instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_233>?
The molecular formula for <BB_233> (Cl.NCC[C@H]1CCC(=O)N1) is C6H13ClN2O.
Describe the ring structures in building block <BB_233>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_233>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_233>.
**Token:** <BB_233> **SMILES:** Cl.NCC[C@H]1CCC(=O)N1 **Molecular Formula:** C6H13ClN2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_234>.
O=C(O)c1ncc2ccccc2c1O
What is the building block token for the following molecule?
O=C(O)c1ncc2ccccc2c1O
<BB_234>
What is the molecular formula for <BB_234>?
The molecular formula for <BB_234> (O=C(O)c1ncc2ccccc2c1O) is C10H7NO3.
Describe the ring structures in building block <BB_234>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_234>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_234>.
**Token:** <BB_234> **SMILES:** O=C(O)c1ncc2ccccc2c1O **Molecular Formula:** C10H7NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_235>.
Cc1ccsc1C(=O)Cc1nc2ccccc2o1
What is the building block token for the following molecule?
Cc1ccsc1C(=O)Cc1nc2ccccc2o1
<BB_235>
What is the molecular formula for <BB_235>?
The molecular formula for <BB_235> (Cc1ccsc1C(=O)Cc1nc2ccccc2o1) is C14H11NO2S.
Describe the ring structures in building block <BB_235>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_235>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_235>.
**Token:** <BB_235> **SMILES:** Cc1ccsc1C(=O)Cc1nc2ccccc2o1 **Molecular Formula:** C14H11NO2S **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_236>.
CS(=O)(=O)CC(=O)O
What is the building block token for the following molecule?
CS(=O)(=O)CC(=O)O
<BB_236>
What is the molecular formula for <BB_236>?
The molecular formula for <BB_236> (CS(=O)(=O)CC(=O)O) is C3H6O4S.
Describe the ring structures in building block <BB_236>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_236>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_236>.
**Token:** <BB_236> **SMILES:** CS(=O)(=O)CC(=O)O **Molecular Formula:** C3H6O4S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_237>.
Sc1nc(-c2ccccc2)no1
What is the building block token for the following molecule?
Sc1nc(-c2ccccc2)no1
<BB_237>
What is the molecular formula for <BB_237>?
The molecular formula for <BB_237> (Sc1nc(-c2ccccc2)no1) is C8H6N2OS.
Describe the ring structures in building block <BB_237>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_237>.
The molecule contains the following groups: Thiol.
Provide a comprehensive chemical profile for the building block <BB_237>.
**Token:** <BB_237> **SMILES:** Sc1nc(-c2ccccc2)no1 **Molecular Formula:** C8H6N2OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Thiol
Provide the SMILES representation for the building block token <BB_238>.
CCn1cc(CNC)c(C)n1
What is the building block token for the following molecule?
CCn1cc(CNC)c(C)n1
<BB_238>
What is the molecular formula for <BB_238>?
The molecular formula for <BB_238> (CCn1cc(CNC)c(C)n1) is C8H15N3.
Describe the ring structures in building block <BB_238>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_238>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_238>.
**Token:** <BB_238> **SMILES:** CCn1cc(CNC)c(C)n1 **Molecular Formula:** C8H15N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_239>.
Cc1nn(C)c(N2CCCN(C)CC2)c1CN
What is the building block token for the following molecule?
Cc1nn(C)c(N2CCCN(C)CC2)c1CN
<BB_239>
What is the molecular formula for <BB_239>?
The molecular formula for <BB_239> (Cc1nn(C)c(N2CCCN(C)CC2)c1CN) is C12H23N5.
Describe the ring structures in building block <BB_239>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 7.
List the primary functional groups present in <BB_239>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_239>.
**Token:** <BB_239> **SMILES:** Cc1nn(C)c(N2CCCN(C)CC2)c1CN **Molecular Formula:** C12H23N5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 7. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_240>.
COC(=O)Nc1ccc(C(=O)O)c(Cl)c1
What is the building block token for the following molecule?
COC(=O)Nc1ccc(C(=O)O)c(Cl)c1
<BB_240>
What is the molecular formula for <BB_240>?
The molecular formula for <BB_240> (COC(=O)Nc1ccc(C(=O)O)c(Cl)c1) is C9H8ClNO4.
Describe the ring structures in building block <BB_240>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_240>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_240>.
**Token:** <BB_240> **SMILES:** COC(=O)Nc1ccc(C(=O)O)c(Cl)c1 **Molecular Formula:** C9H8ClNO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_241>.
COc1ncccc1C(C)=O
What is the building block token for the following molecule?
COc1ncccc1C(C)=O
<BB_241>
What is the molecular formula for <BB_241>?
The molecular formula for <BB_241> (COc1ncccc1C(C)=O) is C8H9NO2.
Describe the ring structures in building block <BB_241>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_241>.
The molecule contains the following groups: Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_241>.
**Token:** <BB_241> **SMILES:** COc1ncccc1C(C)=O **Molecular Formula:** C8H9NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Ether
Provide the SMILES representation for the building block token <BB_242>.
COC(=O)[C@@H](Cc1ccc(O)cc1)NC(=O)CN.Cl
What is the building block token for the following molecule?
COC(=O)[C@@H](Cc1ccc(O)cc1)NC(=O)CN.Cl
<BB_242>
What is the molecular formula for <BB_242>?
The molecular formula for <BB_242> (COC(=O)[C@@H](Cc1ccc(O)cc1)NC(=O)CN.Cl) is C12H17ClN2O4.
Describe the ring structures in building block <BB_242>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_242>.
The molecule contains the following groups: Amine, Amide, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_242>.
**Token:** <BB_242> **SMILES:** COC(=O)[C@@H](Cc1ccc(O)cc1)NC(=O)CN.Cl **Molecular Formula:** C12H17ClN2O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_243>.
Nc1ncc(C2CCCCN2)cn1
What is the building block token for the following molecule?
Nc1ncc(C2CCCCN2)cn1
<BB_243>
What is the molecular formula for <BB_243>?
The molecular formula for <BB_243> (Nc1ncc(C2CCCCN2)cn1) is C9H14N4.
Describe the ring structures in building block <BB_243>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_243>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_243>.
**Token:** <BB_243> **SMILES:** Nc1ncc(C2CCCCN2)cn1 **Molecular Formula:** C9H14N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_244>.
O=C(O)c1ccn2ccccc12
What is the building block token for the following molecule?
O=C(O)c1ccn2ccccc12
<BB_244>
What is the molecular formula for <BB_244>?
The molecular formula for <BB_244> (O=C(O)c1ccn2ccccc12) is C9H7NO2.
Describe the ring structures in building block <BB_244>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_244>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_244>.
**Token:** <BB_244> **SMILES:** O=C(O)c1ccn2ccccc12 **Molecular Formula:** C9H7NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_245>.
CC1(C)OB(C2(F)CC23CCC3)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(C2(F)CC23CCC3)OC1(C)C
<BB_245>
What is the molecular formula for <BB_245>?
The molecular formula for <BB_245> (CC1(C)OB(C2(F)CC23CCC3)OC1(C)C) is C12H20BFO2.
Describe the ring structures in building block <BB_245>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3, an aliphatic ring of size 4.
List the primary functional groups present in <BB_245>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_245>.
**Token:** <BB_245> **SMILES:** CC1(C)OB(C2(F)CC23CCC3)OC1(C)C **Molecular Formula:** C12H20BFO2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3, an aliphatic ring of size 4. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_246>.
N#C[C@H](O)c1ccc(F)cc1
What is the building block token for the following molecule?
N#C[C@H](O)c1ccc(F)cc1
<BB_246>
What is the molecular formula for <BB_246>?
The molecular formula for <BB_246> (N#C[C@H](O)c1ccc(F)cc1) is C8H6FNO.
Describe the ring structures in building block <BB_246>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_246>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_246>.
**Token:** <BB_246> **SMILES:** N#C[C@H](O)c1ccc(F)cc1 **Molecular Formula:** C8H6FNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_247>.
Cl.Cl.NC1CCN(CC2CCOCC2)CC1
What is the building block token for the following molecule?
Cl.Cl.NC1CCN(CC2CCOCC2)CC1
<BB_247>
What is the molecular formula for <BB_247>?
The molecular formula for <BB_247> (Cl.Cl.NC1CCN(CC2CCOCC2)CC1) is C11H24Cl2N2O.
Describe the ring structures in building block <BB_247>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_247>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_247>.
**Token:** <BB_247> **SMILES:** Cl.Cl.NC1CCN(CC2CCOCC2)CC1 **Molecular Formula:** C11H24Cl2N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_248>.
Cl.Cl.NNCc1cccc(F)c1
What is the building block token for the following molecule?
Cl.Cl.NNCc1cccc(F)c1
<BB_248>
What is the molecular formula for <BB_248>?
The molecular formula for <BB_248> (Cl.Cl.NNCc1cccc(F)c1) is C7H11Cl2FN2.
Describe the ring structures in building block <BB_248>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_248>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_248>.
**Token:** <BB_248> **SMILES:** Cl.Cl.NNCc1cccc(F)c1 **Molecular Formula:** C7H11Cl2FN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_249>.
CC(C)CS(=O)(=O)N1CCNCC1.Cl
What is the building block token for the following molecule?
CC(C)CS(=O)(=O)N1CCNCC1.Cl
<BB_249>
What is the molecular formula for <BB_249>?
The molecular formula for <BB_249> (CC(C)CS(=O)(=O)N1CCNCC1.Cl) is C8H19ClN2O2S.
Describe the ring structures in building block <BB_249>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_249>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_249>.
**Token:** <BB_249> **SMILES:** CC(C)CS(=O)(=O)N1CCNCC1.Cl **Molecular Formula:** C8H19ClN2O2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide