instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_1883>?
The molecular formula for <BB_1883> (Cc1cc(CS)no1) is C5H7NOS.
Describe the ring structures in building block <BB_1883>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1883>.
The molecule contains the following groups: Thiol.
Provide a comprehensive chemical profile for the building block <BB_1883>.
**Token:** <BB_1883> **SMILES:** Cc1cc(CS)no1 **Molecular Formula:** C5H7NOS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Thiol
Provide the SMILES representation for the building block token <BB_1884>.
NCCc1cc(F)cc2c1OCOC2
What is the building block token for the following molecule?
NCCc1cc(F)cc2c1OCOC2
<BB_1884>
What is the molecular formula for <BB_1884>?
The molecular formula for <BB_1884> (NCCc1cc(F)cc2c1OCOC2) is C10H12FNO2.
Describe the ring structures in building block <BB_1884>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1884>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1884>.
**Token:** <BB_1884> **SMILES:** NCCc1cc(F)cc2c1OCOC2 **Molecular Formula:** C10H12FNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1885>.
CC(c1ccccc1)c1cc(C(=O)O)n[nH]1
What is the building block token for the following molecule?
CC(c1ccccc1)c1cc(C(=O)O)n[nH]1
<BB_1885>
What is the molecular formula for <BB_1885>?
The molecular formula for <BB_1885> (CC(c1ccccc1)c1cc(C(=O)O)n[nH]1) is C12H12N2O2.
Describe the ring structures in building block <BB_1885>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1885>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1885>.
**Token:** <BB_1885> **SMILES:** CC(c1ccccc1)c1cc(C(=O)O)n[nH]1 **Molecular Formula:** C12H12N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1886>.
CC(C)(C)OC(=O)NCCc1cc(N)[nH]n1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NCCc1cc(N)[nH]n1
<BB_1886>
What is the molecular formula for <BB_1886>?
The molecular formula for <BB_1886> (CC(C)(C)OC(=O)NCCc1cc(N)[nH]n1) is C10H18N4O2.
Describe the ring structures in building block <BB_1886>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1886>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1886>.
**Token:** <BB_1886> **SMILES:** CC(C)(C)OC(=O)NCCc1cc(N)[nH]n1 **Molecular Formula:** C10H18N4O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_1887>.
Cl.N[C@H]1CNC1=O
What is the building block token for the following molecule?
Cl.N[C@H]1CNC1=O
<BB_1887>
What is the molecular formula for <BB_1887>?
The molecular formula for <BB_1887> (Cl.N[C@H]1CNC1=O) is C3H7ClN2O.
Describe the ring structures in building block <BB_1887>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1887>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1887>.
**Token:** <BB_1887> **SMILES:** Cl.N[C@H]1CNC1=O **Molecular Formula:** C3H7ClN2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1888>.
Cl.O=C(O)C12CCC(CNC1)C2(F)F
What is the building block token for the following molecule?
Cl.O=C(O)C12CCC(CNC1)C2(F)F
<BB_1888>
What is the molecular formula for <BB_1888>?
The molecular formula for <BB_1888> (Cl.O=C(O)C12CCC(CNC1)C2(F)F) is C8H12ClF2NO2.
Describe the ring structures in building block <BB_1888>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1888>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1888>.
**Token:** <BB_1888> **SMILES:** Cl.O=C(O)C12CCC(CNC1)C2(F)F **Molecular Formula:** C8H12ClF2NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1889>.
COc1cccc(N2CC(C(=O)O)CC2=O)c1
What is the building block token for the following molecule?
COc1cccc(N2CC(C(=O)O)CC2=O)c1
<BB_1889>
What is the molecular formula for <BB_1889>?
The molecular formula for <BB_1889> (COc1cccc(N2CC(C(=O)O)CC2=O)c1) is C12H13NO4.
Describe the ring structures in building block <BB_1889>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1889>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1889>.
**Token:** <BB_1889> **SMILES:** COc1cccc(N2CC(C(=O)O)CC2=O)c1 **Molecular Formula:** C12H13NO4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_1890>.
CO[C@@H]1C[C@H](N)C12CCC2.Cl
What is the building block token for the following molecule?
CO[C@@H]1C[C@H](N)C12CCC2.Cl
<BB_1890>
What is the molecular formula for <BB_1890>?
The molecular formula for <BB_1890> (CO[C@@H]1C[C@H](N)C12CCC2.Cl) is C8H16ClNO.
Describe the ring structures in building block <BB_1890>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1890>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1890>.
**Token:** <BB_1890> **SMILES:** CO[C@@H]1C[C@H](N)C12CCC2.Cl **Molecular Formula:** C8H16ClNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1891>.
CC(C)(C)c1n[nH]c(=O)s1
What is the building block token for the following molecule?
CC(C)(C)c1n[nH]c(=O)s1
<BB_1891>
What is the molecular formula for <BB_1891>?
The molecular formula for <BB_1891> (CC(C)(C)c1n[nH]c(=O)s1) is C6H10N2OS.
Describe the ring structures in building block <BB_1891>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1891>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1891>.
**Token:** <BB_1891> **SMILES:** CC(C)(C)c1n[nH]c(=O)s1 **Molecular Formula:** C6H10N2OS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1892>.
Cc1ccc(N)cc1-c1ccc(C#N)s1
What is the building block token for the following molecule?
Cc1ccc(N)cc1-c1ccc(C#N)s1
<BB_1892>
What is the molecular formula for <BB_1892>?
The molecular formula for <BB_1892> (Cc1ccc(N)cc1-c1ccc(C#N)s1) is C12H10N2S.
Describe the ring structures in building block <BB_1892>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1892>.
The molecule contains the following groups: Amine, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1892>.
**Token:** <BB_1892> **SMILES:** Cc1ccc(N)cc1-c1ccc(C#N)s1 **Molecular Formula:** C12H10N2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Nitrile
Provide the SMILES representation for the building block token <BB_1893>.
C#CCCc1ccccc1[N+](=O)[O-]
What is the building block token for the following molecule?
C#CCCc1ccccc1[N+](=O)[O-]
<BB_1893>
What is the molecular formula for <BB_1893>?
The molecular formula for <BB_1893> (C#CCCc1ccccc1[N+](=O)[O-]) is C10H9NO2.
Describe the ring structures in building block <BB_1893>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1893>.
The molecule contains the following groups: Tertiary Amine, Nitro.
Provide a comprehensive chemical profile for the building block <BB_1893>.
**Token:** <BB_1893> **SMILES:** C#CCCc1ccccc1[N+](=O)[O-] **Molecular Formula:** C10H9NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Nitro
Provide the SMILES representation for the building block token <BB_1894>.
CC(C)Oc1ccc(S(=O)(=O)Cl)cc1Cl
What is the building block token for the following molecule?
CC(C)Oc1ccc(S(=O)(=O)Cl)cc1Cl
<BB_1894>
What is the molecular formula for <BB_1894>?
The molecular formula for <BB_1894> (CC(C)Oc1ccc(S(=O)(=O)Cl)cc1Cl) is C9H10Cl2O3S.
Describe the ring structures in building block <BB_1894>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1894>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1894>.
**Token:** <BB_1894> **SMILES:** CC(C)Oc1ccc(S(=O)(=O)Cl)cc1Cl **Molecular Formula:** C9H10Cl2O3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1895>.
CC12CCC(C(=O)O)(CO1)C2
What is the building block token for the following molecule?
CC12CCC(C(=O)O)(CO1)C2
<BB_1895>
What is the molecular formula for <BB_1895>?
The molecular formula for <BB_1895> (CC12CCC(C(=O)O)(CO1)C2) is C8H12O3.
Describe the ring structures in building block <BB_1895>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1895>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_1895>.
**Token:** <BB_1895> **SMILES:** CC12CCC(C(=O)O)(CO1)C2 **Molecular Formula:** C8H12O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_1896>.
CNCc1ccn(C)n1
What is the building block token for the following molecule?
CNCc1ccn(C)n1
<BB_1896>
What is the molecular formula for <BB_1896>?
The molecular formula for <BB_1896> (CNCc1ccn(C)n1) is C6H11N3.
Describe the ring structures in building block <BB_1896>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1896>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_1896>.
**Token:** <BB_1896> **SMILES:** CNCc1ccn(C)n1 **Molecular Formula:** C6H11N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_1897>.
CCOC(=O)c1cnnc(Br)c1
What is the building block token for the following molecule?
CCOC(=O)c1cnnc(Br)c1
<BB_1897>
What is the molecular formula for <BB_1897>?
The molecular formula for <BB_1897> (CCOC(=O)c1cnnc(Br)c1) is C7H7BrN2O2.
Describe the ring structures in building block <BB_1897>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1897>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1897>.
**Token:** <BB_1897> **SMILES:** CCOC(=O)c1cnnc(Br)c1 **Molecular Formula:** C7H7BrN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1898>.
O=C(O)c1cncc(F)c1
What is the building block token for the following molecule?
O=C(O)c1cncc(F)c1
<BB_1898>
What is the molecular formula for <BB_1898>?
The molecular formula for <BB_1898> (O=C(O)c1cncc(F)c1) is C6H4FNO2.
Describe the ring structures in building block <BB_1898>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1898>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1898>.
**Token:** <BB_1898> **SMILES:** O=C(O)c1cncc(F)c1 **Molecular Formula:** C6H4FNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1899>.
CC(C)c1c(Cl)nc(Cl)nc1-c1ccccc1
What is the building block token for the following molecule?
CC(C)c1c(Cl)nc(Cl)nc1-c1ccccc1
<BB_1899>
What is the molecular formula for <BB_1899>?
The molecular formula for <BB_1899> (CC(C)c1c(Cl)nc(Cl)nc1-c1ccccc1) is C13H12Cl2N2.
Describe the ring structures in building block <BB_1899>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1899>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1899>.
**Token:** <BB_1899> **SMILES:** CC(C)c1c(Cl)nc(Cl)nc1-c1ccccc1 **Molecular Formula:** C13H12Cl2N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)