instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_1983>?
The molecular formula for <BB_1983> (C1COCCOCCOCCOCCO1) is C10H20O5.
Describe the ring structures in building block <BB_1983>.
The molecule contains 1 ring(s): an aliphatic ring of size 15.
List the primary functional groups present in <BB_1983>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_1983>.
**Token:** <BB_1983> **SMILES:** C1COCCOCCOCCOCCO1 **Molecular Formula:** C10H20O5 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 15. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_1984>.
Cl.Nc1ccc(S(=O)(=O)NCCC(=O)O)cc1
What is the building block token for the following molecule?
Cl.Nc1ccc(S(=O)(=O)NCCC(=O)O)cc1
<BB_1984>
What is the molecular formula for <BB_1984>?
The molecular formula for <BB_1984> (Cl.Nc1ccc(S(=O)(=O)NCCC(=O)O)cc1) is C9H13ClN2O4S.
Describe the ring structures in building block <BB_1984>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1984>.
The molecule contains the following groups: Carboxylic Acid, Amine, Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1984>.
**Token:** <BB_1984> **SMILES:** Cl.Nc1ccc(S(=O)(=O)NCCC(=O)O)cc1 **Molecular Formula:** C9H13ClN2O4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_1985>.
O=C(O)c1cc2nc3c(c(C(F)(F)F)n2n1)CCC3
What is the building block token for the following molecule?
O=C(O)c1cc2nc3c(c(C(F)(F)F)n2n1)CCC3
<BB_1985>
What is the molecular formula for <BB_1985>?
The molecular formula for <BB_1985> (O=C(O)c1cc2nc3c(c(C(F)(F)F)n2n1)CCC3) is C11H8F3N3O2.
Describe the ring structures in building block <BB_1985>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1985>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1985>.
**Token:** <BB_1985> **SMILES:** O=C(O)c1cc2nc3c(c(C(F)(F)F)n2n1)CCC3 **Molecular Formula:** C11H8F3N3O2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1986>.
CCOC(=O)c1c[nH]c(C#N)c1
What is the building block token for the following molecule?
CCOC(=O)c1c[nH]c(C#N)c1
<BB_1986>
What is the molecular formula for <BB_1986>?
The molecular formula for <BB_1986> (CCOC(=O)c1c[nH]c(C#N)c1) is C8H8N2O2.
Describe the ring structures in building block <BB_1986>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1986>.
The molecule contains the following groups: Ester, Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1986>.
**Token:** <BB_1986> **SMILES:** CCOC(=O)c1c[nH]c(C#N)c1 **Molecular Formula:** C8H8N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Nitrile
Provide the SMILES representation for the building block token <BB_1987>.
CNC(=O)C1CCN(C(=O)CCl)CC1
What is the building block token for the following molecule?
CNC(=O)C1CCN(C(=O)CCl)CC1
<BB_1987>
What is the molecular formula for <BB_1987>?
The molecular formula for <BB_1987> (CNC(=O)C1CCN(C(=O)CCl)CC1) is C9H15ClN2O2.
Describe the ring structures in building block <BB_1987>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1987>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1987>.
**Token:** <BB_1987> **SMILES:** CNC(=O)C1CCN(C(=O)CCl)CC1 **Molecular Formula:** C9H15ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1988>.
COC(=O)[C@H]1CC[C@@H](C(=O)CCl)C1
What is the building block token for the following molecule?
COC(=O)[C@H]1CC[C@@H](C(=O)CCl)C1
<BB_1988>
What is the molecular formula for <BB_1988>?
The molecular formula for <BB_1988> (COC(=O)[C@H]1CC[C@@H](C(=O)CCl)C1) is C9H13ClO3.
Describe the ring structures in building block <BB_1988>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1988>.
The molecule contains the following groups: Ester, Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1988>.
**Token:** <BB_1988> **SMILES:** COC(=O)[C@H]1CC[C@@H](C(=O)CCl)C1 **Molecular Formula:** C9H13ClO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Ester, Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1989>.
Cl.NCc1cccc2nonc12
What is the building block token for the following molecule?
Cl.NCc1cccc2nonc12
<BB_1989>
What is the molecular formula for <BB_1989>?
The molecular formula for <BB_1989> (Cl.NCc1cccc2nonc12) is C7H8ClN3O.
Describe the ring structures in building block <BB_1989>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1989>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1989>.
**Token:** <BB_1989> **SMILES:** Cl.NCc1cccc2nonc12 **Molecular Formula:** C7H8ClN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1990>.
NC(=O)C1CN(C(=O)CCl)c2ccccc2O1
What is the building block token for the following molecule?
NC(=O)C1CN(C(=O)CCl)c2ccccc2O1
<BB_1990>
What is the molecular formula for <BB_1990>?
The molecular formula for <BB_1990> (NC(=O)C1CN(C(=O)CCl)c2ccccc2O1) is C11H11ClN2O3.
Describe the ring structures in building block <BB_1990>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1990>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1990>.
**Token:** <BB_1990> **SMILES:** NC(=O)C1CN(C(=O)CCl)c2ccccc2O1 **Molecular Formula:** C11H11ClN2O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1991>.
CC(C)(C)OC(=O)NCCC1(O)CNC1.Cl
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NCCC1(O)CNC1.Cl
<BB_1991>
What is the molecular formula for <BB_1991>?
The molecular formula for <BB_1991> (CC(C)(C)OC(=O)NCCC1(O)CNC1.Cl) is C10H21ClN2O3.
Describe the ring structures in building block <BB_1991>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1991>.
The molecule contains the following groups: Secondary Amine, Amide, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1991>.
**Token:** <BB_1991> **SMILES:** CC(C)(C)OC(=O)NCCC1(O)CNC1.Cl **Molecular Formula:** C10H21ClN2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Amide, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1992>.
CCOC(=O)Cc1c[nH]n(C)c1=O
What is the building block token for the following molecule?
CCOC(=O)Cc1c[nH]n(C)c1=O
<BB_1992>
What is the molecular formula for <BB_1992>?
The molecular formula for <BB_1992> (CCOC(=O)Cc1c[nH]n(C)c1=O) is C8H12N2O3.
Describe the ring structures in building block <BB_1992>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1992>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1992>.
**Token:** <BB_1992> **SMILES:** CCOC(=O)Cc1c[nH]n(C)c1=O **Molecular Formula:** C8H12N2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_1993>.
C#CC(CC(=O)O)c1ccccc1
What is the building block token for the following molecule?
C#CC(CC(=O)O)c1ccccc1
<BB_1993>
What is the molecular formula for <BB_1993>?
The molecular formula for <BB_1993> (C#CC(CC(=O)O)c1ccccc1) is C11H10O2.
Describe the ring structures in building block <BB_1993>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1993>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1993>.
**Token:** <BB_1993> **SMILES:** C#CC(CC(=O)O)c1ccccc1 **Molecular Formula:** C11H10O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1994>.
COCc1ccc(C2CCCN2)o1
What is the building block token for the following molecule?
COCc1ccc(C2CCCN2)o1
<BB_1994>
What is the molecular formula for <BB_1994>?
The molecular formula for <BB_1994> (COCc1ccc(C2CCCN2)o1) is C10H15NO2.
Describe the ring structures in building block <BB_1994>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1994>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1994>.
**Token:** <BB_1994> **SMILES:** COCc1ccc(C2CCCN2)o1 **Molecular Formula:** C10H15NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_1995>.
Cn1c(-c2ccc(C(=O)O)cc2)n[nH]c1=O
What is the building block token for the following molecule?
Cn1c(-c2ccc(C(=O)O)cc2)n[nH]c1=O
<BB_1995>
What is the molecular formula for <BB_1995>?
The molecular formula for <BB_1995> (Cn1c(-c2ccc(C(=O)O)cc2)n[nH]c1=O) is C10H9N3O3.
Describe the ring structures in building block <BB_1995>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1995>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1995>.
**Token:** <BB_1995> **SMILES:** Cn1c(-c2ccc(C(=O)O)cc2)n[nH]c1=O **Molecular Formula:** C10H9N3O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1996>.
Cc1cccc(N)c1OCC(C)C
What is the building block token for the following molecule?
Cc1cccc(N)c1OCC(C)C
<BB_1996>
What is the molecular formula for <BB_1996>?
The molecular formula for <BB_1996> (Cc1cccc(N)c1OCC(C)C) is C11H17NO.
Describe the ring structures in building block <BB_1996>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1996>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1996>.
**Token:** <BB_1996> **SMILES:** Cc1cccc(N)c1OCC(C)C **Molecular Formula:** C11H17NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_1997>.
CCN(CC)C(CN)Cc1ccccc1
What is the building block token for the following molecule?
CCN(CC)C(CN)Cc1ccccc1
<BB_1997>
What is the molecular formula for <BB_1997>?
The molecular formula for <BB_1997> (CCN(CC)C(CN)Cc1ccccc1) is C13H22N2.
Describe the ring structures in building block <BB_1997>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1997>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_1997>.
**Token:** <BB_1997> **SMILES:** CCN(CC)C(CN)Cc1ccccc1 **Molecular Formula:** C13H22N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_1998>.
O=C1COCCN1C1CCNCC1
What is the building block token for the following molecule?
O=C1COCCN1C1CCNCC1
<BB_1998>
What is the molecular formula for <BB_1998>?
The molecular formula for <BB_1998> (O=C1COCCN1C1CCNCC1) is C9H16N2O2.
Describe the ring structures in building block <BB_1998>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1998>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1998>.
**Token:** <BB_1998> **SMILES:** O=C1COCCN1C1CCNCC1 **Molecular Formula:** C9H16N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_1999>.
Cc1ccc(CO)c(Cl)n1.Cl
What is the building block token for the following molecule?
Cc1ccc(CO)c(Cl)n1.Cl
<BB_1999>
What is the molecular formula for <BB_1999>?
The molecular formula for <BB_1999> (Cc1ccc(CO)c(Cl)n1.Cl) is C7H9Cl2NO.
Describe the ring structures in building block <BB_1999>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1999>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1999>.
**Token:** <BB_1999> **SMILES:** Cc1ccc(CO)c(Cl)n1.Cl **Molecular Formula:** C7H9Cl2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)