instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_2016>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2016>.
**Token:** <BB_2016> **SMILES:** COc1ccc(C(=O)OC(C)(C)C)c(N)c1 **Molecular Formula:** C12H17NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_2017>.
Nc1cnc2c(F)c(F)ccc2c1Cl
What is the building block token for the following molecule?
Nc1cnc2c(F)c(F)ccc2c1Cl
<BB_2017>
What is the molecular formula for <BB_2017>?
The molecular formula for <BB_2017> (Nc1cnc2c(F)c(F)ccc2c1Cl) is C9H5ClF2N2.
Describe the ring structures in building block <BB_2017>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2017>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2017>.
**Token:** <BB_2017> **SMILES:** Nc1cnc2c(F)c(F)ccc2c1Cl **Molecular Formula:** C9H5ClF2N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2018>.
N#CC1CCCOCC1
What is the building block token for the following molecule?
N#CC1CCCOCC1
<BB_2018>
What is the molecular formula for <BB_2018>?
The molecular formula for <BB_2018> (N#CC1CCCOCC1) is C7H11NO.
Describe the ring structures in building block <BB_2018>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.
List the primary functional groups present in <BB_2018>.
The molecule contains the following groups: Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2018>.
**Token:** <BB_2018> **SMILES:** N#CC1CCCOCC1 **Molecular Formula:** C7H11NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Ether, Nitrile
Provide the SMILES representation for the building block token <BB_2019>.
O=C(O)c1ccc(F)c(F)c1Cl
What is the building block token for the following molecule?
O=C(O)c1ccc(F)c(F)c1Cl
<BB_2019>
What is the molecular formula for <BB_2019>?
The molecular formula for <BB_2019> (O=C(O)c1ccc(F)c(F)c1Cl) is C7H3ClF2O2.
Describe the ring structures in building block <BB_2019>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2019>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2019>.
**Token:** <BB_2019> **SMILES:** O=C(O)c1ccc(F)c(F)c1Cl **Molecular Formula:** C7H3ClF2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2020>.
Cl.NCCSCc1ccsc1
What is the building block token for the following molecule?
Cl.NCCSCc1ccsc1
<BB_2020>
What is the molecular formula for <BB_2020>?
The molecular formula for <BB_2020> (Cl.NCCSCc1ccsc1) is C7H12ClNS2.
Describe the ring structures in building block <BB_2020>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2020>.
The molecule contains the following groups: Amine, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2020>.
**Token:** <BB_2020> **SMILES:** Cl.NCCSCc1ccsc1 **Molecular Formula:** C7H12ClNS2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2021>.
O=C(CSc1nnc(S)s1)c1ccccc1
What is the building block token for the following molecule?
O=C(CSc1nnc(S)s1)c1ccccc1
<BB_2021>
What is the molecular formula for <BB_2021>?
The molecular formula for <BB_2021> (O=C(CSc1nnc(S)s1)c1ccccc1) is C10H8N2OS3.
Describe the ring structures in building block <BB_2021>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2021>.
The molecule contains the following groups: Ketone, Thiol, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_2021>.
**Token:** <BB_2021> **SMILES:** O=C(CSc1nnc(S)s1)c1ccccc1 **Molecular Formula:** C10H8N2OS3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ketone, Thiol, Sulfide
Provide the SMILES representation for the building block token <BB_2022>.
Br.CN(CCCBr)c1ccccc1
What is the building block token for the following molecule?
Br.CN(CCCBr)c1ccccc1
<BB_2022>
What is the molecular formula for <BB_2022>?
The molecular formula for <BB_2022> (Br.CN(CCCBr)c1ccccc1) is C10H15Br2N.
Describe the ring structures in building block <BB_2022>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2022>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2022>.
**Token:** <BB_2022> **SMILES:** Br.CN(CCCBr)c1ccccc1 **Molecular Formula:** C10H15Br2N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2023>.
Brc1ncc(-c2cccnc2)o1
What is the building block token for the following molecule?
Brc1ncc(-c2cccnc2)o1
<BB_2023>
What is the molecular formula for <BB_2023>?
The molecular formula for <BB_2023> (Brc1ncc(-c2cccnc2)o1) is C8H5BrN2O.
Describe the ring structures in building block <BB_2023>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2023>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2023>.
**Token:** <BB_2023> **SMILES:** Brc1ncc(-c2cccnc2)o1 **Molecular Formula:** C8H5BrN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2024>.
Cc1nc(COc2ccc(C(=O)O)cc2)no1
What is the building block token for the following molecule?
Cc1nc(COc2ccc(C(=O)O)cc2)no1
<BB_2024>
What is the molecular formula for <BB_2024>?
The molecular formula for <BB_2024> (Cc1nc(COc2ccc(C(=O)O)cc2)no1) is C11H10N2O4.
Describe the ring structures in building block <BB_2024>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2024>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_2024>.
**Token:** <BB_2024> **SMILES:** Cc1nc(COc2ccc(C(=O)O)cc2)no1 **Molecular Formula:** C11H10N2O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_2025>.
CCOC(=O)C1C[C@]2(c3ccc(Cl)cc3)C[C@H]1C2
What is the building block token for the following molecule?
CCOC(=O)C1C[C@]2(c3ccc(Cl)cc3)C[C@H]1C2
<BB_2025>
What is the molecular formula for <BB_2025>?
The molecular formula for <BB_2025> (CCOC(=O)C1C[C@]2(c3ccc(Cl)cc3)C[C@H]1C2) is C15H17ClO2.
Describe the ring structures in building block <BB_2025>.
The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2025>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2025>.
**Token:** <BB_2025> **SMILES:** CCOC(=O)C1C[C@]2(c3ccc(Cl)cc3)C[C@H]1C2 **Molecular Formula:** C15H17ClO2 **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2026>.
CCCC(=O)c1ncccc1Cl
What is the building block token for the following molecule?
CCCC(=O)c1ncccc1Cl
<BB_2026>
What is the molecular formula for <BB_2026>?
The molecular formula for <BB_2026> (CCCC(=O)c1ncccc1Cl) is C9H10ClNO.
Describe the ring structures in building block <BB_2026>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2026>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2026>.
**Token:** <BB_2026> **SMILES:** CCCC(=O)c1ncccc1Cl **Molecular Formula:** C9H10ClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2027>.
O=C(O)CC(C(=O)O)c1ccccc1F
What is the building block token for the following molecule?
O=C(O)CC(C(=O)O)c1ccccc1F
<BB_2027>
What is the molecular formula for <BB_2027>?
The molecular formula for <BB_2027> (O=C(O)CC(C(=O)O)c1ccccc1F) is C10H9FO4.
Describe the ring structures in building block <BB_2027>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2027>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2027>.
**Token:** <BB_2027> **SMILES:** O=C(O)CC(C(=O)O)c1ccccc1F **Molecular Formula:** C10H9FO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2028>.
Cc1cc2ccccc2[n+]([O-])c1.Cl
What is the building block token for the following molecule?
Cc1cc2ccccc2[n+]([O-])c1.Cl
<BB_2028>
What is the molecular formula for <BB_2028>?
The molecular formula for <BB_2028> (Cc1cc2ccccc2[n+]([O-])c1.Cl) is C10H10ClNO.
Describe the ring structures in building block <BB_2028>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2028>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2028>.
**Token:** <BB_2028> **SMILES:** Cc1cc2ccccc2[n+]([O-])c1.Cl **Molecular Formula:** C10H10ClNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2029>.
Nc1cc(C(=O)O)c(F)cn1
What is the building block token for the following molecule?
Nc1cc(C(=O)O)c(F)cn1
<BB_2029>
What is the molecular formula for <BB_2029>?
The molecular formula for <BB_2029> (Nc1cc(C(=O)O)c(F)cn1) is C6H5FN2O2.
Describe the ring structures in building block <BB_2029>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2029>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2029>.
**Token:** <BB_2029> **SMILES:** Nc1cc(C(=O)O)c(F)cn1 **Molecular Formula:** C6H5FN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2030>.
COc1cc(C)c(N)cc1OC
What is the building block token for the following molecule?
COc1cc(C)c(N)cc1OC
<BB_2030>
What is the molecular formula for <BB_2030>?
The molecular formula for <BB_2030> (COc1cc(C)c(N)cc1OC) is C9H13NO2.
Describe the ring structures in building block <BB_2030>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2030>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2030>.
**Token:** <BB_2030> **SMILES:** COc1cc(C)c(N)cc1OC **Molecular Formula:** C9H13NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_2031>.
NCCSCC1CC1
What is the building block token for the following molecule?
NCCSCC1CC1
<BB_2031>
What is the molecular formula for <BB_2031>?
The molecular formula for <BB_2031> (NCCSCC1CC1) is C6H13NS.
Describe the ring structures in building block <BB_2031>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_2031>.
The molecule contains the following groups: Amine, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_2031>.
**Token:** <BB_2031> **SMILES:** NCCSCC1CC1 **Molecular Formula:** C6H13NS **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amine, Sulfide
Provide the SMILES representation for the building block token <BB_2032>.
C=CC(C)CCO
What is the building block token for the following molecule?
C=CC(C)CCO
<BB_2032>
What is the molecular formula for <BB_2032>?
The molecular formula for <BB_2032> (C=CC(C)CCO) is C6H12O.
Describe the ring structures in building block <BB_2032>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2032>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2032>.
**Token:** <BB_2032> **SMILES:** C=CC(C)CCO **Molecular Formula:** C6H12O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_2033>.
CCc1csc(B(O)O)c1
What is the building block token for the following molecule?
CCc1csc(B(O)O)c1
<BB_2033>