instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_1950>.
C#CC(N)Cc1cccc(F)c1.Cl
What is the building block token for the following molecule?
C#CC(N)Cc1cccc(F)c1.Cl
<BB_1950>
What is the molecular formula for <BB_1950>?
The molecular formula for <BB_1950> (C#CC(N)Cc1cccc(F)c1.Cl) is C10H11ClFN.
Describe the ring structures in building block <BB_1950>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1950>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1950>.
**Token:** <BB_1950> **SMILES:** C#CC(N)Cc1cccc(F)c1.Cl **Molecular Formula:** C10H11ClFN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1951>.
CCOC(=O)c1ncn(C)c1C=O
What is the building block token for the following molecule?
CCOC(=O)c1ncn(C)c1C=O
<BB_1951>
What is the molecular formula for <BB_1951>?
The molecular formula for <BB_1951> (CCOC(=O)c1ncn(C)c1C=O) is C8H10N2O3.
Describe the ring structures in building block <BB_1951>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1951>.
The molecule contains the following groups: Ester, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_1951>.
**Token:** <BB_1951> **SMILES:** CCOC(=O)c1ncn(C)c1C=O **Molecular Formula:** C8H10N2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_1952>.
CC(Br)C(N)=O
What is the building block token for the following molecule?
CC(Br)C(N)=O
<BB_1952>
What is the molecular formula for <BB_1952>?
The molecular formula for <BB_1952> (CC(Br)C(N)=O) is C3H6BrNO.
Describe the ring structures in building block <BB_1952>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1952>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1952>.
**Token:** <BB_1952> **SMILES:** CC(Br)C(N)=O **Molecular Formula:** C3H6BrNO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1953>.
CC(C)(C)OC(=O)NC(CO)C(F)(F)F
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC(CO)C(F)(F)F
<BB_1953>
What is the molecular formula for <BB_1953>?
The molecular formula for <BB_1953> (CC(C)(C)OC(=O)NC(CO)C(F)(F)F) is C8H14F3NO3.
Describe the ring structures in building block <BB_1953>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1953>.
The molecule contains the following groups: Amide, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1953>.
**Token:** <BB_1953> **SMILES:** CC(C)(C)OC(=O)NC(CO)C(F)(F)F **Molecular Formula:** C8H14F3NO3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1954>.
Br.Nc1nc2cc(Cl)c(Br)cc2[nH]1
What is the building block token for the following molecule?
Br.Nc1nc2cc(Cl)c(Br)cc2[nH]1
<BB_1954>
What is the molecular formula for <BB_1954>?
The molecular formula for <BB_1954> (Br.Nc1nc2cc(Cl)c(Br)cc2[nH]1) is C7H6Br2ClN3.
Describe the ring structures in building block <BB_1954>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1954>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1954>.
**Token:** <BB_1954> **SMILES:** Br.Nc1nc2cc(Cl)c(Br)cc2[nH]1 **Molecular Formula:** C7H6Br2ClN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1955>.
Nc1c(I)cncc1[N+](=O)[O-]
What is the building block token for the following molecule?
Nc1c(I)cncc1[N+](=O)[O-]
<BB_1955>
What is the molecular formula for <BB_1955>?
The molecular formula for <BB_1955> (Nc1c(I)cncc1[N+](=O)[O-]) is C5H4IN3O2.
Describe the ring structures in building block <BB_1955>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1955>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_1955>.
**Token:** <BB_1955> **SMILES:** Nc1c(I)cncc1[N+](=O)[O-] **Molecular Formula:** C5H4IN3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_1956>.
C[C@H](NC(=O)c1ccccc1)C(=O)O
What is the building block token for the following molecule?
C[C@H](NC(=O)c1ccccc1)C(=O)O
<BB_1956>
What is the molecular formula for <BB_1956>?
The molecular formula for <BB_1956> (C[C@H](NC(=O)c1ccccc1)C(=O)O) is C10H11NO3.
Describe the ring structures in building block <BB_1956>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1956>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_1956>.
**Token:** <BB_1956> **SMILES:** C[C@H](NC(=O)c1ccccc1)C(=O)O **Molecular Formula:** C10H11NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_1957>.
CC(C)C(Br)C(=O)N1CCc2sccc2C1
What is the building block token for the following molecule?
CC(C)C(Br)C(=O)N1CCc2sccc2C1
<BB_1957>
What is the molecular formula for <BB_1957>?
The molecular formula for <BB_1957> (CC(C)C(Br)C(=O)N1CCc2sccc2C1) is C12H16BrNOS.
Describe the ring structures in building block <BB_1957>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1957>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1957>.
**Token:** <BB_1957> **SMILES:** CC(C)C(Br)C(=O)N1CCc2sccc2C1 **Molecular Formula:** C12H16BrNOS **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1958>.
CC(C)NCc1ccccn1
What is the building block token for the following molecule?
CC(C)NCc1ccccn1
<BB_1958>
What is the molecular formula for <BB_1958>?
The molecular formula for <BB_1958> (CC(C)NCc1ccccn1) is C9H14N2.
Describe the ring structures in building block <BB_1958>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1958>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_1958>.
**Token:** <BB_1958> **SMILES:** CC(C)NCc1ccccn1 **Molecular Formula:** C9H14N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_1959>.
O=C(O)c1cc(Cl)ccc1Sc1ccc(Cl)cc1
What is the building block token for the following molecule?
O=C(O)c1cc(Cl)ccc1Sc1ccc(Cl)cc1
<BB_1959>
What is the molecular formula for <BB_1959>?
The molecular formula for <BB_1959> (O=C(O)c1cc(Cl)ccc1Sc1ccc(Cl)cc1) is C13H8Cl2O2S.
Describe the ring structures in building block <BB_1959>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1959>.
The molecule contains the following groups: Carboxylic Acid, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1959>.
**Token:** <BB_1959> **SMILES:** O=C(O)c1cc(Cl)ccc1Sc1ccc(Cl)cc1 **Molecular Formula:** C13H8Cl2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1960>.
COc1cc2c(cc1OC)CN(S(N)(=O)=O)CC2
What is the building block token for the following molecule?
COc1cc2c(cc1OC)CN(S(N)(=O)=O)CC2
<BB_1960>
What is the molecular formula for <BB_1960>?
The molecular formula for <BB_1960> (COc1cc2c(cc1OC)CN(S(N)(=O)=O)CC2) is C11H16N2O4S.
Describe the ring structures in building block <BB_1960>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1960>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1960>.
**Token:** <BB_1960> **SMILES:** COc1cc2c(cc1OC)CN(S(N)(=O)=O)CC2 **Molecular Formula:** C11H16N2O4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Ether, Sulfonamide
Provide the SMILES representation for the building block token <BB_1961>.
CCCC1CN(C(=O)OC(C)(C)C)CCN1
What is the building block token for the following molecule?
CCCC1CN(C(=O)OC(C)(C)C)CCN1
<BB_1961>
What is the molecular formula for <BB_1961>?
The molecular formula for <BB_1961> (CCCC1CN(C(=O)OC(C)(C)C)CCN1) is C12H24N2O2.
Describe the ring structures in building block <BB_1961>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1961>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1961>.
**Token:** <BB_1961> **SMILES:** CCCC1CN(C(=O)OC(C)(C)C)CCN1 **Molecular Formula:** C12H24N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_1962>.
O=C(O)C1CCCC2(C1)CC2(F)F
What is the building block token for the following molecule?
O=C(O)C1CCCC2(C1)CC2(F)F
<BB_1962>
What is the molecular formula for <BB_1962>?
The molecular formula for <BB_1962> (O=C(O)C1CCCC2(C1)CC2(F)F) is C9H12F2O2.
Describe the ring structures in building block <BB_1962>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1962>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1962>.
**Token:** <BB_1962> **SMILES:** O=C(O)C1CCCC2(C1)CC2(F)F **Molecular Formula:** C9H12F2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1963>.
Cc1nc(Cl)nc2c1CCC2
What is the building block token for the following molecule?
Cc1nc(Cl)nc2c1CCC2
<BB_1963>
What is the molecular formula for <BB_1963>?
The molecular formula for <BB_1963> (Cc1nc(Cl)nc2c1CCC2) is C8H9ClN2.
Describe the ring structures in building block <BB_1963>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1963>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1963>.
**Token:** <BB_1963> **SMILES:** Cc1nc(Cl)nc2c1CCC2 **Molecular Formula:** C8H9ClN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1964>.
CN(C)C(=O)COc1ccccc1C=O
What is the building block token for the following molecule?
CN(C)C(=O)COc1ccccc1C=O
<BB_1964>
What is the molecular formula for <BB_1964>?
The molecular formula for <BB_1964> (CN(C)C(=O)COc1ccccc1C=O) is C11H13NO3.
Describe the ring structures in building block <BB_1964>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1964>.
The molecule contains the following groups: Amide, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_1964>.
**Token:** <BB_1964> **SMILES:** CN(C)C(=O)COc1ccccc1C=O **Molecular Formula:** C11H13NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_1965>.
COCC(=O)c1cccc(Cl)c1
What is the building block token for the following molecule?
COCC(=O)c1cccc(Cl)c1
<BB_1965>
What is the molecular formula for <BB_1965>?
The molecular formula for <BB_1965> (COCC(=O)c1cccc(Cl)c1) is C9H9ClO2.
Describe the ring structures in building block <BB_1965>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1965>.
The molecule contains the following groups: Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1965>.
**Token:** <BB_1965> **SMILES:** COCC(=O)c1cccc(Cl)c1 **Molecular Formula:** C9H9ClO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1966>.
Cc1ccc(CBr)cc1Br
What is the building block token for the following molecule?
Cc1ccc(CBr)cc1Br
<BB_1966>
What is the molecular formula for <BB_1966>?
The molecular formula for <BB_1966> (Cc1ccc(CBr)cc1Br) is C8H8Br2.
Describe the ring structures in building block <BB_1966>.
The molecule contains 1 ring(s): an aromatic ring of size 6.