instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_1900>.
CCCOCBr
What is the building block token for the following molecule?
CCCOCBr
<BB_1900>
What is the molecular formula for <BB_1900>?
The molecular formula for <BB_1900> (CCCOCBr) is C4H9BrO.
Describe the ring structures in building block <BB_1900>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1900>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1900>.
**Token:** <BB_1900> **SMILES:** CCCOCBr **Molecular Formula:** C4H9BrO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1901>.
N#CC1(c2ccc(OC(F)F)cc2)CC2(COC2)C1
What is the building block token for the following molecule?
N#CC1(c2ccc(OC(F)F)cc2)CC2(COC2)C1
<BB_1901>
What is the molecular formula for <BB_1901>?
The molecular formula for <BB_1901> (N#CC1(c2ccc(OC(F)F)cc2)CC2(COC2)C1) is C14H13F2NO2.
Describe the ring structures in building block <BB_1901>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1901>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1901>.
**Token:** <BB_1901> **SMILES:** N#CC1(c2ccc(OC(F)F)cc2)CC2(COC2)C1 **Molecular Formula:** C14H13F2NO2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Ether, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1902>.
CC(C)(C)OC(=O)N1CC[C@]2(C(=O)O)C[C@H]12
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC[C@]2(C(=O)O)C[C@H]12
<BB_1902>
What is the molecular formula for <BB_1902>?
The molecular formula for <BB_1902> (CC(C)(C)OC(=O)N1CC[C@]2(C(=O)O)C[C@H]12) is C11H17NO4.
Describe the ring structures in building block <BB_1902>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1902>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1902>.
**Token:** <BB_1902> **SMILES:** CC(C)(C)OC(=O)N1CC[C@]2(C(=O)O)C[C@H]12 **Molecular Formula:** C11H17NO4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_1903>.
OC1C2CCC1C2
What is the building block token for the following molecule?
OC1C2CCC1C2
<BB_1903>
What is the molecular formula for <BB_1903>?
The molecular formula for <BB_1903> (OC1C2CCC1C2) is C6H10O.
Describe the ring structures in building block <BB_1903>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1903>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_1903>.
**Token:** <BB_1903> **SMILES:** OC1C2CCC1C2 **Molecular Formula:** C6H10O **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_1904>.
Cl.OCC1(CCl)CCNCC1
What is the building block token for the following molecule?
Cl.OCC1(CCl)CCNCC1
<BB_1904>
What is the molecular formula for <BB_1904>?
The molecular formula for <BB_1904> (Cl.OCC1(CCl)CCNCC1) is C7H15Cl2NO.
Describe the ring structures in building block <BB_1904>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1904>.
The molecule contains the following groups: Secondary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1904>.
**Token:** <BB_1904> **SMILES:** Cl.OCC1(CCl)CCNCC1 **Molecular Formula:** C7H15Cl2NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1905>.
Cc1c(C)c(O)c(C=O)c(C)c1O
What is the building block token for the following molecule?
Cc1c(C)c(O)c(C=O)c(C)c1O
<BB_1905>
What is the molecular formula for <BB_1905>?
The molecular formula for <BB_1905> (Cc1c(C)c(O)c(C=O)c(C)c1O) is C10H12O3.
Describe the ring structures in building block <BB_1905>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1905>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_1905>.
**Token:** <BB_1905> **SMILES:** Cc1c(C)c(O)c(C=O)c(C)c1O **Molecular Formula:** C10H12O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_1906>.
CCOC(=O)CC(=O)c1ccc(Br)cn1
What is the building block token for the following molecule?
CCOC(=O)CC(=O)c1ccc(Br)cn1
<BB_1906>
What is the molecular formula for <BB_1906>?
The molecular formula for <BB_1906> (CCOC(=O)CC(=O)c1ccc(Br)cn1) is C10H10BrNO3.
Describe the ring structures in building block <BB_1906>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1906>.
The molecule contains the following groups: Ester, Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1906>.
**Token:** <BB_1906> **SMILES:** CCOC(=O)CC(=O)c1ccc(Br)cn1 **Molecular Formula:** C10H10BrNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1907>.
CSCC(N)c1ccccc1
What is the building block token for the following molecule?
CSCC(N)c1ccccc1
<BB_1907>
What is the molecular formula for <BB_1907>?
The molecular formula for <BB_1907> (CSCC(N)c1ccccc1) is C9H13NS.
Describe the ring structures in building block <BB_1907>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1907>.
The molecule contains the following groups: Amine, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_1907>.
**Token:** <BB_1907> **SMILES:** CSCC(N)c1ccccc1 **Molecular Formula:** C9H13NS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Sulfide
Provide the SMILES representation for the building block token <BB_1908>.
CCOC(=O)C(C)OC(=O)C(C)O
What is the building block token for the following molecule?
CCOC(=O)C(C)OC(=O)C(C)O
<BB_1908>
What is the molecular formula for <BB_1908>?
The molecular formula for <BB_1908> (CCOC(=O)C(C)OC(=O)C(C)O) is C8H14O5.
Describe the ring structures in building block <BB_1908>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1908>.
The molecule contains the following groups: Ester, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1908>.
**Token:** <BB_1908> **SMILES:** CCOC(=O)C(C)OC(=O)C(C)O **Molecular Formula:** C8H14O5 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1909>.
O=C(O)c1cccc(COC2CCOCC2)c1
What is the building block token for the following molecule?
O=C(O)c1cccc(COC2CCOCC2)c1
<BB_1909>
What is the molecular formula for <BB_1909>?
The molecular formula for <BB_1909> (O=C(O)c1cccc(COC2CCOCC2)c1) is C13H16O4.
Describe the ring structures in building block <BB_1909>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1909>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_1909>.
**Token:** <BB_1909> **SMILES:** O=C(O)c1cccc(COC2CCOCC2)c1 **Molecular Formula:** C13H16O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_1910>.
CCOC(=O)C(=O)c1ccnn1C
What is the building block token for the following molecule?
CCOC(=O)C(=O)c1ccnn1C
<BB_1910>
What is the molecular formula for <BB_1910>?
The molecular formula for <BB_1910> (CCOC(=O)C(=O)c1ccnn1C) is C8H10N2O3.
Describe the ring structures in building block <BB_1910>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1910>.
The molecule contains the following groups: Ester, Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_1910>.
**Token:** <BB_1910> **SMILES:** CCOC(=O)C(=O)c1ccnn1C **Molecular Formula:** C8H10N2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ketone, Ether
Provide the SMILES representation for the building block token <BB_1911>.
Cl.NC1CCCC2(CNC(=O)C2)C1
What is the building block token for the following molecule?
Cl.NC1CCCC2(CNC(=O)C2)C1
<BB_1911>
What is the molecular formula for <BB_1911>?
The molecular formula for <BB_1911> (Cl.NC1CCCC2(CNC(=O)C2)C1) is C9H17ClN2O.
Describe the ring structures in building block <BB_1911>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1911>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1911>.
**Token:** <BB_1911> **SMILES:** Cl.NC1CCCC2(CNC(=O)C2)C1 **Molecular Formula:** C9H17ClN2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1912>.
O=C(O)c1sccc1SC(F)F
What is the building block token for the following molecule?
O=C(O)c1sccc1SC(F)F
<BB_1912>
What is the molecular formula for <BB_1912>?
The molecular formula for <BB_1912> (O=C(O)c1sccc1SC(F)F) is C6H4F2O2S2.
Describe the ring structures in building block <BB_1912>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1912>.
The molecule contains the following groups: Carboxylic Acid, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1912>.
**Token:** <BB_1912> **SMILES:** O=C(O)c1sccc1SC(F)F **Molecular Formula:** C6H4F2O2S2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1913>.
O=C1CCOc2cc(Cl)c(Cl)cc21
What is the building block token for the following molecule?
O=C1CCOc2cc(Cl)c(Cl)cc21
<BB_1913>
What is the molecular formula for <BB_1913>?
The molecular formula for <BB_1913> (O=C1CCOc2cc(Cl)c(Cl)cc21) is C9H6Cl2O2.
Describe the ring structures in building block <BB_1913>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1913>.
The molecule contains the following groups: Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1913>.
**Token:** <BB_1913> **SMILES:** O=C1CCOc2cc(Cl)c(Cl)cc21 **Molecular Formula:** C9H6Cl2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1914>.
COCCCN1Cc2ccc(N)cc2C1
What is the building block token for the following molecule?
COCCCN1Cc2ccc(N)cc2C1
<BB_1914>
What is the molecular formula for <BB_1914>?
The molecular formula for <BB_1914> (COCCCN1Cc2ccc(N)cc2C1) is C12H18N2O.
Describe the ring structures in building block <BB_1914>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1914>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1914>.
**Token:** <BB_1914> **SMILES:** COCCCN1Cc2ccc(N)cc2C1 **Molecular Formula:** C12H18N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_1915>.
Cl.N[C@@H]1CCC[C@H]1c1cccc(C(F)(F)F)c1
What is the building block token for the following molecule?
Cl.N[C@@H]1CCC[C@H]1c1cccc(C(F)(F)F)c1
<BB_1915>
What is the molecular formula for <BB_1915>?
The molecular formula for <BB_1915> (Cl.N[C@@H]1CCC[C@H]1c1cccc(C(F)(F)F)c1) is C12H15ClF3N.
Describe the ring structures in building block <BB_1915>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1915>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1915>.
**Token:** <BB_1915> **SMILES:** Cl.N[C@@H]1CCC[C@H]1c1cccc(C(F)(F)F)c1 **Molecular Formula:** C12H15ClF3N **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1916>.
Cl.Nc1cccc(Nc2ccccc2)n1
What is the building block token for the following molecule?
Cl.Nc1cccc(Nc2ccccc2)n1
<BB_1916>
What is the molecular formula for <BB_1916>?
The molecular formula for <BB_1916> (Cl.Nc1cccc(Nc2ccccc2)n1) is C11H12ClN3.
Describe the ring structures in building block <BB_1916>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.