instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_2000>.
Clc1cccc(C#CCBr)c1
What is the building block token for the following molecule?
Clc1cccc(C#CCBr)c1
<BB_2000>
What is the molecular formula for <BB_2000>?
The molecular formula for <BB_2000> (Clc1cccc(C#CCBr)c1) is C9H6BrCl.
Describe the ring structures in building block <BB_2000>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2000>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2000>.
**Token:** <BB_2000> **SMILES:** Clc1cccc(C#CCBr)c1 **Molecular Formula:** C9H6BrCl **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2001>.
O=C1CC(c2ccccc2)=NN1c1ccccn1
What is the building block token for the following molecule?
O=C1CC(c2ccccc2)=NN1c1ccccn1
<BB_2001>
What is the molecular formula for <BB_2001>?
The molecular formula for <BB_2001> (O=C1CC(c2ccccc2)=NN1c1ccccn1) is C14H11N3O.
Describe the ring structures in building block <BB_2001>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2001>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_2001>.
**Token:** <BB_2001> **SMILES:** O=C1CC(c2ccccc2)=NN1c1ccccn1 **Molecular Formula:** C14H11N3O **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_2002>.
Cc1cc(C=O)c(C)cc1I
What is the building block token for the following molecule?
Cc1cc(C=O)c(C)cc1I
<BB_2002>
What is the molecular formula for <BB_2002>?
The molecular formula for <BB_2002> (Cc1cc(C=O)c(C)cc1I) is C9H9IO.
Describe the ring structures in building block <BB_2002>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2002>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2002>.
**Token:** <BB_2002> **SMILES:** Cc1cc(C=O)c(C)cc1I **Molecular Formula:** C9H9IO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2003>.
FC(Cl)C(F)(F)Oc1cccnc1Cl
What is the building block token for the following molecule?
FC(Cl)C(F)(F)Oc1cccnc1Cl
<BB_2003>
What is the molecular formula for <BB_2003>?
The molecular formula for <BB_2003> (FC(Cl)C(F)(F)Oc1cccnc1Cl) is C7H4Cl2F3NO.
Describe the ring structures in building block <BB_2003>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2003>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2003>.
**Token:** <BB_2003> **SMILES:** FC(Cl)C(F)(F)Oc1cccnc1Cl **Molecular Formula:** C7H4Cl2F3NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2004>.
Cl.Cl.Nc1c[nH]c(=O)nc1N
What is the building block token for the following molecule?
Cl.Cl.Nc1c[nH]c(=O)nc1N
<BB_2004>
What is the molecular formula for <BB_2004>?
The molecular formula for <BB_2004> (Cl.Cl.Nc1c[nH]c(=O)nc1N) is C4H8Cl2N4O.
Describe the ring structures in building block <BB_2004>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2004>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2004>.
**Token:** <BB_2004> **SMILES:** Cl.Cl.Nc1c[nH]c(=O)nc1N **Molecular Formula:** C4H8Cl2N4O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2005>.
CNC(C)c1cccnc1N
What is the building block token for the following molecule?
CNC(C)c1cccnc1N
<BB_2005>
What is the molecular formula for <BB_2005>?
The molecular formula for <BB_2005> (CNC(C)c1cccnc1N) is C8H13N3.
Describe the ring structures in building block <BB_2005>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2005>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_2005>.
**Token:** <BB_2005> **SMILES:** CNC(C)c1cccnc1N **Molecular Formula:** C8H13N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_2006>.
N#Cc1cccc(C(=O)O)c1Br
What is the building block token for the following molecule?
N#Cc1cccc(C(=O)O)c1Br
<BB_2006>
What is the molecular formula for <BB_2006>?
The molecular formula for <BB_2006> (N#Cc1cccc(C(=O)O)c1Br) is C8H4BrNO2.
Describe the ring structures in building block <BB_2006>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2006>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2006>.
**Token:** <BB_2006> **SMILES:** N#Cc1cccc(C(=O)O)c1Br **Molecular Formula:** C8H4BrNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_2007>.
Cl.OC(C(F)F)C1CCCN1
What is the building block token for the following molecule?
Cl.OC(C(F)F)C1CCCN1
<BB_2007>
What is the molecular formula for <BB_2007>?
The molecular formula for <BB_2007> (Cl.OC(C(F)F)C1CCCN1) is C6H12ClF2NO.
Describe the ring structures in building block <BB_2007>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2007>.
The molecule contains the following groups: Secondary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2007>.
**Token:** <BB_2007> **SMILES:** Cl.OC(C(F)F)C1CCCN1 **Molecular Formula:** C6H12ClF2NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2008>.
Cc1nn(-c2ccc(F)cc2)c2[nH]nc(N)c12
What is the building block token for the following molecule?
Cc1nn(-c2ccc(F)cc2)c2[nH]nc(N)c12
<BB_2008>
What is the molecular formula for <BB_2008>?
The molecular formula for <BB_2008> (Cc1nn(-c2ccc(F)cc2)c2[nH]nc(N)c12) is C11H10FN5.
Describe the ring structures in building block <BB_2008>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2008>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2008>.
**Token:** <BB_2008> **SMILES:** Cc1nn(-c2ccc(F)cc2)c2[nH]nc(N)c12 **Molecular Formula:** C11H10FN5 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2009>.
O=C(O)CCCN1C(=O)NC2(CCCC2)C1=O
What is the building block token for the following molecule?
O=C(O)CCCN1C(=O)NC2(CCCC2)C1=O
<BB_2009>
What is the molecular formula for <BB_2009>?
The molecular formula for <BB_2009> (O=C(O)CCCN1C(=O)NC2(CCCC2)C1=O) is C11H16N2O4.
Describe the ring structures in building block <BB_2009>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2009>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_2009>.
**Token:** <BB_2009> **SMILES:** O=C(O)CCCN1C(=O)NC2(CCCC2)C1=O **Molecular Formula:** C11H16N2O4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_2010>.
OCCC1CCCSC1
What is the building block token for the following molecule?
OCCC1CCCSC1
<BB_2010>
What is the molecular formula for <BB_2010>?
The molecular formula for <BB_2010> (OCCC1CCCSC1) is C7H14OS.
Describe the ring structures in building block <BB_2010>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2010>.
The molecule contains the following groups: Alcohol, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_2010>.
**Token:** <BB_2010> **SMILES:** OCCC1CCCSC1 **Molecular Formula:** C7H14OS **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Alcohol, Sulfide
Provide the SMILES representation for the building block token <BB_2011>.
CC(C)(F)c1ccccc1CBr
What is the building block token for the following molecule?
CC(C)(F)c1ccccc1CBr
<BB_2011>
What is the molecular formula for <BB_2011>?
The molecular formula for <BB_2011> (CC(C)(F)c1ccccc1CBr) is C10H12BrF.
Describe the ring structures in building block <BB_2011>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2011>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2011>.
**Token:** <BB_2011> **SMILES:** CC(C)(F)c1ccccc1CBr **Molecular Formula:** C10H12BrF **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2012>.
Nc1ccn(-c2c(F)c(F)c(F)c(F)c2F)n1
What is the building block token for the following molecule?
Nc1ccn(-c2c(F)c(F)c(F)c(F)c2F)n1
<BB_2012>
What is the molecular formula for <BB_2012>?
The molecular formula for <BB_2012> (Nc1ccn(-c2c(F)c(F)c(F)c(F)c2F)n1) is C9H4F5N3.
Describe the ring structures in building block <BB_2012>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2012>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2012>.
**Token:** <BB_2012> **SMILES:** Nc1ccn(-c2c(F)c(F)c(F)c(F)c2F)n1 **Molecular Formula:** C9H4F5N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2013>.
Cc1cc(CN)nnc1C.Cl.Cl
What is the building block token for the following molecule?
Cc1cc(CN)nnc1C.Cl.Cl
<BB_2013>
What is the molecular formula for <BB_2013>?
The molecular formula for <BB_2013> (Cc1cc(CN)nnc1C.Cl.Cl) is C7H13Cl2N3.
Describe the ring structures in building block <BB_2013>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2013>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2013>.
**Token:** <BB_2013> **SMILES:** Cc1cc(CN)nnc1C.Cl.Cl **Molecular Formula:** C7H13Cl2N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2014>.
CNc1ncnc2c(C)n[nH]c12
What is the building block token for the following molecule?
CNc1ncnc2c(C)n[nH]c12
<BB_2014>
What is the molecular formula for <BB_2014>?
The molecular formula for <BB_2014> (CNc1ncnc2c(C)n[nH]c12) is C7H9N5.
Describe the ring structures in building block <BB_2014>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2014>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_2014>.
**Token:** <BB_2014> **SMILES:** CNc1ncnc2c(C)n[nH]c12 **Molecular Formula:** C7H9N5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_2015>.
Cc1nc(CC(=O)O)cs1
What is the building block token for the following molecule?
Cc1nc(CC(=O)O)cs1
<BB_2015>
What is the molecular formula for <BB_2015>?
The molecular formula for <BB_2015> (Cc1nc(CC(=O)O)cs1) is C6H7NO2S.
Describe the ring structures in building block <BB_2015>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2015>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2015>.
**Token:** <BB_2015> **SMILES:** Cc1nc(CC(=O)O)cs1 **Molecular Formula:** C6H7NO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2016>.
COc1ccc(C(=O)OC(C)(C)C)c(N)c1
What is the building block token for the following molecule?
COc1ccc(C(=O)OC(C)(C)C)c(N)c1
<BB_2016>
What is the molecular formula for <BB_2016>?
The molecular formula for <BB_2016> (COc1ccc(C(=O)OC(C)(C)C)c(N)c1) is C12H17NO3.
Describe the ring structures in building block <BB_2016>.
The molecule contains 1 ring(s): an aromatic ring of size 6.