instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_1933>?
The molecular formula for <BB_1933> (CCOC1CCCNC1) is C7H15NO.
Describe the ring structures in building block <BB_1933>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1933>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1933>.
**Token:** <BB_1933> **SMILES:** CCOC1CCCNC1 **Molecular Formula:** C7H15NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_1934>.
Cc1cc(C(=O)O)c(C)n1Cc1ccncc1
What is the building block token for the following molecule?
Cc1cc(C(=O)O)c(C)n1Cc1ccncc1
<BB_1934>
What is the molecular formula for <BB_1934>?
The molecular formula for <BB_1934> (Cc1cc(C(=O)O)c(C)n1Cc1ccncc1) is C13H14N2O2.
Describe the ring structures in building block <BB_1934>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1934>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1934>.
**Token:** <BB_1934> **SMILES:** Cc1cc(C(=O)O)c(C)n1Cc1ccncc1 **Molecular Formula:** C13H14N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1935>.
Nc1ccc(N2CCCS2(=O)=O)cc1
What is the building block token for the following molecule?
Nc1ccc(N2CCCS2(=O)=O)cc1
<BB_1935>
What is the molecular formula for <BB_1935>?
The molecular formula for <BB_1935> (Nc1ccc(N2CCCS2(=O)=O)cc1) is C9H12N2O2S.
Describe the ring structures in building block <BB_1935>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1935>.
The molecule contains the following groups: Amine, Tertiary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1935>.
**Token:** <BB_1935> **SMILES:** Nc1ccc(N2CCCS2(=O)=O)cc1 **Molecular Formula:** C9H12N2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_1936>.
CC(C)(C)c1cc(Cl)nc(N)n1
What is the building block token for the following molecule?
CC(C)(C)c1cc(Cl)nc(N)n1
<BB_1936>
What is the molecular formula for <BB_1936>?
The molecular formula for <BB_1936> (CC(C)(C)c1cc(Cl)nc(N)n1) is C8H12ClN3.
Describe the ring structures in building block <BB_1936>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1936>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1936>.
**Token:** <BB_1936> **SMILES:** CC(C)(C)c1cc(Cl)nc(N)n1 **Molecular Formula:** C8H12ClN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1937>.
O=C(O)c1cn(-c2cccc(C(F)(F)F)c2)nn1
What is the building block token for the following molecule?
O=C(O)c1cn(-c2cccc(C(F)(F)F)c2)nn1
<BB_1937>
What is the molecular formula for <BB_1937>?
The molecular formula for <BB_1937> (O=C(O)c1cn(-c2cccc(C(F)(F)F)c2)nn1) is C10H6F3N3O2.
Describe the ring structures in building block <BB_1937>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1937>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1937>.
**Token:** <BB_1937> **SMILES:** O=C(O)c1cn(-c2cccc(C(F)(F)F)c2)nn1 **Molecular Formula:** C10H6F3N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1938>.
COC(=O)C1=CCCC1(C)C
What is the building block token for the following molecule?
COC(=O)C1=CCCC1(C)C
<BB_1938>
What is the molecular formula for <BB_1938>?
The molecular formula for <BB_1938> (COC(=O)C1=CCCC1(C)C) is C9H14O2.
Describe the ring structures in building block <BB_1938>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1938>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1938>.
**Token:** <BB_1938> **SMILES:** COC(=O)C1=CCCC1(C)C **Molecular Formula:** C9H14O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_1939>.
CS(C)(=O)=NC(=O)C(=O)O
What is the building block token for the following molecule?
CS(C)(=O)=NC(=O)C(=O)O
<BB_1939>
What is the molecular formula for <BB_1939>?
The molecular formula for <BB_1939> (CS(C)(=O)=NC(=O)C(=O)O) is C4H7NO4S.
Describe the ring structures in building block <BB_1939>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1939>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_1939>.
**Token:** <BB_1939> **SMILES:** CS(C)(=O)=NC(=O)C(=O)O **Molecular Formula:** C4H7NO4S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_1940>.
CCN(CC)C(=O)CS
What is the building block token for the following molecule?
CCN(CC)C(=O)CS
<BB_1940>
What is the molecular formula for <BB_1940>?
The molecular formula for <BB_1940> (CCN(CC)C(=O)CS) is C6H13NOS.
Describe the ring structures in building block <BB_1940>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1940>.
The molecule contains the following groups: Amide, Thiol.
Provide a comprehensive chemical profile for the building block <BB_1940>.
**Token:** <BB_1940> **SMILES:** CCN(CC)C(=O)CS **Molecular Formula:** C6H13NOS **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Thiol
Provide the SMILES representation for the building block token <BB_1941>.
CCN1C(=C2C=NN(C)C2=N)Nc2ccccc21
What is the building block token for the following molecule?
CCN1C(=C2C=NN(C)C2=N)Nc2ccccc21
<BB_1941>
What is the molecular formula for <BB_1941>?
The molecular formula for <BB_1941> (CCN1C(=C2C=NN(C)C2=N)Nc2ccccc21) is C13H15N5.
Describe the ring structures in building block <BB_1941>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1941>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_1941>.
**Token:** <BB_1941> **SMILES:** CCN1C(=C2C=NN(C)C2=N)Nc2ccccc21 **Molecular Formula:** C13H15N5 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_1942>.
COCCN1C(=O)C[C@H](C(=O)O)[C@H]1c1nccn1C
What is the building block token for the following molecule?
COCCN1C(=O)C[C@H](C(=O)O)[C@H]1c1nccn1C
<BB_1942>
What is the molecular formula for <BB_1942>?
The molecular formula for <BB_1942> (COCCN1C(=O)C[C@H](C(=O)O)[C@H]1c1nccn1C) is C12H17N3O4.
Describe the ring structures in building block <BB_1942>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_1942>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1942>.
**Token:** <BB_1942> **SMILES:** COCCN1C(=O)C[C@H](C(=O)O)[C@H]1c1nccn1C **Molecular Formula:** C12H17N3O4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_1943>.
Cc1ccc(Cl)cc1CC(=O)O
What is the building block token for the following molecule?
Cc1ccc(Cl)cc1CC(=O)O
<BB_1943>
What is the molecular formula for <BB_1943>?
The molecular formula for <BB_1943> (Cc1ccc(Cl)cc1CC(=O)O) is C9H9ClO2.
Describe the ring structures in building block <BB_1943>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1943>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1943>.
**Token:** <BB_1943> **SMILES:** Cc1ccc(Cl)cc1CC(=O)O **Molecular Formula:** C9H9ClO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1944>.
Cc1cc(S(=O)(=O)Cl)c(C)cc1[N+](=O)[O-]
What is the building block token for the following molecule?
Cc1cc(S(=O)(=O)Cl)c(C)cc1[N+](=O)[O-]
<BB_1944>
What is the molecular formula for <BB_1944>?
The molecular formula for <BB_1944> (Cc1cc(S(=O)(=O)Cl)c(C)cc1[N+](=O)[O-]) is C8H8ClNO4S.
Describe the ring structures in building block <BB_1944>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1944>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_1944>.
**Token:** <BB_1944> **SMILES:** Cc1cc(S(=O)(=O)Cl)c(C)cc1[N+](=O)[O-] **Molecular Formula:** C8H8ClNO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_1945>.
OCCOCCOCC1CCCO1
What is the building block token for the following molecule?
OCCOCCOCC1CCCO1
<BB_1945>
What is the molecular formula for <BB_1945>?
The molecular formula for <BB_1945> (OCCOCCOCC1CCCO1) is C9H18O4.
Describe the ring structures in building block <BB_1945>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1945>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1945>.
**Token:** <BB_1945> **SMILES:** OCCOCCOCC1CCCO1 **Molecular Formula:** C9H18O4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1946>.
Cl.O=C1CC2(CCCC2)C(=O)N1C1CCCNC1
What is the building block token for the following molecule?
Cl.O=C1CC2(CCCC2)C(=O)N1C1CCCNC1
<BB_1946>
What is the molecular formula for <BB_1946>?
The molecular formula for <BB_1946> (Cl.O=C1CC2(CCCC2)C(=O)N1C1CCCNC1) is C13H21ClN2O2.
Describe the ring structures in building block <BB_1946>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1946>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1946>.
**Token:** <BB_1946> **SMILES:** Cl.O=C1CC2(CCCC2)C(=O)N1C1CCCNC1 **Molecular Formula:** C13H21ClN2O2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1947>.
CC(C)(C)OC(=O)N1CCC(C(=N)N)CC1.Cl.Cl
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC(C(=N)N)CC1.Cl.Cl
<BB_1947>
What is the molecular formula for <BB_1947>?
The molecular formula for <BB_1947> (CC(C)(C)OC(=O)N1CCC(C(=N)N)CC1.Cl.Cl) is C11H23Cl2N3O2.
Describe the ring structures in building block <BB_1947>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1947>.
The molecule contains the following groups: Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1947>.
**Token:** <BB_1947> **SMILES:** CC(C)(C)OC(=O)N1CCC(C(=N)N)CC1.Cl.Cl **Molecular Formula:** C11H23Cl2N3O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1948>.
COC(=O)C(O)c1ccc(F)c(I)c1
What is the building block token for the following molecule?
COC(=O)C(O)c1ccc(F)c(I)c1
<BB_1948>
What is the molecular formula for <BB_1948>?
The molecular formula for <BB_1948> (COC(=O)C(O)c1ccc(F)c(I)c1) is C9H8FIO3.
Describe the ring structures in building block <BB_1948>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1948>.
The molecule contains the following groups: Ester, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1948>.
**Token:** <BB_1948> **SMILES:** COC(=O)C(O)c1ccc(F)c(I)c1 **Molecular Formula:** C9H8FIO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1949>.
COC(=O)c1n[nH]c2ccc([N+](=O)[O-])cc12
What is the building block token for the following molecule?
COC(=O)c1n[nH]c2ccc([N+](=O)[O-])cc12
<BB_1949>
What is the molecular formula for <BB_1949>?
The molecular formula for <BB_1949> (COC(=O)c1n[nH]c2ccc([N+](=O)[O-])cc12) is C9H7N3O4.
Describe the ring structures in building block <BB_1949>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1949>.
The molecule contains the following groups: Tertiary Amine, Ester, Ether, Nitro.
Provide a comprehensive chemical profile for the building block <BB_1949>.
**Token:** <BB_1949> **SMILES:** COC(=O)c1n[nH]c2ccc([N+](=O)[O-])cc12 **Molecular Formula:** C9H7N3O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Ester, Ether, Nitro