1.Cl **Molecular Formula:** C9H15ClN4O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1873>.
O=NN1CCC(F)(F)C1
What is the building block token for the following molecule?
O=NN1CCC(F)(F)C1
<BB_1873>
What is the molecular formula for <BB_1873>?
The molecular formula for <BB_1873> (O=NN1CCC(F)(F)C1) is C4H6F2N2O.
Describe the ring structures in building block <BB_1873>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1873>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1873>.
**Token:** <BB_1873> **SMILES:** O=NN1CCC(F)(F)C1 **Molecular Formula:** C4H6F2N2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1874>.
Cl.Nc1cc(C(F)(F)F)nn1-c1cccc(Cl)c1
What is the building block token for the following molecule?
Cl.Nc1cc(C(F)(F)F)nn1-c1cccc(Cl)c1
<BB_1874>
What is the molecular formula for <BB_1874>?
The molecular formula for <BB_1874> (Cl.Nc1cc(C(F)(F)F)nn1-c1cccc(Cl)c1) is C10H8Cl2F3N3.
Describe the ring structures in building block <BB_1874>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1874>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1874>.
**Token:** <BB_1874> **SMILES:** Cl.Nc1cc(C(F)(F)F)nn1-c1cccc(Cl)c1 **Molecular Formula:** C10H8Cl2F3N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1875>.
Cl.N[C@@H](CO)CCCO
What is the building block token for the following molecule?
Cl.N[C@@H](CO)CCCO
<BB_1875>
What is the molecular formula for <BB_1875>?
The molecular formula for <BB_1875> (Cl.N[C@@H](CO)CCCO) is C5H14ClNO2.
Describe the ring structures in building block <BB_1875>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1875>.
The molecule contains the following groups: Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1875>.
**Token:** <BB_1875> **SMILES:** Cl.N[C@@H](CO)CCCO **Molecular Formula:** C5H14ClNO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1876>.
Cn1cnc2[nH]c(=O)cc(C(=O)O)c21
What is the building block token for the following molecule?
Cn1cnc2[nH]c(=O)cc(C(=O)O)c21
<BB_1876>
What is the molecular formula for <BB_1876>?
The molecular formula for <BB_1876> (Cn1cnc2[nH]c(=O)cc(C(=O)O)c21) is C8H7N3O3.
Describe the ring structures in building block <BB_1876>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1876>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1876>.
**Token:** <BB_1876> **SMILES:** Cn1cnc2[nH]c(=O)cc(C(=O)O)c21 **Molecular Formula:** C8H7N3O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1877>.
Cl.Nc1cc(C(F)(F)F)ncc1Cl
What is the building block token for the following molecule?
Cl.Nc1cc(C(F)(F)F)ncc1Cl
<BB_1877>
What is the molecular formula for <BB_1877>?
The molecular formula for <BB_1877> (Cl.Nc1cc(C(F)(F)F)ncc1Cl) is C6H5Cl2F3N2.
Describe the ring structures in building block <BB_1877>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1877>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1877>.
**Token:** <BB_1877> **SMILES:** Cl.Nc1cc(C(F)(F)F)ncc1Cl **Molecular Formula:** C6H5Cl2F3N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1878>.
Cl.FC1(F)CC1C1CNCCO1
What is the building block token for the following molecule?
Cl.FC1(F)CC1C1CNCCO1
<BB_1878>
What is the molecular formula for <BB_1878>?
The molecular formula for <BB_1878> (Cl.FC1(F)CC1C1CNCCO1) is C7H12ClF2NO.
Describe the ring structures in building block <BB_1878>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1878>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1878>.
**Token:** <BB_1878> **SMILES:** Cl.FC1(F)CC1C1CNCCO1 **Molecular Formula:** C7H12ClF2NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1879>.
CC(C)(C)OC(=O)N[C@@H](CC1CC1)C(=O)O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N[C@@H](CC1CC1)C(=O)O
<BB_1879>
What is the molecular formula for <BB_1879>?
The molecular formula for <BB_1879> (CC(C)(C)OC(=O)N[C@@H](CC1CC1)C(=O)O) is C11H19NO4.
Describe the ring structures in building block <BB_1879>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_1879>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1879>.
**Token:** <BB_1879> **SMILES:** CC(C)(C)OC(=O)N[C@@H](CC1CC1)C(=O)O **Molecular Formula:** C11H19NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_1880>.
CCOC(=O)C1CC1CCCBr
What is the building block token for the following molecule?
CCOC(=O)C1CC1CCCBr
<BB_1880>
What is the molecular formula for <BB_1880>?
The molecular formula for <BB_1880> (CCOC(=O)C1CC1CCCBr) is C9H15BrO2.
Describe the ring structures in building block <BB_1880>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_1880>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1880>.
**Token:** <BB_1880> **SMILES:** CCOC(=O)C1CC1CCCBr **Molecular Formula:** C9H15BrO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1881>.
C#CC1(F)CCN(C(=O)OC(C)(C)C)C1
What is the building block token for the following molecule?
C#CC1(F)CCN(C(=O)OC(C)(C)C)C1
<BB_1881>
What is the molecular formula for <BB_1881>?
The molecular formula for <BB_1881> (C#CC1(F)CCN(C(=O)OC(C)(C)C)C1) is C11H16FNO2.
Describe the ring structures in building block <BB_1881>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1881>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1881>.
**Token:** <BB_1881> **SMILES:** C#CC1(F)CCN(C(=O)OC(C)(C)C)C1 **Molecular Formula:** C11H16FNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1882>.
CCOC(=O)C(Br)CC(Br)C(=O)OCC
What is the building block token for the following molecule?
CCOC(=O)C(Br)CC(Br)C(=O)OCC
<BB_1882>
What is the molecular formula for <BB_1882>?
The molecular formula for <BB_1882> (CCOC(=O)C(Br)CC(Br)C(=O)OCC) is C9H14Br2O4.
Describe the ring structures in building block <BB_1882>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1882>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1882>.
**Token:** <BB_1882> **SMILES:** CCOC(=O)C(Br)CC(Br)C(=O)OCC **Molecular Formula:** C9H14Br2O4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1883>.
Cc1cc(CS)no1
What is the building block token for the following molecule?
Cc1cc(CS)no1
<BB_1883>