instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_1916>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1916>.
**Token:** <BB_1916> **SMILES:** Cl.Nc1cccc(Nc2ccccc2)n1 **Molecular Formula:** C11H12ClN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1917>.
Cc1ccc(I)cc1C(=O)O
What is the building block token for the following molecule?
Cc1ccc(I)cc1C(=O)O
<BB_1917>
What is the molecular formula for <BB_1917>?
The molecular formula for <BB_1917> (Cc1ccc(I)cc1C(=O)O) is C8H7IO2.
Describe the ring structures in building block <BB_1917>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1917>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1917>.
**Token:** <BB_1917> **SMILES:** Cc1ccc(I)cc1C(=O)O **Molecular Formula:** C8H7IO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1918>.
Cc1ncc(C(=O)O)n1C.Cl
What is the building block token for the following molecule?
Cc1ncc(C(=O)O)n1C.Cl
<BB_1918>
What is the molecular formula for <BB_1918>?
The molecular formula for <BB_1918> (Cc1ncc(C(=O)O)n1C.Cl) is C6H9ClN2O2.
Describe the ring structures in building block <BB_1918>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1918>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1918>.
**Token:** <BB_1918> **SMILES:** Cc1ncc(C(=O)O)n1C.Cl **Molecular Formula:** C6H9ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1919>.
Fc1ccc(Br)c(Cl)n1
What is the building block token for the following molecule?
Fc1ccc(Br)c(Cl)n1
<BB_1919>
What is the molecular formula for <BB_1919>?
The molecular formula for <BB_1919> (Fc1ccc(Br)c(Cl)n1) is C5H2BrClFN.
Describe the ring structures in building block <BB_1919>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1919>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1919>.
**Token:** <BB_1919> **SMILES:** Fc1ccc(Br)c(Cl)n1 **Molecular Formula:** C5H2BrClFN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1920>.
COc1ccccc1CNCCO
What is the building block token for the following molecule?
COc1ccccc1CNCCO
<BB_1920>
What is the molecular formula for <BB_1920>?
The molecular formula for <BB_1920> (COc1ccccc1CNCCO) is C10H15NO2.
Describe the ring structures in building block <BB_1920>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1920>.
The molecule contains the following groups: Secondary Amine, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1920>.
**Token:** <BB_1920> **SMILES:** COc1ccccc1CNCCO **Molecular Formula:** C10H15NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1921>.
CC(NC(=O)CCl)C12CC3CC(CC(C3)C1)C2
What is the building block token for the following molecule?
CC(NC(=O)CCl)C12CC3CC(CC(C3)C1)C2
<BB_1921>
What is the molecular formula for <BB_1921>?
The molecular formula for <BB_1921> (CC(NC(=O)CCl)C12CC3CC(CC(C3)C1)C2) is C14H22ClNO.
Describe the ring structures in building block <BB_1921>.
The molecule contains 4 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1921>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1921>.
**Token:** <BB_1921> **SMILES:** CC(NC(=O)CCl)C12CC3CC(CC(C3)C1)C2 **Molecular Formula:** C14H22ClNO **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1922>.
Cc1nc2c(F)cc(Br)cc2s1
What is the building block token for the following molecule?
Cc1nc2c(F)cc(Br)cc2s1
<BB_1922>
What is the molecular formula for <BB_1922>?
The molecular formula for <BB_1922> (Cc1nc2c(F)cc(Br)cc2s1) is C8H5BrFNS.
Describe the ring structures in building block <BB_1922>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1922>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1922>.
**Token:** <BB_1922> **SMILES:** Cc1nc2c(F)cc(Br)cc2s1 **Molecular Formula:** C8H5BrFNS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1923>.
Cc1ccc(C(=O)NCC(=O)O)cc1[N+](=O)[O-]
What is the building block token for the following molecule?
Cc1ccc(C(=O)NCC(=O)O)cc1[N+](=O)[O-]
<BB_1923>
What is the molecular formula for <BB_1923>?
The molecular formula for <BB_1923> (Cc1ccc(C(=O)NCC(=O)O)cc1[N+](=O)[O-]) is C10H10N2O5.
Describe the ring structures in building block <BB_1923>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1923>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Amide, Nitro.
Provide a comprehensive chemical profile for the building block <BB_1923>.
**Token:** <BB_1923> **SMILES:** Cc1ccc(C(=O)NCC(=O)O)cc1[N+](=O)[O-] **Molecular Formula:** C10H10N2O5 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Amide, Nitro
Provide the SMILES representation for the building block token <BB_1924>.
Cc1cc(N)ccc1S(=O)(=O)Nc1ccc(Br)cc1
What is the building block token for the following molecule?
Cc1cc(N)ccc1S(=O)(=O)Nc1ccc(Br)cc1
<BB_1924>
What is the molecular formula for <BB_1924>?
The molecular formula for <BB_1924> (Cc1cc(N)ccc1S(=O)(=O)Nc1ccc(Br)cc1) is C13H13BrN2O2S.
Describe the ring structures in building block <BB_1924>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1924>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1924>.
**Token:** <BB_1924> **SMILES:** Cc1cc(N)ccc1S(=O)(=O)Nc1ccc(Br)cc1 **Molecular Formula:** C13H13BrN2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_1925>.
Cc1cc(C(=O)O)cnc1Cl
What is the building block token for the following molecule?
Cc1cc(C(=O)O)cnc1Cl
<BB_1925>
What is the molecular formula for <BB_1925>?
The molecular formula for <BB_1925> (Cc1cc(C(=O)O)cnc1Cl) is C7H6ClNO2.
Describe the ring structures in building block <BB_1925>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1925>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1925>.
**Token:** <BB_1925> **SMILES:** Cc1cc(C(=O)O)cnc1Cl **Molecular Formula:** C7H6ClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1926>.
N#CC1CC2(CNC2)C1.O=C(O)C(F)(F)F
What is the building block token for the following molecule?
N#CC1CC2(CNC2)C1.O=C(O)C(F)(F)F
<BB_1926>
What is the molecular formula for <BB_1926>?
The molecular formula for <BB_1926> (N#CC1CC2(CNC2)C1.O=C(O)C(F)(F)F) is C9H11F3N2O2.
Describe the ring structures in building block <BB_1926>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1926>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1926>.
**Token:** <BB_1926> **SMILES:** N#CC1CC2(CNC2)C1.O=C(O)C(F)(F)F **Molecular Formula:** C9H11F3N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1927>.
N#Cc1cc(F)cc(F)c1S(=O)(=O)Cl
What is the building block token for the following molecule?
N#Cc1cc(F)cc(F)c1S(=O)(=O)Cl
<BB_1927>
What is the molecular formula for <BB_1927>?
The molecular formula for <BB_1927> (N#Cc1cc(F)cc(F)c1S(=O)(=O)Cl) is C7H2ClF2NO2S.
Describe the ring structures in building block <BB_1927>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1927>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1927>.
**Token:** <BB_1927> **SMILES:** N#Cc1cc(F)cc(F)c1S(=O)(=O)Cl **Molecular Formula:** C7H2ClF2NO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1928>.
CC(=O)N1CCN(C(=O)CCC(=O)O)CC1
What is the building block token for the following molecule?
CC(=O)N1CCN(C(=O)CCC(=O)O)CC1
<BB_1928>
What is the molecular formula for <BB_1928>?
The molecular formula for <BB_1928> (CC(=O)N1CCN(C(=O)CCC(=O)O)CC1) is C10H16N2O4.
Describe the ring structures in building block <BB_1928>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1928>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_1928>.
**Token:** <BB_1928> **SMILES:** CC(=O)N1CCN(C(=O)CCC(=O)O)CC1 **Molecular Formula:** C10H16N2O4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_1929>.
Cc1cc(F)ccc1CCCN.Cl
What is the building block token for the following molecule?
Cc1cc(F)ccc1CCCN.Cl
<BB_1929>
What is the molecular formula for <BB_1929>?
The molecular formula for <BB_1929> (Cc1cc(F)ccc1CCCN.Cl) is C10H15ClFN.
Describe the ring structures in building block <BB_1929>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1929>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1929>.
**Token:** <BB_1929> **SMILES:** Cc1cc(F)ccc1CCCN.Cl **Molecular Formula:** C10H15ClFN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1930>.
COC(C=O)C1CCC(F)(F)CC1
What is the building block token for the following molecule?
COC(C=O)C1CCC(F)(F)CC1
<BB_1930>
What is the molecular formula for <BB_1930>?
The molecular formula for <BB_1930> (COC(C=O)C1CCC(F)(F)CC1) is C9H14F2O2.
Describe the ring structures in building block <BB_1930>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1930>.
The molecule contains the following groups: Aldehyde, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1930>.
**Token:** <BB_1930> **SMILES:** COC(C=O)C1CCC(F)(F)CC1 **Molecular Formula:** C9H14F2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Aldehyde, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1931>.
Oc1cc(O)cc(-c2ccccc2)c1
What is the building block token for the following molecule?
Oc1cc(O)cc(-c2ccccc2)c1
<BB_1931>
What is the molecular formula for <BB_1931>?
The molecular formula for <BB_1931> (Oc1cc(O)cc(-c2ccccc2)c1) is C12H10O2.
Describe the ring structures in building block <BB_1931>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1931>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1931>.
**Token:** <BB_1931> **SMILES:** Oc1cc(O)cc(-c2ccccc2)c1 **Molecular Formula:** C12H10O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1932>.
Cc1nc(C)c(CN)s1
What is the building block token for the following molecule?
Cc1nc(C)c(CN)s1
<BB_1932>
What is the molecular formula for <BB_1932>?
The molecular formula for <BB_1932> (Cc1nc(C)c(CN)s1) is C6H10N2S.
Describe the ring structures in building block <BB_1932>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1932>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1932>.
**Token:** <BB_1932> **SMILES:** Cc1nc(C)c(CN)s1 **Molecular Formula:** C6H10N2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1933>.
CCOC1CCCNC1
What is the building block token for the following molecule?
CCOC1CCCNC1
<BB_1933>