instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_1966>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1966>.
**Token:** <BB_1966> **SMILES:** Cc1ccc(CBr)cc1Br **Molecular Formula:** C8H8Br2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1967>.
C1COC(CC2CCOCC2)CN1.Cl
What is the building block token for the following molecule?
C1COC(CC2CCOCC2)CN1.Cl
<BB_1967>
What is the molecular formula for <BB_1967>?
The molecular formula for <BB_1967> (C1COC(CC2CCOCC2)CN1.Cl) is C10H20ClNO2.
Describe the ring structures in building block <BB_1967>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1967>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1967>.
**Token:** <BB_1967> **SMILES:** C1COC(CC2CCOCC2)CN1.Cl **Molecular Formula:** C10H20ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1968>.
O=C(CCc1ccccc1)C(F)(F)F
What is the building block token for the following molecule?
O=C(CCc1ccccc1)C(F)(F)F
<BB_1968>
What is the molecular formula for <BB_1968>?
The molecular formula for <BB_1968> (O=C(CCc1ccccc1)C(F)(F)F) is C10H9F3O.
Describe the ring structures in building block <BB_1968>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1968>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1968>.
**Token:** <BB_1968> **SMILES:** O=C(CCc1ccccc1)C(F)(F)F **Molecular Formula:** C10H9F3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1969>.
CCNC(=O)c1c(N)cnn1C.Cl
What is the building block token for the following molecule?
CCNC(=O)c1c(N)cnn1C.Cl
<BB_1969>
What is the molecular formula for <BB_1969>?
The molecular formula for <BB_1969> (CCNC(=O)c1c(N)cnn1C.Cl) is C7H13ClN4O.
Describe the ring structures in building block <BB_1969>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1969>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1969>.
**Token:** <BB_1969> **SMILES:** CCNC(=O)c1c(N)cnn1C.Cl **Molecular Formula:** C7H13ClN4O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1970>.
CCOC(=O)c1cn(C2CCNC2)nc1C(F)(F)F
What is the building block token for the following molecule?
CCOC(=O)c1cn(C2CCNC2)nc1C(F)(F)F
<BB_1970>
What is the molecular formula for <BB_1970>?
The molecular formula for <BB_1970> (CCOC(=O)c1cn(C2CCNC2)nc1C(F)(F)F) is C11H14F3N3O2.
Describe the ring structures in building block <BB_1970>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1970>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1970>.
**Token:** <BB_1970> **SMILES:** CCOC(=O)c1cn(C2CCNC2)nc1C(F)(F)F **Molecular Formula:** C11H14F3N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1971>.
COC(=O)c1ccc(Br)cc1C(=O)OC
What is the building block token for the following molecule?
COC(=O)c1ccc(Br)cc1C(=O)OC
<BB_1971>
What is the molecular formula for <BB_1971>?
The molecular formula for <BB_1971> (COC(=O)c1ccc(Br)cc1C(=O)OC) is C10H9BrO4.
Describe the ring structures in building block <BB_1971>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1971>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1971>.
**Token:** <BB_1971> **SMILES:** COC(=O)c1ccc(Br)cc1C(=O)OC **Molecular Formula:** C10H9BrO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1972>.
O=[N+]([O-])c1ccc2scc(Br)c2c1
What is the building block token for the following molecule?
O=[N+]([O-])c1ccc2scc(Br)c2c1
<BB_1972>
What is the molecular formula for <BB_1972>?
The molecular formula for <BB_1972> (O=[N+]([O-])c1ccc2scc(Br)c2c1) is C8H4BrNO2S.
Describe the ring structures in building block <BB_1972>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1972>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_1972>.
**Token:** <BB_1972> **SMILES:** O=[N+]([O-])c1ccc2scc(Br)c2c1 **Molecular Formula:** C8H4BrNO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_1973>.
Cc1cnoc1
What is the building block token for the following molecule?
Cc1cnoc1
<BB_1973>
What is the molecular formula for <BB_1973>?
The molecular formula for <BB_1973> (Cc1cnoc1) is C4H5NO.
Describe the ring structures in building block <BB_1973>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1973>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1973>.
**Token:** <BB_1973> **SMILES:** Cc1cnoc1 **Molecular Formula:** C4H5NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1974>.
N#Cc1cn(C2CCCC2)c(=O)[nH]c1=O
What is the building block token for the following molecule?
N#Cc1cn(C2CCCC2)c(=O)[nH]c1=O
<BB_1974>
What is the molecular formula for <BB_1974>?
The molecular formula for <BB_1974> (N#Cc1cn(C2CCCC2)c(=O)[nH]c1=O) is C10H11N3O2.
Describe the ring structures in building block <BB_1974>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1974>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1974>.
**Token:** <BB_1974> **SMILES:** N#Cc1cn(C2CCCC2)c(=O)[nH]c1=O **Molecular Formula:** C10H11N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_1975>.
Nc1ccc(C(=O)Nc2cccnc2)c(Cl)c1
What is the building block token for the following molecule?
Nc1ccc(C(=O)Nc2cccnc2)c(Cl)c1
<BB_1975>
What is the molecular formula for <BB_1975>?
The molecular formula for <BB_1975> (Nc1ccc(C(=O)Nc2cccnc2)c(Cl)c1) is C12H10ClN3O.
Describe the ring structures in building block <BB_1975>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1975>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1975>.
**Token:** <BB_1975> **SMILES:** Nc1ccc(C(=O)Nc2cccnc2)c(Cl)c1 **Molecular Formula:** C12H10ClN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1976>.
COC(=O)C1CCC2(CCCCC2)NC1
What is the building block token for the following molecule?
COC(=O)C1CCC2(CCCCC2)NC1
<BB_1976>
What is the molecular formula for <BB_1976>?
The molecular formula for <BB_1976> (COC(=O)C1CCC2(CCCCC2)NC1) is C12H21NO2.
Describe the ring structures in building block <BB_1976>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1976>.
The molecule contains the following groups: Secondary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1976>.
**Token:** <BB_1976> **SMILES:** COC(=O)C1CCC2(CCCCC2)NC1 **Molecular Formula:** C12H21NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_1977>.
Cn1nccc1C(=O)c1ccnn1C
What is the building block token for the following molecule?
Cn1nccc1C(=O)c1ccnn1C
<BB_1977>
What is the molecular formula for <BB_1977>?
The molecular formula for <BB_1977> (Cn1nccc1C(=O)c1ccnn1C) is C9H10N4O.
Describe the ring structures in building block <BB_1977>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_1977>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_1977>.
**Token:** <BB_1977> **SMILES:** Cn1nccc1C(=O)c1ccnn1C **Molecular Formula:** C9H10N4O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_1978>.
Cl.O=C(O)C1(Cc2c[nH]nn2)CCCC1
What is the building block token for the following molecule?
Cl.O=C(O)C1(Cc2c[nH]nn2)CCCC1
<BB_1978>
What is the molecular formula for <BB_1978>?
The molecular formula for <BB_1978> (Cl.O=C(O)C1(Cc2c[nH]nn2)CCCC1) is C9H14ClN3O2.
Describe the ring structures in building block <BB_1978>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1978>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1978>.
**Token:** <BB_1978> **SMILES:** Cl.O=C(O)C1(Cc2c[nH]nn2)CCCC1 **Molecular Formula:** C9H14ClN3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1979>.
CC(=O)c1cc(Cl)c(N)c(Cl)c1
What is the building block token for the following molecule?
CC(=O)c1cc(Cl)c(N)c(Cl)c1
<BB_1979>
What is the molecular formula for <BB_1979>?
The molecular formula for <BB_1979> (CC(=O)c1cc(Cl)c(N)c(Cl)c1) is C8H7Cl2NO.
Describe the ring structures in building block <BB_1979>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1979>.
The molecule contains the following groups: Amine, Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1979>.
**Token:** <BB_1979> **SMILES:** CC(=O)c1cc(Cl)c(N)c(Cl)c1 **Molecular Formula:** C8H7Cl2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1980>.
Brc1ccc(-c2ccon2)cc1
What is the building block token for the following molecule?
Brc1ccc(-c2ccon2)cc1
<BB_1980>
What is the molecular formula for <BB_1980>?
The molecular formula for <BB_1980> (Brc1ccc(-c2ccon2)cc1) is C9H6BrNO.
Describe the ring structures in building block <BB_1980>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1980>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1980>.
**Token:** <BB_1980> **SMILES:** Brc1ccc(-c2ccon2)cc1 **Molecular Formula:** C9H6BrNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1981>.
Cl.O=C(O)C12CC=CCN1CCC2
What is the building block token for the following molecule?
Cl.O=C(O)C12CC=CCN1CCC2
<BB_1981>
What is the molecular formula for <BB_1981>?
The molecular formula for <BB_1981> (Cl.O=C(O)C12CC=CCN1CCC2) is C9H14ClNO2.
Describe the ring structures in building block <BB_1981>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1981>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1981>.
**Token:** <BB_1981> **SMILES:** Cl.O=C(O)C12CC=CCN1CCC2 **Molecular Formula:** C9H14ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1982>.
O=C(O)c1ccnc(-n2cnnn2)c1
What is the building block token for the following molecule?
O=C(O)c1ccnc(-n2cnnn2)c1
<BB_1982>
What is the molecular formula for <BB_1982>?
The molecular formula for <BB_1982> (O=C(O)c1ccnc(-n2cnnn2)c1) is C7H5N5O2.
Describe the ring structures in building block <BB_1982>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1982>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1982>.
**Token:** <BB_1982> **SMILES:** O=C(O)c1ccnc(-n2cnnn2)c1 **Molecular Formula:** C7H5N5O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1983>.
C1COCCOCCOCCOCCO1
What is the building block token for the following molecule?
C1COCCOCCOCCOCCO1
<BB_1983>